From 1aca00e04580e7b3effefa535edb469876ecce74 Mon Sep 17 00:00:00 2001 From: Luis Felipe Strano Moraes Date: Tue, 13 Mar 2012 13:26:31 -0300 Subject: [PATCH] Updating to version 1.3.2, last public release by Mike Vanier. This was a maintenance release mostly consisting of build fixes and updating the bitmaps for the pieces. --- CONTRIB | 3 + ChangeLog | 9 + INSTALL | 4 +- Makefile.in | 26 +- NEWS | 16 +- README | 6 +- TRANS.TBL | 17 - config.h.in | 214 +- configure | 9278 ++++++++++++++++++++------ configure.ac | 215 + configure.in | 198 - doc/Makefile | 2 +- doc/PORTING | 2 +- doc/TRANS.TBL | 41 - doc/gnushogi.html | 58 + doc/gnushogi.info | 52 +- doc/gnushogi.info-1 | 22 +- doc/gnushogi.info-2 | 85 +- doc/gnushogi.ps | 386 +- doc/gnushogi.texinfo | 70 +- doc/gnushogi_1.html | 84 +- doc/gnushogi_10.html | 160 +- doc/gnushogi_11.html | 170 +- doc/gnushogi_12.html | 122 +- doc/gnushogi_13.html | 346 +- doc/gnushogi_14.html | 113 +- doc/gnushogi_15.html | 340 +- doc/gnushogi_16.html | 239 +- doc/gnushogi_17.html | 680 +-- doc/gnushogi_18.html | 633 +-- doc/gnushogi_19.html | 581 ++- doc/gnushogi_2.html | 491 +-- doc/gnushogi_20.html | 555 ++- doc/gnushogi_21.html | 156 +- doc/gnushogi_22.html | 210 +- doc/gnushogi_23.html | 61 + doc/gnushogi_24.html | 208 + doc/gnushogi_3.html | 407 +- doc/gnushogi_4.html | 147 +- doc/gnushogi_5.html | 183 +- doc/gnushogi_6.html | 127 +- doc/gnushogi_7.html | 186 +- doc/gnushogi_8.html | 145 +- doc/gnushogi_9.html | 138 +- doc/gnushogi_abt.html | 202 + doc/gnushogi_ovr.html | 65 + doc/gnushogi_stoc.html | 37 - doc/gnushogi_toc.html | 134 +- doc/listserv.ref | 69 - doc/xshogi.6 | 55 +- gnushogi/Makefile.in | 2 + gnushogi/Makefile.profile.in | 289 + gnushogi/TRANS.TBL | 30 - gnushogi/commondsp.c | 12 +- gnushogi/cursesdsp.c | 2 +- gnushogi/eval.c | 2 +- gnushogi/genmove.c | 2 - gnushogi/globals.c | 2 +- gnushogi/gnushogi.h | 13 +- gnushogi/search.c | 2 +- gnushogi/sysdeps.c | 4 + misc/TRANS.TBL | 3 - version.h | 2 +- xshogi/BUGS | 24 +- xshogi/Makefile.in | 2 +- xshogi/TRANS.TBL | 15 - xshogi/bitmaps.h | 104 +- xshogi/eastern_bitmaps/TRANS.TBL | 118 - xshogi/eastern_bitmaps/bigblank.xbm | 2 +- xshogi/eastern_bitmaps/bigblankR.xbm | 2 +- xshogi/eastern_bitmaps/biglight.xbm | 2 +- xshogi/eastern_bitmaps/bigsolid.xbm | 2 +- xshogi/eastern_bitmaps/bigsolidR.xbm | 2 +- xshogi/eastern_bitmaps/bigsolidR_l.xbm | 80 +- xshogi/eastern_bitmaps/bigsolidR_m.xbm | 2 +- xshogi/eastern_bitmaps/bigsolid_l.xbm | 80 +- xshogi/eastern_bitmaps/bigsolid_m.xbm | 2 +- xshogi/eastern_bitmaps/bishop.xbm | 2 +- xshogi/eastern_bitmaps/bishopP.top.xbm | 2 +- xshogi/eastern_bitmaps/bishopP.xbm | 2 +- xshogi/eastern_bitmaps/bishopPR.top.xbm | 2 +- xshogi/eastern_bitmaps/bishopPR.xbm | 2 +- xshogi/eastern_bitmaps/bishopPR_l.top.xbm | 2 +- xshogi/eastern_bitmaps/bishopPR_l.xbm | 80 +- xshogi/eastern_bitmaps/bishopPR_m.top.xbm | 2 +- xshogi/eastern_bitmaps/bishopPR_m.xbm | 2 +- xshogi/eastern_bitmaps/bishopP_l.top.xbm | 2 +- xshogi/eastern_bitmaps/bishopP_l.xbm | 80 +- xshogi/eastern_bitmaps/bishopP_m.top.xbm | 2 +- xshogi/eastern_bitmaps/bishopP_m.xbm | 2 +- xshogi/eastern_bitmaps/bishopR.xbm | 2 +- xshogi/eastern_bitmaps/bishopR_l.xbm | 80 +- xshogi/eastern_bitmaps/bishopR_m.xbm | 2 +- xshogi/eastern_bitmaps/bishop_l.xbm | 80 +- xshogi/eastern_bitmaps/bishop_m.xbm | 2 +- xshogi/eastern_bitmaps/gold.xbm | 2 +- xshogi/eastern_bitmaps/goldR.xbm | 2 +- xshogi/eastern_bitmaps/goldR_l.xbm | 80 +- xshogi/eastern_bitmaps/goldR_m.xbm | 2 +- xshogi/eastern_bitmaps/gold_l.xbm | 80 +- xshogi/eastern_bitmaps/gold_m.xbm | 2 +- xshogi/eastern_bitmaps/icon.xbm | 2 +- xshogi/eastern_bitmaps/king.xbm | 2 +- xshogi/eastern_bitmaps/kingR.xbm | 2 +- xshogi/eastern_bitmaps/kingR_l.xbm | 80 +- xshogi/eastern_bitmaps/kingR_m.xbm | 2 +- xshogi/eastern_bitmaps/king_l.xbm | 80 +- xshogi/eastern_bitmaps/king_m.xbm | 2 +- xshogi/eastern_bitmaps/knight.xbm | 2 +- xshogi/eastern_bitmaps/knightP.xbm | 2 +- xshogi/eastern_bitmaps/knightPR.xbm | 2 +- xshogi/eastern_bitmaps/knightPR_l.xbm | 80 +- xshogi/eastern_bitmaps/knightPR_m.xbm | 2 +- xshogi/eastern_bitmaps/knightP_l.xbm | 66 +- xshogi/eastern_bitmaps/knightP_m.xbm | 2 +- xshogi/eastern_bitmaps/knightR.xbm | 2 +- xshogi/eastern_bitmaps/knightR_l.xbm | 80 +- xshogi/eastern_bitmaps/knightR_m.xbm | 2 +- xshogi/eastern_bitmaps/knight_l.xbm | 66 +- xshogi/eastern_bitmaps/knight_m.xbm | 2 +- xshogi/eastern_bitmaps/lance.xbm | 2 +- xshogi/eastern_bitmaps/lanceP.xbm | 2 +- xshogi/eastern_bitmaps/lancePR.xbm | 2 +- xshogi/eastern_bitmaps/lancePR_l.xbm | 80 +- xshogi/eastern_bitmaps/lancePR_m.xbm | 2 +- xshogi/eastern_bitmaps/lanceP_l.xbm | 66 +- xshogi/eastern_bitmaps/lanceP_m.xbm | 2 +- xshogi/eastern_bitmaps/lanceR.xbm | 2 +- xshogi/eastern_bitmaps/lanceR_l.xbm | 80 +- xshogi/eastern_bitmaps/lanceR_m.xbm | 2 +- xshogi/eastern_bitmaps/lance_l.xbm | 66 +- xshogi/eastern_bitmaps/lance_m.xbm | 2 +- xshogi/eastern_bitmaps/none.xbm | 2 +- xshogi/eastern_bitmaps/none_l.xbm | 2 +- xshogi/eastern_bitmaps/none_m.xbm | 2 +- xshogi/eastern_bitmaps/pawn.xbm | 2 +- xshogi/eastern_bitmaps/pawnP.xbm | 2 +- xshogi/eastern_bitmaps/pawnPR.xbm | 2 +- xshogi/eastern_bitmaps/pawnPR_l.xbm | 80 +- xshogi/eastern_bitmaps/pawnPR_m.xbm | 2 +- xshogi/eastern_bitmaps/pawnP_l.xbm | 66 +- xshogi/eastern_bitmaps/pawnP_m.xbm | 2 +- xshogi/eastern_bitmaps/pawnR.xbm | 2 +- xshogi/eastern_bitmaps/pawnR_l.xbm | 80 +- xshogi/eastern_bitmaps/pawnR_m.xbm | 2 +- xshogi/eastern_bitmaps/pawn_l.xbm | 66 +- xshogi/eastern_bitmaps/pawn_m.xbm | 2 +- xshogi/eastern_bitmaps/rook.xbm | 2 +- xshogi/eastern_bitmaps/rookP.top.xbm | 2 +- xshogi/eastern_bitmaps/rookP.xbm | 2 +- xshogi/eastern_bitmaps/rookPR.top.xbm | 2 +- xshogi/eastern_bitmaps/rookPR.xbm | 2 +- xshogi/eastern_bitmaps/rookPR_l.top.xbm | 2 +- xshogi/eastern_bitmaps/rookPR_l.xbm | 80 +- xshogi/eastern_bitmaps/rookPR_m.top.xbm | 2 +- xshogi/eastern_bitmaps/rookPR_m.xbm | 2 +- xshogi/eastern_bitmaps/rookP_l.top.xbm | 2 +- xshogi/eastern_bitmaps/rookP_l.xbm | 80 +- xshogi/eastern_bitmaps/rookP_m.top.xbm | 2 +- xshogi/eastern_bitmaps/rookP_m.xbm | 2 +- xshogi/eastern_bitmaps/rookR.xbm | 2 +- xshogi/eastern_bitmaps/rookR_l.xbm | 80 +- xshogi/eastern_bitmaps/rookR_m.xbm | 2 +- xshogi/eastern_bitmaps/rook_l.xbm | 80 +- xshogi/eastern_bitmaps/rook_m.xbm | 2 +- xshogi/eastern_bitmaps/silver.xbm | 2 +- xshogi/eastern_bitmaps/silverP.xbm | 2 +- xshogi/eastern_bitmaps/silverPR.xbm | 2 +- xshogi/eastern_bitmaps/silverPR_l.xbm | 80 +- xshogi/eastern_bitmaps/silverPR_m.xbm | 2 +- xshogi/eastern_bitmaps/silverP_l.xbm | 80 +- xshogi/eastern_bitmaps/silverP_m.xbm | 2 +- xshogi/eastern_bitmaps/silverR.xbm | 2 +- xshogi/eastern_bitmaps/silverR_l.xbm | 80 +- xshogi/eastern_bitmaps/silverR_m.xbm | 2 +- xshogi/eastern_bitmaps/silver_l.xbm | 80 +- xshogi/eastern_bitmaps/silver_m.xbm | 2 +- xshogi/eastern_bitmaps/smallblank.xbm | 2 +- xshogi/eastern_bitmaps/smallblankR.xbm | 2 +- xshogi/eastern_bitmaps/smalllight.xbm | 2 +- xshogi/eastern_bitmaps/smallsolid.xbm | 2 +- xshogi/eastern_bitmaps/smallsolidR.xbm | 2 +- xshogi/eastern_bitmaps/smallsolidR_l.xbm | 80 +- xshogi/eastern_bitmaps/smallsolidR_m.xbm | 2 +- xshogi/eastern_bitmaps/smallsolid_l.xbm | 66 +- xshogi/eastern_bitmaps/smallsolid_m.xbm | 2 +- xshogi/new_eastern_bitmaps/bigsolidR_l.xbm | 46 + xshogi/new_eastern_bitmaps/bigsolid_l.xbm | 46 + xshogi/new_eastern_bitmaps/bishopPR_l.xbm | 46 + xshogi/new_eastern_bitmaps/bishopP_l.xbm | 46 + xshogi/new_eastern_bitmaps/bishopR_l.xbm | 46 + xshogi/new_eastern_bitmaps/bishop_l.xbm | 46 + xshogi/new_eastern_bitmaps/goldR_l.xbm | 46 + xshogi/new_eastern_bitmaps/gold_l.xbm | 46 + xshogi/new_eastern_bitmaps/kingR_l.xbm | 46 + xshogi/new_eastern_bitmaps/king_l.xbm | 46 + xshogi/new_eastern_bitmaps/knightPR_l.xbm | 46 + xshogi/new_eastern_bitmaps/knightP_l.xbm | 38 + xshogi/new_eastern_bitmaps/knightR_l.xbm | 46 + xshogi/new_eastern_bitmaps/knight_l.xbm | 38 + xshogi/new_eastern_bitmaps/lancePR_l.xbm | 46 + xshogi/new_eastern_bitmaps/lanceP_l.xbm | 38 + xshogi/new_eastern_bitmaps/lanceR_l.xbm | 46 + xshogi/new_eastern_bitmaps/lance_l.xbm | 38 + xshogi/new_eastern_bitmaps/none_l.xbm | 38 + xshogi/new_eastern_bitmaps/pawnPR_l.xbm | 46 + xshogi/new_eastern_bitmaps/pawnP_l.xbm | 38 + xshogi/new_eastern_bitmaps/pawnR_l.xbm | 46 + xshogi/new_eastern_bitmaps/pawn_l.xbm | 38 + xshogi/new_eastern_bitmaps/rookPR_l.xbm | 46 + xshogi/new_eastern_bitmaps/rookP_l.xbm | 46 + xshogi/new_eastern_bitmaps/rookR_l.xbm | 46 + xshogi/new_eastern_bitmaps/rook_l.xbm | 46 + xshogi/new_eastern_bitmaps/silverPR_l.xbm | 46 + xshogi/new_eastern_bitmaps/silverP_l.xbm | 46 + xshogi/new_eastern_bitmaps/silverR_l.xbm | 46 + xshogi/new_eastern_bitmaps/silver_l.xbm | 46 + xshogi/new_eastern_bitmaps/smallsolidR_l.xbm | 46 + xshogi/new_eastern_bitmaps/smallsolid_l.xbm | 38 + xshogi/new_western_bitmaps/bishopPRW.xbm | 38 + xshogi/new_western_bitmaps/bishopPW.xbm | 38 + xshogi/new_western_bitmaps/bishopRW.xbm | 38 + xshogi/new_western_bitmaps/bishopW.xbm | 38 + xshogi/new_western_bitmaps/goldRW.xbm | 38 + xshogi/new_western_bitmaps/goldW.xbm | 38 + xshogi/new_western_bitmaps/kingRW.xbm | 38 + xshogi/new_western_bitmaps/kingW.xbm | 38 + xshogi/new_western_bitmaps/knightPRW.xbm | 46 + xshogi/new_western_bitmaps/knightPW.xbm | 46 + xshogi/new_western_bitmaps/knightRW.xbm | 46 + xshogi/new_western_bitmaps/knightW.xbm | 46 + xshogi/new_western_bitmaps/lancePRW.xbm | 38 + xshogi/new_western_bitmaps/lancePW.xbm | 38 + xshogi/new_western_bitmaps/lanceRW.xbm | 38 + xshogi/new_western_bitmaps/lanceW.xbm | 38 + xshogi/new_western_bitmaps/noneW.xbm | 38 + xshogi/new_western_bitmaps/pawnPRW.xbm | 38 + xshogi/new_western_bitmaps/pawnPW.xbm | 38 + xshogi/new_western_bitmaps/pawnRW.xbm | 38 + xshogi/new_western_bitmaps/pawnW.xbm | 38 + xshogi/new_western_bitmaps/rookPRW.xbm | 38 + xshogi/new_western_bitmaps/rookPW.xbm | 38 + xshogi/new_western_bitmaps/rookRW.xbm | 38 + xshogi/new_western_bitmaps/rookW.xbm | 38 + xshogi/new_western_bitmaps/silverPRW.xbm | 38 + xshogi/new_western_bitmaps/silverPW.xbm | 38 + xshogi/new_western_bitmaps/silverRW.xbm | 38 + xshogi/new_western_bitmaps/silverW.xbm | 38 + xshogi/parser.y | 25 +- xshogi/scanner.l | 22 +- xshogi/sysdeps.h | 19 +- xshogi/western_bitmaps/TRANS.TBL | 29 - xshogi/western_bitmaps/bishopPRW.xbm | 52 +- xshogi/western_bitmaps/bishopPW.xbm | 52 +- xshogi/western_bitmaps/bishopRW.xbm | 52 +- xshogi/western_bitmaps/bishopW.xbm | 52 +- xshogi/western_bitmaps/goldRW.xbm | 52 +- xshogi/western_bitmaps/goldW.xbm | 52 +- xshogi/western_bitmaps/kingRW.xbm | 52 +- xshogi/western_bitmaps/kingW.xbm | 52 +- xshogi/western_bitmaps/knightPRW.xbm | 60 +- xshogi/western_bitmaps/knightPW.xbm | 60 +- xshogi/western_bitmaps/knightRW.xbm | 60 +- xshogi/western_bitmaps/knightW.xbm | 60 +- xshogi/western_bitmaps/lancePRW.xbm | 52 +- xshogi/western_bitmaps/lancePW.xbm | 52 +- xshogi/western_bitmaps/lanceRW.xbm | 52 +- xshogi/western_bitmaps/lanceW.xbm | 52 +- xshogi/western_bitmaps/noneW.xbm | 34 +- xshogi/western_bitmaps/pawnPRW.xbm | 52 +- xshogi/western_bitmaps/pawnPW.xbm | 52 +- xshogi/western_bitmaps/pawnRW.xbm | 52 +- xshogi/western_bitmaps/pawnW.xbm | 52 +- xshogi/western_bitmaps/rookPRW.xbm | 52 +- xshogi/western_bitmaps/rookPW.xbm | 52 +- xshogi/western_bitmaps/rookRW.xbm | 52 +- xshogi/western_bitmaps/rookW.xbm | 52 +- xshogi/western_bitmaps/silverPRW.xbm | 52 +- xshogi/western_bitmaps/silverPW.xbm | 52 +- xshogi/western_bitmaps/silverRW.xbm | 52 +- xshogi/western_bitmaps/silverW.xbm | 52 +- xshogi/xshogi.c | 576 +- xshogi/xshogi.h | 46 +- xshogi/xshogifn.h | 10 +- 284 files changed, 17897 insertions(+), 7950 deletions(-) delete mode 100644 TRANS.TBL create mode 100644 configure.ac delete mode 100644 configure.in delete mode 100644 doc/TRANS.TBL create mode 100644 doc/gnushogi.html create mode 100644 doc/gnushogi_23.html create mode 100644 doc/gnushogi_24.html create mode 100644 doc/gnushogi_abt.html create mode 100644 doc/gnushogi_ovr.html delete mode 100644 doc/gnushogi_stoc.html delete mode 100644 doc/listserv.ref create mode 100644 gnushogi/Makefile.profile.in delete mode 100644 gnushogi/TRANS.TBL delete mode 100644 misc/TRANS.TBL delete mode 100644 xshogi/TRANS.TBL delete mode 100644 xshogi/eastern_bitmaps/TRANS.TBL create mode 100644 xshogi/new_eastern_bitmaps/bigsolidR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/bigsolid_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/bishopPR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/bishopP_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/bishopR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/bishop_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/goldR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/gold_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/kingR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/king_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/knightPR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/knightP_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/knightR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/knight_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/lancePR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/lanceP_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/lanceR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/lance_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/none_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/pawnPR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/pawnP_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/pawnR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/pawn_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/rookPR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/rookP_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/rookR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/rook_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/silverPR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/silverP_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/silverR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/silver_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/smallsolidR_l.xbm create mode 100644 xshogi/new_eastern_bitmaps/smallsolid_l.xbm create mode 100644 xshogi/new_western_bitmaps/bishopPRW.xbm create mode 100644 xshogi/new_western_bitmaps/bishopPW.xbm create mode 100644 xshogi/new_western_bitmaps/bishopRW.xbm create mode 100644 xshogi/new_western_bitmaps/bishopW.xbm create mode 100644 xshogi/new_western_bitmaps/goldRW.xbm create mode 100644 xshogi/new_western_bitmaps/goldW.xbm create mode 100644 xshogi/new_western_bitmaps/kingRW.xbm create mode 100644 xshogi/new_western_bitmaps/kingW.xbm create mode 100644 xshogi/new_western_bitmaps/knightPRW.xbm create mode 100644 xshogi/new_western_bitmaps/knightPW.xbm create mode 100644 xshogi/new_western_bitmaps/knightRW.xbm create mode 100644 xshogi/new_western_bitmaps/knightW.xbm create mode 100644 xshogi/new_western_bitmaps/lancePRW.xbm create mode 100644 xshogi/new_western_bitmaps/lancePW.xbm create mode 100644 xshogi/new_western_bitmaps/lanceRW.xbm create mode 100644 xshogi/new_western_bitmaps/lanceW.xbm create mode 100644 xshogi/new_western_bitmaps/noneW.xbm create mode 100644 xshogi/new_western_bitmaps/pawnPRW.xbm create mode 100644 xshogi/new_western_bitmaps/pawnPW.xbm create mode 100644 xshogi/new_western_bitmaps/pawnRW.xbm create mode 100644 xshogi/new_western_bitmaps/pawnW.xbm create mode 100644 xshogi/new_western_bitmaps/rookPRW.xbm create mode 100644 xshogi/new_western_bitmaps/rookPW.xbm create mode 100644 xshogi/new_western_bitmaps/rookRW.xbm create mode 100644 xshogi/new_western_bitmaps/rookW.xbm create mode 100644 xshogi/new_western_bitmaps/silverPRW.xbm create mode 100644 xshogi/new_western_bitmaps/silverPW.xbm create mode 100644 xshogi/new_western_bitmaps/silverRW.xbm create mode 100644 xshogi/new_western_bitmaps/silverW.xbm delete mode 100644 xshogi/western_bitmaps/TRANS.TBL diff --git a/CONTRIB b/CONTRIB index 38fd1a5..661a4ed 100644 --- a/CONTRIB +++ b/CONTRIB @@ -1,6 +1,9 @@ Contributions from users ------------------------ +Feb 1, 2001 + Bernhard Maerz: new piecesets + Sep 12, 1994 Hiroshi Tsuda: some openings added to gnushogi.tbk diff --git a/ChangeLog b/ChangeLog index a9f4c5c..8438629 100644 --- a/ChangeLog +++ b/ChangeLog @@ -1,5 +1,14 @@ ChangeLog will start with GNU Shogi 1.0 patchlevel 11 (04/07/1993) +version 1.3.2 + 07/2004 + Numerous little fixes to keep the program working on modern + Linuxes. + +version 1.3.1 + 07/2001 + New piece bitmaps (westernized and Japanese). + version 1.3 06/1999 gnushogi is now only one executable. diff --git a/INSTALL b/INSTALL index 0d0d2c6..52b05a1 100644 --- a/INSTALL +++ b/INSTALL @@ -66,12 +66,12 @@ on exit, #define LIST_ON_EXIT in this file. Platforms GNU shogi is known to compile on: ------------------------------------------ -Red Hat Linux 5.2 +Red Hat Linux 9.0 Sun Solaris 2.6 Information about attempted or successful ports to other platforms would be appreciated. If you submit such a report, please specify what you had to do to get GNU shogi to compile and run successfully. --- Mike Vanier (mvanier@bbb.caltech.edu) +-- Mike Vanier (mvanier@cs.caltech.edu) diff --git a/Makefile.in b/Makefile.in index cab7a06..7812668 100644 --- a/Makefile.in +++ b/Makefile.in @@ -24,6 +24,7 @@ # the Free Software Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. # +VERSION = 1.3.2 GNUSHOGIDIR = ./gnushogi XSHOGIDIR = ./xshogi @@ -82,27 +83,32 @@ xshogi_clean: # +# Building a distribution. +# + +dist: + ./make_dist $(VERSION) + + +# # Return to a pristine pre-configuration state. # DISTCLEANFILES = \ - config.cache config.log config.status config.h \ - Makefile $(GNUSHOGIDIR)/Makefile $(XSHOGIDIR)/Makefile + config.cache config.log config.status config.h Makefile \ + $(GNUSHOGIDIR)/Makefile $(GNUSHOGIDIR)/Makefile.profile \ + $(XSHOGIDIR)/Makefile autom4te.cache distclean: clean - for file in $(DISTCLEANFILES); do \ - if [ -f $$file ]; then rm $$file; fi; \ - done + rm -rf $(DISTCLEANFILES) # -# Extra cleanup, for the maintainer only :-) +# Extra cleanup, for the maintainer only. # -MAINTAINERCLEANFILES = configure config.h.in doc/gnushogi.info +MAINTAINERCLEANFILES = configure config.h.in doc/gnushogi.info maintainerclean: distclean - for file in $(MAINTAINERCLEANFILES); do \ - if [ -f $$file ]; then rm $$file; fi; \ - done + rm -f $(MAINTAINERCLEANFILES) diff --git a/NEWS b/NEWS index 523be5f..1d42d14 100644 --- a/NEWS +++ b/NEWS @@ -1,7 +1,21 @@ GNU shogi news -------------- -This file will start with GNU Shogi 1.3 (07/01/1999). +This file starts with GNU Shogi 1.3 (07/01/1999). + +Changes in version 1.3.2 (07/2004): + +* configure.in has been renamed to configure.ac + +* A number of small fixes were added to make the program compile and run + correctly on modern Linuxes. + + +Changes in version 1.3.1 (07/2001): + +* New piece bitmaps for both westernized and Japanese piece sets, courtesy of + Bernhard Maerz. + Changes in version 1.3 (07/1999): diff --git a/README b/README index b33a360..4bd4e15 100644 --- a/README +++ b/README @@ -1,7 +1,7 @@ -GNU Shogi, release 1.3 ----------------------- +GNU Shogi, release 1.3.1 +------------------------ -This is release 1.3 of GNU shogi, a program which plays shogi (Japanese +This is release 1.3.1 of GNU shogi, a program which plays shogi (Japanese chess), as well as xshogi, the graphical interface to GNU shogi. GNU shogi and xshogi were originally written by Matthias Mutz (mutz@fmi.uni-passau.de), but are now maintained by me, Mike Vanier (mvanier@bbb.caltech.edu). GNU diff --git a/TRANS.TBL b/TRANS.TBL deleted file mode 100644 index 534e01c..0000000 --- a/TRANS.TBL +++ /dev/null @@ -1,17 +0,0 @@ -F CHANGELO.;1 ChangeLog -F CONFIGUR.;1 configure -F CONFIGUR.IN;1 configure.in -F CONFIG_H.IN;1 config.h.in -F CONTRIB.;1 CONTRIB -F COPYING.;1 COPYING -D DOC doc -D GNUSHOGI gnushogi -F INSTALL.;1 INSTALL -F INSTALL.GEN;1 INSTALL.generic -F INSTALL-.;1 install-sh -F MAKEFILE.IN;1 Makefile.in -D MISC misc -F NEWS.;1 NEWS -F README.;1 README -F VERSION.H;1 version.h -D XSHOGI xshogi diff --git a/config.h.in b/config.h.in index 76cafb5..591ab5c 100644 --- a/config.h.in +++ b/config.h.in @@ -1,87 +1,195 @@ -/* config.h.in. Generated automatically from configure.in by autoheader. */ +/* config.h.in. Generated from configure.ac by autoheader. */ -/* Define to empty if the keyword does not work. */ -#undef const - -/* Define if you have that is POSIX.1 compatible. */ -#undef HAVE_SYS_WAIT_H +/* Define to 1 if you have the `bcopy' function. */ +#undef HAVE_BCOPY -/* Define as the return type of signal handlers (int or void). */ -#undef RETSIGTYPE +/* Define to 1 if you have the `dup2' function. */ +#undef HAVE_DUP2 -/* Define if the setvbuf function takes the buffering type as its second - argument and the buffer pointer as the third, as on System V - before release 3. */ -#undef SETVBUF_REVERSED +/* Define to 1 if you have the header file. */ +#undef HAVE_ERRNO_H -/* Define to `unsigned' if doesn't define. */ -#undef size_t +/* Define to 1 if you have the header file. */ +#undef HAVE_FCNTL_H -/* Define if you have the ANSI C header files. */ -#undef STDC_HEADERS +/* Define to 1 if you have the `fork' function. */ +#undef HAVE_FORK -/* Define if you can safely include both and . */ -#undef TIME_WITH_SYS_TIME +/* Define to 1 if you have the `gethostname' function. */ +#undef HAVE_GETHOSTNAME -/* Define if your declares struct tm. */ -#undef TM_IN_SYS_TIME +/* Define to 1 if you have the `gettimeofday' function. */ +#undef HAVE_GETTIMEOFDAY -/* Define if the X Window System is missing or not being used. */ -#undef X_DISPLAY_MISSING +/* Define to 1 if you have the header file. */ +#undef HAVE_INTTYPES_H -/* The number of bytes in a long. */ -#undef SIZEOF_LONG +/* Define to 1 if you have the `curses' library (-lcurses). */ +#undef HAVE_LIBCURSES -/* Define if you have the bcopy function. */ -#undef HAVE_BCOPY +/* Define to 1 if you have the `m' library (-lm). */ +#undef HAVE_LIBM -/* Define if you have the gethostname function. */ -#undef HAVE_GETHOSTNAME +/* Define to 1 if you have the `termcap' library (-ltermcap). */ +#undef HAVE_LIBTERMCAP -/* Define if you have the gettimeofday function. */ -#undef HAVE_GETTIMEOFDAY +/* Define to 1 if your system has a GNU libc compatible `malloc' function, and + to 0 otherwise. */ +#undef HAVE_MALLOC -/* Define if you have the memcpy function. */ +/* Define to 1 if you have the `memcpy' function. */ #undef HAVE_MEMCPY -/* Define if you have the setlinebuf function. */ +/* Define to 1 if you have the header file. */ +#undef HAVE_MEMORY_H + +/* Define to 1 if you have the `memset' function. */ +#undef HAVE_MEMSET + +/* Define to 1 if you have the `pow' function. */ +#undef HAVE_POW + +/* Define to 1 if you have the `setlinebuf' function. */ #undef HAVE_SETLINEBUF -/* Define if you have the setvbuf function. */ +/* Define to 1 if you have the `setvbuf' function. */ #undef HAVE_SETVBUF -/* Define if you have the strstr function. */ +/* Define to 1 if stdbool.h conforms to C99. */ +#undef HAVE_STDBOOL_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_STDINT_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_STDLIB_H + +/* Define to 1 if you have the `strcasecmp' function. */ +#undef HAVE_STRCASECMP + +/* Define to 1 if you have the `strchr' function. */ +#undef HAVE_STRCHR + +/* Define to 1 if you have the `strerror' function. */ +#undef HAVE_STRERROR + +/* Define to 1 if you have the header file. */ +#undef HAVE_STRINGS_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_STRING_H + +/* Define to 1 if you have the `strrchr' function. */ +#undef HAVE_STRRCHR + +/* Define to 1 if you have the `strstr' function. */ #undef HAVE_STRSTR -/* Define if you have the strtol function. */ +/* Define to 1 if you have the `strtol' function. */ #undef HAVE_STRTOL -/* Define if you have the header file. */ -#undef HAVE_FCNTL_H - -/* Define if you have the header file. */ +/* Define to 1 if you have the header file. */ #undef HAVE_SYS_FILE_H -/* Define if you have the header file. */ -#undef HAVE_SYS_FILIO_H - -/* Define if you have the header file. */ +/* Define to 1 if you have the header file. */ #undef HAVE_SYS_IOCTL_H -/* Define if you have the header file. */ +/* Define to 1 if you have the header file. */ +#undef HAVE_SYS_PARAM_H + +/* Define to 1 if you have the header file. */ +#undef HAVE_SYS_STAT_H + +/* Define to 1 if you have the header file. */ #undef HAVE_SYS_TIME_H -/* Define if you have the header file. */ -#undef HAVE_TIME_H +/* Define to 1 if you have the header file. */ +#undef HAVE_SYS_TYPES_H -/* Define if you have the header file. */ +/* Define to 1 if you have that is POSIX.1 compatible. */ +#undef HAVE_SYS_WAIT_H + +/* Define to 1 if you have the header file. */ #undef HAVE_UNISTD_H -/* Define if you have the curses library (-lcurses). */ -#undef HAVE_LIBCURSES +/* Define to 1 if you have the `vfork' function. */ +#undef HAVE_VFORK -/* Define if you have the m library (-lm). */ -#undef HAVE_LIBM +/* Define to 1 if you have the header file. */ +#undef HAVE_VFORK_H -/* Define if you have the termcap library (-ltermcap). */ -#undef HAVE_LIBTERMCAP +/* Define to 1 if `fork' works. */ +#undef HAVE_WORKING_FORK + +/* Define to 1 if `vfork' works. */ +#undef HAVE_WORKING_VFORK + +/* Define to 1 if the system has the type `_Bool'. */ +#undef HAVE__BOOL + +/* Define to the address where bug reports for this package should be sent. */ +#undef PACKAGE_BUGREPORT + +/* Define to the full name of this package. */ +#undef PACKAGE_NAME + +/* Define to the full name and version of this package. */ +#undef PACKAGE_STRING + +/* Define to the one symbol short name of this package. */ +#undef PACKAGE_TARNAME + +/* Define to the version of this package. */ +#undef PACKAGE_VERSION + +/* Define to 1 if the C compiler supports function prototypes. */ +#undef PROTOTYPES + +/* Define as the return type of signal handlers (`int' or `void'). */ +#undef RETSIGTYPE + +/* Define to 1 if the `setvbuf' function takes the buffering type as its + second argument and the buffer pointer as the third, as on System V before + release 3. */ +#undef SETVBUF_REVERSED + +/* The size of a `long', as computed by sizeof. */ +#undef SIZEOF_LONG + +/* Define to 1 if you have the ANSI C header files. */ +#undef STDC_HEADERS + +/* Define to 1 if you can safely include both and . */ +#undef TIME_WITH_SYS_TIME + +/* Define to 1 if your declares `struct tm'. */ +#undef TM_IN_SYS_TIME + +/* Define to 1 if the X Window System is missing or not being used. */ +#undef X_DISPLAY_MISSING + +/* Define to 1 if `lex' declares `yytext' as a `char *' by default, not a + `char[]'. */ +#undef YYTEXT_POINTER + +/* Define like PROTOTYPES; this can be used by system headers. */ +#undef __PROTOTYPES + +/* Define to empty if `const' does not conform to ANSI C. */ +#undef const + +/* Define as `__inline' if that's what the C compiler calls it, or to nothing + if it is not supported. */ +#undef inline + +/* Define to rpl_malloc if the replacement function should be used. */ +#undef malloc + +/* Define to `int' if does not define. */ +#undef pid_t + +/* Define to `unsigned' if does not define. */ +#undef size_t + +/* Define as `fork' if `vfork' does not work. */ +#undef vfork diff --git a/configure b/configure index cb94989..ed1b847 100755 --- a/configure +++ b/configure @@ -1,47 +1,326 @@ #! /bin/sh - # Guess values for system-dependent variables and create Makefiles. -# Generated automatically using autoconf version 2.13 -# Copyright (C) 1992, 93, 94, 95, 96 Free Software Foundation, Inc. +# Generated by GNU Autoconf 2.57 for gnushogi 1.3.2. +# +# Report bugs to . # +# Copyright 1992, 1993, 1994, 1995, 1996, 1998, 1999, 2000, 2001, 2002 +# Free Software Foundation, Inc. # This configure script is free software; the Free Software Foundation # gives unlimited permission to copy, distribute and modify it. +## --------------------- ## +## M4sh Initialization. ## +## --------------------- ## + +# Be Bourne compatible +if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then + emulate sh + NULLCMD=: + # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which + # is contrary to our usage. Disable this feature. + alias -g '${1+"$@"}'='"$@"' +elif test -n "${BASH_VERSION+set}" && (set -o posix) >/dev/null 2>&1; then + set -o posix +fi + +# Support unset when possible. +if (FOO=FOO; unset FOO) >/dev/null 2>&1; then + as_unset=unset +else + as_unset=false +fi + + +# Work around bugs in pre-3.0 UWIN ksh. +$as_unset ENV MAIL MAILPATH +PS1='$ ' +PS2='> ' +PS4='+ ' + +# NLS nuisances. +for as_var in \ + LANG LANGUAGE LC_ADDRESS LC_ALL LC_COLLATE LC_CTYPE LC_IDENTIFICATION \ + LC_MEASUREMENT LC_MESSAGES LC_MONETARY LC_NAME LC_NUMERIC LC_PAPER \ + LC_TELEPHONE LC_TIME +do + if (set +x; test -n "`(eval $as_var=C; export $as_var) 2>&1`"); then + eval $as_var=C; export $as_var + else + $as_unset $as_var + fi +done + +# Required to use basename. +if expr a : '\(a\)' >/dev/null 2>&1; then + as_expr=expr +else + as_expr=false +fi + +if (basename /) >/dev/null 2>&1 && test "X`basename / 2>&1`" = "X/"; then + as_basename=basename +else + as_basename=false +fi + + +# Name of the executable. +as_me=`$as_basename "$0" || +$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \ + X"$0" : 'X\(//\)$' \| \ + X"$0" : 'X\(/\)$' \| \ + . : '\(.\)' 2>/dev/null || +echo X/"$0" | + sed '/^.*\/\([^/][^/]*\)\/*$/{ s//\1/; q; } + /^X\/\(\/\/\)$/{ s//\1/; q; } + /^X\/\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` -# Defaults: -ac_help= + +# PATH needs CR, and LINENO needs CR and PATH. +# Avoid depending upon Character Ranges. +as_cr_letters='abcdefghijklmnopqrstuvwxyz' +as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ' +as_cr_Letters=$as_cr_letters$as_cr_LETTERS +as_cr_digits='0123456789' +as_cr_alnum=$as_cr_Letters$as_cr_digits + +# The user is always right. +if test "${PATH_SEPARATOR+set}" != set; then + echo "#! /bin/sh" >conf$$.sh + echo "exit 0" >>conf$$.sh + chmod +x conf$$.sh + if (PATH="/nonexistent;."; conf$$.sh) >/dev/null 2>&1; then + PATH_SEPARATOR=';' + else + PATH_SEPARATOR=: + fi + rm -f conf$$.sh +fi + + + as_lineno_1=$LINENO + as_lineno_2=$LINENO + as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null` + test "x$as_lineno_1" != "x$as_lineno_2" && + test "x$as_lineno_3" = "x$as_lineno_2" || { + # Find who we are. Look in the path if we contain no path at all + # relative or not. + case $0 in + *[\\/]* ) as_myself=$0 ;; + *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break +done + + ;; + esac + # We did not find ourselves, most probably we were run as `sh COMMAND' + # in which case we are not to be found in the path. + if test "x$as_myself" = x; then + as_myself=$0 + fi + if test ! -f "$as_myself"; then + { echo "$as_me: error: cannot find myself; rerun with an absolute path" >&2 + { (exit 1); exit 1; }; } + fi + case $CONFIG_SHELL in + '') + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in /bin$PATH_SEPARATOR/usr/bin$PATH_SEPARATOR$PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for as_base in sh bash ksh sh5; do + case $as_dir in + /*) + if ("$as_dir/$as_base" -c ' + as_lineno_1=$LINENO + as_lineno_2=$LINENO + as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null` + test "x$as_lineno_1" != "x$as_lineno_2" && + test "x$as_lineno_3" = "x$as_lineno_2" ') 2>/dev/null; then + $as_unset BASH_ENV || test "${BASH_ENV+set}" != set || { BASH_ENV=; export BASH_ENV; } + $as_unset ENV || test "${ENV+set}" != set || { ENV=; export ENV; } + CONFIG_SHELL=$as_dir/$as_base + export CONFIG_SHELL + exec "$CONFIG_SHELL" "$0" ${1+"$@"} + fi;; + esac + done +done +;; + esac + + # Create $as_me.lineno as a copy of $as_myself, but with $LINENO + # uniformly replaced by the line number. The first 'sed' inserts a + # line-number line before each line; the second 'sed' does the real + # work. The second script uses 'N' to pair each line-number line + # with the numbered line, and appends trailing '-' during + # substitution so that $LINENO is not a special case at line end. + # (Raja R Harinath suggested sed '=', and Paul Eggert wrote the + # second 'sed' script. Blame Lee E. McMahon for sed's syntax. :-) + sed '=' <$as_myself | + sed ' + N + s,$,-, + : loop + s,^\(['$as_cr_digits']*\)\(.*\)[$]LINENO\([^'$as_cr_alnum'_]\),\1\2\1\3, + t loop + s,-$,, + s,^['$as_cr_digits']*\n,, + ' >$as_me.lineno && + chmod +x $as_me.lineno || + { echo "$as_me: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&2 + { (exit 1); exit 1; }; } + + # Don't try to exec as it changes $[0], causing all sort of problems + # (the dirname of $[0] is not the place where we might find the + # original and so on. Autoconf is especially sensible to this). + . ./$as_me.lineno + # Exit status is that of the last command. + exit +} + + +case `echo "testing\c"; echo 1,2,3`,`echo -n testing; echo 1,2,3` in + *c*,-n*) ECHO_N= ECHO_C=' +' ECHO_T=' ' ;; + *c*,* ) ECHO_N=-n ECHO_C= ECHO_T= ;; + *) ECHO_N= ECHO_C='\c' ECHO_T= ;; +esac + +if expr a : '\(a\)' >/dev/null 2>&1; then + as_expr=expr +else + as_expr=false +fi + +rm -f conf$$ conf$$.exe conf$$.file +echo >conf$$.file +if ln -s conf$$.file conf$$ 2>/dev/null; then + # We could just check for DJGPP; but this test a) works b) is more generic + # and c) will remain valid once DJGPP supports symlinks (DJGPP 2.04). + if test -f conf$$.exe; then + # Don't use ln at all; we don't have any links + as_ln_s='cp -p' + else + as_ln_s='ln -s' + fi +elif ln conf$$.file conf$$ 2>/dev/null; then + as_ln_s=ln +else + as_ln_s='cp -p' +fi +rm -f conf$$ conf$$.exe conf$$.file + +if mkdir -p . 2>/dev/null; then + as_mkdir_p=: +else + as_mkdir_p=false +fi + +as_executable_p="test -f" + +# Sed expression to map a string onto a valid CPP name. +as_tr_cpp="sed y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g" + +# Sed expression to map a string onto a valid variable name. +as_tr_sh="sed y%*+%pp%;s%[^_$as_cr_alnum]%_%g" + + +# IFS +# We need space, tab and new line, in precisely that order. +as_nl=' +' +IFS=" $as_nl" + +# CDPATH. +$as_unset CDPATH + + +# Name of the host. +# hostname on some systems (SVR3.2, Linux) returns a bogus exit status, +# so uname gets run too. +ac_hostname=`(hostname || uname -n) 2>/dev/null | sed 1q` + +exec 6>&1 + +# +# Initializations. +# ac_default_prefix=/usr/local -# Any additions from configure.in: -ac_help="$ac_help - --with-x use the X Window System" -ac_help="$ac_help - --with-top-part-bitmaps Use top part of Kanji bitmaps only." -ac_help="$ac_help - --with-first-shogi-program=PROGNAME - Use PROGNAME as the first shogi program (default: gnushogi)" -ac_help="$ac_help - --with-second-shogi-program=PROGNAME - Use PROGNAME as the second shogi program (default: gnushogi)" -ac_help="$ac_help - --with-first-host=HOSTNAME - Use HOSTNAME as the machine on which the first shogi program - runs (default: localhost)" -ac_help="$ac_help - --with-second-host=HOSTNAME - Use HOSTNAME as the machine on which the second shogi program - runs (default: localhost)" -ac_help="$ac_help - --with-xshogi - Compile the xshogi graphical interface to GNU shogi (default: yes)" +ac_config_libobj_dir=. +cross_compiling=no +subdirs= +MFLAGS= +MAKEFLAGS= +SHELL=${CONFIG_SHELL-/bin/sh} + +# Maximum number of lines to put in a shell here document. +# This variable seems obsolete. It should probably be removed, and +# only ac_max_sed_lines should be used. +: ${ac_max_here_lines=38} + +# Identity of this package. +PACKAGE_NAME='gnushogi' +PACKAGE_TARNAME='gnushogi' +PACKAGE_VERSION='1.3.2' +PACKAGE_STRING='gnushogi 1.3.2' +PACKAGE_BUGREPORT='mvanier@cs.caltech.edu' + +ac_unique_file="version.h" +# Factoring default headers for most tests. +ac_includes_default="\ +#include +#if HAVE_SYS_TYPES_H +# include +#endif +#if HAVE_SYS_STAT_H +# include +#endif +#if STDC_HEADERS +# include +# include +#else +# if HAVE_STDLIB_H +# include +# endif +#endif +#if HAVE_STRING_H +# if !STDC_HEADERS && HAVE_MEMORY_H +# include +# endif +# include +#endif +#if HAVE_STRINGS_H +# include +#endif +#if HAVE_INTTYPES_H +# include +#else +# if HAVE_STDINT_H +# include +# endif +#endif +#if HAVE_UNISTD_H +# include +#endif" + +ac_subst_vars='SHELL PATH_SEPARATOR PACKAGE_NAME PACKAGE_TARNAME PACKAGE_VERSION PACKAGE_STRING PACKAGE_BUGREPORT exec_prefix prefix program_transform_name bindir sbindir libexecdir datadir sysconfdir sharedstatedir localstatedir libdir includedir oldincludedir infodir mandir build_alias host_alias target_alias DEFS ECHO_C ECHO_N ECHO_T LIBS CC CFLAGS LDFLAGS CPPFLAGS ac_ct_CC EXEEXT OBJEXT YACC LEX LEXLIB LEX_OUTPUT_ROOT INSTALL_PROGRAM INSTALL_SCRIPT INSTALL_DATA CPP X_CFLAGS X_PRE_LIBS X_LIBS X_EXTRA_LIBS WARNINGS CEXTRAFLAGS CEXTRAFLAGS2 EGREP LIBOBJS OPT FIRST_SHOGI_PROGRAM SECOND_SHOGI_PROGRAM FIRST_HOST SECOND_HOST XSHOGI XSHOGIINSTALL XSHOGICLEAN LTLIBOBJS' +ac_subst_files='' # Initialize some variables set by options. +ac_init_help= +ac_init_version=false # The variables have the same names as the options, with # dashes changed to underlines. -build=NONE -cache_file=./config.cache +cache_file=/dev/null exec_prefix=NONE -host=NONE no_create= -nonopt=NONE no_recursion= prefix=NONE program_prefix=NONE @@ -50,10 +329,15 @@ program_transform_name=s,x,x, silent= site= srcdir= -target=NONE verbose= x_includes=NONE x_libraries=NONE + +# Installation directory options. +# These are left unexpanded so users can "make install exec_prefix=/foo" +# and all the variables that are supposed to be based on exec_prefix +# by default will actually change. +# Use braces instead of parens because sh, perl, etc. also accept them. bindir='${exec_prefix}/bin' sbindir='${exec_prefix}/sbin' libexecdir='${exec_prefix}/libexec' @@ -67,17 +351,9 @@ oldincludedir='/usr/include' infodir='${prefix}/info' mandir='${prefix}/man' -# Initialize some other variables. -subdirs= -MFLAGS= MAKEFLAGS= -SHELL=${CONFIG_SHELL-/bin/sh} -# Maximum number of lines to put in a shell here document. -ac_max_here_lines=12 - ac_prev= for ac_option do - # If the previous option needs an argument, assign it. if test -n "$ac_prev"; then eval "$ac_prev=\$ac_option" @@ -85,59 +361,59 @@ do continue fi - case "$ac_option" in - -*=*) ac_optarg=`echo "$ac_option" | sed 's/[-_a-zA-Z0-9]*=//'` ;; - *) ac_optarg= ;; - esac + ac_optarg=`expr "x$ac_option" : 'x[^=]*=\(.*\)'` # Accept the important Cygnus configure options, so we can diagnose typos. - case "$ac_option" in + case $ac_option in -bindir | --bindir | --bindi | --bind | --bin | --bi) ac_prev=bindir ;; -bindir=* | --bindir=* | --bindi=* | --bind=* | --bin=* | --bi=*) - bindir="$ac_optarg" ;; + bindir=$ac_optarg ;; -build | --build | --buil | --bui | --bu) - ac_prev=build ;; + ac_prev=build_alias ;; -build=* | --build=* | --buil=* | --bui=* | --bu=*) - build="$ac_optarg" ;; + build_alias=$ac_optarg ;; -cache-file | --cache-file | --cache-fil | --cache-fi \ | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c) ac_prev=cache_file ;; -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \ | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*) - cache_file="$ac_optarg" ;; + cache_file=$ac_optarg ;; + + --config-cache | -C) + cache_file=config.cache ;; -datadir | --datadir | --datadi | --datad | --data | --dat | --da) ac_prev=datadir ;; -datadir=* | --datadir=* | --datadi=* | --datad=* | --data=* | --dat=* \ | --da=*) - datadir="$ac_optarg" ;; + datadir=$ac_optarg ;; -disable-* | --disable-*) - ac_feature=`echo $ac_option|sed -e 's/-*disable-//'` + ac_feature=`expr "x$ac_option" : 'x-*disable-\(.*\)'` # Reject names that are not valid shell variable names. - if test -n "`echo $ac_feature| sed 's/[-a-zA-Z0-9_]//g'`"; then - { echo "configure: error: $ac_feature: invalid feature name" 1>&2; exit 1; } - fi - ac_feature=`echo $ac_feature| sed 's/-/_/g'` - eval "enable_${ac_feature}=no" ;; + expr "x$ac_feature" : ".*[^-_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid feature name: $ac_feature" >&2 + { (exit 1); exit 1; }; } + ac_feature=`echo $ac_feature | sed 's/-/_/g'` + eval "enable_$ac_feature=no" ;; -enable-* | --enable-*) - ac_feature=`echo $ac_option|sed -e 's/-*enable-//' -e 's/=.*//'` + ac_feature=`expr "x$ac_option" : 'x-*enable-\([^=]*\)'` # Reject names that are not valid shell variable names. - if test -n "`echo $ac_feature| sed 's/[-_a-zA-Z0-9]//g'`"; then - { echo "configure: error: $ac_feature: invalid feature name" 1>&2; exit 1; } - fi - ac_feature=`echo $ac_feature| sed 's/-/_/g'` - case "$ac_option" in - *=*) ;; + expr "x$ac_feature" : ".*[^-_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid feature name: $ac_feature" >&2 + { (exit 1); exit 1; }; } + ac_feature=`echo $ac_feature | sed 's/-/_/g'` + case $ac_option in + *=*) ac_optarg=`echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"`;; *) ac_optarg=yes ;; esac - eval "enable_${ac_feature}='$ac_optarg'" ;; + eval "enable_$ac_feature='$ac_optarg'" ;; -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \ | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \ @@ -146,95 +422,47 @@ do -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \ | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \ | --exec=* | --exe=* | --ex=*) - exec_prefix="$ac_optarg" ;; + exec_prefix=$ac_optarg ;; -gas | --gas | --ga | --g) # Obsolete; use --with-gas. with_gas=yes ;; - -help | --help | --hel | --he) - # Omit some internal or obsolete options to make the list less imposing. - # This message is too long to be a string in the A/UX 3.1 sh. - cat << EOF -Usage: configure [options] [host] -Options: [defaults in brackets after descriptions] -Configuration: - --cache-file=FILE cache test results in FILE - --help print this message - --no-create do not create output files - --quiet, --silent do not print \`checking...' messages - --version print the version of autoconf that created configure -Directory and file names: - --prefix=PREFIX install architecture-independent files in PREFIX - [$ac_default_prefix] - --exec-prefix=EPREFIX install architecture-dependent files in EPREFIX - [same as prefix] - --bindir=DIR user executables in DIR [EPREFIX/bin] - --sbindir=DIR system admin executables in DIR [EPREFIX/sbin] - --libexecdir=DIR program executables in DIR [EPREFIX/libexec] - --datadir=DIR read-only architecture-independent data in DIR - [PREFIX/share] - --sysconfdir=DIR read-only single-machine data in DIR [PREFIX/etc] - --sharedstatedir=DIR modifiable architecture-independent data in DIR - [PREFIX/com] - --localstatedir=DIR modifiable single-machine data in DIR [PREFIX/var] - --libdir=DIR object code libraries in DIR [EPREFIX/lib] - --includedir=DIR C header files in DIR [PREFIX/include] - --oldincludedir=DIR C header files for non-gcc in DIR [/usr/include] - --infodir=DIR info documentation in DIR [PREFIX/info] - --mandir=DIR man documentation in DIR [PREFIX/man] - --srcdir=DIR find the sources in DIR [configure dir or ..] - --program-prefix=PREFIX prepend PREFIX to installed program names - --program-suffix=SUFFIX append SUFFIX to installed program names - --program-transform-name=PROGRAM - run sed PROGRAM on installed program names -EOF - cat << EOF -Host type: - --build=BUILD configure for building on BUILD [BUILD=HOST] - --host=HOST configure for HOST [guessed] - --target=TARGET configure for TARGET [TARGET=HOST] -Features and packages: - --disable-FEATURE do not include FEATURE (same as --enable-FEATURE=no) - --enable-FEATURE[=ARG] include FEATURE [ARG=yes] - --with-PACKAGE[=ARG] use PACKAGE [ARG=yes] - --without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no) - --x-includes=DIR X include files are in DIR - --x-libraries=DIR X library files are in DIR -EOF - if test -n "$ac_help"; then - echo "--enable and --with options recognized:$ac_help" - fi - exit 0 ;; + -help | --help | --hel | --he | -h) + ac_init_help=long ;; + -help=r* | --help=r* | --hel=r* | --he=r* | -hr*) + ac_init_help=recursive ;; + -help=s* | --help=s* | --hel=s* | --he=s* | -hs*) + ac_init_help=short ;; -host | --host | --hos | --ho) - ac_prev=host ;; + ac_prev=host_alias ;; -host=* | --host=* | --hos=* | --ho=*) - host="$ac_optarg" ;; + host_alias=$ac_optarg ;; -includedir | --includedir | --includedi | --included | --include \ | --includ | --inclu | --incl | --inc) ac_prev=includedir ;; -includedir=* | --includedir=* | --includedi=* | --included=* | --include=* \ | --includ=* | --inclu=* | --incl=* | --inc=*) - includedir="$ac_optarg" ;; + includedir=$ac_optarg ;; -infodir | --infodir | --infodi | --infod | --info | --inf) ac_prev=infodir ;; -infodir=* | --infodir=* | --infodi=* | --infod=* | --info=* | --inf=*) - infodir="$ac_optarg" ;; + infodir=$ac_optarg ;; -libdir | --libdir | --libdi | --libd) ac_prev=libdir ;; -libdir=* | --libdir=* | --libdi=* | --libd=*) - libdir="$ac_optarg" ;; + libdir=$ac_optarg ;; -libexecdir | --libexecdir | --libexecdi | --libexecd | --libexec \ | --libexe | --libex | --libe) ac_prev=libexecdir ;; -libexecdir=* | --libexecdir=* | --libexecdi=* | --libexecd=* | --libexec=* \ | --libexe=* | --libex=* | --libe=*) - libexecdir="$ac_optarg" ;; + libexecdir=$ac_optarg ;; -localstatedir | --localstatedir | --localstatedi | --localstated \ | --localstate | --localstat | --localsta | --localst \ @@ -243,19 +471,19 @@ EOF -localstatedir=* | --localstatedir=* | --localstatedi=* | --localstated=* \ | --localstate=* | --localstat=* | --localsta=* | --localst=* \ | --locals=* | --local=* | --loca=* | --loc=* | --lo=*) - localstatedir="$ac_optarg" ;; + localstatedir=$ac_optarg ;; -mandir | --mandir | --mandi | --mand | --man | --ma | --m) ac_prev=mandir ;; -mandir=* | --mandir=* | --mandi=* | --mand=* | --man=* | --ma=* | --m=*) - mandir="$ac_optarg" ;; + mandir=$ac_optarg ;; -nfp | --nfp | --nf) # Obsolete; use --without-fp. with_fp=no ;; -no-create | --no-create | --no-creat | --no-crea | --no-cre \ - | --no-cr | --no-c) + | --no-cr | --no-c | -n) no_create=yes ;; -no-recursion | --no-recursion | --no-recursio | --no-recursi \ @@ -269,26 +497,26 @@ EOF -oldincludedir=* | --oldincludedir=* | --oldincludedi=* | --oldincluded=* \ | --oldinclude=* | --oldinclud=* | --oldinclu=* | --oldincl=* | --oldinc=* \ | --oldin=* | --oldi=* | --old=* | --ol=* | --o=*) - oldincludedir="$ac_optarg" ;; + oldincludedir=$ac_optarg ;; -prefix | --prefix | --prefi | --pref | --pre | --pr | --p) ac_prev=prefix ;; -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*) - prefix="$ac_optarg" ;; + prefix=$ac_optarg ;; -program-prefix | --program-prefix | --program-prefi | --program-pref \ | --program-pre | --program-pr | --program-p) ac_prev=program_prefix ;; -program-prefix=* | --program-prefix=* | --program-prefi=* \ | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*) - program_prefix="$ac_optarg" ;; + program_prefix=$ac_optarg ;; -program-suffix | --program-suffix | --program-suffi | --program-suff \ | --program-suf | --program-su | --program-s) ac_prev=program_suffix ;; -program-suffix=* | --program-suffix=* | --program-suffi=* \ | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*) - program_suffix="$ac_optarg" ;; + program_suffix=$ac_optarg ;; -program-transform-name | --program-transform-name \ | --program-transform-nam | --program-transform-na \ @@ -305,7 +533,7 @@ EOF | --program-transfo=* | --program-transf=* \ | --program-trans=* | --program-tran=* \ | --progr-tra=* | --program-tr=* | --program-t=*) - program_transform_name="$ac_optarg" ;; + program_transform_name=$ac_optarg ;; -q | -quiet | --quiet | --quie | --qui | --qu | --q \ | -silent | --silent | --silen | --sile | --sil) @@ -315,7 +543,7 @@ EOF ac_prev=sbindir ;; -sbindir=* | --sbindir=* | --sbindi=* | --sbind=* | --sbin=* \ | --sbi=* | --sb=*) - sbindir="$ac_optarg" ;; + sbindir=$ac_optarg ;; -sharedstatedir | --sharedstatedir | --sharedstatedi \ | --sharedstated | --sharedstate | --sharedstat | --sharedsta \ @@ -326,58 +554,57 @@ EOF | --sharedstated=* | --sharedstate=* | --sharedstat=* | --sharedsta=* \ | --sharedst=* | --shareds=* | --shared=* | --share=* | --shar=* \ | --sha=* | --sh=*) - sharedstatedir="$ac_optarg" ;; + sharedstatedir=$ac_optarg ;; -site | --site | --sit) ac_prev=site ;; -site=* | --site=* | --sit=*) - site="$ac_optarg" ;; + site=$ac_optarg ;; -srcdir | --srcdir | --srcdi | --srcd | --src | --sr) ac_prev=srcdir ;; -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*) - srcdir="$ac_optarg" ;; + srcdir=$ac_optarg ;; -sysconfdir | --sysconfdir | --sysconfdi | --sysconfd | --sysconf \ | --syscon | --sysco | --sysc | --sys | --sy) ac_prev=sysconfdir ;; -sysconfdir=* | --sysconfdir=* | --sysconfdi=* | --sysconfd=* | --sysconf=* \ | --syscon=* | --sysco=* | --sysc=* | --sys=* | --sy=*) - sysconfdir="$ac_optarg" ;; + sysconfdir=$ac_optarg ;; -target | --target | --targe | --targ | --tar | --ta | --t) - ac_prev=target ;; + ac_prev=target_alias ;; -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*) - target="$ac_optarg" ;; + target_alias=$ac_optarg ;; -v | -verbose | --verbose | --verbos | --verbo | --verb) verbose=yes ;; - -version | --version | --versio | --versi | --vers) - echo "configure generated by autoconf version 2.13" - exit 0 ;; + -version | --version | --versio | --versi | --vers | -V) + ac_init_version=: ;; -with-* | --with-*) - ac_package=`echo $ac_option|sed -e 's/-*with-//' -e 's/=.*//'` + ac_package=`expr "x$ac_option" : 'x-*with-\([^=]*\)'` # Reject names that are not valid shell variable names. - if test -n "`echo $ac_package| sed 's/[-_a-zA-Z0-9]//g'`"; then - { echo "configure: error: $ac_package: invalid package name" 1>&2; exit 1; } - fi + expr "x$ac_package" : ".*[^-_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid package name: $ac_package" >&2 + { (exit 1); exit 1; }; } ac_package=`echo $ac_package| sed 's/-/_/g'` - case "$ac_option" in - *=*) ;; + case $ac_option in + *=*) ac_optarg=`echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"`;; *) ac_optarg=yes ;; esac - eval "with_${ac_package}='$ac_optarg'" ;; + eval "with_$ac_package='$ac_optarg'" ;; -without-* | --without-*) - ac_package=`echo $ac_option|sed -e 's/-*without-//'` + ac_package=`expr "x$ac_option" : 'x-*without-\(.*\)'` # Reject names that are not valid shell variable names. - if test -n "`echo $ac_package| sed 's/[-a-zA-Z0-9_]//g'`"; then - { echo "configure: error: $ac_package: invalid package name" 1>&2; exit 1; } - fi - ac_package=`echo $ac_package| sed 's/-/_/g'` - eval "with_${ac_package}=no" ;; + expr "x$ac_package" : ".*[^-_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid package name: $ac_package" >&2 + { (exit 1); exit 1; }; } + ac_package=`echo $ac_package | sed 's/-/_/g'` + eval "with_$ac_package=no" ;; --x) # Obsolete; use --with-x. @@ -388,99 +615,110 @@ EOF ac_prev=x_includes ;; -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \ | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*) - x_includes="$ac_optarg" ;; + x_includes=$ac_optarg ;; -x-libraries | --x-libraries | --x-librarie | --x-librari \ | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l) ac_prev=x_libraries ;; -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \ | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*) - x_libraries="$ac_optarg" ;; + x_libraries=$ac_optarg ;; - -*) { echo "configure: error: $ac_option: invalid option; use --help to show usage" 1>&2; exit 1; } + -*) { echo "$as_me: error: unrecognized option: $ac_option +Try \`$0 --help' for more information." >&2 + { (exit 1); exit 1; }; } ;; + *=*) + ac_envvar=`expr "x$ac_option" : 'x\([^=]*\)='` + # Reject names that are not valid shell variable names. + expr "x$ac_envvar" : ".*[^_$as_cr_alnum]" >/dev/null && + { echo "$as_me: error: invalid variable name: $ac_envvar" >&2 + { (exit 1); exit 1; }; } + ac_optarg=`echo "$ac_optarg" | sed "s/'/'\\\\\\\\''/g"` + eval "$ac_envvar='$ac_optarg'" + export $ac_envvar ;; + *) - if test -n "`echo $ac_option| sed 's/[-a-z0-9.]//g'`"; then - echo "configure: warning: $ac_option: invalid host type" 1>&2 - fi - if test "x$nonopt" != xNONE; then - { echo "configure: error: can only configure for one host and one target at a time" 1>&2; exit 1; } - fi - nonopt="$ac_option" + # FIXME: should be removed in autoconf 3.0. + echo "$as_me: WARNING: you should use --build, --host, --target" >&2 + expr "x$ac_option" : ".*[^-._$as_cr_alnum]" >/dev/null && + echo "$as_me: WARNING: invalid host type: $ac_option" >&2 + : ${build_alias=$ac_option} ${host_alias=$ac_option} ${target_alias=$ac_option} ;; esac done if test -n "$ac_prev"; then - { echo "configure: error: missing argument to --`echo $ac_prev | sed 's/_/-/g'`" 1>&2; exit 1; } + ac_option=--`echo $ac_prev | sed 's/_/-/g'` + { echo "$as_me: error: missing argument to $ac_option" >&2 + { (exit 1); exit 1; }; } fi -trap 'rm -fr conftest* confdefs* core core.* *.core $ac_clean_files; exit 1' 1 2 15 - -# File descriptor usage: -# 0 standard input -# 1 file creation -# 2 errors and warnings -# 3 some systems may open it to /dev/tty -# 4 used on the Kubota Titan -# 6 checking for... messages and results -# 5 compiler messages saved in config.log -if test "$silent" = yes; then - exec 6>/dev/null -else - exec 6>&1 -fi -exec 5>./config.log - -echo "\ -This file contains any messages produced by compilers while -running configure, to aid debugging if configure makes a mistake. -" 1>&5 +# Be sure to have absolute paths. +for ac_var in exec_prefix prefix +do + eval ac_val=$`echo $ac_var` + case $ac_val in + [\\/$]* | ?:[\\/]* | NONE | '' ) ;; + *) { echo "$as_me: error: expected an absolute directory name for --$ac_var: $ac_val" >&2 + { (exit 1); exit 1; }; };; + esac +done -# Strip out --no-create and --no-recursion so they do not pile up. -# Also quote any args containing shell metacharacters. -ac_configure_args= -for ac_arg +# Be sure to have absolute paths. +for ac_var in bindir sbindir libexecdir datadir sysconfdir sharedstatedir \ + localstatedir libdir includedir oldincludedir infodir mandir do - case "$ac_arg" in - -no-create | --no-create | --no-creat | --no-crea | --no-cre \ - | --no-cr | --no-c) ;; - -no-recursion | --no-recursion | --no-recursio | --no-recursi \ - | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r) ;; - *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?]*) - ac_configure_args="$ac_configure_args '$ac_arg'" ;; - *) ac_configure_args="$ac_configure_args $ac_arg" ;; + eval ac_val=$`echo $ac_var` + case $ac_val in + [\\/$]* | ?:[\\/]* ) ;; + *) { echo "$as_me: error: expected an absolute directory name for --$ac_var: $ac_val" >&2 + { (exit 1); exit 1; }; };; esac done -# NLS nuisances. -# Only set these to C if already set. These must not be set unconditionally -# because not all systems understand e.g. LANG=C (notably SCO). -# Fixing LC_MESSAGES prevents Solaris sh from translating var values in `set'! -# Non-C LC_CTYPE values break the ctype check. -if test "${LANG+set}" = set; then LANG=C; export LANG; fi -if test "${LC_ALL+set}" = set; then LC_ALL=C; export LC_ALL; fi -if test "${LC_MESSAGES+set}" = set; then LC_MESSAGES=C; export LC_MESSAGES; fi -if test "${LC_CTYPE+set}" = set; then LC_CTYPE=C; export LC_CTYPE; fi +# There might be people who depend on the old broken behavior: `$host' +# used to hold the argument of --host etc. +# FIXME: To remove some day. +build=$build_alias +host=$host_alias +target=$target_alias + +# FIXME: To remove some day. +if test "x$host_alias" != x; then + if test "x$build_alias" = x; then + cross_compiling=maybe + echo "$as_me: WARNING: If you wanted to set the --build type, don't use --host. + If a cross compiler is detected then cross compile mode will be used." >&2 + elif test "x$build_alias" != "x$host_alias"; then + cross_compiling=yes + fi +fi -# confdefs.h avoids OS command line length limits that DEFS can exceed. -rm -rf conftest* confdefs.h -# AIX cpp loses on an empty file, so make sure it contains at least a newline. -echo > confdefs.h +ac_tool_prefix= +test -n "$host_alias" && ac_tool_prefix=$host_alias- + +test "$silent" = yes && exec 6>/dev/null -# A filename unique to this package, relative to the directory that -# configure is in, which we can look for to find out if srcdir is correct. -ac_unique_file=gnushogi/gnushogi.h # Find the source files, if location was not specified. if test -z "$srcdir"; then ac_srcdir_defaulted=yes # Try the directory containing this script, then its parent. - ac_prog=$0 - ac_confdir=`echo $ac_prog|sed 's%/[^/][^/]*$%%'` - test "x$ac_confdir" = "x$ac_prog" && ac_confdir=. + ac_confdir=`(dirname "$0") 2>/dev/null || +$as_expr X"$0" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$0" : 'X\(//\)[^/]' \| \ + X"$0" : 'X\(//\)$' \| \ + X"$0" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$0" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` srcdir=$ac_confdir if test ! -r $srcdir/$ac_unique_file; then srcdir=.. @@ -490,13 +728,449 @@ else fi if test ! -r $srcdir/$ac_unique_file; then if test "$ac_srcdir_defaulted" = yes; then - { echo "configure: error: can not find sources in $ac_confdir or .." 1>&2; exit 1; } + { echo "$as_me: error: cannot find sources ($ac_unique_file) in $ac_confdir or .." >&2 + { (exit 1); exit 1; }; } else - { echo "configure: error: can not find sources in $srcdir" 1>&2; exit 1; } + { echo "$as_me: error: cannot find sources ($ac_unique_file) in $srcdir" >&2 + { (exit 1); exit 1; }; } fi fi -srcdir=`echo "${srcdir}" | sed 's%\([^/]\)/*$%\1%'` +(cd $srcdir && test -r ./$ac_unique_file) 2>/dev/null || + { echo "$as_me: error: sources are in $srcdir, but \`cd $srcdir' does not work" >&2 + { (exit 1); exit 1; }; } +srcdir=`echo "$srcdir" | sed 's%\([^\\/]\)[\\/]*$%\1%'` +ac_env_build_alias_set=${build_alias+set} +ac_env_build_alias_value=$build_alias +ac_cv_env_build_alias_set=${build_alias+set} +ac_cv_env_build_alias_value=$build_alias +ac_env_host_alias_set=${host_alias+set} +ac_env_host_alias_value=$host_alias +ac_cv_env_host_alias_set=${host_alias+set} +ac_cv_env_host_alias_value=$host_alias +ac_env_target_alias_set=${target_alias+set} +ac_env_target_alias_value=$target_alias +ac_cv_env_target_alias_set=${target_alias+set} +ac_cv_env_target_alias_value=$target_alias +ac_env_CC_set=${CC+set} +ac_env_CC_value=$CC +ac_cv_env_CC_set=${CC+set} +ac_cv_env_CC_value=$CC +ac_env_CFLAGS_set=${CFLAGS+set} +ac_env_CFLAGS_value=$CFLAGS +ac_cv_env_CFLAGS_set=${CFLAGS+set} +ac_cv_env_CFLAGS_value=$CFLAGS +ac_env_LDFLAGS_set=${LDFLAGS+set} +ac_env_LDFLAGS_value=$LDFLAGS +ac_cv_env_LDFLAGS_set=${LDFLAGS+set} +ac_cv_env_LDFLAGS_value=$LDFLAGS +ac_env_CPPFLAGS_set=${CPPFLAGS+set} +ac_env_CPPFLAGS_value=$CPPFLAGS +ac_cv_env_CPPFLAGS_set=${CPPFLAGS+set} +ac_cv_env_CPPFLAGS_value=$CPPFLAGS +ac_env_CPP_set=${CPP+set} +ac_env_CPP_value=$CPP +ac_cv_env_CPP_set=${CPP+set} +ac_cv_env_CPP_value=$CPP + +# +# Report the --help message. +# +if test "$ac_init_help" = "long"; then + # Omit some internal or obsolete options to make the list less imposing. + # This message is too long to be a string in the A/UX 3.1 sh. + cat <<_ACEOF +\`configure' configures gnushogi 1.3.2 to adapt to many kinds of systems. + +Usage: $0 [OPTION]... [VAR=VALUE]... + +To assign environment variables (e.g., CC, CFLAGS...), specify them as +VAR=VALUE. See below for descriptions of some of the useful variables. + +Defaults for the options are specified in brackets. + +Configuration: + -h, --help display this help and exit + --help=short display options specific to this package + --help=recursive display the short help of all the included packages + -V, --version display version information and exit + -q, --quiet, --silent do not print \`checking...' messages + --cache-file=FILE cache test results in FILE [disabled] + -C, --config-cache alias for \`--cache-file=config.cache' + -n, --no-create do not create output files + --srcdir=DIR find the sources in DIR [configure dir or \`..'] + +_ACEOF + + cat <<_ACEOF +Installation directories: + --prefix=PREFIX install architecture-independent files in PREFIX + [$ac_default_prefix] + --exec-prefix=EPREFIX install architecture-dependent files in EPREFIX + [PREFIX] + +By default, \`make install' will install all the files in +\`$ac_default_prefix/bin', \`$ac_default_prefix/lib' etc. You can specify +an installation prefix other than \`$ac_default_prefix' using \`--prefix', +for instance \`--prefix=\$HOME'. + +For better control, use the options below. + +Fine tuning of the installation directories: + --bindir=DIR user executables [EPREFIX/bin] + --sbindir=DIR system admin executables [EPREFIX/sbin] + --libexecdir=DIR program executables [EPREFIX/libexec] + --datadir=DIR read-only architecture-independent data [PREFIX/share] + --sysconfdir=DIR read-only single-machine data [PREFIX/etc] + --sharedstatedir=DIR modifiable architecture-independent data [PREFIX/com] + --localstatedir=DIR modifiable single-machine data [PREFIX/var] + --libdir=DIR object code libraries [EPREFIX/lib] + --includedir=DIR C header files [PREFIX/include] + --oldincludedir=DIR C header files for non-gcc [/usr/include] + --infodir=DIR info documentation [PREFIX/info] + --mandir=DIR man documentation [PREFIX/man] +_ACEOF + + cat <<\_ACEOF + +X features: + --x-includes=DIR X include files are in DIR + --x-libraries=DIR X library files are in DIR +_ACEOF +fi + +if test -n "$ac_init_help"; then + case $ac_init_help in + short | recursive ) echo "Configuration of gnushogi 1.3.2:";; + esac + cat <<\_ACEOF + +Optional Packages: + --with-PACKAGE[=ARG] use PACKAGE [ARG=yes] + --without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no) + --with-x use the X Window System + --with-top-part-bitmaps Use top part of Kanji bitmaps only. + --with-first-shogi-program=PROGNAME + Use PROGNAME as the first shogi program (default: gnushogi) + --with-second-shogi-program=PROGNAME + Use PROGNAME as the second shogi program (default: gnushogi) + --with-first-host=HOSTNAME + Use HOSTNAME as the machine on which the first shogi program + runs (default: localhost) + --with-second-host=HOSTNAME + Use HOSTNAME as the machine on which the second shogi program + runs (default: localhost) + --with-xshogi + Compile the xshogi graphical interface to GNU shogi (default: yes) + +Some influential environment variables: + CC C compiler command + CFLAGS C compiler flags + LDFLAGS linker flags, e.g. -L if you have libraries in a + nonstandard directory + CPPFLAGS C/C++ preprocessor flags, e.g. -I if you have + headers in a nonstandard directory + CPP C preprocessor + +Use these variables to override the choices made by `configure' or to help +it to find libraries and programs with nonstandard names/locations. + +Report bugs to . +_ACEOF +fi + +if test "$ac_init_help" = "recursive"; then + # If there are subdirs, report their specific --help. + ac_popdir=`pwd` + for ac_dir in : $ac_subdirs_all; do test "x$ac_dir" = x: && continue + test -d $ac_dir || continue + ac_builddir=. + +if test "$ac_dir" != .; then + ac_dir_suffix=/`echo "$ac_dir" | sed 's,^\.[\\/],,'` + # A "../" for each directory in $ac_dir_suffix. + ac_top_builddir=`echo "$ac_dir_suffix" | sed 's,/[^\\/]*,../,g'` +else + ac_dir_suffix= ac_top_builddir= +fi + +case $srcdir in + .) # No --srcdir option. We are building in place. + ac_srcdir=. + if test -z "$ac_top_builddir"; then + ac_top_srcdir=. + else + ac_top_srcdir=`echo $ac_top_builddir | sed 's,/$,,'` + fi ;; + [\\/]* | ?:[\\/]* ) # Absolute path. + ac_srcdir=$srcdir$ac_dir_suffix; + ac_top_srcdir=$srcdir ;; + *) # Relative path. + ac_srcdir=$ac_top_builddir$srcdir$ac_dir_suffix + ac_top_srcdir=$ac_top_builddir$srcdir ;; +esac +# Don't blindly perform a `cd "$ac_dir"/$ac_foo && pwd` since $ac_foo can be +# absolute. +ac_abs_builddir=`cd "$ac_dir" && cd $ac_builddir && pwd` +ac_abs_top_builddir=`cd "$ac_dir" && cd ${ac_top_builddir}. && pwd` +ac_abs_srcdir=`cd "$ac_dir" && cd $ac_srcdir && pwd` +ac_abs_top_srcdir=`cd "$ac_dir" && cd $ac_top_srcdir && pwd` + + cd $ac_dir + # Check for guested configure; otherwise get Cygnus style configure. + if test -f $ac_srcdir/configure.gnu; then + echo + $SHELL $ac_srcdir/configure.gnu --help=recursive + elif test -f $ac_srcdir/configure; then + echo + $SHELL $ac_srcdir/configure --help=recursive + elif test -f $ac_srcdir/configure.ac || + test -f $ac_srcdir/configure.in; then + echo + $ac_configure --help + else + echo "$as_me: WARNING: no configuration information is in $ac_dir" >&2 + fi + cd $ac_popdir + done +fi + +test -n "$ac_init_help" && exit 0 +if $ac_init_version; then + cat <<\_ACEOF +gnushogi configure 1.3.2 +generated by GNU Autoconf 2.57 + +Copyright 1992, 1993, 1994, 1995, 1996, 1998, 1999, 2000, 2001, 2002 +Free Software Foundation, Inc. +This configure script is free software; the Free Software Foundation +gives unlimited permission to copy, distribute and modify it. +_ACEOF + exit 0 +fi +exec 5>config.log +cat >&5 <<_ACEOF +This file contains any messages produced by compilers while +running configure, to aid debugging if configure makes a mistake. + +It was created by gnushogi $as_me 1.3.2, which was +generated by GNU Autoconf 2.57. Invocation command line was + + $ $0 $@ + +_ACEOF +{ +cat <<_ASUNAME +## --------- ## +## Platform. ## +## --------- ## + +hostname = `(hostname || uname -n) 2>/dev/null | sed 1q` +uname -m = `(uname -m) 2>/dev/null || echo unknown` +uname -r = `(uname -r) 2>/dev/null || echo unknown` +uname -s = `(uname -s) 2>/dev/null || echo unknown` +uname -v = `(uname -v) 2>/dev/null || echo unknown` + +/usr/bin/uname -p = `(/usr/bin/uname -p) 2>/dev/null || echo unknown` +/bin/uname -X = `(/bin/uname -X) 2>/dev/null || echo unknown` + +/bin/arch = `(/bin/arch) 2>/dev/null || echo unknown` +/usr/bin/arch -k = `(/usr/bin/arch -k) 2>/dev/null || echo unknown` +/usr/convex/getsysinfo = `(/usr/convex/getsysinfo) 2>/dev/null || echo unknown` +hostinfo = `(hostinfo) 2>/dev/null || echo unknown` +/bin/machine = `(/bin/machine) 2>/dev/null || echo unknown` +/usr/bin/oslevel = `(/usr/bin/oslevel) 2>/dev/null || echo unknown` +/bin/universe = `(/bin/universe) 2>/dev/null || echo unknown` + +_ASUNAME + +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + echo "PATH: $as_dir" +done + +} >&5 + +cat >&5 <<_ACEOF + + +## ----------- ## +## Core tests. ## +## ----------- ## + +_ACEOF + +# Keep a trace of the command line. +# Strip out --no-create and --no-recursion so they do not pile up. +# Strip out --silent because we don't want to record it for future runs. +# Also quote any args containing shell meta-characters. +# Make two passes to allow for proper duplicate-argument suppression. +ac_configure_args= +ac_configure_args0= +ac_configure_args1= +ac_sep= +ac_must_keep_next=false +for ac_pass in 1 2 +do + for ac_arg + do + case $ac_arg in + -no-create | --no-c* | -n | -no-recursion | --no-r*) continue ;; + -q | -quiet | --quiet | --quie | --qui | --qu | --q \ + | -silent | --silent | --silen | --sile | --sil) + continue ;; + *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?\"\']*) + ac_arg=`echo "$ac_arg" | sed "s/'/'\\\\\\\\''/g"` ;; + esac + case $ac_pass in + 1) ac_configure_args0="$ac_configure_args0 '$ac_arg'" ;; + 2) + ac_configure_args1="$ac_configure_args1 '$ac_arg'" + if test $ac_must_keep_next = true; then + ac_must_keep_next=false # Got value, back to normal. + else + case $ac_arg in + *=* | --config-cache | -C | -disable-* | --disable-* \ + | -enable-* | --enable-* | -gas | --g* | -nfp | --nf* \ + | -q | -quiet | --q* | -silent | --sil* | -v | -verb* \ + | -with-* | --with-* | -without-* | --without-* | --x) + case "$ac_configure_args0 " in + "$ac_configure_args1"*" '$ac_arg' "* ) continue ;; + esac + ;; + -* ) ac_must_keep_next=true ;; + esac + fi + ac_configure_args="$ac_configure_args$ac_sep'$ac_arg'" + # Get rid of the leading space. + ac_sep=" " + ;; + esac + done +done +$as_unset ac_configure_args0 || test "${ac_configure_args0+set}" != set || { ac_configure_args0=; export ac_configure_args0; } +$as_unset ac_configure_args1 || test "${ac_configure_args1+set}" != set || { ac_configure_args1=; export ac_configure_args1; } + +# When interrupted or exit'd, cleanup temporary files, and complete +# config.log. We remove comments because anyway the quotes in there +# would cause problems or look ugly. +# WARNING: Be sure not to use single quotes in there, as some shells, +# such as our DU 5.0 friend, will then `close' the trap. +trap 'exit_status=$? + # Save into config.log some information that might help in debugging. + { + echo + + cat <<\_ASBOX +## ---------------- ## +## Cache variables. ## +## ---------------- ## +_ASBOX + echo + # The following way of writing the cache mishandles newlines in values, +{ + (set) 2>&1 | + case `(ac_space='"'"' '"'"'; set | grep ac_space) 2>&1` in + *ac_space=\ *) + sed -n \ + "s/'"'"'/'"'"'\\\\'"'"''"'"'/g; + s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='"'"'\\2'"'"'/p" + ;; + *) + sed -n \ + "s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1=\\2/p" + ;; + esac; +} + echo + + cat <<\_ASBOX +## ----------------- ## +## Output variables. ## +## ----------------- ## +_ASBOX + echo + for ac_var in $ac_subst_vars + do + eval ac_val=$`echo $ac_var` + echo "$ac_var='"'"'$ac_val'"'"'" + done | sort + echo + + if test -n "$ac_subst_files"; then + cat <<\_ASBOX +## ------------- ## +## Output files. ## +## ------------- ## +_ASBOX + echo + for ac_var in $ac_subst_files + do + eval ac_val=$`echo $ac_var` + echo "$ac_var='"'"'$ac_val'"'"'" + done | sort + echo + fi + + if test -s confdefs.h; then + cat <<\_ASBOX +## ----------- ## +## confdefs.h. ## +## ----------- ## +_ASBOX + echo + sed "/^$/d" confdefs.h | sort + echo + fi + test "$ac_signal" != 0 && + echo "$as_me: caught signal $ac_signal" + echo "$as_me: exit $exit_status" + } >&5 + rm -f core core.* *.core && + rm -rf conftest* confdefs* conf$$* $ac_clean_files && + exit $exit_status + ' 0 +for ac_signal in 1 2 13 15; do + trap 'ac_signal='$ac_signal'; { (exit 1); exit 1; }' $ac_signal +done +ac_signal=0 + +# confdefs.h avoids OS command line length limits that DEFS can exceed. +rm -rf conftest* confdefs.h +# AIX cpp loses on an empty file, so make sure it contains at least a newline. +echo >confdefs.h + +# Predefined preprocessor variables. + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_NAME "$PACKAGE_NAME" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_TARNAME "$PACKAGE_TARNAME" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_VERSION "$PACKAGE_VERSION" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_STRING "$PACKAGE_STRING" +_ACEOF + + +cat >>confdefs.h <<_ACEOF +#define PACKAGE_BUGREPORT "$PACKAGE_BUGREPORT" +_ACEOF + + +# Let the site file select an alternate cache file if it wants to. # Prefer explicitly selected file to automatically selected ones. if test -z "$CONFIG_SITE"; then if test "x$prefix" != xNONE; then @@ -507,261 +1181,764 @@ if test -z "$CONFIG_SITE"; then fi for ac_site_file in $CONFIG_SITE; do if test -r "$ac_site_file"; then - echo "loading site script $ac_site_file" + { echo "$as_me:$LINENO: loading site script $ac_site_file" >&5 +echo "$as_me: loading site script $ac_site_file" >&6;} + sed 's/^/| /' "$ac_site_file" >&5 . "$ac_site_file" fi done if test -r "$cache_file"; then - echo "loading cache $cache_file" - . $cache_file + # Some versions of bash will fail to source /dev/null (special + # files actually), so we avoid doing that. + if test -f "$cache_file"; then + { echo "$as_me:$LINENO: loading cache $cache_file" >&5 +echo "$as_me: loading cache $cache_file" >&6;} + case $cache_file in + [\\/]* | ?:[\\/]* ) . $cache_file;; + *) . ./$cache_file;; + esac + fi else - echo "creating cache $cache_file" - > $cache_file + { echo "$as_me:$LINENO: creating cache $cache_file" >&5 +echo "$as_me: creating cache $cache_file" >&6;} + >$cache_file +fi + +# Check that the precious variables saved in the cache have kept the same +# value. +ac_cache_corrupted=false +for ac_var in `(set) 2>&1 | + sed -n 's/^ac_env_\([a-zA-Z_0-9]*\)_set=.*/\1/p'`; do + eval ac_old_set=\$ac_cv_env_${ac_var}_set + eval ac_new_set=\$ac_env_${ac_var}_set + eval ac_old_val="\$ac_cv_env_${ac_var}_value" + eval ac_new_val="\$ac_env_${ac_var}_value" + case $ac_old_set,$ac_new_set in + set,) + { echo "$as_me:$LINENO: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&5 +echo "$as_me: error: \`$ac_var' was set to \`$ac_old_val' in the previous run" >&2;} + ac_cache_corrupted=: ;; + ,set) + { echo "$as_me:$LINENO: error: \`$ac_var' was not set in the previous run" >&5 +echo "$as_me: error: \`$ac_var' was not set in the previous run" >&2;} + ac_cache_corrupted=: ;; + ,);; + *) + if test "x$ac_old_val" != "x$ac_new_val"; then + { echo "$as_me:$LINENO: error: \`$ac_var' has changed since the previous run:" >&5 +echo "$as_me: error: \`$ac_var' has changed since the previous run:" >&2;} + { echo "$as_me:$LINENO: former value: $ac_old_val" >&5 +echo "$as_me: former value: $ac_old_val" >&2;} + { echo "$as_me:$LINENO: current value: $ac_new_val" >&5 +echo "$as_me: current value: $ac_new_val" >&2;} + ac_cache_corrupted=: + fi;; + esac + # Pass precious variables to config.status. + if test "$ac_new_set" = set; then + case $ac_new_val in + *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?\"\']*) + ac_arg=$ac_var=`echo "$ac_new_val" | sed "s/'/'\\\\\\\\''/g"` ;; + *) ac_arg=$ac_var=$ac_new_val ;; + esac + case " $ac_configure_args " in + *" '$ac_arg' "*) ;; # Avoid dups. Use of quotes ensures accuracy. + *) ac_configure_args="$ac_configure_args '$ac_arg'" ;; + esac + fi +done +if $ac_cache_corrupted; then + { echo "$as_me:$LINENO: error: changes in the environment can compromise the build" >&5 +echo "$as_me: error: changes in the environment can compromise the build" >&2;} + { { echo "$as_me:$LINENO: error: run \`make distclean' and/or \`rm $cache_file' and start over" >&5 +echo "$as_me: error: run \`make distclean' and/or \`rm $cache_file' and start over" >&2;} + { (exit 1); exit 1; }; } fi ac_ext=c -# CFLAGS is not in ac_cpp because -g, -O, etc. are not valid cpp options. ac_cpp='$CPP $CPPFLAGS' -ac_compile='${CC-cc} -c $CFLAGS $CPPFLAGS conftest.$ac_ext 1>&5' -ac_link='${CC-cc} -o conftest${ac_exeext} $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS 1>&5' -cross_compiling=$ac_cv_prog_cc_cross - -ac_exeext= -ac_objext=o -if (echo "testing\c"; echo 1,2,3) | grep c >/dev/null; then - # Stardent Vistra SVR4 grep lacks -e, says ghazi@caip.rutgers.edu. - if (echo -n testing; echo 1,2,3) | sed s/-n/xn/ | grep xn >/dev/null; then - ac_n= ac_c=' -' ac_t=' ' - else - ac_n=-n ac_c= ac_t= - fi -else - ac_n= ac_c='\c' ac_t= -fi +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + + + + + + + + + + + + + + + + + + + + + + + ac_config_headers="$ac_config_headers config.h" + + + # # Check for C compiler. # echo -echo $ac_n "checking for C compiler""... $ac_c" 1>&6 -echo "configure:555: checking for C compiler" >&5 +echo "$as_me:$LINENO: checking for C compiler" >&5 +echo $ECHO_N "checking for C compiler... $ECHO_C" >&6 echo -# Extract the first word of "gcc", so it can be a program name with args. +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}gcc", so it can be a program name with args. +set dummy ${ac_tool_prefix}gcc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$CC"; then + ac_cv_prog_CC="$CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="${ac_tool_prefix}gcc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +CC=$ac_cv_prog_CC +if test -n "$CC"; then + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_CC"; then + ac_ct_CC=$CC + # Extract the first word of "gcc", so it can be a program name with args. set dummy gcc; ac_word=$2 -echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:561: checking for $ac_word" >&5 -if eval "test \"`echo '$''{'ac_cv_prog_CC'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="gcc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + + CC=$ac_ct_CC +else + CC="$ac_cv_prog_CC" +fi + +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + # Extract the first word of "${ac_tool_prefix}cc", so it can be a program name with args. +set dummy ${ac_tool_prefix}cc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else if test -n "$CC"; then ac_cv_prog_CC="$CC" # Let the user override the test. else - IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS=":" - ac_dummy="$PATH" - for ac_dir in $ac_dummy; do - test -z "$ac_dir" && ac_dir=. - if test -f $ac_dir/$ac_word; then - ac_cv_prog_CC="gcc" - break - fi - done - IFS="$ac_save_ifs" +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="${ac_tool_prefix}cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + fi fi -CC="$ac_cv_prog_CC" +CC=$ac_cv_prog_CC if test -n "$CC"; then - echo "$ac_t""$CC" 1>&6 + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +fi +if test -z "$ac_cv_prog_CC"; then + ac_ct_CC=$CC + # Extract the first word of "cc", so it can be a program name with args. +set dummy cc; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. +else +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + +fi +fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6 else - echo "$ac_t""no" 1>&6 + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 fi + CC=$ac_ct_CC +else + CC="$ac_cv_prog_CC" +fi + +fi if test -z "$CC"; then # Extract the first word of "cc", so it can be a program name with args. set dummy cc; ac_word=$2 -echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:591: checking for $ac_word" >&5 -if eval "test \"`echo '$''{'ac_cv_prog_CC'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else if test -n "$CC"; then ac_cv_prog_CC="$CC" # Let the user override the test. else - IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS=":" ac_prog_rejected=no - ac_dummy="$PATH" - for ac_dir in $ac_dummy; do - test -z "$ac_dir" && ac_dir=. - if test -f $ac_dir/$ac_word; then - if test "$ac_dir/$ac_word" = "/usr/ucb/cc"; then - ac_prog_rejected=yes - continue - fi - ac_cv_prog_CC="cc" - break - fi - done - IFS="$ac_save_ifs" +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + if test "$as_dir/$ac_word$ac_exec_ext" = "/usr/ucb/cc"; then + ac_prog_rejected=yes + continue + fi + ac_cv_prog_CC="cc" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + if test $ac_prog_rejected = yes; then # We found a bogon in the path, so make sure we never use it. set dummy $ac_cv_prog_CC shift - if test $# -gt 0; then + if test $# != 0; then # We chose a different compiler from the bogus one. # However, it has the same basename, so the bogon will be chosen # first if we set CC to just the basename; use the full file name. shift - set dummy "$ac_dir/$ac_word" "$@" - shift - ac_cv_prog_CC="$@" + ac_cv_prog_CC="$as_dir/$ac_word${1+' '}$@" fi fi fi fi -CC="$ac_cv_prog_CC" +CC=$ac_cv_prog_CC if test -n "$CC"; then - echo "$ac_t""$CC" 1>&6 + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 else - echo "$ac_t""no" 1>&6 + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 fi - if test -z "$CC"; then - case "`uname -s`" in - *win32* | *WIN32*) - # Extract the first word of "cl", so it can be a program name with args. -set dummy cl; ac_word=$2 -echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:642: checking for $ac_word" >&5 -if eval "test \"`echo '$''{'ac_cv_prog_CC'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 +fi +if test -z "$CC"; then + if test -n "$ac_tool_prefix"; then + for ac_prog in cl + do + # Extract the first word of "$ac_tool_prefix$ac_prog", so it can be a program name with args. +set dummy $ac_tool_prefix$ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else if test -n "$CC"; then ac_cv_prog_CC="$CC" # Let the user override the test. else - IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS=":" - ac_dummy="$PATH" - for ac_dir in $ac_dummy; do - test -z "$ac_dir" && ac_dir=. - if test -f $ac_dir/$ac_word; then - ac_cv_prog_CC="cl" - break - fi - done - IFS="$ac_save_ifs" +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_CC="$ac_tool_prefix$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + fi fi -CC="$ac_cv_prog_CC" +CC=$ac_cv_prog_CC if test -n "$CC"; then - echo "$ac_t""$CC" 1>&6 -else - echo "$ac_t""no" 1>&6 -fi - ;; - esac - fi - test -z "$CC" && { echo "configure: error: no acceptable cc found in \$PATH" 1>&2; exit 1; } -fi - -echo $ac_n "checking whether the C compiler ($CC $CFLAGS $LDFLAGS) works""... $ac_c" 1>&6 -echo "configure:674: checking whether the C compiler ($CC $CFLAGS $LDFLAGS) works" >&5 - -ac_ext=c -# CFLAGS is not in ac_cpp because -g, -O, etc. are not valid cpp options. -ac_cpp='$CPP $CPPFLAGS' -ac_compile='${CC-cc} -c $CFLAGS $CPPFLAGS conftest.$ac_ext 1>&5' -ac_link='${CC-cc} -o conftest${ac_exeext} $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS 1>&5' -cross_compiling=$ac_cv_prog_cc_cross - -cat > conftest.$ac_ext << EOF - -#line 685 "configure" -#include "confdefs.h" - -main(){return(0);} -EOF -if { (eval echo configure:690: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - ac_cv_prog_cc_works=yes - # If we can't run a trivial program, we are probably using a cross compiler. - if (./conftest; exit) 2>/dev/null; then - ac_cv_prog_cc_cross=no - else - ac_cv_prog_cc_cross=yes - fi + echo "$as_me:$LINENO: result: $CC" >&5 +echo "${ECHO_T}$CC" >&6 else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - ac_cv_prog_cc_works=no + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 fi -rm -fr conftest* -ac_ext=c -# CFLAGS is not in ac_cpp because -g, -O, etc. are not valid cpp options. -ac_cpp='$CPP $CPPFLAGS' -ac_compile='${CC-cc} -c $CFLAGS $CPPFLAGS conftest.$ac_ext 1>&5' -ac_link='${CC-cc} -o conftest${ac_exeext} $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS 1>&5' -cross_compiling=$ac_cv_prog_cc_cross -echo "$ac_t""$ac_cv_prog_cc_works" 1>&6 -if test $ac_cv_prog_cc_works = no; then - { echo "configure: error: installation or configuration problem: C compiler cannot create executables." 1>&2; exit 1; } + test -n "$CC" && break + done fi -echo $ac_n "checking whether the C compiler ($CC $CFLAGS $LDFLAGS) is a cross-compiler""... $ac_c" 1>&6 -echo "configure:716: checking whether the C compiler ($CC $CFLAGS $LDFLAGS) is a cross-compiler" >&5 -echo "$ac_t""$ac_cv_prog_cc_cross" 1>&6 -cross_compiling=$ac_cv_prog_cc_cross - -echo $ac_n "checking whether we are using GNU C""... $ac_c" 1>&6 -echo "configure:721: checking whether we are using GNU C" >&5 -if eval "test \"`echo '$''{'ac_cv_prog_gcc'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 +if test -z "$CC"; then + ac_ct_CC=$CC + for ac_prog in cl +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_ac_ct_CC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - cat > conftest.c <&5; (eval $ac_try) 2>&5; }; } | egrep yes >/dev/null 2>&1; then - ac_cv_prog_gcc=yes + if test -n "$ac_ct_CC"; then + ac_cv_prog_ac_ct_CC="$ac_ct_CC" # Let the user override the test. else - ac_cv_prog_gcc=no +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_ac_ct_CC="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + fi fi +ac_ct_CC=$ac_cv_prog_ac_ct_CC +if test -n "$ac_ct_CC"; then + echo "$as_me:$LINENO: result: $ac_ct_CC" >&5 +echo "${ECHO_T}$ac_ct_CC" >&6 +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi -echo "$ac_t""$ac_cv_prog_gcc" 1>&6 + test -n "$ac_ct_CC" && break +done + + CC=$ac_ct_CC +fi + +fi + + +test -z "$CC" && { { echo "$as_me:$LINENO: error: no acceptable C compiler found in \$PATH +See \`config.log' for more details." >&5 +echo "$as_me: error: no acceptable C compiler found in \$PATH +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } + +# Provide some information about the compiler. +echo "$as_me:$LINENO:" \ + "checking for C compiler version" >&5 +ac_compiler=`set X $ac_compile; echo $2` +{ (eval echo "$as_me:$LINENO: \"$ac_compiler --version &5\"") >&5 + (eval $ac_compiler --version &5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (eval echo "$as_me:$LINENO: \"$ac_compiler -v &5\"") >&5 + (eval $ac_compiler -v &5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +{ (eval echo "$as_me:$LINENO: \"$ac_compiler -V &5\"") >&5 + (eval $ac_compiler -V &5) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } + +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ -if test $ac_cv_prog_gcc = yes; then - GCC=yes + ; + return 0; +} +_ACEOF +ac_clean_files_save=$ac_clean_files +ac_clean_files="$ac_clean_files a.out a.exe b.out" +# Try to create an executable without -o first, disregard a.out. +# It will help us diagnose broken compilers, and finding out an intuition +# of exeext. +echo "$as_me:$LINENO: checking for C compiler default output" >&5 +echo $ECHO_N "checking for C compiler default output... $ECHO_C" >&6 +ac_link_default=`echo "$ac_link" | sed 's/ -o *conftest[^ ]*//'` +if { (eval echo "$as_me:$LINENO: \"$ac_link_default\"") >&5 + (eval $ac_link_default) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + # Find the output, starting from the most likely. This scheme is +# not robust to junk in `.', hence go to wildcards (a.*) only as a last +# resort. + +# Be careful to initialize this variable, since it used to be cached. +# Otherwise an old cache value of `no' led to `EXEEXT = no' in a Makefile. +ac_cv_exeext= +# b.out is created by i960 compilers. +for ac_file in a_out.exe a.exe conftest.exe a.out conftest a.* conftest.* b.out +do + test -f "$ac_file" || continue + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.o | *.obj ) + ;; + conftest.$ac_ext ) + # This is the source file. + ;; + [ab].out ) + # We found the default executable, but exeext='' is most + # certainly right. + break;; + *.* ) + ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'` + # FIXME: I believe we export ac_cv_exeext for Libtool, + # but it would be cool to find out if it's true. Does anybody + # maintain Libtool? --akim. + export ac_cv_exeext + break;; + * ) + break;; + esac +done else - GCC= + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +{ { echo "$as_me:$LINENO: error: C compiler cannot create executables +See \`config.log' for more details." >&5 +echo "$as_me: error: C compiler cannot create executables +See \`config.log' for more details." >&2;} + { (exit 77); exit 77; }; } +fi + +ac_exeext=$ac_cv_exeext +echo "$as_me:$LINENO: result: $ac_file" >&5 +echo "${ECHO_T}$ac_file" >&6 + +# Check the compiler produces executables we can run. If not, either +# the compiler is broken, or we cross compile. +echo "$as_me:$LINENO: checking whether the C compiler works" >&5 +echo $ECHO_N "checking whether the C compiler works... $ECHO_C" >&6 +# FIXME: These cross compiler hacks should be removed for Autoconf 3.0 +# If not cross compiling, check that we can run a simple program. +if test "$cross_compiling" != yes; then + if { ac_try='./$ac_file' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + cross_compiling=no + else + if test "$cross_compiling" = maybe; then + cross_compiling=yes + else + { { echo "$as_me:$LINENO: error: cannot run C compiled programs. +If you meant to cross compile, use \`--host'. +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot run C compiled programs. +If you meant to cross compile, use \`--host'. +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } + fi + fi fi +echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 + +rm -f a.out a.exe conftest$ac_cv_exeext b.out +ac_clean_files=$ac_clean_files_save +# Check the compiler produces executables we can run. If not, either +# the compiler is broken, or we cross compile. +echo "$as_me:$LINENO: checking whether we are cross compiling" >&5 +echo $ECHO_N "checking whether we are cross compiling... $ECHO_C" >&6 +echo "$as_me:$LINENO: result: $cross_compiling" >&5 +echo "${ECHO_T}$cross_compiling" >&6 + +echo "$as_me:$LINENO: checking for suffix of executables" >&5 +echo $ECHO_N "checking for suffix of executables... $ECHO_C" >&6 +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + # If both `conftest.exe' and `conftest' are `present' (well, observable) +# catch `conftest.exe'. For instance with Cygwin, `ls conftest' will +# work properly (i.e., refer to `conftest.exe'), while it won't with +# `rm'. +for ac_file in conftest.exe conftest conftest.*; do + test -f "$ac_file" || continue + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg | *.o | *.obj ) ;; + *.* ) ac_cv_exeext=`expr "$ac_file" : '[^.]*\(\..*\)'` + export ac_cv_exeext + break;; + * ) break;; + esac +done +else + { { echo "$as_me:$LINENO: error: cannot compute suffix of executables: cannot compile and link +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot compute suffix of executables: cannot compile and link +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi + +rm -f conftest$ac_cv_exeext +echo "$as_me:$LINENO: result: $ac_cv_exeext" >&5 +echo "${ECHO_T}$ac_cv_exeext" >&6 + +rm -f conftest.$ac_ext +EXEEXT=$ac_cv_exeext +ac_exeext=$EXEEXT +echo "$as_me:$LINENO: checking for suffix of object files" >&5 +echo $ECHO_N "checking for suffix of object files... $ECHO_C" >&6 +if test "${ac_cv_objext+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ -ac_test_CFLAGS="${CFLAGS+set}" -ac_save_CFLAGS="$CFLAGS" -CFLAGS= -echo $ac_n "checking whether ${CC-cc} accepts -g""... $ac_c" 1>&6 -echo "configure:749: checking whether ${CC-cc} accepts -g" >&5 -if eval "test \"`echo '$''{'ac_cv_prog_cc_g'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + ; + return 0; +} +_ACEOF +rm -f conftest.o conftest.obj +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; then + for ac_file in `(ls conftest.o conftest.obj; ls conftest.*) 2>/dev/null`; do + case $ac_file in + *.$ac_ext | *.xcoff | *.tds | *.d | *.pdb | *.xSYM | *.bb | *.bbg ) ;; + *) ac_cv_objext=`expr "$ac_file" : '.*\.\(.*\)'` + break;; + esac +done else - echo 'void f(){}' > conftest.c -if test -z "`${CC-cc} -g -c conftest.c 2>&1`"; then + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +{ { echo "$as_me:$LINENO: error: cannot compute suffix of object files: cannot compile +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot compute suffix of object files: cannot compile +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi + +rm -f conftest.$ac_cv_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_objext" >&5 +echo "${ECHO_T}$ac_cv_objext" >&6 +OBJEXT=$ac_cv_objext +ac_objext=$OBJEXT +echo "$as_me:$LINENO: checking whether we are using the GNU C compiler" >&5 +echo $ECHO_N "checking whether we are using the GNU C compiler... $ECHO_C" >&6 +if test "${ac_cv_c_compiler_gnu+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ +#ifndef __GNUC__ + choke me +#endif + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_compiler_gnu=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_compiler_gnu=no +fi +rm -f conftest.$ac_objext conftest.$ac_ext +ac_cv_c_compiler_gnu=$ac_compiler_gnu + +fi +echo "$as_me:$LINENO: result: $ac_cv_c_compiler_gnu" >&5 +echo "${ECHO_T}$ac_cv_c_compiler_gnu" >&6 +GCC=`test $ac_compiler_gnu = yes && echo yes` +ac_test_CFLAGS=${CFLAGS+set} +ac_save_CFLAGS=$CFLAGS +CFLAGS="-g" +echo "$as_me:$LINENO: checking whether $CC accepts -g" >&5 +echo $ECHO_N "checking whether $CC accepts -g... $ECHO_C" >&6 +if test "${ac_cv_prog_cc_g+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then ac_cv_prog_cc_g=yes else - ac_cv_prog_cc_g=no -fi -rm -f conftest* + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 +ac_cv_prog_cc_g=no fi - -echo "$ac_t""$ac_cv_prog_cc_g" 1>&6 +rm -f conftest.$ac_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_prog_cc_g" >&5 +echo "${ECHO_T}$ac_cv_prog_cc_g" >&6 if test "$ac_test_CFLAGS" = set; then - CFLAGS="$ac_save_CFLAGS" + CFLAGS=$ac_save_CFLAGS elif test $ac_cv_prog_cc_g = yes; then if test "$GCC" = yes; then CFLAGS="-g -O2" @@ -775,6 +1952,223 @@ else CFLAGS= fi fi +echo "$as_me:$LINENO: checking for $CC option to accept ANSI C" >&5 +echo $ECHO_N "checking for $CC option to accept ANSI C... $ECHO_C" >&6 +if test "${ac_cv_prog_cc_stdc+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_prog_cc_stdc=no +ac_save_CC=$CC +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +#include +#include +#include +/* Most of the following tests are stolen from RCS 5.7's src/conf.sh. */ +struct buf { int x; }; +FILE * (*rcsopen) (struct buf *, struct stat *, int); +static char *e (p, i) + char **p; + int i; +{ + return p[i]; +} +static char *f (char * (*g) (char **, int), char **p, ...) +{ + char *s; + va_list v; + va_start (v,p); + s = g (p, va_arg (v,int)); + va_end (v); + return s; +} +int test (int i, double x); +struct s1 {int (*f) (int a);}; +struct s2 {int (*f) (double a);}; +int pairnames (int, char **, FILE *(*)(struct buf *, struct stat *, int), int, int); +int argc; +char **argv; +int +main () +{ +return f (e, argv, 0) != argv[0] || f (e, argv, 1) != argv[1]; + ; + return 0; +} +_ACEOF +# Don't try gcc -ansi; that turns off useful extensions and +# breaks some systems' header files. +# AIX -qlanglvl=ansi +# Ultrix and OSF/1 -std1 +# HP-UX 10.20 and later -Ae +# HP-UX older versions -Aa -D_HPUX_SOURCE +# SVR4 -Xc -D__EXTENSIONS__ +for ac_arg in "" -qlanglvl=ansi -std1 -Ae "-Aa -D_HPUX_SOURCE" "-Xc -D__EXTENSIONS__" +do + CC="$ac_save_CC $ac_arg" + rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_prog_cc_stdc=$ac_arg +break +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.$ac_objext +done +rm -f conftest.$ac_ext conftest.$ac_objext +CC=$ac_save_CC + +fi + +case "x$ac_cv_prog_cc_stdc" in + x|xno) + echo "$as_me:$LINENO: result: none needed" >&5 +echo "${ECHO_T}none needed" >&6 ;; + *) + echo "$as_me:$LINENO: result: $ac_cv_prog_cc_stdc" >&5 +echo "${ECHO_T}$ac_cv_prog_cc_stdc" >&6 + CC="$CC $ac_cv_prog_cc_stdc" ;; +esac + +# Some people use a C++ compiler to compile C. Since we use `exit', +# in C++ we need to declare it. In case someone uses the same compiler +# for both compiling C and C++ we need to have the C++ compiler decide +# the declaration of exit, since it's the most demanding environment. +cat >conftest.$ac_ext <<_ACEOF +#ifndef __cplusplus + choke me +#endif +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + for ac_declaration in \ + ''\ + '#include ' \ + 'extern "C" void std::exit (int) throw (); using std::exit;' \ + 'extern "C" void std::exit (int); using std::exit;' \ + 'extern "C" void exit (int) throw ();' \ + 'extern "C" void exit (int);' \ + 'void exit (int);' +do + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +$ac_declaration +int +main () +{ +exit (42); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +continue +fi +rm -f conftest.$ac_objext conftest.$ac_ext + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_declaration +int +main () +{ +exit (42); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + break +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.$ac_objext conftest.$ac_ext +done +rm -f conftest* +if test -n "$ac_declaration"; then + echo '#ifdef __cplusplus' >>confdefs.h + echo $ac_declaration >>confdefs.h + echo '#endif' >>confdefs.h +fi + +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.$ac_objext conftest.$ac_ext +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu @@ -783,123 +2177,295 @@ fi # echo -echo $ac_n "checking for yacc/bison, lex/flex, and install""... $ac_c" 1>&6 -echo "configure:788: checking for yacc/bison, lex/flex, and install" >&5 +echo "$as_me:$LINENO: checking for yacc/bison, lex/flex, and install" >&5 +echo $ECHO_N "checking for yacc/bison, lex/flex, and install... $ECHO_C" >&6 echo for ac_prog in 'bison -y' byacc do -# Extract the first word of "$ac_prog", so it can be a program name with args. + # Extract the first word of "$ac_prog", so it can be a program name with args. set dummy $ac_prog; ac_word=$2 -echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:796: checking for $ac_word" >&5 -if eval "test \"`echo '$''{'ac_cv_prog_YACC'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_YACC+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else if test -n "$YACC"; then ac_cv_prog_YACC="$YACC" # Let the user override the test. else - IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS=":" - ac_dummy="$PATH" - for ac_dir in $ac_dummy; do - test -z "$ac_dir" && ac_dir=. - if test -f $ac_dir/$ac_word; then - ac_cv_prog_YACC="$ac_prog" - break - fi - done - IFS="$ac_save_ifs" +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_YACC="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + fi fi -YACC="$ac_cv_prog_YACC" +YACC=$ac_cv_prog_YACC if test -n "$YACC"; then - echo "$ac_t""$YACC" 1>&6 + echo "$as_me:$LINENO: result: $YACC" >&5 +echo "${ECHO_T}$YACC" >&6 else - echo "$ac_t""no" 1>&6 + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 fi -test -n "$YACC" && break + test -n "$YACC" && break done test -n "$YACC" || YACC="yacc" -# Extract the first word of "flex", so it can be a program name with args. -set dummy flex; ac_word=$2 -echo $ac_n "checking for $ac_word""... $ac_c" 1>&6 -echo "configure:829: checking for $ac_word" >&5 -if eval "test \"`echo '$''{'ac_cv_prog_LEX'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + +for ac_prog in flex lex +do + # Extract the first word of "$ac_prog", so it can be a program name with args. +set dummy $ac_prog; ac_word=$2 +echo "$as_me:$LINENO: checking for $ac_word" >&5 +echo $ECHO_N "checking for $ac_word... $ECHO_C" >&6 +if test "${ac_cv_prog_LEX+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else if test -n "$LEX"; then ac_cv_prog_LEX="$LEX" # Let the user override the test. else - IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS=":" - ac_dummy="$PATH" - for ac_dir in $ac_dummy; do - test -z "$ac_dir" && ac_dir=. - if test -f $ac_dir/$ac_word; then - ac_cv_prog_LEX="flex" - break - fi - done - IFS="$ac_save_ifs" - test -z "$ac_cv_prog_LEX" && ac_cv_prog_LEX="lex" +as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_word$ac_exec_ext"; then + ac_cv_prog_LEX="$ac_prog" + echo "$as_me:$LINENO: found $as_dir/$ac_word$ac_exec_ext" >&5 + break 2 + fi +done +done + fi fi -LEX="$ac_cv_prog_LEX" +LEX=$ac_cv_prog_LEX if test -n "$LEX"; then - echo "$ac_t""$LEX" 1>&6 + echo "$as_me:$LINENO: result: $LEX" >&5 +echo "${ECHO_T}$LEX" >&6 else - echo "$ac_t""no" 1>&6 + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 fi + test -n "$LEX" && break +done +test -n "$LEX" || LEX=":" + if test -z "$LEXLIB" then - case "$LEX" in - flex*) ac_lib=fl ;; - *) ac_lib=l ;; - esac - echo $ac_n "checking for yywrap in -l$ac_lib""... $ac_c" 1>&6 -echo "configure:863: checking for yywrap in -l$ac_lib" >&5 -ac_lib_var=`echo $ac_lib'_'yywrap | sed 'y%./+-%__p_%'` -if eval "test \"`echo '$''{'ac_cv_lib_$ac_lib_var'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - ac_save_LIBS="$LIBS" -LIBS="-l$ac_lib $LIBS" -cat > conftest.$ac_ext <&5 +echo $ECHO_N "checking for yywrap in -lfl... $ECHO_C" >&6 +if test "${ac_cv_lib_fl_yywrap+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-lfl $LIBS" +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char yywrap(); - -int main() { -yywrap() -; return 0; } -EOF -if { (eval echo configure:882: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=no" -fi -rm -f conftest* -LIBS="$ac_save_LIBS" + builtin and then its argument prototype would still apply. */ +char yywrap (); +int +main () +{ +yywrap (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_fl_yywrap=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_fl_yywrap=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_fl_yywrap" >&5 +echo "${ECHO_T}$ac_cv_lib_fl_yywrap" >&6 +if test $ac_cv_lib_fl_yywrap = yes; then + LEXLIB="-lfl" +else + echo "$as_me:$LINENO: checking for yywrap in -ll" >&5 +echo $ECHO_N "checking for yywrap in -ll... $ECHO_C" >&6 +if test "${ac_cv_lib_l_yywrap+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS +LIBS="-ll $LIBS" +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ -fi -if eval "test \"`echo '$ac_cv_lib_'$ac_lib_var`\" = yes"; then - echo "$ac_t""yes" 1>&6 - LEXLIB="-l$ac_lib" -else - echo "$ac_t""no" 1>&6 -fi +/* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif +/* We use char because int might match the return type of a gcc2 + builtin and then its argument prototype would still apply. */ +char yywrap (); +int +main () +{ +yywrap (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_l_yywrap=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_l_yywrap=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_l_yywrap" >&5 +echo "${ECHO_T}$ac_cv_lib_l_yywrap" >&6 +if test $ac_cv_lib_l_yywrap = yes; then + LEXLIB="-ll" +fi + +fi + +fi + +if test "x$LEX" != "x:"; then + echo "$as_me:$LINENO: checking lex output file root" >&5 +echo $ECHO_N "checking lex output file root... $ECHO_C" >&6 +if test "${ac_cv_prog_lex_root+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # The minimal lex program is just a single line: %%. But some broken lexes +# (Solaris, I think it was) want two %% lines, so accommodate them. +cat >conftest.l <<_ACEOF +%% +%% +_ACEOF +{ (eval echo "$as_me:$LINENO: \"$LEX conftest.l\"") >&5 + (eval $LEX conftest.l) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } +if test -f lex.yy.c; then + ac_cv_prog_lex_root=lex.yy +elif test -f lexyy.c; then + ac_cv_prog_lex_root=lexyy +else + { { echo "$as_me:$LINENO: error: cannot find output from $LEX; giving up" >&5 +echo "$as_me: error: cannot find output from $LEX; giving up" >&2;} + { (exit 1); exit 1; }; } +fi +fi +echo "$as_me:$LINENO: result: $ac_cv_prog_lex_root" >&5 +echo "${ECHO_T}$ac_cv_prog_lex_root" >&6 +rm -f conftest.l +LEX_OUTPUT_ROOT=$ac_cv_prog_lex_root + +echo "$as_me:$LINENO: checking whether yytext is a pointer" >&5 +echo $ECHO_N "checking whether yytext is a pointer... $ECHO_C" >&6 +if test "${ac_cv_prog_lex_yytext_pointer+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # POSIX says lex can declare yytext either as a pointer or an array; the +# default is implementation-dependent. Figure out which it is, since +# not all implementations provide the %pointer and %array declarations. +ac_cv_prog_lex_yytext_pointer=no +echo 'extern char *yytext;' >>$LEX_OUTPUT_ROOT.c +ac_save_LIBS=$LIBS +LIBS="$LIBS $LEXLIB" +cat >conftest.$ac_ext <<_ACEOF +`cat $LEX_OUTPUT_ROOT.c` +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_prog_lex_yytext_pointer=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_save_LIBS +rm -f "${LEX_OUTPUT_ROOT}.c" + +fi +echo "$as_me:$LINENO: result: $ac_cv_prog_lex_yytext_pointer" >&5 +echo "${ECHO_T}$ac_cv_prog_lex_yytext_pointer" >&6 +if test $ac_cv_prog_lex_yytext_pointer = yes; then + +cat >>confdefs.h <<\_ACEOF +#define YYTEXT_POINTER 1 +_ACEOF fi +fi ac_aux_dir= for ac_dir in $srcdir $srcdir/.. $srcdir/../..; do if test -f $ac_dir/install-sh; then @@ -910,14 +2476,20 @@ for ac_dir in $srcdir $srcdir/.. $srcdir/../..; do ac_aux_dir=$ac_dir ac_install_sh="$ac_aux_dir/install.sh -c" break + elif test -f $ac_dir/shtool; then + ac_aux_dir=$ac_dir + ac_install_sh="$ac_aux_dir/shtool install -c" + break fi done if test -z "$ac_aux_dir"; then - { echo "configure: error: can not find install-sh or install.sh in $srcdir $srcdir/.. $srcdir/../.." 1>&2; exit 1; } + { { echo "$as_me:$LINENO: error: cannot find install-sh or install.sh in $srcdir $srcdir/.. $srcdir/../.." >&5 +echo "$as_me: error: cannot find install-sh or install.sh in $srcdir $srcdir/.. $srcdir/../.." >&2;} + { (exit 1); exit 1; }; } fi -ac_config_guess=$ac_aux_dir/config.guess -ac_config_sub=$ac_aux_dir/config.sub -ac_configure=$ac_aux_dir/configure # This should be Cygnus configure. +ac_config_guess="$SHELL $ac_aux_dir/config.guess" +ac_config_sub="$SHELL $ac_aux_dir/config.sub" +ac_configure="$SHELL $ac_aux_dir/configure" # This should be Cygnus configure. # Find a good install program. We prefer a C program (faster), # so one script is as good as another. But avoid the broken or @@ -926,60 +2498,73 @@ ac_configure=$ac_aux_dir/configure # This should be Cygnus configure. # SunOS /usr/etc/install # IRIX /sbin/install # AIX /bin/install +# AmigaOS /C/install, which installs bootblocks on floppy discs # AIX 4 /usr/bin/installbsd, which doesn't work without a -g flag # AFS /usr/afsws/bin/install, which mishandles nonexistent args # SVR4 /usr/ucb/install, which tries to use the nonexistent group "staff" # ./install, which can be erroneously created by make from ./install.sh. -echo $ac_n "checking for a BSD compatible install""... $ac_c" 1>&6 -echo "configure:935: checking for a BSD compatible install" >&5 +echo "$as_me:$LINENO: checking for a BSD-compatible install" >&5 +echo $ECHO_N "checking for a BSD-compatible install... $ECHO_C" >&6 if test -z "$INSTALL"; then -if eval "test \"`echo '$''{'ac_cv_path_install'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - IFS="${IFS= }"; ac_save_IFS="$IFS"; IFS=":" - for ac_dir in $PATH; do - # Account for people who put trailing slashes in PATH elements. - case "$ac_dir/" in - /|./|.//|/etc/*|/usr/sbin/*|/usr/etc/*|/sbin/*|/usr/afsws/bin/*|/usr/ucb/*) ;; - *) - # OSF1 and SCO ODT 3.0 have their own names for install. - # Don't use installbsd from OSF since it installs stuff as root - # by default. - for ac_prog in ginstall scoinst install; do - if test -f $ac_dir/$ac_prog; then - if test $ac_prog = install && - grep dspmsg $ac_dir/$ac_prog >/dev/null 2>&1; then - # AIX install. It has an incompatible calling convention. - : - else - ac_cv_path_install="$ac_dir/$ac_prog -c" - break 2 - fi - fi +if test "${ac_cv_path_install+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + # Account for people who put trailing slashes in PATH elements. +case $as_dir/ in + ./ | .// | /cC/* | \ + /etc/* | /usr/sbin/* | /usr/etc/* | /sbin/* | /usr/afsws/bin/* | \ + /usr/ucb/* ) ;; + *) + # OSF1 and SCO ODT 3.0 have their own names for install. + # Don't use installbsd from OSF since it installs stuff as root + # by default. + for ac_prog in ginstall scoinst install; do + for ac_exec_ext in '' $ac_executable_extensions; do + if $as_executable_p "$as_dir/$ac_prog$ac_exec_ext"; then + if test $ac_prog = install && + grep dspmsg "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then + # AIX install. It has an incompatible calling convention. + : + elif test $ac_prog = install && + grep pwplus "$as_dir/$ac_prog$ac_exec_ext" >/dev/null 2>&1; then + # program-specific install script used by HP pwplus--don't use. + : + else + ac_cv_path_install="$as_dir/$ac_prog$ac_exec_ext -c" + break 3 + fi + fi done - ;; - esac - done - IFS="$ac_save_IFS" + done + ;; +esac +done + fi if test "${ac_cv_path_install+set}" = set; then - INSTALL="$ac_cv_path_install" + INSTALL=$ac_cv_path_install else # As a last resort, use the slow shell script. We don't cache a # path for INSTALL within a source directory, because that will # break other packages using the cache if that directory is # removed, or if the path is relative. - INSTALL="$ac_install_sh" + INSTALL=$ac_install_sh fi fi -echo "$ac_t""$INSTALL" 1>&6 +echo "$as_me:$LINENO: result: $INSTALL" >&5 +echo "${ECHO_T}$INSTALL" >&6 # Use test -z because SunOS4 sh mishandles braces in ${var-val}. # It thinks the first close brace ends the variable substitution. test -z "$INSTALL_PROGRAM" && INSTALL_PROGRAM='${INSTALL}' -test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL_PROGRAM}' +test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL}' test -z "$INSTALL_DATA" && INSTALL_DATA='${INSTALL} -m 644' @@ -990,99 +2575,250 @@ test -z "$INSTALL_DATA" && INSTALL_DATA='${INSTALL} -m 644' # echo -echo $ac_n "checking how to run the C preprocessor""... $ac_c" 1>&6 -echo "configure:995: checking how to run the C preprocessor" >&5 +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu +echo "$as_me:$LINENO: checking how to run the C preprocessor" >&5 +echo $ECHO_N "checking how to run the C preprocessor... $ECHO_C" >&6 # On Suns, sometimes $CPP names a directory. if test -n "$CPP" && test -d "$CPP"; then CPP= fi if test -z "$CPP"; then -if eval "test \"`echo '$''{'ac_cv_prog_CPP'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - # This must be in double quotes, not single quotes, because CPP may get - # substituted into the Makefile and "${CC-cc}" will confuse make. - CPP="${CC-cc} -E" + if test "${ac_cv_prog_CPP+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + # Double quotes because CPP needs to be expanded + for CPP in "$CC -E" "$CC -E -traditional-cpp" "/lib/cpp" + do + ac_preproc_ok=false +for ac_c_preproc_warn_flag in '' yes +do + # Use a header file that comes with gcc, so configuring glibc + # with a fresh cross-compiler works. + # Prefer to if __STDC__ is defined, since + # exists even on freestanding compilers. # On the NeXT, cc -E runs the code through the compiler's parser, - # not just through cpp. - cat > conftest.$ac_ext < -Syntax Error -EOF -ac_try="$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out" -{ (eval echo configure:1016: \"$ac_try\") 1>&5; (eval $ac_try) 2>&5; } -ac_err=`grep -v '^ *+' conftest.out | grep -v "^conftest.${ac_ext}\$"` -if test -z "$ac_err"; then - : + # not just through cpp. "Syntax error" is here to catch this case. + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#ifdef __STDC__ +# include +#else +# include +#endif + Syntax error +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + else + ac_cpp_err= + fi else - echo "$ac_err" >&5 - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - CPP="${CC-cc} -E -traditional-cpp" - cat > conftest.$ac_ext < -Syntax Error -EOF -ac_try="$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out" -{ (eval echo configure:1033: \"$ac_try\") 1>&5; (eval $ac_try) 2>&5; } -ac_err=`grep -v '^ *+' conftest.out | grep -v "^conftest.${ac_ext}\$"` -if test -z "$ac_err"; then + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then : else - echo "$ac_err" >&5 - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - CPP="${CC-cc} -nologo -E" - cat > conftest.$ac_ext < -Syntax Error -EOF -ac_try="$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out" -{ (eval echo configure:1050: \"$ac_try\") 1>&5; (eval $ac_try) 2>&5; } -ac_err=`grep -v '^ *+' conftest.out | grep -v "^conftest.${ac_ext}\$"` -if test -z "$ac_err"; then - : + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Broken: fails on valid input. +continue +fi +rm -f conftest.err conftest.$ac_ext + + # OK, works on sane cases. Now check whether non-existent headers + # can be detected and how. + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + else + ac_cpp_err= + fi else - echo "$ac_err" >&5 - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - CPP=/lib/cpp + ac_cpp_err=yes fi -rm -f conftest* +if test -z "$ac_cpp_err"; then + # Broken: success on invalid input. +continue +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Passes both tests. +ac_preproc_ok=: +break fi -rm -f conftest* +rm -f conftest.err conftest.$ac_ext + +done +# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. +rm -f conftest.err conftest.$ac_ext +if $ac_preproc_ok; then + break fi -rm -f conftest* - ac_cv_prog_CPP="$CPP" + + done + ac_cv_prog_CPP=$CPP + +fi + CPP=$ac_cv_prog_CPP +else + ac_cv_prog_CPP=$CPP +fi +echo "$as_me:$LINENO: result: $CPP" >&5 +echo "${ECHO_T}$CPP" >&6 +ac_preproc_ok=false +for ac_c_preproc_warn_flag in '' yes +do + # Use a header file that comes with gcc, so configuring glibc + # with a fresh cross-compiler works. + # Prefer to if __STDC__ is defined, since + # exists even on freestanding compilers. + # On the NeXT, cc -E runs the code through the compiler's parser, + # not just through cpp. "Syntax error" is here to catch this case. + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#ifdef __STDC__ +# include +#else +# include +#endif + Syntax error +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + : +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Broken: fails on valid input. +continue +fi +rm -f conftest.err conftest.$ac_ext + + # OK, works on sane cases. Now check whether non-existent headers + # can be detected and how. + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + # Broken: success on invalid input. +continue +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + # Passes both tests. +ac_preproc_ok=: +break fi - CPP="$ac_cv_prog_CPP" +rm -f conftest.err conftest.$ac_ext + +done +# Because of `break', _AC_PREPROC_IFELSE's cleaning code was skipped. +rm -f conftest.err conftest.$ac_ext +if $ac_preproc_ok; then + : else - ac_cv_prog_CPP="$CPP" + { { echo "$as_me:$LINENO: error: C preprocessor \"$CPP\" fails sanity check +See \`config.log' for more details." >&5 +echo "$as_me: error: C preprocessor \"$CPP\" fails sanity check +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } fi -echo "$ac_t""$CPP" 1>&6 -# If we find X, set shell vars x_includes and x_libraries to the -# paths, otherwise set no_x=yes. -# Uses ac_ vars as temps to allow command line to override cache and checks. -# --without-x overrides everything else, but does not touch the cache. -echo $ac_n "checking for X""... $ac_c" 1>&6 -echo "configure:1079: checking for X" >&5 +ac_ext=c +ac_cpp='$CPP $CPPFLAGS' +ac_compile='$CC -c $CFLAGS $CPPFLAGS conftest.$ac_ext >&5' +ac_link='$CC -o conftest$ac_exeext $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS >&5' +ac_compiler_gnu=$ac_cv_c_compiler_gnu + + +echo "$as_me:$LINENO: checking for X" >&5 +echo $ECHO_N "checking for X... $ECHO_C" >&6 + # Check whether --with-x or --without-x was given. if test "${with_x+set}" = set; then withval="$with_x" - : -fi +fi; # $have_x is `yes', `no', `disabled', or empty when we do not yet know. if test "x$with_x" = xno; then # The user explicitly disabled X. @@ -1092,193 +2828,184 @@ else # Both variables are already set. have_x=yes else -if eval "test \"`echo '$''{'ac_cv_have_x'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + if test "${ac_cv_have_x+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else # One or both of the vars are not set, and there is no cached value. -ac_x_includes=NO ac_x_libraries=NO -rm -fr conftestdir -if mkdir conftestdir; then - cd conftestdir +ac_x_includes=no ac_x_libraries=no +rm -fr conftest.dir +if mkdir conftest.dir; then + cd conftest.dir # Make sure to not put "make" in the Imakefile rules, since we grep it out. - cat > Imakefile <<'EOF' + cat >Imakefile <<'_ACEOF' acfindx: @echo 'ac_im_incroot="${INCROOT}"; ac_im_usrlibdir="${USRLIBDIR}"; ac_im_libdir="${LIBDIR}"' -EOF +_ACEOF if (xmkmf) >/dev/null 2>/dev/null && test -f Makefile; then # GNU make sometimes prints "make[1]: Entering...", which would confuse us. eval `${MAKE-make} acfindx 2>/dev/null | grep -v make` # Open Windows xmkmf reportedly sets LIBDIR instead of USRLIBDIR. for ac_extension in a so sl; do if test ! -f $ac_im_usrlibdir/libX11.$ac_extension && - test -f $ac_im_libdir/libX11.$ac_extension; then + test -f $ac_im_libdir/libX11.$ac_extension; then ac_im_usrlibdir=$ac_im_libdir; break fi done # Screen out bogus values from the imake configuration. They are # bogus both because they are the default anyway, and because # using them would break gcc on systems where it needs fixed includes. - case "$ac_im_incroot" in + case $ac_im_incroot in /usr/include) ;; - *) test -f "$ac_im_incroot/X11/Xos.h" && ac_x_includes="$ac_im_incroot" ;; + *) test -f "$ac_im_incroot/X11/Xos.h" && ac_x_includes=$ac_im_incroot;; esac - case "$ac_im_usrlibdir" in + case $ac_im_usrlibdir in /usr/lib | /lib) ;; - *) test -d "$ac_im_usrlibdir" && ac_x_libraries="$ac_im_usrlibdir" ;; + *) test -d "$ac_im_usrlibdir" && ac_x_libraries=$ac_im_usrlibdir ;; esac fi cd .. - rm -fr conftestdir + rm -fr conftest.dir fi -if test "$ac_x_includes" = NO; then - # Guess where to find include files, by looking for this one X11 .h file. - test -z "$x_direct_test_include" && x_direct_test_include=X11/Intrinsic.h - +# Standard set of common directories for X headers. +# Check X11 before X11Rn because it is often a symlink to the current release. +ac_x_header_dirs=' +/usr/X11/include +/usr/X11R6/include +/usr/X11R5/include +/usr/X11R4/include + +/usr/include/X11 +/usr/include/X11R6 +/usr/include/X11R5 +/usr/include/X11R4 + +/usr/local/X11/include +/usr/local/X11R6/include +/usr/local/X11R5/include +/usr/local/X11R4/include + +/usr/local/include/X11 +/usr/local/include/X11R6 +/usr/local/include/X11R5 +/usr/local/include/X11R4 + +/usr/X386/include +/usr/x386/include +/usr/XFree86/include/X11 + +/usr/include +/usr/local/include +/usr/unsupported/include +/usr/athena/include +/usr/local/x11r5/include +/usr/lpp/Xamples/include + +/usr/openwin/include +/usr/openwin/share/include' + +if test "$ac_x_includes" = no; then + # Guess where to find include files, by looking for Intrinsic.h. # First, try using that file with no special directory specified. -cat > conftest.$ac_ext < -EOF -ac_try="$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out" -{ (eval echo configure:1146: \"$ac_try\") 1>&5; (eval $ac_try) 2>&5; } -ac_err=`grep -v '^ *+' conftest.out | grep -v "^conftest.${ac_ext}\$"` -if test -z "$ac_err"; then - rm -rf conftest* + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then # We can compile using X headers with no special include directory. ac_x_includes= else - echo "$ac_err" >&5 - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - # Look for the header file in a standard set of common directories. -# Check X11 before X11Rn because it is often a symlink to the current release. - for ac_dir in \ - /usr/X11/include \ - /usr/X11R6/include \ - /usr/X11R5/include \ - /usr/X11R4/include \ - \ - /usr/include/X11 \ - /usr/include/X11R6 \ - /usr/include/X11R5 \ - /usr/include/X11R4 \ - \ - /usr/local/X11/include \ - /usr/local/X11R6/include \ - /usr/local/X11R5/include \ - /usr/local/X11R4/include \ - \ - /usr/local/include/X11 \ - /usr/local/include/X11R6 \ - /usr/local/include/X11R5 \ - /usr/local/include/X11R4 \ - \ - /usr/X386/include \ - /usr/x386/include \ - /usr/XFree86/include/X11 \ - \ - /usr/include \ - /usr/local/include \ - /usr/unsupported/include \ - /usr/athena/include \ - /usr/local/x11r5/include \ - /usr/lpp/Xamples/include \ - \ - /usr/openwin/include \ - /usr/openwin/share/include \ - ; \ - do - if test -r "$ac_dir/$x_direct_test_include"; then - ac_x_includes=$ac_dir - break - fi - done + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + for ac_dir in $ac_x_header_dirs; do + if test -r "$ac_dir/X11/Intrinsic.h"; then + ac_x_includes=$ac_dir + break + fi +done fi -rm -f conftest* -fi # $ac_x_includes = NO +rm -f conftest.err conftest.$ac_ext +fi # $ac_x_includes = no -if test "$ac_x_libraries" = NO; then +if test "$ac_x_libraries" = no; then # Check for the libraries. - - test -z "$x_direct_test_library" && x_direct_test_library=Xt - test -z "$x_direct_test_function" && x_direct_test_function=XtMalloc - # See if we find them without any special options. # Don't add to $LIBS permanently. - ac_save_LIBS="$LIBS" - LIBS="-l$x_direct_test_library $LIBS" -cat > conftest.$ac_ext <&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - LIBS="$ac_save_LIBS" + ac_save_LIBS=$LIBS + LIBS="-lXt $LIBS" + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +int +main () +{ +XtMalloc (0) + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + LIBS=$ac_save_LIBS # We can link X programs with no special library path. ac_x_libraries= else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - LIBS="$ac_save_LIBS" -# First see if replacing the include by lib works. -# Check X11 before X11Rn because it is often a symlink to the current release. -for ac_dir in `echo "$ac_x_includes" | sed s/include/lib/` \ - /usr/X11/lib \ - /usr/X11R6/lib \ - /usr/X11R5/lib \ - /usr/X11R4/lib \ - \ - /usr/lib/X11 \ - /usr/lib/X11R6 \ - /usr/lib/X11R5 \ - /usr/lib/X11R4 \ - \ - /usr/local/X11/lib \ - /usr/local/X11R6/lib \ - /usr/local/X11R5/lib \ - /usr/local/X11R4/lib \ - \ - /usr/local/lib/X11 \ - /usr/local/lib/X11R6 \ - /usr/local/lib/X11R5 \ - /usr/local/lib/X11R4 \ - \ - /usr/X386/lib \ - /usr/x386/lib \ - /usr/XFree86/lib/X11 \ - \ - /usr/lib \ - /usr/local/lib \ - /usr/unsupported/lib \ - /usr/athena/lib \ - /usr/local/x11r5/lib \ - /usr/lpp/Xamples/lib \ - /lib/usr/lib/X11 \ - \ - /usr/openwin/lib \ - /usr/openwin/share/lib \ - ; \ + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +LIBS=$ac_save_LIBS +for ac_dir in `echo "$ac_x_includes $ac_x_header_dirs" | sed s/include/lib/g` do + # Don't even attempt the hair of trying to link an X program! for ac_extension in a so sl; do - if test -r $ac_dir/lib${x_direct_test_library}.$ac_extension; then + if test -r $ac_dir/libXt.$ac_extension; then ac_x_libraries=$ac_dir break 2 fi done done fi -rm -f conftest* -fi # $ac_x_libraries = NO +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +fi # $ac_x_libraries = no -if test "$ac_x_includes" = NO || test "$ac_x_libraries" = NO; then +if test "$ac_x_includes" = no || test "$ac_x_libraries" = no; then # Didn't find X anywhere. Cache the known absence of X. ac_cv_have_x="have_x=no" else @@ -1287,12 +3014,14 @@ else ac_x_includes=$ac_x_includes ac_x_libraries=$ac_x_libraries" fi fi + fi eval "$ac_cv_have_x" fi # $with_x != no if test "$have_x" != yes; then - echo "$ac_t""$have_x" 1>&6 + echo "$as_me:$LINENO: result: $have_x" >&5 +echo "${ECHO_T}$have_x" >&6 no_x=yes else # If each of the values was on the command line, it overrides each guess. @@ -1301,14 +3030,16 @@ else # Update the cache value to reflect the command line values. ac_cv_have_x="have_x=yes \ ac_x_includes=$x_includes ac_x_libraries=$x_libraries" - echo "$ac_t""libraries $x_libraries, headers $x_includes" 1>&6 + echo "$as_me:$LINENO: result: libraries $x_libraries, headers $x_includes" >&5 +echo "${ECHO_T}libraries $x_libraries, headers $x_includes" >&6 fi if test "$no_x" = yes; then # Not all programs may use this symbol, but it does not hurt to define it. - cat >> confdefs.h <<\EOF + +cat >>confdefs.h <<\_ACEOF #define X_DISPLAY_MISSING 1 -EOF +_ACEOF X_CFLAGS= X_PRE_LIBS= X_LIBS= X_EXTRA_LIBS= else @@ -1321,60 +3052,99 @@ else X_LIBS="$X_LIBS -L$x_libraries" # For Solaris; some versions of Sun CC require a space after -R and # others require no space. Words are not sufficient . . . . - case "`(uname -sr) 2>/dev/null`" in + case `(uname -sr) 2>/dev/null` in "SunOS 5"*) - echo $ac_n "checking whether -R must be followed by a space""... $ac_c" 1>&6 -echo "configure:1328: checking whether -R must be followed by a space" >&5 - ac_xsave_LIBS="$LIBS"; LIBS="$LIBS -R$x_libraries" - cat > conftest.$ac_ext <&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* + echo "$as_me:$LINENO: checking whether -R must be followed by a space" >&5 +echo $ECHO_N "checking whether -R must be followed by a space... $ECHO_C" >&6 + ac_xsave_LIBS=$LIBS; LIBS="$LIBS -R$x_libraries" + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then ac_R_nospace=yes else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - ac_R_nospace=no + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_R_nospace=no fi -rm -f conftest* +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext if test $ac_R_nospace = yes; then - echo "$ac_t""no" 1>&6 + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 X_LIBS="$X_LIBS -R$x_libraries" else LIBS="$ac_xsave_LIBS -R $x_libraries" - cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ -; return 0; } -EOF -if { (eval echo configure:1361: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then ac_R_space=yes else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - ac_R_space=no + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_R_space=no fi -rm -f conftest* +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext if test $ac_R_space = yes; then - echo "$ac_t""yes" 1>&6 + echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 X_LIBS="$X_LIBS -R $x_libraries" else - echo "$ac_t""neither works" 1>&6 + echo "$as_me:$LINENO: result: neither works" >&5 +echo "${ECHO_T}neither works" >&6 fi fi - LIBS="$ac_xsave_LIBS" + LIBS=$ac_xsave_LIBS esac fi @@ -1385,522 +3155,854 @@ rm -f conftest* if test "$ISC" = yes; then X_EXTRA_LIBS="$X_EXTRA_LIBS -lnsl_s -linet" else - # Martyn.Johnson@cl.cam.ac.uk says this is needed for Ultrix, if the X - # libraries were built with DECnet support. And karl@cs.umb.edu says + # Martyn Johnson says this is needed for Ultrix, if the X + # libraries were built with DECnet support. And Karl Berry says # the Alpha needs dnet_stub (dnet does not exist). - echo $ac_n "checking for dnet_ntoa in -ldnet""... $ac_c" 1>&6 -echo "configure:1393: checking for dnet_ntoa in -ldnet" >&5 -ac_lib_var=`echo dnet'_'dnet_ntoa | sed 'y%./+-%__p_%'` -if eval "test \"`echo '$''{'ac_cv_lib_$ac_lib_var'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + ac_xsave_LIBS="$LIBS"; LIBS="$LIBS $X_LIBS -lX11" + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +/* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif +/* We use char because int might match the return type of a gcc2 + builtin and then its argument prototype would still apply. */ +char XOpenDisplay (); +int +main () +{ +XOpenDisplay (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + : else - ac_save_LIBS="$LIBS" + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +echo "$as_me:$LINENO: checking for dnet_ntoa in -ldnet" >&5 +echo $ECHO_N "checking for dnet_ntoa in -ldnet... $ECHO_C" >&6 +if test "${ac_cv_lib_dnet_dnet_ntoa+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS LIBS="-ldnet $LIBS" -cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char dnet_ntoa(); - -int main() { -dnet_ntoa() -; return 0; } -EOF -if { (eval echo configure:1412: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=no" -fi -rm -f conftest* -LIBS="$ac_save_LIBS" - -fi -if eval "test \"`echo '$ac_cv_lib_'$ac_lib_var`\" = yes"; then - echo "$ac_t""yes" 1>&6 + builtin and then its argument prototype would still apply. */ +char dnet_ntoa (); +int +main () +{ +dnet_ntoa (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_dnet_dnet_ntoa=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_dnet_dnet_ntoa=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_dnet_dnet_ntoa" >&5 +echo "${ECHO_T}$ac_cv_lib_dnet_dnet_ntoa" >&6 +if test $ac_cv_lib_dnet_dnet_ntoa = yes; then X_EXTRA_LIBS="$X_EXTRA_LIBS -ldnet" -else - echo "$ac_t""no" 1>&6 fi if test $ac_cv_lib_dnet_dnet_ntoa = no; then - echo $ac_n "checking for dnet_ntoa in -ldnet_stub""... $ac_c" 1>&6 -echo "configure:1434: checking for dnet_ntoa in -ldnet_stub" >&5 -ac_lib_var=`echo dnet_stub'_'dnet_ntoa | sed 'y%./+-%__p_%'` -if eval "test \"`echo '$''{'ac_cv_lib_$ac_lib_var'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + echo "$as_me:$LINENO: checking for dnet_ntoa in -ldnet_stub" >&5 +echo $ECHO_N "checking for dnet_ntoa in -ldnet_stub... $ECHO_C" >&6 +if test "${ac_cv_lib_dnet_stub_dnet_ntoa+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - ac_save_LIBS="$LIBS" + ac_check_lib_save_LIBS=$LIBS LIBS="-ldnet_stub $LIBS" -cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char dnet_ntoa(); - -int main() { -dnet_ntoa() -; return 0; } -EOF -if { (eval echo configure:1453: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=no" -fi -rm -f conftest* -LIBS="$ac_save_LIBS" - -fi -if eval "test \"`echo '$ac_cv_lib_'$ac_lib_var`\" = yes"; then - echo "$ac_t""yes" 1>&6 + builtin and then its argument prototype would still apply. */ +char dnet_ntoa (); +int +main () +{ +dnet_ntoa (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_dnet_stub_dnet_ntoa=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_dnet_stub_dnet_ntoa=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_dnet_stub_dnet_ntoa" >&5 +echo "${ECHO_T}$ac_cv_lib_dnet_stub_dnet_ntoa" >&6 +if test $ac_cv_lib_dnet_stub_dnet_ntoa = yes; then X_EXTRA_LIBS="$X_EXTRA_LIBS -ldnet_stub" -else - echo "$ac_t""no" 1>&6 fi fi +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext + LIBS="$ac_xsave_LIBS" # msh@cis.ufl.edu says -lnsl (and -lsocket) are needed for his 386/AT, # to get the SysV transport functions. - # chad@anasazi.com says the Pyramis MIS-ES running DC/OSx (SVR4) + # Chad R. Larson says the Pyramis MIS-ES running DC/OSx (SVR4) # needs -lnsl. # The nsl library prevents programs from opening the X display - # on Irix 5.2, according to dickey@clark.net. - echo $ac_n "checking for gethostbyname""... $ac_c" 1>&6 -echo "configure:1482: checking for gethostbyname" >&5 -if eval "test \"`echo '$''{'ac_cv_func_gethostbyname'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - cat > conftest.$ac_ext <&5 +echo $ECHO_N "checking for gethostbyname... $ECHO_C" >&6 +if test "${ac_cv_func_gethostbyname+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ /* System header to define __stub macros and hopefully few prototypes, - which can conflict with char gethostbyname(); below. */ -#include + which can conflict with char gethostbyname (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ +#ifdef __STDC__ +# include +#else +# include +#endif /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +{ +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char gethostbyname(); - -int main() { - + builtin and then its argument prototype would still apply. */ +char gethostbyname (); /* The GNU C library defines this for functions which it implements to always fail with ENOSYS. Some functions are actually named something starting with __ and the normal name is an alias. */ #if defined (__stub_gethostbyname) || defined (__stub___gethostbyname) choke me #else -gethostbyname(); +char (*f) () = gethostbyname; +#endif +#ifdef __cplusplus +} #endif -; return 0; } -EOF -if { (eval echo configure:1510: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_func_gethostbyname=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_func_gethostbyname=no" -fi -rm -f conftest* -fi - -if eval "test \"`echo '$ac_cv_func_'gethostbyname`\" = yes"; then - echo "$ac_t""yes" 1>&6 - : -else - echo "$ac_t""no" 1>&6 -fi +int +main () +{ +return f != gethostbyname; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_func_gethostbyname=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_func_gethostbyname=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_func_gethostbyname" >&5 +echo "${ECHO_T}$ac_cv_func_gethostbyname" >&6 if test $ac_cv_func_gethostbyname = no; then - echo $ac_n "checking for gethostbyname in -lnsl""... $ac_c" 1>&6 -echo "configure:1531: checking for gethostbyname in -lnsl" >&5 -ac_lib_var=`echo nsl'_'gethostbyname | sed 'y%./+-%__p_%'` -if eval "test \"`echo '$''{'ac_cv_lib_$ac_lib_var'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + echo "$as_me:$LINENO: checking for gethostbyname in -lnsl" >&5 +echo $ECHO_N "checking for gethostbyname in -lnsl... $ECHO_C" >&6 +if test "${ac_cv_lib_nsl_gethostbyname+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - ac_save_LIBS="$LIBS" + ac_check_lib_save_LIBS=$LIBS LIBS="-lnsl $LIBS" -cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char gethostbyname(); - -int main() { -gethostbyname() -; return 0; } -EOF -if { (eval echo configure:1550: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=no" + builtin and then its argument prototype would still apply. */ +char gethostbyname (); +int +main () +{ +gethostbyname (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_nsl_gethostbyname=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_nsl_gethostbyname=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_nsl_gethostbyname" >&5 +echo "${ECHO_T}$ac_cv_lib_nsl_gethostbyname" >&6 +if test $ac_cv_lib_nsl_gethostbyname = yes; then + X_EXTRA_LIBS="$X_EXTRA_LIBS -lnsl" fi -rm -f conftest* -LIBS="$ac_save_LIBS" -fi -if eval "test \"`echo '$ac_cv_lib_'$ac_lib_var`\" = yes"; then - echo "$ac_t""yes" 1>&6 - X_EXTRA_LIBS="$X_EXTRA_LIBS -lnsl" + if test $ac_cv_lib_nsl_gethostbyname = no; then + echo "$as_me:$LINENO: checking for gethostbyname in -lbsd" >&5 +echo $ECHO_N "checking for gethostbyname in -lbsd... $ECHO_C" >&6 +if test "${ac_cv_lib_bsd_gethostbyname+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - echo "$ac_t""no" 1>&6 + ac_check_lib_save_LIBS=$LIBS +LIBS="-lbsd $LIBS" +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +/* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif +/* We use char because int might match the return type of a gcc2 + builtin and then its argument prototype would still apply. */ +char gethostbyname (); +int +main () +{ +gethostbyname (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_bsd_gethostbyname=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_bsd_gethostbyname=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_bsd_gethostbyname" >&5 +echo "${ECHO_T}$ac_cv_lib_bsd_gethostbyname" >&6 +if test $ac_cv_lib_bsd_gethostbyname = yes; then + X_EXTRA_LIBS="$X_EXTRA_LIBS -lbsd" fi + fi fi # lieder@skyler.mavd.honeywell.com says without -lsocket, # socket/setsockopt and other routines are undefined under SCO ODT # 2.0. But -lsocket is broken on IRIX 5.2 (and is not necessary - # on later versions), says simon@lia.di.epfl.ch: it contains - # gethostby* variants that don't use the nameserver (or something). - # -lsocket must be given before -lnsl if both are needed. - # We assume that if connect needs -lnsl, so does gethostbyname. - echo $ac_n "checking for connect""... $ac_c" 1>&6 -echo "configure:1580: checking for connect" >&5 -if eval "test \"`echo '$''{'ac_cv_func_connect'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - cat > conftest.$ac_ext <&5 +echo $ECHO_N "checking for connect... $ECHO_C" >&6 +if test "${ac_cv_func_connect+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ /* System header to define __stub macros and hopefully few prototypes, - which can conflict with char connect(); below. */ -#include + which can conflict with char connect (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ +#ifdef __STDC__ +# include +#else +# include +#endif /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +{ +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char connect(); - -int main() { - + builtin and then its argument prototype would still apply. */ +char connect (); /* The GNU C library defines this for functions which it implements to always fail with ENOSYS. Some functions are actually named something starting with __ and the normal name is an alias. */ #if defined (__stub_connect) || defined (__stub___connect) choke me #else -connect(); +char (*f) () = connect; +#endif +#ifdef __cplusplus +} #endif -; return 0; } -EOF -if { (eval echo configure:1608: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_func_connect=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_func_connect=no" -fi -rm -f conftest* -fi - -if eval "test \"`echo '$ac_cv_func_'connect`\" = yes"; then - echo "$ac_t""yes" 1>&6 - : -else - echo "$ac_t""no" 1>&6 -fi +int +main () +{ +return f != connect; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_func_connect=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_func_connect=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_func_connect" >&5 +echo "${ECHO_T}$ac_cv_func_connect" >&6 if test $ac_cv_func_connect = no; then - echo $ac_n "checking for connect in -lsocket""... $ac_c" 1>&6 -echo "configure:1629: checking for connect in -lsocket" >&5 -ac_lib_var=`echo socket'_'connect | sed 'y%./+-%__p_%'` -if eval "test \"`echo '$''{'ac_cv_lib_$ac_lib_var'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + echo "$as_me:$LINENO: checking for connect in -lsocket" >&5 +echo $ECHO_N "checking for connect in -lsocket... $ECHO_C" >&6 +if test "${ac_cv_lib_socket_connect+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - ac_save_LIBS="$LIBS" + ac_check_lib_save_LIBS=$LIBS LIBS="-lsocket $X_EXTRA_LIBS $LIBS" -cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char connect(); - -int main() { -connect() -; return 0; } -EOF -if { (eval echo configure:1648: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=no" -fi -rm -f conftest* -LIBS="$ac_save_LIBS" - -fi -if eval "test \"`echo '$ac_cv_lib_'$ac_lib_var`\" = yes"; then - echo "$ac_t""yes" 1>&6 + builtin and then its argument prototype would still apply. */ +char connect (); +int +main () +{ +connect (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_socket_connect=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_socket_connect=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_socket_connect" >&5 +echo "${ECHO_T}$ac_cv_lib_socket_connect" >&6 +if test $ac_cv_lib_socket_connect = yes; then X_EXTRA_LIBS="-lsocket $X_EXTRA_LIBS" -else - echo "$ac_t""no" 1>&6 fi fi - # gomez@mi.uni-erlangen.de says -lposix is necessary on A/UX. - echo $ac_n "checking for remove""... $ac_c" 1>&6 -echo "configure:1672: checking for remove" >&5 -if eval "test \"`echo '$''{'ac_cv_func_remove'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - cat > conftest.$ac_ext <&5 +echo $ECHO_N "checking for remove... $ECHO_C" >&6 +if test "${ac_cv_func_remove+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ /* System header to define __stub macros and hopefully few prototypes, - which can conflict with char remove(); below. */ -#include + which can conflict with char remove (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ +#ifdef __STDC__ +# include +#else +# include +#endif /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +{ +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char remove(); - -int main() { - + builtin and then its argument prototype would still apply. */ +char remove (); /* The GNU C library defines this for functions which it implements to always fail with ENOSYS. Some functions are actually named something starting with __ and the normal name is an alias. */ #if defined (__stub_remove) || defined (__stub___remove) choke me #else -remove(); +char (*f) () = remove; +#endif +#ifdef __cplusplus +} #endif -; return 0; } -EOF -if { (eval echo configure:1700: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_func_remove=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_func_remove=no" -fi -rm -f conftest* -fi - -if eval "test \"`echo '$ac_cv_func_'remove`\" = yes"; then - echo "$ac_t""yes" 1>&6 - : -else - echo "$ac_t""no" 1>&6 -fi +int +main () +{ +return f != remove; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_func_remove=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_func_remove=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_func_remove" >&5 +echo "${ECHO_T}$ac_cv_func_remove" >&6 if test $ac_cv_func_remove = no; then - echo $ac_n "checking for remove in -lposix""... $ac_c" 1>&6 -echo "configure:1721: checking for remove in -lposix" >&5 -ac_lib_var=`echo posix'_'remove | sed 'y%./+-%__p_%'` -if eval "test \"`echo '$''{'ac_cv_lib_$ac_lib_var'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + echo "$as_me:$LINENO: checking for remove in -lposix" >&5 +echo $ECHO_N "checking for remove in -lposix... $ECHO_C" >&6 +if test "${ac_cv_lib_posix_remove+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - ac_save_LIBS="$LIBS" + ac_check_lib_save_LIBS=$LIBS LIBS="-lposix $LIBS" -cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char remove(); - -int main() { -remove() -; return 0; } -EOF -if { (eval echo configure:1740: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=no" -fi -rm -f conftest* -LIBS="$ac_save_LIBS" - -fi -if eval "test \"`echo '$ac_cv_lib_'$ac_lib_var`\" = yes"; then - echo "$ac_t""yes" 1>&6 + builtin and then its argument prototype would still apply. */ +char remove (); +int +main () +{ +remove (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_posix_remove=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_posix_remove=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_posix_remove" >&5 +echo "${ECHO_T}$ac_cv_lib_posix_remove" >&6 +if test $ac_cv_lib_posix_remove = yes; then X_EXTRA_LIBS="$X_EXTRA_LIBS -lposix" -else - echo "$ac_t""no" 1>&6 fi fi # BSDI BSD/OS 2.1 needs -lipc for XOpenDisplay. - echo $ac_n "checking for shmat""... $ac_c" 1>&6 -echo "configure:1764: checking for shmat" >&5 -if eval "test \"`echo '$''{'ac_cv_func_shmat'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - cat > conftest.$ac_ext <&5 +echo $ECHO_N "checking for shmat... $ECHO_C" >&6 +if test "${ac_cv_func_shmat+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ /* System header to define __stub macros and hopefully few prototypes, - which can conflict with char shmat(); below. */ -#include + which can conflict with char shmat (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ +#ifdef __STDC__ +# include +#else +# include +#endif /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +{ +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char shmat(); - -int main() { - + builtin and then its argument prototype would still apply. */ +char shmat (); /* The GNU C library defines this for functions which it implements to always fail with ENOSYS. Some functions are actually named something starting with __ and the normal name is an alias. */ #if defined (__stub_shmat) || defined (__stub___shmat) choke me #else -shmat(); +char (*f) () = shmat; +#endif +#ifdef __cplusplus +} #endif -; return 0; } -EOF -if { (eval echo configure:1792: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_func_shmat=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_func_shmat=no" -fi -rm -f conftest* -fi - -if eval "test \"`echo '$ac_cv_func_'shmat`\" = yes"; then - echo "$ac_t""yes" 1>&6 - : -else - echo "$ac_t""no" 1>&6 -fi +int +main () +{ +return f != shmat; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_func_shmat=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_func_shmat=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_func_shmat" >&5 +echo "${ECHO_T}$ac_cv_func_shmat" >&6 if test $ac_cv_func_shmat = no; then - echo $ac_n "checking for shmat in -lipc""... $ac_c" 1>&6 -echo "configure:1813: checking for shmat in -lipc" >&5 -ac_lib_var=`echo ipc'_'shmat | sed 'y%./+-%__p_%'` -if eval "test \"`echo '$''{'ac_cv_lib_$ac_lib_var'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + echo "$as_me:$LINENO: checking for shmat in -lipc" >&5 +echo $ECHO_N "checking for shmat in -lipc... $ECHO_C" >&6 +if test "${ac_cv_lib_ipc_shmat+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - ac_save_LIBS="$LIBS" + ac_check_lib_save_LIBS=$LIBS LIBS="-lipc $LIBS" -cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char shmat(); - -int main() { -shmat() -; return 0; } -EOF -if { (eval echo configure:1832: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=no" -fi -rm -f conftest* -LIBS="$ac_save_LIBS" - -fi -if eval "test \"`echo '$ac_cv_lib_'$ac_lib_var`\" = yes"; then - echo "$ac_t""yes" 1>&6 + builtin and then its argument prototype would still apply. */ +char shmat (); +int +main () +{ +shmat (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_ipc_shmat=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_ipc_shmat=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_ipc_shmat" >&5 +echo "${ECHO_T}$ac_cv_lib_ipc_shmat" >&6 +if test $ac_cv_lib_ipc_shmat = yes; then X_EXTRA_LIBS="$X_EXTRA_LIBS -lipc" -else - echo "$ac_t""no" 1>&6 fi fi fi # Check for libraries that X11R6 Xt/Xaw programs need. - ac_save_LDFLAGS="$LDFLAGS" + ac_save_LDFLAGS=$LDFLAGS test -n "$x_libraries" && LDFLAGS="$LDFLAGS -L$x_libraries" # SM needs ICE to (dynamically) link under SunOS 4.x (so we have to # check for ICE first), but we must link in the order -lSM -lICE or # we get undefined symbols. So assume we have SM if we have ICE. # These have to be linked with before -lX11, unlike the other # libraries we check for below, so use a different variable. - # --interran@uluru.Stanford.EDU, kb@cs.umb.edu. - echo $ac_n "checking for IceConnectionNumber in -lICE""... $ac_c" 1>&6 -echo "configure:1865: checking for IceConnectionNumber in -lICE" >&5 -ac_lib_var=`echo ICE'_'IceConnectionNumber | sed 'y%./+-%__p_%'` -if eval "test \"`echo '$''{'ac_cv_lib_$ac_lib_var'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - ac_save_LIBS="$LIBS" + # John Interrante, Karl Berry + echo "$as_me:$LINENO: checking for IceConnectionNumber in -lICE" >&5 +echo $ECHO_N "checking for IceConnectionNumber in -lICE... $ECHO_C" >&6 +if test "${ac_cv_lib_ICE_IceConnectionNumber+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_check_lib_save_LIBS=$LIBS LIBS="-lICE $X_EXTRA_LIBS $LIBS" -cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char IceConnectionNumber(); - -int main() { -IceConnectionNumber() -; return 0; } -EOF -if { (eval echo configure:1884: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=no" -fi -rm -f conftest* -LIBS="$ac_save_LIBS" - -fi -if eval "test \"`echo '$ac_cv_lib_'$ac_lib_var`\" = yes"; then - echo "$ac_t""yes" 1>&6 + builtin and then its argument prototype would still apply. */ +char IceConnectionNumber (); +int +main () +{ +IceConnectionNumber (); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_ICE_IceConnectionNumber=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_ICE_IceConnectionNumber=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_ICE_IceConnectionNumber" >&5 +echo "${ECHO_T}$ac_cv_lib_ICE_IceConnectionNumber" >&6 +if test $ac_cv_lib_ICE_IceConnectionNumber = yes; then X_PRE_LIBS="$X_PRE_LIBS -lSM -lICE" -else - echo "$ac_t""no" 1>&6 fi - LDFLAGS="$ac_save_LDFLAGS" + LDFLAGS=$ac_save_LDFLAGS fi @@ -1910,145 +4012,196 @@ fi # Check for other libraries. # -echo $ac_n "checking for clrtoeol in -lcurses""... $ac_c" 1>&6 -echo "configure:1915: checking for clrtoeol in -lcurses" >&5 -ac_lib_var=`echo curses'_'clrtoeol | sed 'y%./+-%__p_%'` -if eval "test \"`echo '$''{'ac_cv_lib_$ac_lib_var'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + +echo "$as_me:$LINENO: checking for clrtoeol in -lcurses" >&5 +echo $ECHO_N "checking for clrtoeol in -lcurses... $ECHO_C" >&6 +if test "${ac_cv_lib_curses_clrtoeol+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - ac_save_LIBS="$LIBS" + ac_check_lib_save_LIBS=$LIBS LIBS="-lcurses $LIBS" -cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char clrtoeol(); - -int main() { -clrtoeol() -; return 0; } -EOF -if { (eval echo configure:1934: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=no" -fi -rm -f conftest* -LIBS="$ac_save_LIBS" - -fi -if eval "test \"`echo '$ac_cv_lib_'$ac_lib_var`\" = yes"; then - echo "$ac_t""yes" 1>&6 - ac_tr_lib=HAVE_LIB`echo curses | sed -e 's/[^a-zA-Z0-9_]/_/g' \ - -e 'y/abcdefghijklmnopqrstuvwxyz/ABCDEFGHIJKLMNOPQRSTUVWXYZ/'` - cat >> confdefs.h <&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_curses_clrtoeol=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_curses_clrtoeol=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_curses_clrtoeol" >&5 +echo "${ECHO_T}$ac_cv_lib_curses_clrtoeol" >&6 +if test $ac_cv_lib_curses_clrtoeol = yes; then + cat >>confdefs.h <<_ACEOF +#define HAVE_LIBCURSES 1 +_ACEOF LIBS="-lcurses $LIBS" -else - echo "$ac_t""no" 1>&6 fi -echo $ac_n "checking for pow in -lm""... $ac_c" 1>&6 -echo "configure:1962: checking for pow in -lm" >&5 -ac_lib_var=`echo m'_'pow | sed 'y%./+-%__p_%'` -if eval "test \"`echo '$''{'ac_cv_lib_$ac_lib_var'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + +echo "$as_me:$LINENO: checking for pow in -lm" >&5 +echo $ECHO_N "checking for pow in -lm... $ECHO_C" >&6 +if test "${ac_cv_lib_m_pow+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - ac_save_LIBS="$LIBS" + ac_check_lib_save_LIBS=$LIBS LIBS="-lm $LIBS" -cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char pow(); - -int main() { -pow() -; return 0; } -EOF -if { (eval echo configure:1981: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=no" -fi -rm -f conftest* -LIBS="$ac_save_LIBS" - -fi -if eval "test \"`echo '$ac_cv_lib_'$ac_lib_var`\" = yes"; then - echo "$ac_t""yes" 1>&6 - ac_tr_lib=HAVE_LIB`echo m | sed -e 's/[^a-zA-Z0-9_]/_/g' \ - -e 'y/abcdefghijklmnopqrstuvwxyz/ABCDEFGHIJKLMNOPQRSTUVWXYZ/'` - cat >> confdefs.h <&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_m_pow=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_m_pow=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_m_pow" >&5 +echo "${ECHO_T}$ac_cv_lib_m_pow" >&6 +if test $ac_cv_lib_m_pow = yes; then + cat >>confdefs.h <<_ACEOF +#define HAVE_LIBM 1 +_ACEOF LIBS="-lm $LIBS" -else - echo "$ac_t""no" 1>&6 fi -echo $ac_n "checking for tgoto in -ltermcap""... $ac_c" 1>&6 -echo "configure:2009: checking for tgoto in -ltermcap" >&5 -ac_lib_var=`echo termcap'_'tgoto | sed 'y%./+-%__p_%'` -if eval "test \"`echo '$''{'ac_cv_lib_$ac_lib_var'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + +echo "$as_me:$LINENO: checking for tgoto in -ltermcap" >&5 +echo $ECHO_N "checking for tgoto in -ltermcap... $ECHO_C" >&6 +if test "${ac_cv_lib_termcap_tgoto+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - ac_save_LIBS="$LIBS" + ac_check_lib_save_LIBS=$LIBS LIBS="-ltermcap $LIBS" -cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char tgoto(); - -int main() { -tgoto() -; return 0; } -EOF -if { (eval echo configure:2028: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_lib_$ac_lib_var=no" -fi -rm -f conftest* -LIBS="$ac_save_LIBS" - -fi -if eval "test \"`echo '$ac_cv_lib_'$ac_lib_var`\" = yes"; then - echo "$ac_t""yes" 1>&6 - ac_tr_lib=HAVE_LIB`echo termcap | sed -e 's/[^a-zA-Z0-9_]/_/g' \ - -e 'y/abcdefghijklmnopqrstuvwxyz/ABCDEFGHIJKLMNOPQRSTUVWXYZ/'` - cat >> confdefs.h <&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_lib_termcap_tgoto=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_lib_termcap_tgoto=no +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +LIBS=$ac_check_lib_save_LIBS +fi +echo "$as_me:$LINENO: result: $ac_cv_lib_termcap_tgoto" >&5 +echo "${ECHO_T}$ac_cv_lib_termcap_tgoto" >&6 +if test $ac_cv_lib_termcap_tgoto = yes; then + cat >>confdefs.h <<_ACEOF +#define HAVE_LIBTERMCAP 1 +_ACEOF LIBS="-ltermcap $LIBS" -else - echo "$ac_t""no" 1>&6 fi @@ -2057,10 +4210,12 @@ fi # C compiler warnings. # -if [ $ac_cv_prog_gcc = yes ] +if [ $ac_cv_c_compiler_gnu = yes ] then -WARNINGS="-Wall -Wno-implicit-int" +WARNINGS="-Wall -Wno-implicit-int -Wstrict-prototypes -ansi -pedantic" CEXTRAFLAGS="-fsigned-char -funroll-loops \$(HASH)" +# For profiling targets: +CEXTRAFLAGS2="-fsigned-char -pg -fprofile-arcs -ftest-coverage \$(HASH)" else # Who knows what warnings your compiler uses? WARNINGS= @@ -2071,55 +4226,93 @@ fi + # # Check for header files. # echo -echo $ac_n "checking for header files""... $ac_c" 1>&6 -echo "configure:2081: checking for header files" >&5 +echo "$as_me:$LINENO: checking for header files" >&5 +echo $ECHO_N "checking for header files... $ECHO_C" >&6 echo -echo $ac_n "checking for ANSI C header files""... $ac_c" 1>&6 -echo "configure:2085: checking for ANSI C header files" >&5 -if eval "test \"`echo '$''{'ac_cv_header_stdc'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 +echo "$as_me:$LINENO: checking for egrep" >&5 +echo $ECHO_N "checking for egrep... $ECHO_C" >&6 +if test "${ac_cv_prog_egrep+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - cat > conftest.$ac_ext </dev/null 2>&1 + then ac_cv_prog_egrep='grep -E' + else ac_cv_prog_egrep='egrep' + fi +fi +echo "$as_me:$LINENO: result: $ac_cv_prog_egrep" >&5 +echo "${ECHO_T}$ac_cv_prog_egrep" >&6 + EGREP=$ac_cv_prog_egrep + + +echo "$as_me:$LINENO: checking for ANSI C header files" >&5 +echo $ECHO_N "checking for ANSI C header files... $ECHO_C" >&6 +if test "${ac_cv_header_stdc+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ #include #include #include #include -EOF -ac_try="$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out" -{ (eval echo configure:2098: \"$ac_try\") 1>&5; (eval $ac_try) 2>&5; } -ac_err=`grep -v '^ *+' conftest.out | grep -v "^conftest.${ac_ext}\$"` -if test -z "$ac_err"; then - rm -rf conftest* + +int +main () +{ + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then ac_cv_header_stdc=yes else - echo "$ac_err" >&5 - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - ac_cv_header_stdc=no + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_header_stdc=no fi -rm -f conftest* +rm -f conftest.$ac_objext conftest.$ac_ext if test $ac_cv_header_stdc = yes; then # SunOS 4.x string.h does not declare mem*, contrary to ANSI. -cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ #include -EOF + +_ACEOF if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | - egrep "memchr" >/dev/null 2>&1; then + $EGREP "memchr" >/dev/null 2>&1; then : else - rm -rf conftest* ac_cv_header_stdc=no fi rm -f conftest* @@ -2128,16 +4321,20 @@ fi if test $ac_cv_header_stdc = yes; then # ISC 2.0.2 stdlib.h does not declare free, contrary to ANSI. -cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ #include -EOF + +_ACEOF if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | - egrep "free" >/dev/null 2>&1; then + $EGREP "free" >/dev/null 2>&1; then : else - rm -rf conftest* ac_cv_header_stdc=no fi rm -f conftest* @@ -2146,198 +4343,684 @@ fi if test $ac_cv_header_stdc = yes; then # /bin/cc in Irix-4.0.5 gets non-ANSI ctype macros unless using -ansi. -if test "$cross_compiling" = yes; then + if test "$cross_compiling" = yes; then : else - cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ #include -#define ISLOWER(c) ('a' <= (c) && (c) <= 'z') -#define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c)) -#define XOR(e, f) (((e) && !(f)) || (!(e) && (f))) -int main () { int i; for (i = 0; i < 256; i++) -if (XOR (islower (i), ISLOWER (i)) || toupper (i) != TOUPPER (i)) exit(2); -exit (0); } +#if ((' ' & 0x0FF) == 0x020) +# define ISLOWER(c) ('a' <= (c) && (c) <= 'z') +# define TOUPPER(c) (ISLOWER(c) ? 'A' + ((c) - 'a') : (c)) +#else +# define ISLOWER(c) \ + (('a' <= (c) && (c) <= 'i') \ + || ('j' <= (c) && (c) <= 'r') \ + || ('s' <= (c) && (c) <= 'z')) +# define TOUPPER(c) (ISLOWER(c) ? ((c) | 0x40) : (c)) +#endif -EOF -if { (eval echo configure:2165: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext} && (./conftest; exit) 2>/dev/null -then +#define XOR(e, f) (((e) && !(f)) || (!(e) && (f))) +int +main () +{ + int i; + for (i = 0; i < 256; i++) + if (XOR (islower (i), ISLOWER (i)) + || toupper (i) != TOUPPER (i)) + exit(2); + exit (0); +} +_ACEOF +rm -f conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { ac_try='./conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then : else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -fr conftest* - ac_cv_header_stdc=no + echo "$as_me: program exited with status $ac_status" >&5 +echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +( exit $ac_status ) +ac_cv_header_stdc=no fi -rm -fr conftest* +rm -f core core.* *.core gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext fi - fi fi - -echo "$ac_t""$ac_cv_header_stdc" 1>&6 +echo "$as_me:$LINENO: result: $ac_cv_header_stdc" >&5 +echo "${ECHO_T}$ac_cv_header_stdc" >&6 if test $ac_cv_header_stdc = yes; then - cat >> confdefs.h <<\EOF + +cat >>confdefs.h <<\_ACEOF #define STDC_HEADERS 1 -EOF +_ACEOF fi -echo $ac_n "checking for sys/wait.h that is POSIX.1 compatible""... $ac_c" 1>&6 -echo "configure:2189: checking for sys/wait.h that is POSIX.1 compatible" >&5 -if eval "test \"`echo '$''{'ac_cv_header_sys_wait_h'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 +echo "$as_me:$LINENO: checking for sys/wait.h that is POSIX.1 compatible" >&5 +echo $ECHO_N "checking for sys/wait.h that is POSIX.1 compatible... $ECHO_C" >&6 +if test "${ac_cv_header_sys_wait_h+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ #include #include #ifndef WEXITSTATUS -#define WEXITSTATUS(stat_val) ((unsigned)(stat_val) >> 8) +# define WEXITSTATUS(stat_val) ((unsigned)(stat_val) >> 8) #endif #ifndef WIFEXITED -#define WIFEXITED(stat_val) (((stat_val) & 255) == 0) -#endif -int main() { -int s; -wait (&s); -s = WIFEXITED (s) ? WEXITSTATUS (s) : 1; -; return 0; } -EOF -if { (eval echo configure:2210: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>&5; }; then - rm -rf conftest* +# define WIFEXITED(stat_val) (((stat_val) & 255) == 0) +#endif + +int +main () +{ + int s; + wait (&s); + s = WIFEXITED (s) ? WEXITSTATUS (s) : 1; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then ac_cv_header_sys_wait_h=yes else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - ac_cv_header_sys_wait_h=no + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_header_sys_wait_h=no fi -rm -f conftest* +rm -f conftest.$ac_objext conftest.$ac_ext fi - -echo "$ac_t""$ac_cv_header_sys_wait_h" 1>&6 +echo "$as_me:$LINENO: result: $ac_cv_header_sys_wait_h" >&5 +echo "${ECHO_T}$ac_cv_header_sys_wait_h" >&6 if test $ac_cv_header_sys_wait_h = yes; then - cat >> confdefs.h <<\EOF + +cat >>confdefs.h <<\_ACEOF #define HAVE_SYS_WAIT_H 1 -EOF +_ACEOF fi -for ac_hdr in fcntl.h sys/file.h sys/ioctl.h sys/time.h unistd.h +# On IRIX 5.3, sys/types and inttypes.h are conflicting. + + + + + + + + + +for ac_header in sys/types.h sys/stat.h stdlib.h string.h memory.h strings.h \ + inttypes.h stdint.h unistd.h do -ac_safe=`echo "$ac_hdr" | sed 'y%./+-%__p_%'` -echo $ac_n "checking for $ac_hdr""... $ac_c" 1>&6 -echo "configure:2234: checking for $ac_hdr" >&5 -if eval "test \"`echo '$''{'ac_cv_header_$ac_safe'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - cat > conftest.$ac_ext < -EOF -ac_try="$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out" -{ (eval echo configure:2244: \"$ac_try\") 1>&5; (eval $ac_try) 2>&5; } -ac_err=`grep -v '^ *+' conftest.out | grep -v "^conftest.${ac_ext}\$"` -if test -z "$ac_err"; then - rm -rf conftest* - eval "ac_cv_header_$ac_safe=yes" -else - echo "$ac_err" >&5 - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_header_$ac_safe=no" -fi -rm -f conftest* +as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh` +echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default + +#include <$ac_header> +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + eval "$as_ac_Header=yes" +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +eval "$as_ac_Header=no" +fi +rm -f conftest.$ac_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 +if test `eval echo '${'$as_ac_Header'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + fi -if eval "test \"`echo '$ac_cv_header_'$ac_safe`\" = yes"; then - echo "$ac_t""yes" 1>&6 - ac_tr_hdr=HAVE_`echo $ac_hdr | sed 'y%abcdefghijklmnopqrstuvwxyz./-%ABCDEFGHIJKLMNOPQRSTUVWXYZ___%'` - cat >> confdefs.h <&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 +else + # Is the header compilable? +echo "$as_me:$LINENO: checking $ac_header usability" >&5 +echo $ECHO_N "checking $ac_header usability... $ECHO_C" >&6 +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +#include <$ac_header> +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_header_compiler=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_header_compiler=no +fi +rm -f conftest.$ac_objext conftest.$ac_ext +echo "$as_me:$LINENO: result: $ac_header_compiler" >&5 +echo "${ECHO_T}$ac_header_compiler" >&6 + +# Is the header present? +echo "$as_me:$LINENO: checking $ac_header presence" >&5 +echo $ECHO_N "checking $ac_header presence... $ECHO_C" >&6 +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <$ac_header> +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + ac_header_preproc=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_header_preproc=no +fi +rm -f conftest.err conftest.$ac_ext +echo "$as_me:$LINENO: result: $ac_header_preproc" >&5 +echo "${ECHO_T}$ac_header_preproc" >&6 + +# So? What about this header? +case $ac_header_compiler:$ac_header_preproc in + yes:no ) + { echo "$as_me:$LINENO: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&5 +echo "$as_me: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5 +echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;} + ( + cat <<\_ASBOX +## ------------------------------------ ## +## Report this to bug-autoconf@gnu.org. ## +## ------------------------------------ ## +_ASBOX + ) | + sed "s/^/$as_me: WARNING: /" >&2 + ;; + no:yes ) + { echo "$as_me:$LINENO: WARNING: $ac_header: present but cannot be compiled" >&5 +echo "$as_me: WARNING: $ac_header: present but cannot be compiled" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: check for missing prerequisite headers?" >&5 +echo "$as_me: WARNING: $ac_header: check for missing prerequisite headers?" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5 +echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;} + ( + cat <<\_ASBOX +## ------------------------------------ ## +## Report this to bug-autoconf@gnu.org. ## +## ------------------------------------ ## +_ASBOX + ) | + sed "s/^/$as_me: WARNING: /" >&2 + ;; +esac +echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - echo "$ac_t""no" 1>&6 + eval "$as_ac_Header=$ac_header_preproc" +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 + fi +if test `eval echo '${'$as_ac_Header'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +fi + done -for ac_hdr in time.h sys/time.h sys/filio.h + + + +for ac_header in sys/param.h sys/time.h unistd.h do -ac_safe=`echo "$ac_hdr" | sed 'y%./+-%__p_%'` -echo $ac_n "checking for $ac_hdr""... $ac_c" 1>&6 -echo "configure:2274: checking for $ac_hdr" >&5 -if eval "test \"`echo '$''{'ac_cv_header_$ac_safe'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - cat > conftest.$ac_ext < -EOF -ac_try="$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out" -{ (eval echo configure:2284: \"$ac_try\") 1>&5; (eval $ac_try) 2>&5; } -ac_err=`grep -v '^ *+' conftest.out | grep -v "^conftest.${ac_ext}\$"` -if test -z "$ac_err"; then - rm -rf conftest* - eval "ac_cv_header_$ac_safe=yes" -else - echo "$ac_err" >&5 - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_header_$ac_safe=no" +as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh` +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 +else + # Is the header compilable? +echo "$as_me:$LINENO: checking $ac_header usability" >&5 +echo $ECHO_N "checking $ac_header usability... $ECHO_C" >&6 +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +#include <$ac_header> +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_header_compiler=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_header_compiler=no +fi +rm -f conftest.$ac_objext conftest.$ac_ext +echo "$as_me:$LINENO: result: $ac_header_compiler" >&5 +echo "${ECHO_T}$ac_header_compiler" >&6 + +# Is the header present? +echo "$as_me:$LINENO: checking $ac_header presence" >&5 +echo $ECHO_N "checking $ac_header presence... $ECHO_C" >&6 +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <$ac_header> +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + ac_header_preproc=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_header_preproc=no +fi +rm -f conftest.err conftest.$ac_ext +echo "$as_me:$LINENO: result: $ac_header_preproc" >&5 +echo "${ECHO_T}$ac_header_preproc" >&6 + +# So? What about this header? +case $ac_header_compiler:$ac_header_preproc in + yes:no ) + { echo "$as_me:$LINENO: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&5 +echo "$as_me: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5 +echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;} + ( + cat <<\_ASBOX +## ------------------------------------ ## +## Report this to bug-autoconf@gnu.org. ## +## ------------------------------------ ## +_ASBOX + ) | + sed "s/^/$as_me: WARNING: /" >&2 + ;; + no:yes ) + { echo "$as_me:$LINENO: WARNING: $ac_header: present but cannot be compiled" >&5 +echo "$as_me: WARNING: $ac_header: present but cannot be compiled" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: check for missing prerequisite headers?" >&5 +echo "$as_me: WARNING: $ac_header: check for missing prerequisite headers?" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5 +echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;} + ( + cat <<\_ASBOX +## ------------------------------------ ## +## Report this to bug-autoconf@gnu.org. ## +## ------------------------------------ ## +_ASBOX + ) | + sed "s/^/$as_me: WARNING: /" >&2 + ;; +esac +echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + eval "$as_ac_Header=$ac_header_preproc" fi -rm -f conftest* +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 + fi -if eval "test \"`echo '$ac_cv_header_'$ac_safe`\" = yes"; then - echo "$ac_t""yes" 1>&6 - ac_tr_hdr=HAVE_`echo $ac_hdr | sed 'y%abcdefghijklmnopqrstuvwxyz./-%ABCDEFGHIJKLMNOPQRSTUVWXYZ___%'` - cat >> confdefs.h <&6 +if test `eval echo '${'$as_ac_Header'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + fi + done -echo $ac_n "checking whether time.h and sys/time.h may both be included""... $ac_c" 1>&6 -echo "configure:2311: checking whether time.h and sys/time.h may both be included" >&5 -if eval "test \"`echo '$''{'ac_cv_header_time'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + +for ac_header in errno.h +do +as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh` +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 +else + # Is the header compilable? +echo "$as_me:$LINENO: checking $ac_header usability" >&5 +echo $ECHO_N "checking $ac_header usability... $ECHO_C" >&6 +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +#include <$ac_header> +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_header_compiler=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_header_compiler=no +fi +rm -f conftest.$ac_objext conftest.$ac_ext +echo "$as_me:$LINENO: result: $ac_header_compiler" >&5 +echo "${ECHO_T}$ac_header_compiler" >&6 + +# Is the header present? +echo "$as_me:$LINENO: checking $ac_header presence" >&5 +echo $ECHO_N "checking $ac_header presence... $ECHO_C" >&6 +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <$ac_header> +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + ac_header_preproc=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_header_preproc=no +fi +rm -f conftest.err conftest.$ac_ext +echo "$as_me:$LINENO: result: $ac_header_preproc" >&5 +echo "${ECHO_T}$ac_header_preproc" >&6 + +# So? What about this header? +case $ac_header_compiler:$ac_header_preproc in + yes:no ) + { echo "$as_me:$LINENO: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&5 +echo "$as_me: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5 +echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;} + ( + cat <<\_ASBOX +## ------------------------------------ ## +## Report this to bug-autoconf@gnu.org. ## +## ------------------------------------ ## +_ASBOX + ) | + sed "s/^/$as_me: WARNING: /" >&2 + ;; + no:yes ) + { echo "$as_me:$LINENO: WARNING: $ac_header: present but cannot be compiled" >&5 +echo "$as_me: WARNING: $ac_header: present but cannot be compiled" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: check for missing prerequisite headers?" >&5 +echo "$as_me: WARNING: $ac_header: check for missing prerequisite headers?" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5 +echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;} + ( + cat <<\_ASBOX +## ------------------------------------ ## +## Report this to bug-autoconf@gnu.org. ## +## ------------------------------------ ## +_ASBOX + ) | + sed "s/^/$as_me: WARNING: /" >&2 + ;; +esac +echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - cat > conftest.$ac_ext <&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 + +fi +if test `eval echo '${'$as_ac_Header'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +fi + +done + +echo "$as_me:$LINENO: checking whether time.h and sys/time.h may both be included" >&5 +echo $ECHO_N "checking whether time.h and sys/time.h may both be included... $ECHO_C" >&6 +if test "${ac_cv_header_time+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ #include #include #include -int main() { -struct tm *tp; -; return 0; } -EOF -if { (eval echo configure:2325: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>&5; }; then - rm -rf conftest* + +int +main () +{ +if ((struct tm *) 0) +return 0; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then ac_cv_header_time=yes else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - ac_cv_header_time=no + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_header_time=no fi -rm -f conftest* +rm -f conftest.$ac_objext conftest.$ac_ext fi - -echo "$ac_t""$ac_cv_header_time" 1>&6 +echo "$as_me:$LINENO: result: $ac_cv_header_time" >&5 +echo "${ECHO_T}$ac_cv_header_time" >&6 if test $ac_cv_header_time = yes; then - cat >> confdefs.h <<\EOF + +cat >>confdefs.h <<\_ACEOF #define TIME_WITH_SYS_TIME 1 -EOF +_ACEOF fi @@ -2347,231 +5030,896 @@ fi # Check for typedefs, structures, and compiler characteristics. # -echo -echo $ac_n "checking for typedefs""... $ac_c" 1>&6 -echo "configure:2353: checking for typedefs" >&5 echo +echo "$as_me:$LINENO: checking for typedefs" >&5 +echo $ECHO_N "checking for typedefs... $ECHO_C" >&6 +echo + +echo "$as_me:$LINENO: checking for an ANSI C-conforming const" >&5 +echo $ECHO_N "checking for an ANSI C-conforming const... $ECHO_C" >&6 +if test "${ac_cv_c_const+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +int +main () +{ +/* FIXME: Include the comments suggested by Paul. */ +#ifndef __cplusplus + /* Ultrix mips cc rejects this. */ + typedef int charset[2]; + const charset x; + /* SunOS 4.1.1 cc rejects this. */ + char const *const *ccp; + char **p; + /* NEC SVR4.0.2 mips cc rejects this. */ + struct point {int x, y;}; + static struct point const zero = {0,0}; + /* AIX XL C 1.02.0.0 rejects this. + It does not let you subtract one const X* pointer from another in + an arm of an if-expression whose if-part is not a constant + expression */ + const char *g = "string"; + ccp = &g + (g ? g-g : 0); + /* HPUX 7.0 cc rejects these. */ + ++ccp; + p = (char**) ccp; + ccp = (char const *const *) p; + { /* SCO 3.2v4 cc rejects this. */ + char *t; + char const *s = 0 ? (char *) 0 : (char const *) 0; + + *t++ = 0; + } + { /* Someone thinks the Sun supposedly-ANSI compiler will reject this. */ + int x[] = {25, 17}; + const int *foo = &x[0]; + ++foo; + } + { /* Sun SC1.0 ANSI compiler rejects this -- but not the above. */ + typedef const int *iptr; + iptr p = 0; + ++p; + } + { /* AIX XL C 1.02.0.0 rejects this saying + "k.c", line 2.27: 1506-025 (S) Operand must be a modifiable lvalue. */ + struct s { int j; const int *ap[3]; }; + struct s *b; b->j = 5; + } + { /* ULTRIX-32 V3.1 (Rev 9) vcc rejects this */ + const int foo = 10; + } +#endif -echo $ac_n "checking for working const""... $ac_c" 1>&6 -echo "configure:2357: checking for working const" >&5 -if eval "test \"`echo '$''{'ac_cv_c_const'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - cat > conftest.$ac_ext <j = 5; -} -{ /* ULTRIX-32 V3.1 (Rev 9) vcc rejects this */ - const int foo = 10; -} - -; return 0; } -EOF -if { (eval echo configure:2411: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>&5; }; then - rm -rf conftest* + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then ac_cv_c_const=yes else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - ac_cv_c_const=no + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_c_const=no fi -rm -f conftest* +rm -f conftest.$ac_objext conftest.$ac_ext fi - -echo "$ac_t""$ac_cv_c_const" 1>&6 +echo "$as_me:$LINENO: result: $ac_cv_c_const" >&5 +echo "${ECHO_T}$ac_cv_c_const" >&6 if test $ac_cv_c_const = no; then - cat >> confdefs.h <<\EOF -#define const -EOF + +cat >>confdefs.h <<\_ACEOF +#define const +_ACEOF fi -echo $ac_n "checking for size_t""... $ac_c" 1>&6 -echo "configure:2432: checking for size_t" >&5 -if eval "test \"`echo '$''{'ac_cv_type_size_t'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 +echo "$as_me:$LINENO: checking for stdbool.h that conforms to C99" >&5 +echo $ECHO_N "checking for stdbool.h that conforms to C99... $ECHO_C" >&6 +if test "${ac_cv_header_stdbool_h+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - cat > conftest.$ac_ext < -#if STDC_HEADERS -#include -#include + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ + +#include +#ifndef bool +# error bool is not defined #endif -EOF -if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | - egrep "(^|[^a-zA-Z_0-9])size_t[^a-zA-Z_0-9]" >/dev/null 2>&1; then - rm -rf conftest* - ac_cv_type_size_t=yes +#ifndef false +# error false is not defined +#endif +#if false +# error false is not 0 +#endif +#ifndef true +# error true is not defined +#endif +#if true != 1 +# error true is not 1 +#endif +#ifndef __bool_true_false_are_defined +# error __bool_true_false_are_defined is not defined +#endif + + struct s { _Bool s: 1; _Bool t; } s; + + char a[true == 1 ? 1 : -1]; + char b[false == 0 ? 1 : -1]; + char c[__bool_true_false_are_defined == 1 ? 1 : -1]; + char d[(bool) -0.5 == true ? 1 : -1]; + bool e = &s; + char f[(_Bool) -0.0 == false ? 1 : -1]; + char g[true]; + char h[sizeof (_Bool)]; + char i[sizeof s.t]; + +int +main () +{ + return !a + !b + !c + !d + !e + !f + !g + !h + !i; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_header_stdbool_h=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_header_stdbool_h=no +fi +rm -f conftest.$ac_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_header_stdbool_h" >&5 +echo "${ECHO_T}$ac_cv_header_stdbool_h" >&6 +echo "$as_me:$LINENO: checking for _Bool" >&5 +echo $ECHO_N "checking for _Bool... $ECHO_C" >&6 +if test "${ac_cv_type__Bool+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +int +main () +{ +if ((_Bool *) 0) + return 0; +if (sizeof (_Bool)) + return 0; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_type__Bool=yes else - rm -rf conftest* - ac_cv_type_size_t=no + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_type__Bool=no fi -rm -f conftest* +rm -f conftest.$ac_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_type__Bool" >&5 +echo "${ECHO_T}$ac_cv_type__Bool" >&6 +if test $ac_cv_type__Bool = yes; then + +cat >>confdefs.h <<_ACEOF +#define HAVE__BOOL 1 +_ACEOF + fi -echo "$ac_t""$ac_cv_type_size_t" 1>&6 -if test $ac_cv_type_size_t = no; then - cat >> confdefs.h <<\EOF + +if test $ac_cv_header_stdbool_h = yes; then + +cat >>confdefs.h <<\_ACEOF +#define HAVE_STDBOOL_H 1 +_ACEOF + +fi + +echo "$as_me:$LINENO: checking for inline" >&5 +echo $ECHO_N "checking for inline... $ECHO_C" >&6 +if test "${ac_cv_c_inline+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_c_inline=no +for ac_kw in inline __inline__ __inline; do + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#ifndef __cplusplus +typedef int foo_t; +static $ac_kw foo_t static_foo () {return 0; } +$ac_kw foo_t foo () {return 0; } +#endif + +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_c_inline=$ac_kw; break +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.$ac_objext conftest.$ac_ext +done + +fi +echo "$as_me:$LINENO: result: $ac_cv_c_inline" >&5 +echo "${ECHO_T}$ac_cv_c_inline" >&6 +case $ac_cv_c_inline in + inline | yes) ;; + no) +cat >>confdefs.h <<\_ACEOF +#define inline +_ACEOF + ;; + *) cat >>confdefs.h <<_ACEOF +#define inline $ac_cv_c_inline +_ACEOF + ;; +esac + +echo "$as_me:$LINENO: checking for pid_t" >&5 +echo $ECHO_N "checking for pid_t... $ECHO_C" >&6 +if test "${ac_cv_type_pid_t+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +int +main () +{ +if ((pid_t *) 0) + return 0; +if (sizeof (pid_t)) + return 0; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_type_pid_t=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_type_pid_t=no +fi +rm -f conftest.$ac_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_type_pid_t" >&5 +echo "${ECHO_T}$ac_cv_type_pid_t" >&6 +if test $ac_cv_type_pid_t = yes; then + : +else + +cat >>confdefs.h <<_ACEOF +#define pid_t int +_ACEOF + +fi + +echo "$as_me:$LINENO: checking for size_t" >&5 +echo $ECHO_N "checking for size_t... $ECHO_C" >&6 +if test "${ac_cv_type_size_t+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +int +main () +{ +if ((size_t *) 0) + return 0; +if (sizeof (size_t)) + return 0; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_type_size_t=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_type_size_t=no +fi +rm -f conftest.$ac_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_type_size_t" >&5 +echo "${ECHO_T}$ac_cv_type_size_t" >&6 +if test $ac_cv_type_size_t = yes; then + : +else + +cat >>confdefs.h <<_ACEOF #define size_t unsigned -EOF +_ACEOF fi -echo $ac_n "checking whether time.h and sys/time.h may both be included""... $ac_c" 1>&6 -echo "configure:2465: checking whether time.h and sys/time.h may both be included" >&5 -if eval "test \"`echo '$''{'ac_cv_header_time'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 +echo "$as_me:$LINENO: checking whether time.h and sys/time.h may both be included" >&5 +echo $ECHO_N "checking whether time.h and sys/time.h may both be included... $ECHO_C" >&6 +if test "${ac_cv_header_time+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ #include #include #include -int main() { -struct tm *tp; -; return 0; } -EOF -if { (eval echo configure:2479: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>&5; }; then - rm -rf conftest* + +int +main () +{ +if ((struct tm *) 0) +return 0; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then ac_cv_header_time=yes else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - ac_cv_header_time=no + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_header_time=no fi -rm -f conftest* +rm -f conftest.$ac_objext conftest.$ac_ext fi - -echo "$ac_t""$ac_cv_header_time" 1>&6 +echo "$as_me:$LINENO: result: $ac_cv_header_time" >&5 +echo "${ECHO_T}$ac_cv_header_time" >&6 if test $ac_cv_header_time = yes; then - cat >> confdefs.h <<\EOF + +cat >>confdefs.h <<\_ACEOF #define TIME_WITH_SYS_TIME 1 -EOF +_ACEOF fi -echo $ac_n "checking whether struct tm is in sys/time.h or time.h""... $ac_c" 1>&6 -echo "configure:2500: checking whether struct tm is in sys/time.h or time.h" >&5 -if eval "test \"`echo '$''{'ac_cv_struct_tm'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 +echo "$as_me:$LINENO: checking whether struct tm is in sys/time.h or time.h" >&5 +echo $ECHO_N "checking whether struct tm is in sys/time.h or time.h... $ECHO_C" >&6 +if test "${ac_cv_struct_tm+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ #include #include -int main() { + +int +main () +{ struct tm *tp; tp->tm_sec; -; return 0; } -EOF -if { (eval echo configure:2513: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>&5; }; then - rm -rf conftest* + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then ac_cv_struct_tm=time.h else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - ac_cv_struct_tm=sys/time.h + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_struct_tm=sys/time.h fi -rm -f conftest* +rm -f conftest.$ac_objext conftest.$ac_ext fi - -echo "$ac_t""$ac_cv_struct_tm" 1>&6 +echo "$as_me:$LINENO: result: $ac_cv_struct_tm" >&5 +echo "${ECHO_T}$ac_cv_struct_tm" >&6 if test $ac_cv_struct_tm = sys/time.h; then - cat >> confdefs.h <<\EOF + +cat >>confdefs.h <<\_ACEOF #define TM_IN_SYS_TIME 1 -EOF +_ACEOF fi -echo -echo $ac_n "checking for compiler characteristics""... $ac_c" 1>&6 -echo "configure:2536: checking for compiler characteristics" >&5 +echo +echo "$as_me:$LINENO: checking for compiler characteristics" >&5 +echo $ECHO_N "checking for compiler characteristics... $ECHO_C" >&6 echo -echo $ac_n "checking size of long""... $ac_c" 1>&6 -echo "configure:2540: checking size of long" >&5 -if eval "test \"`echo '$''{'ac_cv_sizeof_long'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else +echo "$as_me:$LINENO: checking for long" >&5 +echo $ECHO_N "checking for long... $ECHO_C" >&6 +if test "${ac_cv_type_long+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +int +main () +{ +if ((long *) 0) + return 0; +if (sizeof (long)) + return 0; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_type_long=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_type_long=no +fi +rm -f conftest.$ac_objext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_type_long" >&5 +echo "${ECHO_T}$ac_cv_type_long" >&6 + +echo "$as_me:$LINENO: checking size of long" >&5 +echo $ECHO_N "checking size of long... $ECHO_C" >&6 +if test "${ac_cv_sizeof_long+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test "$ac_cv_type_long" = yes; then + # The cast to unsigned long works around a bug in the HP C Compiler + # version HP92453-01 B.11.11.23709.GP, which incorrectly rejects + # declarations like `int a3[[(sizeof (unsigned char)) >= 0]];'. + # This bug is HP SR number 8606223364. if test "$cross_compiling" = yes; then - { echo "configure: error: can not run test program while cross compiling" 1>&2; exit 1; } + # Depending upon the size, compute the lo and hi bounds. +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +int +main () +{ +static int test_array [1 - 2 * !(((long) (sizeof (long))) >= 0)]; +test_array [0] = 0 + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_lo=0 ac_mid=0 + while :; do + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +int +main () +{ +static int test_array [1 - 2 * !(((long) (sizeof (long))) <= $ac_mid)]; +test_array [0] = 0 + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_hi=$ac_mid; break +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_lo=`expr $ac_mid + 1` + if test $ac_lo -le $ac_mid; then + ac_lo= ac_hi= + break + fi + ac_mid=`expr 2 '*' $ac_mid + 1` +fi +rm -f conftest.$ac_objext conftest.$ac_ext + done +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +int +main () +{ +static int test_array [1 - 2 * !(((long) (sizeof (long))) < 0)]; +test_array [0] = 0 + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_hi=-1 ac_mid=-1 + while :; do + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +int +main () +{ +static int test_array [1 - 2 * !(((long) (sizeof (long))) >= $ac_mid)]; +test_array [0] = 0 + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_lo=$ac_mid; break +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_hi=`expr '(' $ac_mid ')' - 1` + if test $ac_mid -le $ac_hi; then + ac_lo= ac_hi= + break + fi + ac_mid=`expr 2 '*' $ac_mid` +fi +rm -f conftest.$ac_objext conftest.$ac_ext + done +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_lo= ac_hi= +fi +rm -f conftest.$ac_objext conftest.$ac_ext +fi +rm -f conftest.$ac_objext conftest.$ac_ext +# Binary search between lo and hi bounds. +while test "x$ac_lo" != "x$ac_hi"; do + ac_mid=`expr '(' $ac_hi - $ac_lo ')' / 2 + $ac_lo` + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +int +main () +{ +static int test_array [1 - 2 * !(((long) (sizeof (long))) <= $ac_mid)]; +test_array [0] = 0 + + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_hi=$ac_mid +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_lo=`expr '(' $ac_mid ')' + 1` +fi +rm -f conftest.$ac_objext conftest.$ac_ext +done +case $ac_lo in +?*) ac_cv_sizeof_long=$ac_lo;; +'') { { echo "$as_me:$LINENO: error: cannot compute sizeof (long), 77 +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot compute sizeof (long), 77 +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } ;; +esac else - cat > conftest.$ac_ext <&5 +echo "$as_me: error: cannot run test program while cross compiling +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +long longval () { return (long) (sizeof (long)); } +unsigned long ulongval () { return (long) (sizeof (long)); } #include -main() +#include +int +main () { - FILE *f=fopen("conftestval", "w"); - if (!f) exit(1); - fprintf(f, "%d\n", sizeof(long)); - exit(0); + + FILE *f = fopen ("conftest.val", "w"); + if (! f) + exit (1); + if (((long) (sizeof (long))) < 0) + { + long i = longval (); + if (i != ((long) (sizeof (long)))) + exit (1); + fprintf (f, "%ld\n", i); + } + else + { + unsigned long i = ulongval (); + if (i != ((long) (sizeof (long)))) + exit (1); + fprintf (f, "%lu\n", i); + } + exit (ferror (f) || fclose (f) != 0); + + ; + return 0; } -EOF -if { (eval echo configure:2559: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext} && (./conftest; exit) 2>/dev/null -then - ac_cv_sizeof_long=`cat conftestval` +_ACEOF +rm -f conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { ac_try='./conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_sizeof_long=`cat conftest.val` +else + echo "$as_me: program exited with status $ac_status" >&5 +echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +( exit $ac_status ) +{ { echo "$as_me:$LINENO: error: cannot compute sizeof (long), 77 +See \`config.log' for more details." >&5 +echo "$as_me: error: cannot compute sizeof (long), 77 +See \`config.log' for more details." >&2;} + { (exit 1); exit 1; }; } +fi +rm -f core core.* *.core gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext +fi +fi +rm -f conftest.val else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -fr conftest* ac_cv_sizeof_long=0 fi -rm -fr conftest* fi - -fi -echo "$ac_t""$ac_cv_sizeof_long" 1>&6 -cat >> confdefs.h <&5 +echo "${ECHO_T}$ac_cv_sizeof_long" >&6 +cat >>confdefs.h <<_ACEOF #define SIZEOF_LONG $ac_cv_sizeof_long -EOF +_ACEOF @@ -2581,68 +5929,918 @@ EOF # echo -echo $ac_n "checking for library functions""... $ac_c" 1>&6 -echo "configure:2586: checking for library functions" >&5 +echo "$as_me:$LINENO: checking for library functions" >&5 +echo $ECHO_N "checking for library functions... $ECHO_C" >&6 echo -echo $ac_n "checking whether setvbuf arguments are reversed""... $ac_c" 1>&6 -echo "configure:2590: checking whether setvbuf arguments are reversed" >&5 -if eval "test \"`echo '$''{'ac_cv_func_setvbuf_reversed'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 + + +for ac_header in unistd.h vfork.h +do +as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh` +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 +else + # Is the header compilable? +echo "$as_me:$LINENO: checking $ac_header usability" >&5 +echo $ECHO_N "checking $ac_header usability... $ECHO_C" >&6 +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +#include <$ac_header> +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_header_compiler=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_header_compiler=no +fi +rm -f conftest.$ac_objext conftest.$ac_ext +echo "$as_me:$LINENO: result: $ac_header_compiler" >&5 +echo "${ECHO_T}$ac_header_compiler" >&6 + +# Is the header present? +echo "$as_me:$LINENO: checking $ac_header presence" >&5 +echo $ECHO_N "checking $ac_header presence... $ECHO_C" >&6 +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <$ac_header> +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + ac_header_preproc=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_header_preproc=no +fi +rm -f conftest.err conftest.$ac_ext +echo "$as_me:$LINENO: result: $ac_header_preproc" >&5 +echo "${ECHO_T}$ac_header_preproc" >&6 + +# So? What about this header? +case $ac_header_compiler:$ac_header_preproc in + yes:no ) + { echo "$as_me:$LINENO: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&5 +echo "$as_me: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5 +echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;} + ( + cat <<\_ASBOX +## ------------------------------------ ## +## Report this to bug-autoconf@gnu.org. ## +## ------------------------------------ ## +_ASBOX + ) | + sed "s/^/$as_me: WARNING: /" >&2 + ;; + no:yes ) + { echo "$as_me:$LINENO: WARNING: $ac_header: present but cannot be compiled" >&5 +echo "$as_me: WARNING: $ac_header: present but cannot be compiled" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: check for missing prerequisite headers?" >&5 +echo "$as_me: WARNING: $ac_header: check for missing prerequisite headers?" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5 +echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;} + ( + cat <<\_ASBOX +## ------------------------------------ ## +## Report this to bug-autoconf@gnu.org. ## +## ------------------------------------ ## +_ASBOX + ) | + sed "s/^/$as_me: WARNING: /" >&2 + ;; +esac +echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + eval "$as_ac_Header=$ac_header_preproc" +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 + +fi +if test `eval echo '${'$as_ac_Header'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +fi + +done + + + +for ac_func in fork vfork +do +as_ac_var=`echo "ac_cv_func_$ac_func" | $as_tr_sh` +echo "$as_me:$LINENO: checking for $ac_func" >&5 +echo $ECHO_N "checking for $ac_func... $ECHO_C" >&6 +if eval "test \"\${$as_ac_var+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +/* System header to define __stub macros and hopefully few prototypes, + which can conflict with char $ac_func (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ +#ifdef __STDC__ +# include +#else +# include +#endif +/* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +{ +#endif +/* We use char because int might match the return type of a gcc2 + builtin and then its argument prototype would still apply. */ +char $ac_func (); +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined (__stub_$ac_func) || defined (__stub___$ac_func) +choke me +#else +char (*f) () = $ac_func; +#endif +#ifdef __cplusplus +} +#endif + +int +main () +{ +return f != $ac_func; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + eval "$as_ac_var=yes" +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +eval "$as_ac_var=no" +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_var'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_var'}'`" >&6 +if test `eval echo '${'$as_ac_var'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_func" | $as_tr_cpp` 1 +_ACEOF + +fi +done + +if test "x$ac_cv_func_fork" = xyes; then + echo "$as_me:$LINENO: checking for working fork" >&5 +echo $ECHO_N "checking for working fork... $ECHO_C" >&6 +if test "${ac_cv_func_fork_works+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else if test "$cross_compiling" = yes; then - { echo "configure: error: can not run test program while cross compiling" 1>&2; exit 1; } + ac_cv_func_fork_works=cross +else + cat >conftest.$ac_ext <<_ACEOF +/* By Ruediger Kuhlmann. */ + #include + #if HAVE_UNISTD_H + # include + #endif + /* Some systems only have a dummy stub for fork() */ + int main () + { + if (fork() < 0) + exit (1); + exit (0); + } +_ACEOF +rm -f conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { ac_try='./conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_func_fork_works=yes +else + echo "$as_me: program exited with status $ac_status" >&5 +echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +( exit $ac_status ) +ac_cv_func_fork_works=no +fi +rm -f core core.* *.core gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext +fi +fi +echo "$as_me:$LINENO: result: $ac_cv_func_fork_works" >&5 +echo "${ECHO_T}$ac_cv_func_fork_works" >&6 + +else + ac_cv_func_fork_works=$ac_cv_func_fork +fi +if test "x$ac_cv_func_fork_works" = xcross; then + case $host in + *-*-amigaos* | *-*-msdosdjgpp*) + # Override, as these systems have only a dummy fork() stub + ac_cv_func_fork_works=no + ;; + *) + ac_cv_func_fork_works=yes + ;; + esac + { echo "$as_me:$LINENO: WARNING: result $ac_cv_func_fork_works guessed because of cross compilation" >&5 +echo "$as_me: WARNING: result $ac_cv_func_fork_works guessed because of cross compilation" >&2;} +fi +ac_cv_func_vfork_works=$ac_cv_func_vfork +if test "x$ac_cv_func_vfork" = xyes; then + echo "$as_me:$LINENO: checking for working vfork" >&5 +echo $ECHO_N "checking for working vfork... $ECHO_C" >&6 +if test "${ac_cv_func_vfork_works+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +/* Thanks to Paul Eggert for this test. */ #include -/* If setvbuf has the reversed format, exit 0. */ -main () { - /* This call has the arguments reversed. - A reversed system may check and see that the address of main - is not _IOLBF, _IONBF, or _IOFBF, and return nonzero. */ - if (setvbuf(stdout, _IOLBF, (char *) main, BUFSIZ) != 0) - exit(1); - putc('\r', stdout); - exit(0); /* Non-reversed systems segv here. */ -} -EOF -if { (eval echo configure:2612: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext} && (./conftest; exit) 2>/dev/null -then - ac_cv_func_setvbuf_reversed=yes +#include +#include +#include +#include +#if HAVE_UNISTD_H +# include +#endif +#if HAVE_VFORK_H +# include +#endif +/* On some sparc systems, changes by the child to local and incoming + argument registers are propagated back to the parent. The compiler + is told about this with #include , but some compilers + (e.g. gcc -O) don't grok . Test for this by using a + static variable whose address is put into a register that is + clobbered by the vfork. */ +static void +#ifdef __cplusplus +sparc_address_test (int arg) +# else +sparc_address_test (arg) int arg; +#endif +{ + static pid_t child; + if (!child) { + child = vfork (); + if (child < 0) { + perror ("vfork"); + _exit(2); + } + if (!child) { + arg = getpid(); + write(-1, "", 0); + _exit (arg); + } + } +} + +int +main () +{ + pid_t parent = getpid (); + pid_t child; + + sparc_address_test (0); + + child = vfork (); + + if (child == 0) { + /* Here is another test for sparc vfork register problems. This + test uses lots of local variables, at least as many local + variables as main has allocated so far including compiler + temporaries. 4 locals are enough for gcc 1.40.3 on a Solaris + 4.1.3 sparc, but we use 8 to be safe. A buggy compiler should + reuse the register of parent for one of the local variables, + since it will think that parent can't possibly be used any more + in this routine. Assigning to the local variable will thus + munge parent in the parent process. */ + pid_t + p = getpid(), p1 = getpid(), p2 = getpid(), p3 = getpid(), + p4 = getpid(), p5 = getpid(), p6 = getpid(), p7 = getpid(); + /* Convince the compiler that p..p7 are live; otherwise, it might + use the same hardware register for all 8 local variables. */ + if (p != p1 || p != p2 || p != p3 || p != p4 + || p != p5 || p != p6 || p != p7) + _exit(1); + + /* On some systems (e.g. IRIX 3.3), vfork doesn't separate parent + from child file descriptors. If the child closes a descriptor + before it execs or exits, this munges the parent's descriptor + as well. Test for this by closing stdout in the child. */ + _exit(close(fileno(stdout)) != 0); + } else { + int status; + struct stat st; + + while (wait(&status) != child) + ; + exit( + /* Was there some problem with vforking? */ + child < 0 + + /* Did the child fail? (This shouldn't happen.) */ + || status + + /* Did the vfork/compiler bug occur? */ + || parent != getpid() + + /* Did the file descriptor bug occur? */ + || fstat(fileno(stdout), &st) != 0 + ); + } +} +_ACEOF +rm -f conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { ac_try='./conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_func_vfork_works=yes else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -fr conftest* - ac_cv_func_setvbuf_reversed=no + echo "$as_me: program exited with status $ac_status" >&5 +echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +( exit $ac_status ) +ac_cv_func_vfork_works=no +fi +rm -f core core.* *.core gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext +fi +fi +echo "$as_me:$LINENO: result: $ac_cv_func_vfork_works" >&5 +echo "${ECHO_T}$ac_cv_func_vfork_works" >&6 + +fi; +if test "x$ac_cv_func_fork_works" = xcross; then + ac_cv_func_vfork_works=ac_cv_func_vfork + { echo "$as_me:$LINENO: WARNING: result $ac_cv_func_vfork_works guessed because of cross compilation" >&5 +echo "$as_me: WARNING: result $ac_cv_func_vfork_works guessed because of cross compilation" >&2;} +fi + +if test "x$ac_cv_func_vfork_works" = xyes; then + +cat >>confdefs.h <<\_ACEOF +#define HAVE_WORKING_VFORK 1 +_ACEOF + +else + +cat >>confdefs.h <<\_ACEOF +#define vfork fork +_ACEOF + +fi +if test "x$ac_cv_func_fork_works" = xyes; then + +cat >>confdefs.h <<\_ACEOF +#define HAVE_WORKING_FORK 1 +_ACEOF + +fi + +if test $ac_cv_c_compiler_gnu = yes; then + echo "$as_me:$LINENO: checking whether $CC needs -traditional" >&5 +echo $ECHO_N "checking whether $CC needs -traditional... $ECHO_C" >&6 +if test "${ac_cv_prog_gcc_traditional+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_pattern="Autoconf.*'x'" + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +Autoconf TIOCGETP +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "$ac_pattern" >/dev/null 2>&1; then + ac_cv_prog_gcc_traditional=yes +else + ac_cv_prog_gcc_traditional=no +fi +rm -f conftest* + + + if test $ac_cv_prog_gcc_traditional = no; then + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +Autoconf TCGETA +_ACEOF +if (eval "$ac_cpp conftest.$ac_ext") 2>&5 | + $EGREP "$ac_pattern" >/dev/null 2>&1; then + ac_cv_prog_gcc_traditional=yes +fi +rm -f conftest* + + fi +fi +echo "$as_me:$LINENO: result: $ac_cv_prog_gcc_traditional" >&5 +echo "${ECHO_T}$ac_cv_prog_gcc_traditional" >&6 + if test $ac_cv_prog_gcc_traditional = yes; then + CC="$CC -traditional" + fi +fi + + +for ac_header in stdlib.h +do +as_ac_Header=`echo "ac_cv_header_$ac_header" | $as_tr_sh` +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 +else + # Is the header compilable? +echo "$as_me:$LINENO: checking $ac_header usability" >&5 +echo $ECHO_N "checking $ac_header usability... $ECHO_C" >&6 +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +$ac_includes_default +#include <$ac_header> +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_header_compiler=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_header_compiler=no +fi +rm -f conftest.$ac_objext conftest.$ac_ext +echo "$as_me:$LINENO: result: $ac_header_compiler" >&5 +echo "${ECHO_T}$ac_header_compiler" >&6 + +# Is the header present? +echo "$as_me:$LINENO: checking $ac_header presence" >&5 +echo $ECHO_N "checking $ac_header presence... $ECHO_C" >&6 +cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include <$ac_header> +_ACEOF +if { (eval echo "$as_me:$LINENO: \"$ac_cpp conftest.$ac_ext\"") >&5 + (eval $ac_cpp conftest.$ac_ext) 2>conftest.er1 + ac_status=$? + grep -v '^ *+' conftest.er1 >conftest.err + rm -f conftest.er1 + cat conftest.err >&5 + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } >/dev/null; then + if test -s conftest.err; then + ac_cpp_err=$ac_c_preproc_warn_flag + else + ac_cpp_err= + fi +else + ac_cpp_err=yes +fi +if test -z "$ac_cpp_err"; then + ac_header_preproc=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + + ac_header_preproc=no +fi +rm -f conftest.err conftest.$ac_ext +echo "$as_me:$LINENO: result: $ac_header_preproc" >&5 +echo "${ECHO_T}$ac_header_preproc" >&6 + +# So? What about this header? +case $ac_header_compiler:$ac_header_preproc in + yes:no ) + { echo "$as_me:$LINENO: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&5 +echo "$as_me: WARNING: $ac_header: accepted by the compiler, rejected by the preprocessor!" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5 +echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;} + ( + cat <<\_ASBOX +## ------------------------------------ ## +## Report this to bug-autoconf@gnu.org. ## +## ------------------------------------ ## +_ASBOX + ) | + sed "s/^/$as_me: WARNING: /" >&2 + ;; + no:yes ) + { echo "$as_me:$LINENO: WARNING: $ac_header: present but cannot be compiled" >&5 +echo "$as_me: WARNING: $ac_header: present but cannot be compiled" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: check for missing prerequisite headers?" >&5 +echo "$as_me: WARNING: $ac_header: check for missing prerequisite headers?" >&2;} + { echo "$as_me:$LINENO: WARNING: $ac_header: proceeding with the preprocessor's result" >&5 +echo "$as_me: WARNING: $ac_header: proceeding with the preprocessor's result" >&2;} + ( + cat <<\_ASBOX +## ------------------------------------ ## +## Report this to bug-autoconf@gnu.org. ## +## ------------------------------------ ## +_ASBOX + ) | + sed "s/^/$as_me: WARNING: /" >&2 + ;; +esac +echo "$as_me:$LINENO: checking for $ac_header" >&5 +echo $ECHO_N "checking for $ac_header... $ECHO_C" >&6 +if eval "test \"\${$as_ac_Header+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + eval "$as_ac_Header=$ac_header_preproc" +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_Header'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_Header'}'`" >&6 + +fi +if test `eval echo '${'$as_ac_Header'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_header" | $as_tr_cpp` 1 +_ACEOF + +fi + +done + +echo "$as_me:$LINENO: checking for GNU libc compatible malloc" >&5 +echo $ECHO_N "checking for GNU libc compatible malloc... $ECHO_C" >&6 +if test "${ac_cv_func_malloc_0_nonnull+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + if test "$cross_compiling" = yes; then + ac_cv_func_malloc_0_nonnull=no +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#if STDC_HEADERS || HAVE_STDLIB_H +# include +#else +char *malloc (); +#endif + +int +main () +{ +exit (malloc (0) ? 0 : 1); + ; + return 0; +} +_ACEOF +rm -f conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { ac_try='./conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_func_malloc_0_nonnull=yes +else + echo "$as_me: program exited with status $ac_status" >&5 +echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +( exit $ac_status ) +ac_cv_func_malloc_0_nonnull=no +fi +rm -f core core.* *.core gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext fi -rm -fr conftest* fi +echo "$as_me:$LINENO: result: $ac_cv_func_malloc_0_nonnull" >&5 +echo "${ECHO_T}$ac_cv_func_malloc_0_nonnull" >&6 +if test $ac_cv_func_malloc_0_nonnull = yes; then +cat >>confdefs.h <<\_ACEOF +#define HAVE_MALLOC 1 +_ACEOF + +else + cat >>confdefs.h <<\_ACEOF +#define HAVE_MALLOC 0 +_ACEOF + + LIBOBJS="$LIBOBJS malloc.$ac_objext" + +cat >>confdefs.h <<\_ACEOF +#define malloc rpl_malloc +_ACEOF + +fi + + + +echo "$as_me:$LINENO: checking for function prototypes" >&5 +echo $ECHO_N "checking for function prototypes... $ECHO_C" >&6 +if test "$ac_cv_prog_cc_stdc" != no; then + echo "$as_me:$LINENO: result: yes" >&5 +echo "${ECHO_T}yes" >&6 + +cat >>confdefs.h <<\_ACEOF +#define PROTOTYPES 1 +_ACEOF + + +cat >>confdefs.h <<\_ACEOF +#define __PROTOTYPES 1 +_ACEOF + +else + echo "$as_me:$LINENO: result: no" >&5 +echo "${ECHO_T}no" >&6 +fi + +echo "$as_me:$LINENO: checking whether setvbuf arguments are reversed" >&5 +echo $ECHO_N "checking whether setvbuf arguments are reversed... $ECHO_C" >&6 +if test "${ac_cv_func_setvbuf_reversed+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + ac_cv_func_setvbuf_reversed=no + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +# if PROTOTYPES + int (setvbuf) (FILE *, int, char *, size_t); +# endif +int +main () +{ +char buf; return setvbuf (stdout, _IOLBF, &buf, 1); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +# if PROTOTYPES + int (setvbuf) (FILE *, int, char *, size_t); +# endif +int +main () +{ +char buf; return setvbuf (stdout, &buf, _IOLBF, 1); + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + # It compiles and links either way, so it must not be declared + # with a prototype and most likely this is a K&R C compiler. + # Try running it. + if test "$cross_compiling" = yes; then + : # Assume setvbuf is not reversed when cross-compiling. +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +#include +int +main () +{ +/* This call has the arguments reversed. + A reversed system may check and see that the address of buf + is not _IOLBF, _IONBF, or _IOFBF, and return nonzero. */ + char buf; + if (setvbuf (stdout, _IOLBF, &buf, 1) != 0) + exit (1); + putchar ('\r'); + exit (0); /* Non-reversed systems SEGV here. */ + ; + return 0; +} +_ACEOF +rm -f conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && { ac_try='./conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + ac_cv_func_setvbuf_reversed=yes +else + echo "$as_me: program exited with status $ac_status" >&5 +echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +( exit $ac_status ) rm -f core core.* *.core fi +rm -f core core.* *.core gmon.out bb.out conftest$ac_exeext conftest.$ac_objext conftest.$ac_ext +fi + ac_cv_func_setvbuf_reversed=yes +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 -echo "$ac_t""$ac_cv_func_setvbuf_reversed" 1>&6 +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: $ac_cv_func_setvbuf_reversed" >&5 +echo "${ECHO_T}$ac_cv_func_setvbuf_reversed" >&6 if test $ac_cv_func_setvbuf_reversed = yes; then - cat >> confdefs.h <<\EOF + +cat >>confdefs.h <<\_ACEOF #define SETVBUF_REVERSED 1 -EOF +_ACEOF fi -echo $ac_n "checking return type of signal handlers""... $ac_c" 1>&6 -echo "configure:2636: checking return type of signal handlers" >&5 -if eval "test \"`echo '$''{'ac_cv_type_signal'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 +echo "$as_me:$LINENO: checking return type of signal handlers" >&5 +echo $ECHO_N "checking return type of signal handlers... $ECHO_C" >&6 +if test "${ac_cv_type_signal+set}" = set; then + echo $ECHO_N "(cached) $ECHO_C" >&6 else - cat > conftest.$ac_ext <conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ #include #include #ifdef signal -#undef signal +# undef signal #endif #ifdef __cplusplus extern "C" void (*signal (int, void (*)(int)))(int); @@ -2650,190 +6848,387 @@ extern "C" void (*signal (int, void (*)(int)))(int); void (*signal ()) (); #endif -int main() { +int +main () +{ int i; -; return 0; } -EOF -if { (eval echo configure:2658: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>&5; }; then - rm -rf conftest* + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext +if { (eval echo "$as_me:$LINENO: \"$ac_compile\"") >&5 + (eval $ac_compile) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest.$ac_objext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then ac_cv_type_signal=void else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - ac_cv_type_signal=int + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +ac_cv_type_signal=int fi -rm -f conftest* +rm -f conftest.$ac_objext conftest.$ac_ext fi +echo "$as_me:$LINENO: result: $ac_cv_type_signal" >&5 +echo "${ECHO_T}$ac_cv_type_signal" >&6 -echo "$ac_t""$ac_cv_type_signal" 1>&6 -cat >> confdefs.h <>confdefs.h <<_ACEOF #define RETSIGTYPE $ac_cv_type_signal -EOF +_ACEOF + + -for ac_func in gethostname gettimeofday strstr strtol + + + + +for ac_func in dup2 gethostname gettimeofday memset pow strcasecmp do -echo $ac_n "checking for $ac_func""... $ac_c" 1>&6 -echo "configure:2679: checking for $ac_func" >&5 -if eval "test \"`echo '$''{'ac_cv_func_$ac_func'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - cat > conftest.$ac_ext <&5 +echo $ECHO_N "checking for $ac_func... $ECHO_C" >&6 +if eval "test \"\${$as_ac_var+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ /* System header to define __stub macros and hopefully few prototypes, - which can conflict with char $ac_func(); below. */ -#include + which can conflict with char $ac_func (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ +#ifdef __STDC__ +# include +#else +# include +#endif /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +{ +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char $ac_func(); + builtin and then its argument prototype would still apply. */ +char $ac_func (); +/* The GNU C library defines this for functions which it implements + to always fail with ENOSYS. Some functions are actually named + something starting with __ and the normal name is an alias. */ +#if defined (__stub_$ac_func) || defined (__stub___$ac_func) +choke me +#else +char (*f) () = $ac_func; +#endif +#ifdef __cplusplus +} +#endif -int main() { +int +main () +{ +return f != $ac_func; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + eval "$as_ac_var=yes" +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +eval "$as_ac_var=no" +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_var'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_var'}'`" >&6 +if test `eval echo '${'$as_ac_var'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_func" | $as_tr_cpp` 1 +_ACEOF +fi +done + + + + + + +for ac_func in strchr strerror strrchr strstr strtol +do +as_ac_var=`echo "ac_cv_func_$ac_func" | $as_tr_sh` +echo "$as_me:$LINENO: checking for $ac_func" >&5 +echo $ECHO_N "checking for $ac_func... $ECHO_C" >&6 +if eval "test \"\${$as_ac_var+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ +/* System header to define __stub macros and hopefully few prototypes, + which can conflict with char $ac_func (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ +#ifdef __STDC__ +# include +#else +# include +#endif +/* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +{ +#endif +/* We use char because int might match the return type of a gcc2 + builtin and then its argument prototype would still apply. */ +char $ac_func (); /* The GNU C library defines this for functions which it implements to always fail with ENOSYS. Some functions are actually named something starting with __ and the normal name is an alias. */ #if defined (__stub_$ac_func) || defined (__stub___$ac_func) choke me #else -$ac_func(); +char (*f) () = $ac_func; +#endif +#ifdef __cplusplus +} #endif -; return 0; } -EOF -if { (eval echo configure:2707: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_func_$ac_func=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_func_$ac_func=no" -fi -rm -f conftest* -fi +int +main () +{ +return f != $ac_func; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + eval "$as_ac_var=yes" +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +eval "$as_ac_var=no" +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_var'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_var'}'`" >&6 +if test `eval echo '${'$as_ac_var'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_func" | $as_tr_cpp` 1 +_ACEOF -if eval "test \"`echo '$ac_cv_func_'$ac_func`\" = yes"; then - echo "$ac_t""yes" 1>&6 - ac_tr_func=HAVE_`echo $ac_func | tr 'abcdefghijklmnopqrstuvwxyz' 'ABCDEFGHIJKLMNOPQRSTUVWXYZ'` - cat >> confdefs.h <&6 fi done + + for ac_func in memcpy bcopy do -echo $ac_n "checking for $ac_func""... $ac_c" 1>&6 -echo "configure:2734: checking for $ac_func" >&5 -if eval "test \"`echo '$''{'ac_cv_func_$ac_func'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - cat > conftest.$ac_ext <&5 +echo $ECHO_N "checking for $ac_func... $ECHO_C" >&6 +if eval "test \"\${$as_ac_var+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ /* System header to define __stub macros and hopefully few prototypes, - which can conflict with char $ac_func(); below. */ -#include + which can conflict with char $ac_func (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ +#ifdef __STDC__ +# include +#else +# include +#endif /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +{ +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char $ac_func(); - -int main() { - + builtin and then its argument prototype would still apply. */ +char $ac_func (); /* The GNU C library defines this for functions which it implements to always fail with ENOSYS. Some functions are actually named something starting with __ and the normal name is an alias. */ #if defined (__stub_$ac_func) || defined (__stub___$ac_func) choke me #else -$ac_func(); +char (*f) () = $ac_func; +#endif +#ifdef __cplusplus +} #endif -; return 0; } -EOF -if { (eval echo configure:2762: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_func_$ac_func=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_func_$ac_func=no" -fi -rm -f conftest* -fi +int +main () +{ +return f != $ac_func; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + eval "$as_ac_var=yes" +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +eval "$as_ac_var=no" +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_var'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_var'}'`" >&6 +if test `eval echo '${'$as_ac_var'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_func" | $as_tr_cpp` 1 +_ACEOF -if eval "test \"`echo '$ac_cv_func_'$ac_func`\" = yes"; then - echo "$ac_t""yes" 1>&6 - ac_tr_func=HAVE_`echo $ac_func | tr 'abcdefghijklmnopqrstuvwxyz' 'ABCDEFGHIJKLMNOPQRSTUVWXYZ'` - cat >> confdefs.h <&6 fi done + + for ac_func in setlinebuf setvbuf do -echo $ac_n "checking for $ac_func""... $ac_c" 1>&6 -echo "configure:2789: checking for $ac_func" >&5 -if eval "test \"`echo '$''{'ac_cv_func_$ac_func'+set}'`\" = set"; then - echo $ac_n "(cached) $ac_c" 1>&6 -else - cat > conftest.$ac_ext <&5 +echo $ECHO_N "checking for $ac_func... $ECHO_C" >&6 +if eval "test \"\${$as_ac_var+set}\" = set"; then + echo $ECHO_N "(cached) $ECHO_C" >&6 +else + cat >conftest.$ac_ext <<_ACEOF +#line $LINENO "configure" +/* confdefs.h. */ +_ACEOF +cat confdefs.h >>conftest.$ac_ext +cat >>conftest.$ac_ext <<_ACEOF +/* end confdefs.h. */ /* System header to define __stub macros and hopefully few prototypes, - which can conflict with char $ac_func(); below. */ -#include + which can conflict with char $ac_func (); below. + Prefer to if __STDC__ is defined, since + exists even on freestanding compilers. */ +#ifdef __STDC__ +# include +#else +# include +#endif /* Override any gcc2 internal prototype to avoid an error. */ +#ifdef __cplusplus +extern "C" +{ +#endif /* We use char because int might match the return type of a gcc2 - builtin and then its argument prototype would still apply. */ -char $ac_func(); - -int main() { - + builtin and then its argument prototype would still apply. */ +char $ac_func (); /* The GNU C library defines this for functions which it implements to always fail with ENOSYS. Some functions are actually named something starting with __ and the normal name is an alias. */ #if defined (__stub_$ac_func) || defined (__stub___$ac_func) choke me #else -$ac_func(); +char (*f) () = $ac_func; +#endif +#ifdef __cplusplus +} #endif -; return 0; } -EOF -if { (eval echo configure:2817: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest${ac_exeext}; then - rm -rf conftest* - eval "ac_cv_func_$ac_func=yes" -else - echo "configure: failed program was:" >&5 - cat conftest.$ac_ext >&5 - rm -rf conftest* - eval "ac_cv_func_$ac_func=no" -fi -rm -f conftest* -fi +int +main () +{ +return f != $ac_func; + ; + return 0; +} +_ACEOF +rm -f conftest.$ac_objext conftest$ac_exeext +if { (eval echo "$as_me:$LINENO: \"$ac_link\"") >&5 + (eval $ac_link) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); } && + { ac_try='test -s conftest$ac_exeext' + { (eval echo "$as_me:$LINENO: \"$ac_try\"") >&5 + (eval $ac_try) 2>&5 + ac_status=$? + echo "$as_me:$LINENO: \$? = $ac_status" >&5 + (exit $ac_status); }; }; then + eval "$as_ac_var=yes" +else + echo "$as_me: failed program was:" >&5 +sed 's/^/| /' conftest.$ac_ext >&5 + +eval "$as_ac_var=no" +fi +rm -f conftest.$ac_objext conftest$ac_exeext conftest.$ac_ext +fi +echo "$as_me:$LINENO: result: `eval echo '${'$as_ac_var'}'`" >&5 +echo "${ECHO_T}`eval echo '${'$as_ac_var'}'`" >&6 +if test `eval echo '${'$as_ac_var'}'` = yes; then + cat >>confdefs.h <<_ACEOF +#define `echo "HAVE_$ac_func" | $as_tr_cpp` 1 +_ACEOF -if eval "test \"`echo '$ac_cv_func_'$ac_func`\" = yes"; then - echo "$ac_t""yes" 1>&6 - ac_tr_func=HAVE_`echo $ac_func | tr 'abcdefghijklmnopqrstuvwxyz' 'ABCDEFGHIJKLMNOPQRSTUVWXYZ'` - cat >> confdefs.h <&6 fi done @@ -2858,39 +7253,40 @@ SECOND_SHOGI_PROGRAM=gnushogi FIRST_HOST=localhost SECOND_HOST=localhost + # Check whether --with-top-part-bitmaps or --without-top-part-bitmaps was given. if test "${with_top_part_bitmaps+set}" = set; then withval="$with_top_part_bitmaps" OPT=-DTOP_PART_BITMAPS -fi +fi; # Check whether --with-first-shogi-program or --without-first-shogi-program was given. if test "${with_first_shogi_program+set}" = set; then withval="$with_first_shogi_program" FIRST_SHOGI_PROGRAM=$withval -fi +fi; # Check whether --with-second-shogi-program or --without-second-shogi-program was given. if test "${with_second_shogi_program+set}" = set; then withval="$with_second_shogi_program" SECOND_SHOGI_PROGRAM=$withval -fi +fi; # Check whether --with-first-host or --without-first-host was given. if test "${with_first_host+set}" = set; then withval="$with_first_host" FIRST_HOST=$withval -fi +fi; # Check whether --with-second-host or --without-second-host was given. if test "${with_second_host+set}" = set; then withval="$with_second_host" SECOND_HOST=$withval -fi +fi; # Check whether --with-xshogi or --without-xshogi was given. @@ -2899,8 +7295,7 @@ if test "${with_xshogi+set}" = set; then with_xshogi=$withval else with_xshogi=yes -fi - +fi; @@ -2927,378 +7322,1109 @@ fi echo echo outputting files... -trap '' 1 2 15 -cat > confcache <<\EOF + ac_config_files="$ac_config_files Makefile gnushogi/Makefile gnushogi/Makefile.profile xshogi/Makefile" + +cat >confcache <<\_ACEOF # This file is a shell script that caches the results of configure # tests run on this system so they can be shared between configure -# scripts and configure runs. It is not useful on other systems. -# If it contains results you don't want to keep, you may remove or edit it. +# scripts and configure runs, see configure's option --config-cache. +# It is not useful on other systems. If it contains results you don't +# want to keep, you may remove or edit it. # -# By default, configure uses ./config.cache as the cache file, -# creating it if it does not exist already. You can give configure -# the --cache-file=FILE option to use a different cache file; that is -# what configure does when it calls configure scripts in -# subdirectories, so they share the cache. -# Giving --cache-file=/dev/null disables caching, for debugging configure. -# config.status only pays attention to the cache file if you give it the -# --recheck option to rerun configure. +# config.status only pays attention to the cache file if you give it +# the --recheck option to rerun configure. # -EOF +# `ac_cv_env_foo' variables (set or unset) will be overridden when +# loading this file, other *unset* `ac_cv_foo' will be assigned the +# following values. + +_ACEOF + # The following way of writing the cache mishandles newlines in values, # but we know of no workaround that is simple, portable, and efficient. # So, don't put newlines in cache variables' values. # Ultrix sh set writes to stderr and can't be redirected directly, # and sets the high bit in the cache file unless we assign to the vars. -(set) 2>&1 | - case `(ac_space=' '; set | grep ac_space) 2>&1` in - *ac_space=\ *) - # `set' does not quote correctly, so add quotes (double-quote substitution - # turns \\\\ into \\, and sed turns \\ into \). - sed -n \ - -e "s/'/'\\\\''/g" \ - -e "s/^\\([a-zA-Z0-9_]*_cv_[a-zA-Z0-9_]*\\)=\\(.*\\)/\\1=\${\\1='\\2'}/p" - ;; - *) - # `set' quotes correctly as required by POSIX, so do not add quotes. - sed -n -e 's/^\([a-zA-Z0-9_]*_cv_[a-zA-Z0-9_]*\)=\(.*\)/\1=${\1=\2}/p' - ;; - esac >> confcache -if cmp -s $cache_file confcache; then - : -else +{ + (set) 2>&1 | + case `(ac_space=' '; set | grep ac_space) 2>&1` in + *ac_space=\ *) + # `set' does not quote correctly, so add quotes (double-quote + # substitution turns \\\\ into \\, and sed turns \\ into \). + sed -n \ + "s/'/'\\\\''/g; + s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1='\\2'/p" + ;; + *) + # `set' quotes correctly as required by POSIX, so do not add quotes. + sed -n \ + "s/^\\([_$as_cr_alnum]*_cv_[_$as_cr_alnum]*\\)=\\(.*\\)/\\1=\\2/p" + ;; + esac; +} | + sed ' + t clear + : clear + s/^\([^=]*\)=\(.*[{}].*\)$/test "${\1+set}" = set || &/ + t end + /^ac_cv_env/!s/^\([^=]*\)=\(.*\)$/\1=${\1=\2}/ + : end' >>confcache +if diff $cache_file confcache >/dev/null 2>&1; then :; else if test -w $cache_file; then - echo "updating cache $cache_file" - cat confcache > $cache_file + test "x$cache_file" != "x/dev/null" && echo "updating cache $cache_file" + cat confcache >$cache_file else echo "not updating unwritable cache $cache_file" fi fi rm -f confcache -trap 'rm -fr conftest* confdefs* core core.* *.core $ac_clean_files; exit 1' 1 2 15 - test "x$prefix" = xNONE && prefix=$ac_default_prefix # Let make expand exec_prefix. test "x$exec_prefix" = xNONE && exec_prefix='${prefix}' -# Any assignment to VPATH causes Sun make to only execute -# the first set of double-colon rules, so remove it if not needed. -# If there is a colon in the path, we need to keep it. +# VPATH may cause trouble with some makes, so we remove $(srcdir), +# ${srcdir} and @srcdir@ from VPATH if srcdir is ".", strip leading and +# trailing colons and then remove the whole line if VPATH becomes empty +# (actually we leave an empty line to preserve line numbers). if test "x$srcdir" = x.; then - ac_vpsub='/^[ ]*VPATH[ ]*=[^:]*$/d' + ac_vpsub='/^[ ]*VPATH[ ]*=/{ +s/:*\$(srcdir):*/:/; +s/:*\${srcdir}:*/:/; +s/:*@srcdir@:*/:/; +s/^\([^=]*=[ ]*\):*/\1/; +s/:*$//; +s/^[^=]*=[ ]*$//; +}' fi -trap 'rm -f $CONFIG_STATUS conftest*; exit 1' 1 2 15 - DEFS=-DHAVE_CONFIG_H -# Without the "./", some shells look in PATH for config.status. -: ${CONFIG_STATUS=./config.status} +ac_libobjs= +ac_ltlibobjs= +for ac_i in : $LIBOBJS; do test "x$ac_i" = x: && continue + # 1. Remove the extension, and $U if already installed. + ac_i=`echo "$ac_i" | + sed 's/\$U\././;s/\.o$//;s/\.obj$//'` + # 2. Add them. + ac_libobjs="$ac_libobjs $ac_i\$U.$ac_objext" + ac_ltlibobjs="$ac_ltlibobjs $ac_i"'$U.lo' +done +LIBOBJS=$ac_libobjs -echo creating $CONFIG_STATUS -rm -f $CONFIG_STATUS -cat > $CONFIG_STATUS <&5 +echo "$as_me: creating $CONFIG_STATUS" >&6;} +cat >$CONFIG_STATUS <<_ACEOF +#! $SHELL +# Generated by $as_me. # Run this file to recreate the current configuration. -# This directory was configured as follows, -# on host `(hostname || uname -n) 2>/dev/null | sed 1q`: -# -# $0 $ac_configure_args -# # Compiler output produced by configure, useful for debugging -# configure, is in ./config.log if it exists. +# configure, is in config.log if it exists. -ac_cs_usage="Usage: $CONFIG_STATUS [--recheck] [--version] [--help]" -for ac_option +debug=false +ac_cs_recheck=false +ac_cs_silent=false +SHELL=\${CONFIG_SHELL-$SHELL} +_ACEOF + +cat >>$CONFIG_STATUS <<\_ACEOF +## --------------------- ## +## M4sh Initialization. ## +## --------------------- ## + +# Be Bourne compatible +if test -n "${ZSH_VERSION+set}" && (emulate sh) >/dev/null 2>&1; then + emulate sh + NULLCMD=: + # Zsh 3.x and 4.x performs word splitting on ${1+"$@"}, which + # is contrary to our usage. Disable this feature. + alias -g '${1+"$@"}'='"$@"' +elif test -n "${BASH_VERSION+set}" && (set -o posix) >/dev/null 2>&1; then + set -o posix +fi + +# Support unset when possible. +if (FOO=FOO; unset FOO) >/dev/null 2>&1; then + as_unset=unset +else + as_unset=false +fi + + +# Work around bugs in pre-3.0 UWIN ksh. +$as_unset ENV MAIL MAILPATH +PS1='$ ' +PS2='> ' +PS4='+ ' + +# NLS nuisances. +for as_var in \ + LANG LANGUAGE LC_ADDRESS LC_ALL LC_COLLATE LC_CTYPE LC_IDENTIFICATION \ + LC_MEASUREMENT LC_MESSAGES LC_MONETARY LC_NAME LC_NUMERIC LC_PAPER \ + LC_TELEPHONE LC_TIME do - case "\$ac_option" in - -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r) - echo "running \${CONFIG_SHELL-/bin/sh} $0 $ac_configure_args --no-create --no-recursion" - exec \${CONFIG_SHELL-/bin/sh} $0 $ac_configure_args --no-create --no-recursion ;; - -version | --version | --versio | --versi | --vers | --ver | --ve | --v) - echo "$CONFIG_STATUS generated by autoconf version 2.13" - exit 0 ;; - -help | --help | --hel | --he | --h) - echo "\$ac_cs_usage"; exit 0 ;; - *) echo "\$ac_cs_usage"; exit 1 ;; - esac + if (set +x; test -n "`(eval $as_var=C; export $as_var) 2>&1`"); then + eval $as_var=C; export $as_var + else + $as_unset $as_var + fi done -ac_given_srcdir=$srcdir -ac_given_INSTALL="$INSTALL" +# Required to use basename. +if expr a : '\(a\)' >/dev/null 2>&1; then + as_expr=expr +else + as_expr=false +fi -trap 'rm -fr `echo "Makefile gnushogi/Makefile xshogi/Makefile config.h" | sed "s/:[^ ]*//g"` conftest*; exit 1' 1 2 15 -EOF -cat >> $CONFIG_STATUS </dev/null 2>&1 && test "X`basename / 2>&1`" = "X/"; then + as_basename=basename +else + as_basename=false +fi -# Protect against being on the right side of a sed subst in config.status. -sed 's/%@/@@/; s/@%/@@/; s/%g\$/@g/; /@g\$/s/[\\\\&%]/\\\\&/g; - s/@@/%@/; s/@@/@%/; s/@g\$/%g/' > conftest.subs <<\\CEOF -$ac_vpsub -$extrasub -s%@SHELL@%$SHELL%g -s%@CFLAGS@%$CFLAGS%g -s%@CPPFLAGS@%$CPPFLAGS%g -s%@CXXFLAGS@%$CXXFLAGS%g -s%@FFLAGS@%$FFLAGS%g -s%@DEFS@%$DEFS%g -s%@LDFLAGS@%$LDFLAGS%g -s%@LIBS@%$LIBS%g -s%@exec_prefix@%$exec_prefix%g -s%@prefix@%$prefix%g -s%@program_transform_name@%$program_transform_name%g -s%@bindir@%$bindir%g -s%@sbindir@%$sbindir%g -s%@libexecdir@%$libexecdir%g -s%@datadir@%$datadir%g -s%@sysconfdir@%$sysconfdir%g -s%@sharedstatedir@%$sharedstatedir%g -s%@localstatedir@%$localstatedir%g -s%@libdir@%$libdir%g -s%@includedir@%$includedir%g -s%@oldincludedir@%$oldincludedir%g -s%@infodir@%$infodir%g -s%@mandir@%$mandir%g -s%@CC@%$CC%g -s%@YACC@%$YACC%g -s%@LEX@%$LEX%g -s%@LEXLIB@%$LEXLIB%g -s%@INSTALL_PROGRAM@%$INSTALL_PROGRAM%g -s%@INSTALL_SCRIPT@%$INSTALL_SCRIPT%g -s%@INSTALL_DATA@%$INSTALL_DATA%g -s%@CPP@%$CPP%g -s%@X_CFLAGS@%$X_CFLAGS%g -s%@X_PRE_LIBS@%$X_PRE_LIBS%g -s%@X_LIBS@%$X_LIBS%g -s%@X_EXTRA_LIBS@%$X_EXTRA_LIBS%g -s%@WARNINGS@%$WARNINGS%g -s%@CEXTRAFLAGS@%$CEXTRAFLAGS%g -s%@OPT@%$OPT%g -s%@FIRST_SHOGI_PROGRAM@%$FIRST_SHOGI_PROGRAM%g -s%@SECOND_SHOGI_PROGRAM@%$SECOND_SHOGI_PROGRAM%g -s%@FIRST_HOST@%$FIRST_HOST%g -s%@SECOND_HOST@%$SECOND_HOST%g -s%@XSHOGI@%$XSHOGI%g -s%@XSHOGIINSTALL@%$XSHOGIINSTALL%g -s%@XSHOGICLEAN@%$XSHOGICLEAN%g -CEOF -EOF - -cat >> $CONFIG_STATUS <<\EOF - -# Split the substitutions into bite-sized pieces for seds with -# small command number limits, like on Digital OSF/1 and HP-UX. -ac_max_sed_cmds=90 # Maximum number of lines to put in a sed script. -ac_file=1 # Number of current file. -ac_beg=1 # First line for current file. -ac_end=$ac_max_sed_cmds # Line after last line for current file. -ac_more_lines=: -ac_sed_cmds="" -while $ac_more_lines; do - if test $ac_beg -gt 1; then - sed "1,${ac_beg}d; ${ac_end}q" conftest.subs > conftest.s$ac_file +# Name of the executable. +as_me=`$as_basename "$0" || +$as_expr X/"$0" : '.*/\([^/][^/]*\)/*$' \| \ + X"$0" : 'X\(//\)$' \| \ + X"$0" : 'X\(/\)$' \| \ + . : '\(.\)' 2>/dev/null || +echo X/"$0" | + sed '/^.*\/\([^/][^/]*\)\/*$/{ s//\1/; q; } + /^X\/\(\/\/\)$/{ s//\1/; q; } + /^X\/\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + + +# PATH needs CR, and LINENO needs CR and PATH. +# Avoid depending upon Character Ranges. +as_cr_letters='abcdefghijklmnopqrstuvwxyz' +as_cr_LETTERS='ABCDEFGHIJKLMNOPQRSTUVWXYZ' +as_cr_Letters=$as_cr_letters$as_cr_LETTERS +as_cr_digits='0123456789' +as_cr_alnum=$as_cr_Letters$as_cr_digits + +# The user is always right. +if test "${PATH_SEPARATOR+set}" != set; then + echo "#! /bin/sh" >conf$$.sh + echo "exit 0" >>conf$$.sh + chmod +x conf$$.sh + if (PATH="/nonexistent;."; conf$$.sh) >/dev/null 2>&1; then + PATH_SEPARATOR=';' else - sed "${ac_end}q" conftest.subs > conftest.s$ac_file + PATH_SEPARATOR=: + fi + rm -f conf$$.sh +fi + + + as_lineno_1=$LINENO + as_lineno_2=$LINENO + as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null` + test "x$as_lineno_1" != "x$as_lineno_2" && + test "x$as_lineno_3" = "x$as_lineno_2" || { + # Find who we are. Look in the path if we contain no path at all + # relative or not. + case $0 in + *[\\/]* ) as_myself=$0 ;; + *) as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in $PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + test -r "$as_dir/$0" && as_myself=$as_dir/$0 && break +done + + ;; + esac + # We did not find ourselves, most probably we were run as `sh COMMAND' + # in which case we are not to be found in the path. + if test "x$as_myself" = x; then + as_myself=$0 fi - if test ! -s conftest.s$ac_file; then - ac_more_lines=false - rm -f conftest.s$ac_file + if test ! -f "$as_myself"; then + { { echo "$as_me:$LINENO: error: cannot find myself; rerun with an absolute path" >&5 +echo "$as_me: error: cannot find myself; rerun with an absolute path" >&2;} + { (exit 1); exit 1; }; } + fi + case $CONFIG_SHELL in + '') + as_save_IFS=$IFS; IFS=$PATH_SEPARATOR +for as_dir in /bin$PATH_SEPARATOR/usr/bin$PATH_SEPARATOR$PATH +do + IFS=$as_save_IFS + test -z "$as_dir" && as_dir=. + for as_base in sh bash ksh sh5; do + case $as_dir in + /*) + if ("$as_dir/$as_base" -c ' + as_lineno_1=$LINENO + as_lineno_2=$LINENO + as_lineno_3=`(expr $as_lineno_1 + 1) 2>/dev/null` + test "x$as_lineno_1" != "x$as_lineno_2" && + test "x$as_lineno_3" = "x$as_lineno_2" ') 2>/dev/null; then + $as_unset BASH_ENV || test "${BASH_ENV+set}" != set || { BASH_ENV=; export BASH_ENV; } + $as_unset ENV || test "${ENV+set}" != set || { ENV=; export ENV; } + CONFIG_SHELL=$as_dir/$as_base + export CONFIG_SHELL + exec "$CONFIG_SHELL" "$0" ${1+"$@"} + fi;; + esac + done +done +;; + esac + + # Create $as_me.lineno as a copy of $as_myself, but with $LINENO + # uniformly replaced by the line number. The first 'sed' inserts a + # line-number line before each line; the second 'sed' does the real + # work. The second script uses 'N' to pair each line-number line + # with the numbered line, and appends trailing '-' during + # substitution so that $LINENO is not a special case at line end. + # (Raja R Harinath suggested sed '=', and Paul Eggert wrote the + # second 'sed' script. Blame Lee E. McMahon for sed's syntax. :-) + sed '=' <$as_myself | + sed ' + N + s,$,-, + : loop + s,^\(['$as_cr_digits']*\)\(.*\)[$]LINENO\([^'$as_cr_alnum'_]\),\1\2\1\3, + t loop + s,-$,, + s,^['$as_cr_digits']*\n,, + ' >$as_me.lineno && + chmod +x $as_me.lineno || + { { echo "$as_me:$LINENO: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&5 +echo "$as_me: error: cannot create $as_me.lineno; rerun with a POSIX shell" >&2;} + { (exit 1); exit 1; }; } + + # Don't try to exec as it changes $[0], causing all sort of problems + # (the dirname of $[0] is not the place where we might find the + # original and so on. Autoconf is especially sensible to this). + . ./$as_me.lineno + # Exit status is that of the last command. + exit +} + + +case `echo "testing\c"; echo 1,2,3`,`echo -n testing; echo 1,2,3` in + *c*,-n*) ECHO_N= ECHO_C=' +' ECHO_T=' ' ;; + *c*,* ) ECHO_N=-n ECHO_C= ECHO_T= ;; + *) ECHO_N= ECHO_C='\c' ECHO_T= ;; +esac + +if expr a : '\(a\)' >/dev/null 2>&1; then + as_expr=expr +else + as_expr=false +fi + +rm -f conf$$ conf$$.exe conf$$.file +echo >conf$$.file +if ln -s conf$$.file conf$$ 2>/dev/null; then + # We could just check for DJGPP; but this test a) works b) is more generic + # and c) will remain valid once DJGPP supports symlinks (DJGPP 2.04). + if test -f conf$$.exe; then + # Don't use ln at all; we don't have any links + as_ln_s='cp -p' else - if test -z "$ac_sed_cmds"; then - ac_sed_cmds="sed -f conftest.s$ac_file" - else - ac_sed_cmds="$ac_sed_cmds | sed -f conftest.s$ac_file" - fi - ac_file=`expr $ac_file + 1` - ac_beg=$ac_end - ac_end=`expr $ac_end + $ac_max_sed_cmds` + as_ln_s='ln -s' fi +elif ln conf$$.file conf$$ 2>/dev/null; then + as_ln_s=ln +else + as_ln_s='cp -p' +fi +rm -f conf$$ conf$$.exe conf$$.file + +if mkdir -p . 2>/dev/null; then + as_mkdir_p=: +else + as_mkdir_p=false +fi + +as_executable_p="test -f" + +# Sed expression to map a string onto a valid CPP name. +as_tr_cpp="sed y%*$as_cr_letters%P$as_cr_LETTERS%;s%[^_$as_cr_alnum]%_%g" + +# Sed expression to map a string onto a valid variable name. +as_tr_sh="sed y%*+%pp%;s%[^_$as_cr_alnum]%_%g" + + +# IFS +# We need space, tab and new line, in precisely that order. +as_nl=' +' +IFS=" $as_nl" + +# CDPATH. +$as_unset CDPATH + +exec 6>&1 + +# Open the log real soon, to keep \$[0] and so on meaningful, and to +# report actual input values of CONFIG_FILES etc. instead of their +# values after options handling. Logging --version etc. is OK. +exec 5>>config.log +{ + echo + sed 'h;s/./-/g;s/^.../## /;s/...$/ ##/;p;x;p;x' <<_ASBOX +## Running $as_me. ## +_ASBOX +} >&5 +cat >&5 <<_CSEOF + +This file was extended by gnushogi $as_me 1.3.2, which was +generated by GNU Autoconf 2.57. Invocation command line was + + CONFIG_FILES = $CONFIG_FILES + CONFIG_HEADERS = $CONFIG_HEADERS + CONFIG_LINKS = $CONFIG_LINKS + CONFIG_COMMANDS = $CONFIG_COMMANDS + $ $0 $@ + +_CSEOF +echo "on `(hostname || uname -n) 2>/dev/null | sed 1q`" >&5 +echo >&5 +_ACEOF + +# Files that config.status was made for. +if test -n "$ac_config_files"; then + echo "config_files=\"$ac_config_files\"" >>$CONFIG_STATUS +fi + +if test -n "$ac_config_headers"; then + echo "config_headers=\"$ac_config_headers\"" >>$CONFIG_STATUS +fi + +if test -n "$ac_config_links"; then + echo "config_links=\"$ac_config_links\"" >>$CONFIG_STATUS +fi + +if test -n "$ac_config_commands"; then + echo "config_commands=\"$ac_config_commands\"" >>$CONFIG_STATUS +fi + +cat >>$CONFIG_STATUS <<\_ACEOF + +ac_cs_usage="\ +\`$as_me' instantiates files from templates according to the +current configuration. + +Usage: $0 [OPTIONS] [FILE]... + + -h, --help print this help, then exit + -V, --version print version number, then exit + -q, --quiet do not print progress messages + -d, --debug don't remove temporary files + --recheck update $as_me by reconfiguring in the same conditions + --file=FILE[:TEMPLATE] + instantiate the configuration file FILE + --header=FILE[:TEMPLATE] + instantiate the configuration header FILE + +Configuration files: +$config_files + +Configuration headers: +$config_headers + +Report bugs to ." +_ACEOF + +cat >>$CONFIG_STATUS <<_ACEOF +ac_cs_version="\\ +gnushogi config.status 1.3.2 +configured by $0, generated by GNU Autoconf 2.57, + with options \\"`echo "$ac_configure_args" | sed 's/[\\""\`\$]/\\\\&/g'`\\" + +Copyright 1992, 1993, 1994, 1995, 1996, 1998, 1999, 2000, 2001 +Free Software Foundation, Inc. +This config.status script is free software; the Free Software Foundation +gives unlimited permission to copy, distribute and modify it." +srcdir=$srcdir +INSTALL="$INSTALL" +_ACEOF + +cat >>$CONFIG_STATUS <<\_ACEOF +# If no file are specified by the user, then we need to provide default +# value. By we need to know if files were specified by the user. +ac_need_defaults=: +while test $# != 0 +do + case $1 in + --*=*) + ac_option=`expr "x$1" : 'x\([^=]*\)='` + ac_optarg=`expr "x$1" : 'x[^=]*=\(.*\)'` + ac_shift=: + ;; + -*) + ac_option=$1 + ac_optarg=$2 + ac_shift=shift + ;; + *) # This is not an option, so the user has probably given explicit + # arguments. + ac_option=$1 + ac_need_defaults=false;; + esac + + case $ac_option in + # Handling of the options. +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF + -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r) + ac_cs_recheck=: ;; + --version | --vers* | -V ) + echo "$ac_cs_version"; exit 0 ;; + --he | --h) + # Conflict between --help and --header + { { echo "$as_me:$LINENO: error: ambiguous option: $1 +Try \`$0 --help' for more information." >&5 +echo "$as_me: error: ambiguous option: $1 +Try \`$0 --help' for more information." >&2;} + { (exit 1); exit 1; }; };; + --help | --hel | -h ) + echo "$ac_cs_usage"; exit 0 ;; + --debug | --d* | -d ) + debug=: ;; + --file | --fil | --fi | --f ) + $ac_shift + CONFIG_FILES="$CONFIG_FILES $ac_optarg" + ac_need_defaults=false;; + --header | --heade | --head | --hea ) + $ac_shift + CONFIG_HEADERS="$CONFIG_HEADERS $ac_optarg" + ac_need_defaults=false;; + -q | -quiet | --quiet | --quie | --qui | --qu | --q \ + | -silent | --silent | --silen | --sile | --sil | --si | --s) + ac_cs_silent=: ;; + + # This is an error. + -*) { { echo "$as_me:$LINENO: error: unrecognized option: $1 +Try \`$0 --help' for more information." >&5 +echo "$as_me: error: unrecognized option: $1 +Try \`$0 --help' for more information." >&2;} + { (exit 1); exit 1; }; } ;; + + *) ac_config_targets="$ac_config_targets $1" ;; + + esac + shift done -if test -z "$ac_sed_cmds"; then - ac_sed_cmds=cat + +ac_configure_extra_args= + +if $ac_cs_silent; then + exec 6>/dev/null + ac_configure_extra_args="$ac_configure_extra_args --silent" fi -EOF -cat >> $CONFIG_STATUS <>$CONFIG_STATUS <<_ACEOF +if \$ac_cs_recheck; then + echo "running $SHELL $0 " $ac_configure_args \$ac_configure_extra_args " --no-create --no-recursion" >&6 + exec $SHELL $0 $ac_configure_args \$ac_configure_extra_args --no-create --no-recursion +fi -CONFIG_FILES=\${CONFIG_FILES-"Makefile gnushogi/Makefile xshogi/Makefile"} -EOF -cat >> $CONFIG_STATUS <<\EOF -for ac_file in .. $CONFIG_FILES; do if test "x$ac_file" != x..; then - # Support "outfile[:infile[:infile...]]", defaulting infile="outfile.in". - case "$ac_file" in - *:*) ac_file_in=`echo "$ac_file"|sed 's%[^:]*:%%'` - ac_file=`echo "$ac_file"|sed 's%:.*%%'` ;; - *) ac_file_in="${ac_file}.in" ;; +_ACEOF + + + + + +cat >>$CONFIG_STATUS <<\_ACEOF +for ac_config_target in $ac_config_targets +do + case "$ac_config_target" in + # Handling of arguments. + "Makefile" ) CONFIG_FILES="$CONFIG_FILES Makefile" ;; + "gnushogi/Makefile" ) CONFIG_FILES="$CONFIG_FILES gnushogi/Makefile" ;; + "gnushogi/Makefile.profile" ) CONFIG_FILES="$CONFIG_FILES gnushogi/Makefile.profile" ;; + "xshogi/Makefile" ) CONFIG_FILES="$CONFIG_FILES xshogi/Makefile" ;; + "config.h" ) CONFIG_HEADERS="$CONFIG_HEADERS config.h" ;; + *) { { echo "$as_me:$LINENO: error: invalid argument: $ac_config_target" >&5 +echo "$as_me: error: invalid argument: $ac_config_target" >&2;} + { (exit 1); exit 1; }; };; esac +done - # Adjust a relative srcdir, top_srcdir, and INSTALL for subdirectories. +# If the user did not use the arguments to specify the items to instantiate, +# then the envvar interface is used. Set only those that are not. +# We use the long form for the default assignment because of an extremely +# bizarre bug on SunOS 4.1.3. +if $ac_need_defaults; then + test "${CONFIG_FILES+set}" = set || CONFIG_FILES=$config_files + test "${CONFIG_HEADERS+set}" = set || CONFIG_HEADERS=$config_headers +fi - # Remove last slash and all that follows it. Not all systems have dirname. - ac_dir=`echo $ac_file|sed 's%/[^/][^/]*$%%'` - if test "$ac_dir" != "$ac_file" && test "$ac_dir" != .; then - # The file is in a subdirectory. - test ! -d "$ac_dir" && mkdir "$ac_dir" - ac_dir_suffix="/`echo $ac_dir|sed 's%^\./%%'`" - # A "../" for each directory in $ac_dir_suffix. - ac_dots=`echo $ac_dir_suffix|sed 's%/[^/]*%../%g'` - else - ac_dir_suffix= ac_dots= +# Have a temporary directory for convenience. Make it in the build tree +# simply because there is no reason to put it here, and in addition, +# creating and moving files from /tmp can sometimes cause problems. +# Create a temporary directory, and hook for its removal unless debugging. +$debug || +{ + trap 'exit_status=$?; rm -rf $tmp && exit $exit_status' 0 + trap '{ (exit 1); exit 1; }' 1 2 13 15 +} + +# Create a (secure) tmp directory for tmp files. + +{ + tmp=`(umask 077 && mktemp -d -q "./confstatXXXXXX") 2>/dev/null` && + test -n "$tmp" && test -d "$tmp" +} || +{ + tmp=./confstat$$-$RANDOM + (umask 077 && mkdir $tmp) +} || +{ + echo "$me: cannot create a temporary directory in ." >&2 + { (exit 1); exit 1; } +} + +_ACEOF + +cat >>$CONFIG_STATUS <<_ACEOF + +# +# CONFIG_FILES section. +# + +# No need to generate the scripts if there are no CONFIG_FILES. +# This happens for instance when ./config.status config.h +if test -n "\$CONFIG_FILES"; then + # Protect against being on the right side of a sed subst in config.status. + sed 's/,@/@@/; s/@,/@@/; s/,;t t\$/@;t t/; /@;t t\$/s/[\\\\&,]/\\\\&/g; + s/@@/,@/; s/@@/@,/; s/@;t t\$/,;t t/' >\$tmp/subs.sed <<\\CEOF +s,@SHELL@,$SHELL,;t t +s,@PATH_SEPARATOR@,$PATH_SEPARATOR,;t t +s,@PACKAGE_NAME@,$PACKAGE_NAME,;t t +s,@PACKAGE_TARNAME@,$PACKAGE_TARNAME,;t t +s,@PACKAGE_VERSION@,$PACKAGE_VERSION,;t t +s,@PACKAGE_STRING@,$PACKAGE_STRING,;t t +s,@PACKAGE_BUGREPORT@,$PACKAGE_BUGREPORT,;t t +s,@exec_prefix@,$exec_prefix,;t t +s,@prefix@,$prefix,;t t +s,@program_transform_name@,$program_transform_name,;t t +s,@bindir@,$bindir,;t t +s,@sbindir@,$sbindir,;t t +s,@libexecdir@,$libexecdir,;t t +s,@datadir@,$datadir,;t t +s,@sysconfdir@,$sysconfdir,;t t +s,@sharedstatedir@,$sharedstatedir,;t t +s,@localstatedir@,$localstatedir,;t t +s,@libdir@,$libdir,;t t +s,@includedir@,$includedir,;t t +s,@oldincludedir@,$oldincludedir,;t t +s,@infodir@,$infodir,;t t +s,@mandir@,$mandir,;t t +s,@build_alias@,$build_alias,;t t +s,@host_alias@,$host_alias,;t t +s,@target_alias@,$target_alias,;t t +s,@DEFS@,$DEFS,;t t +s,@ECHO_C@,$ECHO_C,;t t +s,@ECHO_N@,$ECHO_N,;t t +s,@ECHO_T@,$ECHO_T,;t t +s,@LIBS@,$LIBS,;t t +s,@CC@,$CC,;t t +s,@CFLAGS@,$CFLAGS,;t t +s,@LDFLAGS@,$LDFLAGS,;t t +s,@CPPFLAGS@,$CPPFLAGS,;t t +s,@ac_ct_CC@,$ac_ct_CC,;t t +s,@EXEEXT@,$EXEEXT,;t t +s,@OBJEXT@,$OBJEXT,;t t +s,@YACC@,$YACC,;t t +s,@LEX@,$LEX,;t t +s,@LEXLIB@,$LEXLIB,;t t +s,@LEX_OUTPUT_ROOT@,$LEX_OUTPUT_ROOT,;t t +s,@INSTALL_PROGRAM@,$INSTALL_PROGRAM,;t t +s,@INSTALL_SCRIPT@,$INSTALL_SCRIPT,;t t +s,@INSTALL_DATA@,$INSTALL_DATA,;t t +s,@CPP@,$CPP,;t t +s,@X_CFLAGS@,$X_CFLAGS,;t t +s,@X_PRE_LIBS@,$X_PRE_LIBS,;t t +s,@X_LIBS@,$X_LIBS,;t t +s,@X_EXTRA_LIBS@,$X_EXTRA_LIBS,;t t +s,@WARNINGS@,$WARNINGS,;t t +s,@CEXTRAFLAGS@,$CEXTRAFLAGS,;t t +s,@CEXTRAFLAGS2@,$CEXTRAFLAGS2,;t t +s,@EGREP@,$EGREP,;t t +s,@LIBOBJS@,$LIBOBJS,;t t +s,@OPT@,$OPT,;t t +s,@FIRST_SHOGI_PROGRAM@,$FIRST_SHOGI_PROGRAM,;t t +s,@SECOND_SHOGI_PROGRAM@,$SECOND_SHOGI_PROGRAM,;t t +s,@FIRST_HOST@,$FIRST_HOST,;t t +s,@SECOND_HOST@,$SECOND_HOST,;t t +s,@XSHOGI@,$XSHOGI,;t t +s,@XSHOGIINSTALL@,$XSHOGIINSTALL,;t t +s,@XSHOGICLEAN@,$XSHOGICLEAN,;t t +s,@LTLIBOBJS@,$LTLIBOBJS,;t t +CEOF + +_ACEOF + + cat >>$CONFIG_STATUS <<\_ACEOF + # Split the substitutions into bite-sized pieces for seds with + # small command number limits, like on Digital OSF/1 and HP-UX. + ac_max_sed_lines=48 + ac_sed_frag=1 # Number of current file. + ac_beg=1 # First line for current file. + ac_end=$ac_max_sed_lines # Line after last line for current file. + ac_more_lines=: + ac_sed_cmds= + while $ac_more_lines; do + if test $ac_beg -gt 1; then + sed "1,${ac_beg}d; ${ac_end}q" $tmp/subs.sed >$tmp/subs.frag + else + sed "${ac_end}q" $tmp/subs.sed >$tmp/subs.frag + fi + if test ! -s $tmp/subs.frag; then + ac_more_lines=false + else + # The purpose of the label and of the branching condition is to + # speed up the sed processing (if there are no `@' at all, there + # is no need to browse any of the substitutions). + # These are the two extra sed commands mentioned above. + (echo ':t + /@[a-zA-Z_][a-zA-Z_0-9]*@/!b' && cat $tmp/subs.frag) >$tmp/subs-$ac_sed_frag.sed + if test -z "$ac_sed_cmds"; then + ac_sed_cmds="sed -f $tmp/subs-$ac_sed_frag.sed" + else + ac_sed_cmds="$ac_sed_cmds | sed -f $tmp/subs-$ac_sed_frag.sed" + fi + ac_sed_frag=`expr $ac_sed_frag + 1` + ac_beg=$ac_end + ac_end=`expr $ac_end + $ac_max_sed_lines` + fi + done + if test -z "$ac_sed_cmds"; then + ac_sed_cmds=cat fi +fi # test -n "$CONFIG_FILES" - case "$ac_given_srcdir" in - .) srcdir=. - if test -z "$ac_dots"; then top_srcdir=. - else top_srcdir=`echo $ac_dots|sed 's%/$%%'`; fi ;; - /*) srcdir="$ac_given_srcdir$ac_dir_suffix"; top_srcdir="$ac_given_srcdir" ;; - *) # Relative path. - srcdir="$ac_dots$ac_given_srcdir$ac_dir_suffix" - top_srcdir="$ac_dots$ac_given_srcdir" ;; +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF +for ac_file in : $CONFIG_FILES; do test "x$ac_file" = x: && continue + # Support "outfile[:infile[:infile...]]", defaulting infile="outfile.in". + case $ac_file in + - | *:- | *:-:* ) # input from stdin + cat >$tmp/stdin + ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'` + ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;; + *:* ) ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'` + ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;; + * ) ac_file_in=$ac_file.in ;; esac - case "$ac_given_INSTALL" in - [/$]*) INSTALL="$ac_given_INSTALL" ;; - *) INSTALL="$ac_dots$ac_given_INSTALL" ;; - esac + # Compute @srcdir@, @top_srcdir@, and @INSTALL@ for subdirectories. + ac_dir=`(dirname "$ac_file") 2>/dev/null || +$as_expr X"$ac_file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$ac_file" : 'X\(//\)[^/]' \| \ + X"$ac_file" : 'X\(//\)$' \| \ + X"$ac_file" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$ac_file" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + { if $as_mkdir_p; then + mkdir -p "$ac_dir" + else + as_dir="$ac_dir" + as_dirs= + while test ! -d "$as_dir"; do + as_dirs="$as_dir $as_dirs" + as_dir=`(dirname "$as_dir") 2>/dev/null || +$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_dir" : 'X\(//\)[^/]' \| \ + X"$as_dir" : 'X\(//\)$' \| \ + X"$as_dir" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$as_dir" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + done + test ! -n "$as_dirs" || mkdir $as_dirs + fi || { { echo "$as_me:$LINENO: error: cannot create directory \"$ac_dir\"" >&5 +echo "$as_me: error: cannot create directory \"$ac_dir\"" >&2;} + { (exit 1); exit 1; }; }; } + + ac_builddir=. - echo creating "$ac_file" - rm -f "$ac_file" - configure_input="Generated automatically from `echo $ac_file_in|sed 's%.*/%%'` by configure." - case "$ac_file" in - *Makefile*) ac_comsub="1i\\ -# $configure_input" ;; - *) ac_comsub= ;; +if test "$ac_dir" != .; then + ac_dir_suffix=/`echo "$ac_dir" | sed 's,^\.[\\/],,'` + # A "../" for each directory in $ac_dir_suffix. + ac_top_builddir=`echo "$ac_dir_suffix" | sed 's,/[^\\/]*,../,g'` +else + ac_dir_suffix= ac_top_builddir= +fi + +case $srcdir in + .) # No --srcdir option. We are building in place. + ac_srcdir=. + if test -z "$ac_top_builddir"; then + ac_top_srcdir=. + else + ac_top_srcdir=`echo $ac_top_builddir | sed 's,/$,,'` + fi ;; + [\\/]* | ?:[\\/]* ) # Absolute path. + ac_srcdir=$srcdir$ac_dir_suffix; + ac_top_srcdir=$srcdir ;; + *) # Relative path. + ac_srcdir=$ac_top_builddir$srcdir$ac_dir_suffix + ac_top_srcdir=$ac_top_builddir$srcdir ;; +esac +# Don't blindly perform a `cd "$ac_dir"/$ac_foo && pwd` since $ac_foo can be +# absolute. +ac_abs_builddir=`cd "$ac_dir" && cd $ac_builddir && pwd` +ac_abs_top_builddir=`cd "$ac_dir" && cd ${ac_top_builddir}. && pwd` +ac_abs_srcdir=`cd "$ac_dir" && cd $ac_srcdir && pwd` +ac_abs_top_srcdir=`cd "$ac_dir" && cd $ac_top_srcdir && pwd` + + + case $INSTALL in + [\\/$]* | ?:[\\/]* ) ac_INSTALL=$INSTALL ;; + *) ac_INSTALL=$ac_top_builddir$INSTALL ;; esac - ac_file_inputs=`echo $ac_file_in|sed -e "s%^%$ac_given_srcdir/%" -e "s%:% $ac_given_srcdir/%g"` - sed -e "$ac_comsub -s%@configure_input@%$configure_input%g -s%@srcdir@%$srcdir%g -s%@top_srcdir@%$top_srcdir%g -s%@INSTALL@%$INSTALL%g -" $ac_file_inputs | (eval "$ac_sed_cmds") > $ac_file -fi; done -rm -f conftest.s* + if test x"$ac_file" != x-; then + { echo "$as_me:$LINENO: creating $ac_file" >&5 +echo "$as_me: creating $ac_file" >&6;} + rm -f "$ac_file" + fi + # Let's still pretend it is `configure' which instantiates (i.e., don't + # use $as_me), people would be surprised to read: + # /* config.h. Generated by config.status. */ + if test x"$ac_file" = x-; then + configure_input= + else + configure_input="$ac_file. " + fi + configure_input=$configure_input"Generated from `echo $ac_file_in | + sed 's,.*/,,'` by configure." + + # First look for the input files in the build tree, otherwise in the + # src tree. + ac_file_inputs=`IFS=: + for f in $ac_file_in; do + case $f in + -) echo $tmp/stdin ;; + [\\/$]*) + # Absolute (can't be DOS-style, as IFS=:) + test -f "$f" || { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5 +echo "$as_me: error: cannot find input file: $f" >&2;} + { (exit 1); exit 1; }; } + echo $f;; + *) # Relative + if test -f "$f"; then + # Build tree + echo $f + elif test -f "$srcdir/$f"; then + # Source tree + echo $srcdir/$f + else + # /dev/null tree + { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5 +echo "$as_me: error: cannot find input file: $f" >&2;} + { (exit 1); exit 1; }; } + fi;; + esac + done` || { (exit 1); exit 1; } +_ACEOF +cat >>$CONFIG_STATUS <<_ACEOF + sed "$ac_vpsub +$extrasub +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF +:t +/@[a-zA-Z_][a-zA-Z_0-9]*@/!b +s,@configure_input@,$configure_input,;t t +s,@srcdir@,$ac_srcdir,;t t +s,@abs_srcdir@,$ac_abs_srcdir,;t t +s,@top_srcdir@,$ac_top_srcdir,;t t +s,@abs_top_srcdir@,$ac_abs_top_srcdir,;t t +s,@builddir@,$ac_builddir,;t t +s,@abs_builddir@,$ac_abs_builddir,;t t +s,@top_builddir@,$ac_top_builddir,;t t +s,@abs_top_builddir@,$ac_abs_top_builddir,;t t +s,@INSTALL@,$ac_INSTALL,;t t +" $ac_file_inputs | (eval "$ac_sed_cmds") >$tmp/out + rm -f $tmp/stdin + if test x"$ac_file" != x-; then + mv $tmp/out $ac_file + else + cat $tmp/out + rm -f $tmp/out + fi + +done +_ACEOF +cat >>$CONFIG_STATUS <<\_ACEOF + +# +# CONFIG_HEADER section. +# # These sed commands are passed to sed as "A NAME B NAME C VALUE D", where # NAME is the cpp macro being defined and VALUE is the value it is being given. # # ac_d sets the value in "#define NAME VALUE" lines. -ac_dA='s%^\([ ]*\)#\([ ]*define[ ][ ]*\)' -ac_dB='\([ ][ ]*\)[^ ]*%\1#\2' -ac_dC='\3' -ac_dD='%g' -# ac_u turns "#undef NAME" with trailing blanks into "#define NAME VALUE". -ac_uA='s%^\([ ]*\)#\([ ]*\)undef\([ ][ ]*\)' -ac_uB='\([ ]\)%\1#\2define\3' +ac_dA='s,^\([ ]*\)#\([ ]*define[ ][ ]*\)' +ac_dB='[ ].*$,\1#\2' +ac_dC=' ' +ac_dD=',;t' +# ac_u turns "#undef NAME" without trailing blanks into "#define NAME VALUE". +ac_uA='s,^\([ ]*\)#\([ ]*\)undef\([ ][ ]*\)' +ac_uB='$,\1#\2define\3' ac_uC=' ' -ac_uD='\4%g' -# ac_e turns "#undef NAME" without trailing blanks into "#define NAME VALUE". -ac_eA='s%^\([ ]*\)#\([ ]*\)undef\([ ][ ]*\)' -ac_eB='$%\1#\2define\3' -ac_eC=' ' -ac_eD='%g' - -if test "${CONFIG_HEADERS+set}" != set; then -EOF -cat >> $CONFIG_STATUS <> $CONFIG_STATUS <<\EOF -fi -for ac_file in .. $CONFIG_HEADERS; do if test "x$ac_file" != x..; then +ac_uD=',;t' + +for ac_file in : $CONFIG_HEADERS; do test "x$ac_file" = x: && continue # Support "outfile[:infile[:infile...]]", defaulting infile="outfile.in". - case "$ac_file" in - *:*) ac_file_in=`echo "$ac_file"|sed 's%[^:]*:%%'` - ac_file=`echo "$ac_file"|sed 's%:.*%%'` ;; - *) ac_file_in="${ac_file}.in" ;; + case $ac_file in + - | *:- | *:-:* ) # input from stdin + cat >$tmp/stdin + ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'` + ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;; + *:* ) ac_file_in=`echo "$ac_file" | sed 's,[^:]*:,,'` + ac_file=`echo "$ac_file" | sed 's,:.*,,'` ;; + * ) ac_file_in=$ac_file.in ;; esac - echo creating $ac_file - - rm -f conftest.frag conftest.in conftest.out - ac_file_inputs=`echo $ac_file_in|sed -e "s%^%$ac_given_srcdir/%" -e "s%:% $ac_given_srcdir/%g"` - cat $ac_file_inputs > conftest.in - -EOF - -# Transform confdefs.h into a sed script conftest.vals that substitutes -# the proper values into config.h.in to produce config.h. And first: -# Protect against being on the right side of a sed subst in config.status. -# Protect against being in an unquoted here document in config.status. -rm -f conftest.vals -cat > conftest.hdr <<\EOF -s/[\\&%]/\\&/g -s%[\\$`]%\\&%g -s%#define \([A-Za-z_][A-Za-z0-9_]*\) *\(.*\)%${ac_dA}\1${ac_dB}\1${ac_dC}\2${ac_dD}%gp -s%ac_d%ac_u%gp -s%ac_u%ac_e%gp -EOF -sed -n -f conftest.hdr confdefs.h > conftest.vals -rm -f conftest.hdr + test x"$ac_file" != x- && { echo "$as_me:$LINENO: creating $ac_file" >&5 +echo "$as_me: creating $ac_file" >&6;} + + # First look for the input files in the build tree, otherwise in the + # src tree. + ac_file_inputs=`IFS=: + for f in $ac_file_in; do + case $f in + -) echo $tmp/stdin ;; + [\\/$]*) + # Absolute (can't be DOS-style, as IFS=:) + test -f "$f" || { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5 +echo "$as_me: error: cannot find input file: $f" >&2;} + { (exit 1); exit 1; }; } + echo $f;; + *) # Relative + if test -f "$f"; then + # Build tree + echo $f + elif test -f "$srcdir/$f"; then + # Source tree + echo $srcdir/$f + else + # /dev/null tree + { { echo "$as_me:$LINENO: error: cannot find input file: $f" >&5 +echo "$as_me: error: cannot find input file: $f" >&2;} + { (exit 1); exit 1; }; } + fi;; + esac + done` || { (exit 1); exit 1; } + # Remove the trailing spaces. + sed 's/[ ]*$//' $ac_file_inputs >$tmp/in + +_ACEOF + +# Transform confdefs.h into two sed scripts, `conftest.defines' and +# `conftest.undefs', that substitutes the proper values into +# config.h.in to produce config.h. The first handles `#define' +# templates, and the second `#undef' templates. +# And first: Protect against being on the right side of a sed subst in +# config.status. Protect against being in an unquoted here document +# in config.status. +rm -f conftest.defines conftest.undefs +# Using a here document instead of a string reduces the quoting nightmare. +# Putting comments in sed scripts is not portable. +# +# `end' is used to avoid that the second main sed command (meant for +# 0-ary CPP macros) applies to n-ary macro definitions. +# See the Autoconf documentation for `clear'. +cat >confdef2sed.sed <<\_ACEOF +s/[\\&,]/\\&/g +s,[\\$`],\\&,g +t clear +: clear +s,^[ ]*#[ ]*define[ ][ ]*\([^ (][^ (]*\)\(([^)]*)\)[ ]*\(.*\)$,${ac_dA}\1${ac_dB}\1\2${ac_dC}\3${ac_dD},gp +t end +s,^[ ]*#[ ]*define[ ][ ]*\([^ ][^ ]*\)[ ]*\(.*\)$,${ac_dA}\1${ac_dB}\1${ac_dC}\2${ac_dD},gp +: end +_ACEOF +# If some macros were called several times there might be several times +# the same #defines, which is useless. Nevertheless, we may not want to +# sort them, since we want the *last* AC-DEFINE to be honored. +uniq confdefs.h | sed -n -f confdef2sed.sed >conftest.defines +sed 's/ac_d/ac_u/g' conftest.defines >conftest.undefs +rm -f confdef2sed.sed # This sed command replaces #undef with comments. This is necessary, for # example, in the case of _POSIX_SOURCE, which is predefined and required # on some systems where configure will not decide to define it. -cat >> conftest.vals <<\EOF -s%^[ ]*#[ ]*undef[ ][ ]*[a-zA-Z_][a-zA-Z_0-9]*%/* & */% -EOF - -# Break up conftest.vals because some shells have a limit on -# the size of here documents, and old seds have small limits too. +cat >>conftest.undefs <<\_ACEOF +s,^[ ]*#[ ]*undef[ ][ ]*[a-zA-Z_][a-zA-Z_0-9]*,/* & */, +_ACEOF + +# Break up conftest.defines because some shells have a limit on the size +# of here documents, and old seds have small limits too (100 cmds). +echo ' # Handle all the #define templates only if necessary.' >>$CONFIG_STATUS +echo ' if grep "^[ ]*#[ ]*define" $tmp/in >/dev/null; then' >>$CONFIG_STATUS +echo ' # If there are no defines, we may have an empty if/fi' >>$CONFIG_STATUS +echo ' :' >>$CONFIG_STATUS +rm -f conftest.tail +while grep . conftest.defines >/dev/null +do + # Write a limited-size here document to $tmp/defines.sed. + echo ' cat >$tmp/defines.sed <>$CONFIG_STATUS + # Speed up: don't consider the non `#define' lines. + echo '/^[ ]*#[ ]*define/!b' >>$CONFIG_STATUS + # Work around the forget-to-reset-the-flag bug. + echo 't clr' >>$CONFIG_STATUS + echo ': clr' >>$CONFIG_STATUS + sed ${ac_max_here_lines}q conftest.defines >>$CONFIG_STATUS + echo 'CEOF + sed -f $tmp/defines.sed $tmp/in >$tmp/out + rm -f $tmp/in + mv $tmp/out $tmp/in +' >>$CONFIG_STATUS + sed 1,${ac_max_here_lines}d conftest.defines >conftest.tail + rm -f conftest.defines + mv conftest.tail conftest.defines +done +rm -f conftest.defines +echo ' fi # grep' >>$CONFIG_STATUS +echo >>$CONFIG_STATUS +# Break up conftest.undefs because some shells have a limit on the size +# of here documents, and old seds have small limits too (100 cmds). +echo ' # Handle all the #undef templates' >>$CONFIG_STATUS rm -f conftest.tail -while : +while grep . conftest.undefs >/dev/null do - ac_lines=`grep -c . conftest.vals` - # grep -c gives empty output for an empty file on some AIX systems. - if test -z "$ac_lines" || test "$ac_lines" -eq 0; then break; fi - # Write a limited-size here document to conftest.frag. - echo ' cat > conftest.frag <> $CONFIG_STATUS - sed ${ac_max_here_lines}q conftest.vals >> $CONFIG_STATUS + # Write a limited-size here document to $tmp/undefs.sed. + echo ' cat >$tmp/undefs.sed <>$CONFIG_STATUS + # Speed up: don't consider the non `#undef' + echo '/^[ ]*#[ ]*undef/!b' >>$CONFIG_STATUS + # Work around the forget-to-reset-the-flag bug. + echo 't clr' >>$CONFIG_STATUS + echo ': clr' >>$CONFIG_STATUS + sed ${ac_max_here_lines}q conftest.undefs >>$CONFIG_STATUS echo 'CEOF - sed -f conftest.frag conftest.in > conftest.out - rm -f conftest.in - mv conftest.out conftest.in -' >> $CONFIG_STATUS - sed 1,${ac_max_here_lines}d conftest.vals > conftest.tail - rm -f conftest.vals - mv conftest.tail conftest.vals -done -rm -f conftest.vals - -cat >> $CONFIG_STATUS <<\EOF - rm -f conftest.frag conftest.h - echo "/* $ac_file. Generated automatically by configure. */" > conftest.h - cat conftest.in >> conftest.h - rm -f conftest.in - if cmp -s $ac_file conftest.h 2>/dev/null; then - echo "$ac_file is unchanged" - rm -f conftest.h + sed -f $tmp/undefs.sed $tmp/in >$tmp/out + rm -f $tmp/in + mv $tmp/out $tmp/in +' >>$CONFIG_STATUS + sed 1,${ac_max_here_lines}d conftest.undefs >conftest.tail + rm -f conftest.undefs + mv conftest.tail conftest.undefs +done +rm -f conftest.undefs + +cat >>$CONFIG_STATUS <<\_ACEOF + # Let's still pretend it is `configure' which instantiates (i.e., don't + # use $as_me), people would be surprised to read: + # /* config.h. Generated by config.status. */ + if test x"$ac_file" = x-; then + echo "/* Generated by configure. */" >$tmp/config.h else - # Remove last slash and all that follows it. Not all systems have dirname. - ac_dir=`echo $ac_file|sed 's%/[^/][^/]*$%%'` - if test "$ac_dir" != "$ac_file" && test "$ac_dir" != .; then - # The file is in a subdirectory. - test ! -d "$ac_dir" && mkdir "$ac_dir" - fi - rm -f $ac_file - mv conftest.h $ac_file + echo "/* $ac_file. Generated by configure. */" >$tmp/config.h fi -fi; done + cat $tmp/in >>$tmp/config.h + rm -f $tmp/in + if test x"$ac_file" != x-; then + if diff $ac_file $tmp/config.h >/dev/null 2>&1; then + { echo "$as_me:$LINENO: $ac_file is unchanged" >&5 +echo "$as_me: $ac_file is unchanged" >&6;} + else + ac_dir=`(dirname "$ac_file") 2>/dev/null || +$as_expr X"$ac_file" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$ac_file" : 'X\(//\)[^/]' \| \ + X"$ac_file" : 'X\(//\)$' \| \ + X"$ac_file" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$ac_file" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + { if $as_mkdir_p; then + mkdir -p "$ac_dir" + else + as_dir="$ac_dir" + as_dirs= + while test ! -d "$as_dir"; do + as_dirs="$as_dir $as_dirs" + as_dir=`(dirname "$as_dir") 2>/dev/null || +$as_expr X"$as_dir" : 'X\(.*[^/]\)//*[^/][^/]*/*$' \| \ + X"$as_dir" : 'X\(//\)[^/]' \| \ + X"$as_dir" : 'X\(//\)$' \| \ + X"$as_dir" : 'X\(/\)' \| \ + . : '\(.\)' 2>/dev/null || +echo X"$as_dir" | + sed '/^X\(.*[^/]\)\/\/*[^/][^/]*\/*$/{ s//\1/; q; } + /^X\(\/\/\)[^/].*/{ s//\1/; q; } + /^X\(\/\/\)$/{ s//\1/; q; } + /^X\(\/\).*/{ s//\1/; q; } + s/.*/./; q'` + done + test ! -n "$as_dirs" || mkdir $as_dirs + fi || { { echo "$as_me:$LINENO: error: cannot create directory \"$ac_dir\"" >&5 +echo "$as_me: error: cannot create directory \"$ac_dir\"" >&2;} + { (exit 1); exit 1; }; }; } -EOF -cat >> $CONFIG_STATUS <> $CONFIG_STATUS <<\EOF +cat >>$CONFIG_STATUS <<\_ACEOF -exit 0 -EOF +{ (exit 0); exit 0; } +_ACEOF chmod +x $CONFIG_STATUS -rm -fr confdefs* $ac_clean_files -test "$no_create" = yes || ${CONFIG_SHELL-/bin/sh} $CONFIG_STATUS || exit 1 +ac_clean_files=$ac_clean_files_save + + +# configure is writing to config.log, and then calls config.status. +# config.status does its own redirection, appending to config.log. +# Unfortunately, on DOS this fails, as config.log is still kept open +# by configure, so config.status won't be able to write to it; its +# output is simply discarded. So we exec the FD to /dev/null, +# effectively closing config.log, so it can be properly (re)opened and +# appended to by config.status. When coming back to configure, we +# need to make the FD available again. +if test "$no_create" != yes; then + ac_cs_success=: + ac_config_status_args= + test "$silent" = yes && + ac_config_status_args="$ac_config_status_args --quiet" + exec 5>/dev/null + $SHELL $CONFIG_STATUS $ac_config_status_args || ac_cs_success=false + exec 5>>config.log + # Use ||, not &&, to avoid exiting from the if with $? = 1, which + # would make configure fail if this is the last instruction. + $ac_cs_success || { (exit 1); exit 1; } +fi diff --git a/configure.ac b/configure.ac new file mode 100644 index 0000000..8f5c10f --- /dev/null +++ b/configure.ac @@ -0,0 +1,215 @@ +# ------------------------------------------------------------ +# GNU shogi and xshogi configuration script. +# ------------------------------------------------------------ + +dnl Process this file with autoconf to produce a configure script. + +AC_PREREQ(2.57) +AC_INIT([gnushogi],[1.3.2],[mvanier@cs.caltech.edu]) +AC_CONFIG_SRCDIR([version.h]) +AC_CONFIG_HEADER(config.h) + + +# +# Check for C compiler. +# + +echo +AC_MSG_CHECKING(for C compiler) +echo + +AC_PROG_CC + + +# +# Check for parser generators. +# + +echo +AC_MSG_CHECKING([for yacc/bison, lex/flex, and install]) +echo + +AC_PROG_YACC +AC_PROG_LEX +AC_PROG_INSTALL + + +# +# Check for X windows. +# + +echo +AC_PATH_XTRA + + +# +# Check for other libraries. +# + +AC_CHECK_LIB(curses, clrtoeol) +AC_CHECK_LIB(m, pow) +dnl Replace `main' with a function in -ltermcap: +AC_CHECK_LIB(termcap, tgoto) + + +# +# C compiler warnings. +# + +if [[ $ac_cv_c_compiler_gnu = yes ]] +then +WARNINGS="-Wall -Wno-implicit-int -Wstrict-prototypes -ansi -pedantic" +CEXTRAFLAGS="-fsigned-char -funroll-loops \$(HASH)" +# For profiling targets: +CEXTRAFLAGS2="-fsigned-char -pg -fprofile-arcs -ftest-coverage \$(HASH)" +else +# Who knows what warnings your compiler uses? +WARNINGS= +CEXTRAFLAGS="\$(HASH)" +fi + +AC_SUBST(WARNINGS) +AC_SUBST(CEXTRAFLAGS) +AC_SUBST(CEXTRAFLAGS2) + + +# +# Check for header files. +# + +echo +AC_MSG_CHECKING(for header files) +echo + +AC_HEADER_STDC +AC_HEADER_SYS_WAIT +AC_CHECK_HEADERS([fcntl.h stdlib.h string.h sys/file.h sys/ioctl.h]) +AC_CHECK_HEADERS([sys/param.h sys/time.h unistd.h]) +AC_CHECK_HEADERS(errno.h) +AC_HEADER_TIME + + +# +# Check for typedefs, structures, and compiler characteristics. +# + +echo +AC_MSG_CHECKING(for typedefs) +echo + +AC_C_CONST +AC_HEADER_STDBOOL +AC_C_INLINE +AC_TYPE_PID_T +AC_TYPE_SIZE_T +AC_HEADER_TIME +AC_STRUCT_TM + +echo +AC_MSG_CHECKING(for compiler characteristics) +echo + +AC_CHECK_SIZEOF(long) + + +# +# Check for library functions. +# + +echo +AC_MSG_CHECKING(for library functions) +echo + +AC_FUNC_FORK +AC_PROG_GCC_TRADITIONAL +AC_FUNC_MALLOC +AC_FUNC_SETVBUF_REVERSED +AC_TYPE_SIGNAL +AC_CHECK_FUNCS([dup2 gethostname gettimeofday memset pow strcasecmp]) +AC_CHECK_FUNCS([strchr strerror strrchr strstr strtol]) +AC_CHECK_FUNCS(memcpy bcopy) +AC_CHECK_FUNCS(setlinebuf setvbuf) + + +# +# Set various user-definable options. +# +# Valid OPT settings: +# --with-top-part-bitmaps +# +# Other settings: +# --with-first-shogi-program=PROGNAME +# --with-second-shogi-program=PROGNAME +# --with-first-host=HOSTNAME +# --with-second-host=HOSTNAME +# + +OPT= +FIRST_SHOGI_PROGRAM=gnushogi +SECOND_SHOGI_PROGRAM=gnushogi +FIRST_HOST=localhost +SECOND_HOST=localhost + +AC_ARG_WITH(top-part-bitmaps, +[ --with-top-part-bitmaps Use top part of Kanji bitmaps only.], +OPT=-DTOP_PART_BITMAPS) + +AC_ARG_WITH(first-shogi-program, +[ --with-first-shogi-program=PROGNAME + Use PROGNAME as the first shogi program (default: gnushogi)], +FIRST_SHOGI_PROGRAM=$withval) + +AC_ARG_WITH(second-shogi-program, +[ --with-second-shogi-program=PROGNAME + Use PROGNAME as the second shogi program (default: gnushogi)], +SECOND_SHOGI_PROGRAM=$withval) + +AC_ARG_WITH(first-host, +[ --with-first-host=HOSTNAME + Use HOSTNAME as the machine on which the first shogi program + runs (default: localhost)], +FIRST_HOST=$withval) + +AC_ARG_WITH(second-host, +[ --with-second-host=HOSTNAME + Use HOSTNAME as the machine on which the second shogi program + runs (default: localhost)], +SECOND_HOST=$withval) + +AC_ARG_WITH(xshogi, +[ --with-xshogi + Compile the xshogi graphical interface to GNU shogi (default: yes)], +with_xshogi=$withval, +with_xshogi=yes) + +AC_SUBST(OPT) +AC_SUBST(FIRST_SHOGI_PROGRAM) +AC_SUBST(SECOND_SHOGI_PROGRAM) +AC_SUBST(FIRST_HOST) +AC_SUBST(SECOND_HOST) + +if [[ $with_xshogi = yes ]] +then +XSHOGI=xshogi_compile +XSHOGIINSTALL=xshogi_install +XSHOGICLEAN=xshogi_clean +else +XSHOGI= +XSHOGIINSTALL= +XSHOGICLEAN= +fi + +AC_SUBST(XSHOGI) +AC_SUBST(XSHOGIINSTALL) +AC_SUBST(XSHOGICLEAN) + + +echo +echo outputting files... + +AC_CONFIG_FILES([Makefile + gnushogi/Makefile + gnushogi/Makefile.profile + xshogi/Makefile]) +AC_OUTPUT + diff --git a/configure.in b/configure.in deleted file mode 100644 index f6e0580..0000000 --- a/configure.in +++ /dev/null @@ -1,198 +0,0 @@ -# ------------------------------------------------------------ -# GNU shogi and xshogi configuration script. -# ------------------------------------------------------------ - -dnl Process this file with autoconf to produce a configure script. - -AC_INIT(gnushogi/gnushogi.h) -AC_CONFIG_HEADER(config.h) - - -# -# Check for C compiler. -# - -echo -AC_MSG_CHECKING(for C compiler) -echo - -AC_PROG_CC - - -# -# Check for parser generators. -# - -echo -AC_MSG_CHECKING([for yacc/bison, lex/flex, and install]) -echo - -AC_PROG_YACC -AC_PROG_LEX -AC_PROG_INSTALL - - -# -# Check for X windows. -# - -echo -AC_PATH_XTRA - - -# -# Check for other libraries. -# - -AC_CHECK_LIB(curses, clrtoeol) -AC_CHECK_LIB(m, pow) -dnl Replace `main' with a function in -ltermcap: -AC_CHECK_LIB(termcap, tgoto) - - -# -# C compiler warnings. -# - -if [[ $ac_cv_prog_gcc = yes ]] -then -WARNINGS="-Wall -Wno-implicit-int" -CEXTRAFLAGS="-fsigned-char -funroll-loops \$(HASH)" -else -# Who knows what warnings your compiler uses? -WARNINGS= -CEXTRAFLAGS="\$(HASH)" -fi - -AC_SUBST(WARNINGS) -AC_SUBST(CEXTRAFLAGS) - - -# -# Check for header files. -# - -echo -AC_MSG_CHECKING(for header files) -echo - -AC_HEADER_STDC -AC_HEADER_SYS_WAIT -AC_CHECK_HEADERS(fcntl.h sys/file.h sys/ioctl.h sys/time.h unistd.h) -AC_CHECK_HEADERS(time.h sys/time.h sys/filio.h) -AC_HEADER_TIME - - -# -# Check for typedefs, structures, and compiler characteristics. -# - -echo -AC_MSG_CHECKING(for typedefs) -echo - -AC_C_CONST -AC_TYPE_SIZE_T -AC_HEADER_TIME -AC_STRUCT_TM - -echo -AC_MSG_CHECKING(for compiler characteristics) -echo - -AC_CHECK_SIZEOF(long) - - -# -# Check for library functions. -# - -echo -AC_MSG_CHECKING(for library functions) -echo - -AC_FUNC_SETVBUF_REVERSED -AC_TYPE_SIGNAL -AC_CHECK_FUNCS(gethostname gettimeofday strstr strtol) -AC_CHECK_FUNCS(memcpy bcopy) -AC_CHECK_FUNCS(setlinebuf setvbuf) - - -# -# Set various user-definable options. -# -# Valid OPT settings: -# --with-top-part-bitmaps -# -# Other settings: -# --with-first-shogi-program=PROGNAME -# --with-second-shogi-program=PROGNAME -# --with-first-host=HOSTNAME -# --with-second-host=HOSTNAME -# - -OPT= -FIRST_SHOGI_PROGRAM=gnushogi -SECOND_SHOGI_PROGRAM=gnushogi -FIRST_HOST=localhost -SECOND_HOST=localhost - -AC_ARG_WITH(top-part-bitmaps, -[ --with-top-part-bitmaps Use top part of Kanji bitmaps only.], -OPT=-DTOP_PART_BITMAPS) - -AC_ARG_WITH(first-shogi-program, -[ --with-first-shogi-program=PROGNAME - Use PROGNAME as the first shogi program (default: gnushogi)], -FIRST_SHOGI_PROGRAM=$withval) - -AC_ARG_WITH(second-shogi-program, -[ --with-second-shogi-program=PROGNAME - Use PROGNAME as the second shogi program (default: gnushogi)], -SECOND_SHOGI_PROGRAM=$withval) - -AC_ARG_WITH(first-host, -[ --with-first-host=HOSTNAME - Use HOSTNAME as the machine on which the first shogi program - runs (default: localhost)], -FIRST_HOST=$withval) - -AC_ARG_WITH(second-host, -[ --with-second-host=HOSTNAME - Use HOSTNAME as the machine on which the second shogi program - runs (default: localhost)], -SECOND_HOST=$withval) - -AC_ARG_WITH(xshogi, -[ --with-xshogi - Compile the xshogi graphical interface to GNU shogi (default: yes)], -with_xshogi=$withval, -with_xshogi=yes) - -AC_SUBST(OPT) -AC_SUBST(FIRST_SHOGI_PROGRAM) -AC_SUBST(SECOND_SHOGI_PROGRAM) -AC_SUBST(FIRST_HOST) -AC_SUBST(SECOND_HOST) - -if [[ $with_xshogi = yes ]] -then -XSHOGI=xshogi_compile -XSHOGIINSTALL=xshogi_install -XSHOGICLEAN=xshogi_clean -else -XSHOGI= -XSHOGIINSTALL= -XSHOGICLEAN= -fi - -AC_SUBST(XSHOGI) -AC_SUBST(XSHOGIINSTALL) -AC_SUBST(XSHOGICLEAN) - - -echo -echo outputting files... - -AC_OUTPUT(Makefile gnushogi/Makefile xshogi/Makefile) - diff --git a/doc/Makefile b/doc/Makefile index 2281134..8349954 100644 --- a/doc/Makefile +++ b/doc/Makefile @@ -31,7 +31,7 @@ ps2: spell: tr '[A-Z]' '[a-z]' < gnushogi.texinfo | tr -cd '[A-Za-z0-9_ \012]' | \ - tr -s '[ ]' '\012' | sort | uniq -c | sort -nr | spell + tr -s '[ ]' '\012' | sort | uniq -c | sort -nr | spell | sort | uniq clean: @for file in $(CLEANFILES); \ diff --git a/doc/PORTING b/doc/PORTING index f28913d..9108864 100644 --- a/doc/PORTING +++ b/doc/PORTING @@ -4,7 +4,7 @@ Porting GNU shogi NOTE: this file may be seriously outdated. I haven't had time to go over it yet. Let me know if there are problems. --- Mike (mvanier@bbb.caltech.edu) +-- Mike (mvanier@cs.caltech.edu) This describes how to port GNU shogi to machines with scarce memory. diff --git a/doc/TRANS.TBL b/doc/TRANS.TBL deleted file mode 100644 index 2c57a0b..0000000 --- a/doc/TRANS.TBL +++ /dev/null @@ -1,41 +0,0 @@ -F BOOKFILE.;1 BOOKFILES -F GNUSHOGI.000;1 gnushogi_22.html -F GNUSHOGI.001;1 gnushogi_21.html -F GNUSHOGI.002;1 gnushogi_20.html -F GNUSHOGI.003;1 gnushogi_19.html -F GNUSHOGI.004;1 gnushogi_18.html -F GNUSHOGI.005;1 gnushogi_17.html -F GNUSHOGI.006;1 gnushogi_16.html -F GNUSHOGI.007;1 gnushogi_15.html -F GNUSHOGI.008;1 gnushogi_14.html -F GNUSHOGI.009;1 gnushogi_13.html -F GNUSHOGI.00A;1 gnushogi_12.html -F GNUSHOGI.00B;1 gnushogi_11.html -F GNUSHOGI.00C;1 gnushogi_10.html -F GNUSHOGI.00D;1 gnushogi_9.html -F GNUSHOGI.00E;1 gnushogi_8.html -F GNUSHOGI.00F;1 gnushogi_7.html -F GNUSHOGI.00G;1 gnushogi_6.html -F GNUSHOGI.00H;1 gnushogi_5.html -F GNUSHOGI.00I;1 gnushogi_4.html -F GNUSHOGI.00J;1 gnushogi_3.html -F GNUSHOGI.00K;1 gnushogi_2.html -F GNUSHOGI.00L;1 gnushogi_1.html -F GNUSHOGI.00M;1 gnushogi_stoc.html -F GNUSHOGI.00N;1 gnushogi.info-2 -F GNUSHOGI.00O;1 gnushogi.info-1 -F GNUSHOGI.6;1 gnushogi.6 -F GNUSHOGI.HTM;1 gnushogi_toc.html -F GNUSHOGI.INF;1 gnushogi.info -F GNUSHOGI.PS;1 gnushogi.ps -F GNUSHOGI.TEX;1 gnushogi.texinfo -F LISTSERV.REF;1 listserv.ref -F MAKEFILE.;1 Makefile -F MAKE_FIG.;1 make_fig1 -F MAKE_FIG.000;1 make_fig2 -F PORTING.;1 PORTING -F SHOGI.RUL;1 shogi.rules -F TEXINFO.TEX;1 texinfo.tex -F TUTORIAL.000;1 tutorial2.gam -F TUTORIAL.GAM;1 tutorial1.gam -F XSHOGI.6;1 xshogi.6 diff --git a/doc/gnushogi.html b/doc/gnushogi.html new file mode 100644 index 0000000..c20fcc9 --- /dev/null +++ b/doc/gnushogi.html @@ -0,0 +1,58 @@ + + + + + +GNU Shogi manual: GNU Shogi manual + + + + + + + + + + + + + + + + + +
[Top][Contents][Index][ ? ]
+
+

GNU Shogi manual

+ +

+ + + + + + + + + +
1. Introduction  What is GNU shogi?
GNU GENERAL PUBLIC LICENSE  The GNU General Public License.
2. About the game of shogi  General information, rules, etc.
3. gnushogi  How to play GNU shogi (gnushogi).
4. xshogi  The X interface to GNU shogi.
5. References and links  Where to go for more information.
6. Acknowledgements  
7. Bugs  Where and how to report bugs.
8. Index  
+

+ +

+
+ +This document was generated +by Michael C. Vanier on July, 7 2004 +using texi2html + + + diff --git a/doc/gnushogi.info b/doc/gnushogi.info index 1798d34..b009eee 100644 --- a/doc/gnushogi.info +++ b/doc/gnushogi.info @@ -1,4 +1,4 @@ -This is gnushogi.info, produced by Makeinfo version 3.12h from +This is gnushogi.info, produced by makeinfo version 4.3 from gnushogi.texinfo. This file describes how to use GNU shogi, a program which plays @@ -23,33 +23,33 @@ translation approved by the Free Software Foundation.  Indirect: -gnushogi.info-1: 928 -gnushogi.info-2: 49347 +gnushogi.info-1: 926 +gnushogi.info-2: 49337  Tag Table: (Indirect) -Node: Top928 -Node: Introduction1486 -Node: License2566 -Node: About shogi21727 -Node: The rules of shogi24322 -Node: The moves of the pieces25984 -Node: The opening setup29150 -Node: Promotion of pieces30682 -Node: Drops32525 -Node: Winning the game34777 -Node: Draws35491 -Node: Handicaps37896 -Node: Notes for chess players41323 -Node: Sample game42042 -Node: Mating problems49347 -Node: Shogi variants51596 -Node: Differences between shogi and chess55956 -Node: gnushogi60365 -Node: xshogi71847 -Node: References and links88414 -Node: Acknowledgements91580 -Node: Bugs93108 -Node: Index93592 +Node: Top926 +Node: Introduction1484 +Node: License2565 +Node: About shogi21724 +Node: The rules of shogi24319 +Node: The moves of the pieces25979 +Node: The opening setup29145 +Node: Promotion of pieces30677 +Node: Drops32518 +Node: Winning the game34770 +Node: Draws35484 +Node: Handicaps37889 +Node: Notes for chess players41315 +Node: Sample game42033 +Node: Mating problems49337 +Node: Shogi variants51585 +Node: Differences between shogi and chess55943 +Node: gnushogi60351 +Node: xshogi71829 +Node: References and links87937 +Node: Acknowledgements91081 +Node: Bugs92590 +Node: Index93073  End Tag Table diff --git a/doc/gnushogi.info-1 b/doc/gnushogi.info-1 index c2af8de..e37ba55 100644 --- a/doc/gnushogi.info-1 +++ b/doc/gnushogi.info-1 @@ -1,4 +1,4 @@ -This is gnushogi.info, produced by Makeinfo version 3.12h from +This is gnushogi.info, produced by makeinfo version 4.3 from gnushogi.texinfo. This file describes how to use GNU shogi, a program which plays @@ -50,9 +50,9 @@ chess, against a human (or computer) opponent. This file describes how to use GNU shogi and also gives background information about the game of shogi. - This file describes GNU shogi version 1.3. It was written by me, + This file describes GNU shogi version 1.3.2. It was written by me, Mike Vanier, the current maintainer of GNU shogi. My email address is -. +. GNU shogi is actually two programs: @@ -81,7 +81,6 @@ GNU GENERAL PUBLIC LICENSE ************************** Version 2, June 1991 - Copyright (C) 1989, 1991 Free Software Foundation, Inc. 675 Mass Ave, Cambridge, MA 02139, USA @@ -140,7 +139,6 @@ patent must be licensed for everyone's free use or not licensed at all. modification follow. TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION - 0. This License applies to any program or other work which contains a notice placed by the copyright holder saying it may be distributed under the terms of this General Public License. The "Program", @@ -524,8 +522,8 @@ Kanji characters on each piece. In fact, only the top character is needed to identify the piece and thus only the top character is used in shogi diagrams. I will use alphabetical equivalents in the diagrams here; to see what the Kanji characters look like, start up xshogi -(*note xshogi::.) and compare the starting setup there with the -starting setup in this file (*note The opening setup::.). +(*note xshogi::) and compare the starting setup there with the starting +setup in this file (*note The opening setup::). The object of the game is to capture the opponent's King. The board is a grid of 9x9 uncolored squares, and pieces are placed on the @@ -650,7 +648,7 @@ Promotion of pieces In sharp contrast to international chess, where only pawns can promote to higher-ranked pieces, most of the pieces in shogi can promote. The promoted ranks are discussed in the section on piece -moves (*note The moves of the pieces::.) but are repeated here for +moves (*note The moves of the pieces::) but are repeated here for reference: Pawn @@ -701,7 +699,7 @@ promotion zone. Promotion is mandatory in these cases: These forced promotions ensure that a piece cannot be moved to a square from which it would have no further move. - Pieces "dropped" onto the board (*note Drops::.) always drop in the + Pieces "dropped" onto the board (*note Drops::) always drop in the unpromoted state, even if they drop into the promotion zone.  @@ -856,7 +854,7 @@ strongest. The degree of the handicap, represented by the position in the list, represents the difference in rank between the two players for which the handicap is appropriate. These rules are taken from the books "Shogi for Beginners" by John Fairbairn and "The Art of Shogi" by Tony -Hoskings (*note References and links::.) and, I believe, represent +Hoskings (*note References and links::) and, I believe, represent current Japanese practice. @@ -921,7 +919,7 @@ Some of these have been mentioned elsewhere, but they bear repeating. 3. There is no special castling move. There _are_ a large number of possible defensive formations referred to as "castles" (*note - Sample game::.) but there is no need for special moves to create + Sample game::) but there is no need for special moves to create them. 4. A given piece can only promote to _one_ other kind of piece. @@ -935,7 +933,7 @@ Sample game =========== This game was annotated by Pieter Stouten (*note References and -links::.). I have made some minor corrections. Note that captures are +links::). I have made some minor corrections. Note that captures are denoted by the "x" symbol e.g. Rx3f and drops are denoted by the "*" symbol e.g. R*3f. Check is indicated by a "+" after the move, e.g. R3f+. I recommend you use gnushogi/xshogi to play along with this diff --git a/doc/gnushogi.info-2 b/doc/gnushogi.info-2 index af2563b..12ceac9 100644 --- a/doc/gnushogi.info-2 +++ b/doc/gnushogi.info-2 @@ -1,4 +1,4 @@ -This is gnushogi.info, produced by Makeinfo version 3.12h from +This is gnushogi.info, produced by makeinfo version 4.3 from gnushogi.texinfo. This file describes how to use GNU shogi, a program which plays @@ -62,7 +62,7 @@ three-mover. Here is a really trivial three-mover: Black in hand: S, G - Here, Black plays G*2b, White plays K1c, and Black plays S*1d mate. + Here, Black plays G*2b, White plays K1c, and Black plays G*1d mate. More typical tsume problems range from 5 moves to arbitrarily high numbers of moves, and they can be quite brain-busting. Tsume problems may seem artificial, but in the closing stages of the game where both @@ -73,7 +73,7 @@ scenario for the attacker: you have to mate your opponent even though he has every piece not on the board in hand, which means you have to develop sharp attacking skills. Many more tsume problems can be found on the internet; I particularly recommend Patrick Davin's "Shogi Nexus" -(*note References and links::.). +(*note References and links::).  File: gnushogi.info, Node: Shogi variants, Next: Differences between shogi and chess, Prev: Mating problems, Up: About shogi @@ -90,11 +90,11 @@ Chu (middle) shogi, which is still played a little bit. Thanks to the efforts of George Hodges and John Fairbairn of the Shogi Association (two British shogi enthusiasts), these games were resurrected and rules and sets for them can still be purchased from George Hodges (*note -References and links::.). I hope to eventually extend GNU shogi so -that it can play at least some of these games. There are also several +References and links::). I hope to eventually extend GNU shogi so that +it can play at least some of these games. There are also several non-historical variants of shogi; I don't know much about them but you can find information about them on the internet (*note References and -links::.). +links::). The historical variants include: @@ -143,7 +143,7 @@ links::.). with 192 pieces. For those for whom Dai-dai shogi is just too small :-) - 8. Tai (grand) shogi, played on a 25x25 board with 377 pieces! Until + 8. Tai (grand) shogi, played on a 25x25 board with 354 pieces! Until recently, this was thought to be the biggest chess game ever devised, but now there is... @@ -175,7 +175,7 @@ thorny question of which game is "better" although my bias may have already come through :-) In fact, the drop rule makes the two games so different in character that arguing over which game is better is like comparing apples to oranges (you'd be better off comparing chess to Chu -shogi (*note Shogi variants::.). However, I believe that if you are a +shogi (*note Shogi variants::). However, I believe that if you are a chess fan you'll really like shogi as well, and shogi is also popular with many people who don't particularly like chess. @@ -334,10 +334,10 @@ xshogi::. The book gnushogi.tbk consists of a sequence of openings. An opening begins with a line starting with a # (the rest of the line is a comment). Following this is a series of moves in algebraic notation -alternating black and white separated by white space. A move may have a -? after it indicating this move should never be made in this position. -Moves are stored as position:move so transpositions between openings can -take place. +alternating between black and white separated by whitespace. A move +may have a ? after it indicating this move should never be made in +this position. Moves are stored as position:move so transpositions +between openings can take place. HASHFILE @@ -468,8 +468,8 @@ English. causes the computer to play both sides of a shogi game. `black' - causes the computer to take the white pieces, if the computer is - to move first. + causes the computer to play as White, if the computer was to move + first. `bsave' saves a game to disk as a book textfile. The program will prompt @@ -606,7 +606,7 @@ English. backout the last level for both sides. Equal to 2 undo's. `reverse' - causes the board display to be reversed. That is, the black + causes the board display to be reversed. That is, the Black's pieces will now appear at the top of the board. `rv' @@ -640,8 +640,8 @@ English. (e.g. retract one move for each side). `white' - causes the computer to take the black pieces, if the computer is - to move first the go command must be given. + causes the computer to play as Black; if the computer is to move + first the go command must be given. `xget' read an xshogi position file. @@ -806,21 +806,12 @@ that you can set in your .Xdefaults file. colors or four. You shouldn't have to specify monochrome. xshogi will determine if this is necessary. -`-wpc or -blackPieceColor color' - Color specification for black pieces suitable for - XParseColor(3X11). Default: #FFFFCC. These colors look good on a - DEC workstation. If you need different colors, try using the - xcolors application. Source for xcolors can be found in the X11 - contrib directory. +`-pc or -pieceColor color' + Color specification for pieces suitable for XParseColor(). + Default: #FFFFD7. -`-bpc or -whitePieceColor color' - Same for white pieces. Default: #202020. - -`-lsc or -lightSquareColor color' - Same for light squares. Default: #C8C365. - -`-dsc or -darkSquareColor color' - Same for dark squares. Default: #77A26D. +`-sc or -squareColor color' + Same for squares. Default: #EBDFB0. `-wps or -westernPieceSet (True | False)' Choose the Western style piece set. @@ -869,7 +860,7 @@ that you can set in your .Xdefaults file. Shogi thinks on your time; if not, it does not. (Yes, this does seem backwards, doesn't it.) You can also try adding other commands to the initString; see the gnushogi documentation (*note - gnushogi::.) for details. + gnushogi::) for details. `blackString and whiteString' These resources control what is sent when the Machine Black and @@ -897,11 +888,8 @@ that you can set in your .Xdefaults file. If you are using a grayscale monitor, try setting the colors to: - XShogi*blackPieceColor: gray100 - XShogi*whitePieceColor: gray0 - XShogi*lightSquareColor: gray60 - XShogi*darkSquareColor: gray40 - + XShogi*pieceColor: gray100 + XShogi*squareColor: gray60 COMMAND BUTTONS AND KEYS @@ -997,14 +985,15 @@ that you can set in your .Xdefaults file. the Black or White indicator at the top of the screen. `Challenge' - allows to make a two display game between two human players. + allows you to make a two display game between two human players. Enter the display you want to connect to. If you are allowed to connect, a new board is displayed at the remote display. Challenge mode can only be stopped by pressing "quit". `Select Level' - allows to reset the clocks for both players. Enter the number of - moves and the number of minutes in which the moves should be done. + allows you to reset the clocks for both players. Enter the number + of moves and the number of minutes in which the moves should be + done. `Move NOW' force computer to stop thinking and to make the current best move. @@ -1136,7 +1125,7 @@ did the translation from Japanese to English. George also sells equipment for all the historical shogi variants -(*note Shogi variants::.) (except for Kyoku tai shogi) and also sells +(*note Shogi variants::) (except for Kyoku tai shogi) and also sells back issues of the magazine "Shogi" which he published for 70 issues in the late 70's to late 80's. This magazine is STRONGLY recommended; it contains more information about shogi in English than you will ever @@ -1145,7 +1134,7 @@ find anywhere else. Here are some useful URLs: -Pieter Stouten's shogi page: `http://www.halcyon.com/stouten/shogi.html' +Pieter Stouten's shogi page: `http://www.shogi.net' This is the main shogi-related site on the internet, with links to almost all the other sites. @@ -1195,10 +1184,10 @@ Acknowledgements West. * Pieter Stouten, for having the most comprehensive shogi site on the - World Wide Web `http://www.halcyon.com/stouten/shogi.html', and for - maintaining the shogi-l mailing list. Go to Pieter's web site for - more information on subscribing to the list. Also thanks to - everyone who contributes and has contributed to that list. + World Wide Web (`http://www.shogi.net'), and for maintaining the + shogi-l mailing list. Go to Pieter's web site for more + information on subscribing to the list. Also thanks to everyone + who contributes and has contributed to that list. * Matt Casters, for testing GNU shogi. Matt and I will be working together on improving the solution engine in future versions of @@ -1214,7 +1203,7 @@ Bugs The motto of GNU shogi is "100% bug-free or you don't pay!" :-) In the extremely unlikely case (*ahem*) that you do find a bug, please -send me (Mike Vanier) an email at . Also, feel +send me (Mike Vanier) an email at . Also, feel free to send me comments, complaints, out-and-out raves, suggestions, plane tickets to Hawaii, and/or large suitcases filled with unmarked, untraceable hundred-dollar bills. @@ -1234,6 +1223,7 @@ Index * Dai-dai Shogi: Shogi variants. * Draws: Draws. * Drops: Drops. +* gnushogi: gnushogi. * GPL: License. * Handicaps: Handicaps. * Introduction: Introduction. @@ -1256,7 +1246,6 @@ Index * Wa Shogi: Shogi variants. * Web sites: References and links. * Winning the game: Winning the game. -* gnushogi: gnushogi. * xshogi: xshogi. diff --git a/doc/gnushogi.ps b/doc/gnushogi.ps index 58de818..db33063 100644 --- a/doc/gnushogi.ps +++ b/doc/gnushogi.ps @@ -1,5 +1,5 @@ %!PS-Adobe-2.0 -%%Creator: dvips(k) 5.85 Copyright 1999 Radical Eye Software +%%Creator: dvips(k) 5.86 Copyright 1999 Radical Eye Software %%Title: gnushogi.dvi %%Pages: 52 %%PageOrder: Ascend @@ -8,7 +8,7 @@ %DVIPSWebPage: (www.radicaleye.com) %DVIPSCommandLine: dvips -t letter gnushogi.dvi -o gnushogi.ps %DVIPSParameters: dpi=600, compressed -%DVIPSSource: TeX output 1999.06.29:0328 +%DVIPSSource: TeX output 2004.07.07:1715 %%BeginProcSet: texc.pro %! /TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S @@ -1691,11 +1691,11 @@ Fj(GNU)45 b(shogi)g(is)f(a)i(program)f(that)h(pla)m(ys)f(shogi,)j(the)e 643 y(h)m(uman)33 b(\(or)h(computer\))h(opp)s(onen)m(t.)51 b(This)32 b(\014le)h(describ)s(es)f(ho)m(w)i(to)h(use)e(GNU)i(shogi)e (and)h(also)g(giv)m(es)150 752 y(bac)m(kground)c(information)f(ab)s -(out)h(the)g(game)i(of)e(shogi.)275 887 y(This)21 b(\014le)i(describ)s -(es)e(GNU)j(shogi)f(v)m(ersion)g(1.3.)39 b(It)24 b(w)m(as)f(written)g -(b)m(y)g(me,)i(Mik)m(e)f(V)-8 b(anier,)25 b(the)e(curren)m(t)150 -996 y(main)m(tainer)29 b(of)i(GNU)g(shogi.)40 b(My)31 -b(email)e(address)h(is)f Fg(mvanier@bbb.caltech.edu)p +(out)h(the)g(game)i(of)e(shogi.)275 887 y(This)37 b(\014le)h(describ)s +(es)g(GNU)i(shogi)f(v)m(ersion)g(1.3.2.)69 b(It)39 b(w)m(as)h(written)e +(b)m(y)i(me,)h(Mik)m(e)f(V)-8 b(anier,)42 b(the)150 996 +y(curren)m(t)30 b(main)m(tainer)f(of)i(GNU)g(shogi.)40 +b(My)31 b(email)e(address)h(is)f Fg(mvanier@cs.caltech.edu)p Fj(.)275 1131 y(GNU)i(shogi)e(is)h(actually)g(t)m(w)m(o)h(programs:)150 1375 y(`)p Fg(gnushogi)p Fj(')630 1484 y(is)e(the)i(text-based)g (program)g(whic)m(h)e(also)h(con)m(tains)h(the)f(game-pla)m(ying)h @@ -2942,9 +2942,9 @@ y(|)190 b(|)h(|)g(|)95 b(c)150 2683 y(----------------+)198 198 3012 y(|)190 b(|)h(|)g(|)95 b(e)150 3122 y(----------------+)198 3231 y(|)190 b(|)48 b(bN)f(|)191 b(|)95 b(f)150 3341 y(----------------+)150 3450 y(Black)46 b(in)i(hand:)94 -b(S,)47 b(G)275 3794 y Fj(Here,)40 b(Blac)m(k)e(pla)m(ys)f(G*2b,)k -(White)c(pla)m(ys)g(K1c,)j(and)e(Blac)m(k)g(pla)m(ys)f(S*1d)h(mate.)63 -b(More)38 b(t)m(ypical)150 3904 y(tsume)28 b(problems)f(range)i(from)g +b(2G)275 3794 y Fj(Here,)38 b(Blac)m(k)f(pla)m(ys)f(G*2b,)j(White)d +(pla)m(ys)g(K1c,)i(and)e(Blac)m(k)h(pla)m(ys)f(G*1d)h(mate.)59 +b(More)37 b(t)m(ypical)150 3904 y(tsume)28 b(problems)f(range)i(from)g (5)g(mo)m(v)m(es)h(to)f(arbitrarily)d(high)h(n)m(um)m(b)s(ers)g(of)i (mo)m(v)m(es,)i(and)d(they)h(can)g(b)s(e)150 4013 y(quite)k (brain-busting.)49 b(Tsume)33 b(problems)f(ma)m(y)j(seem)f @@ -3053,7 +3053,7 @@ b(prett)m(y)j(outlandish,)e(but)g(they)h(ha)m(v)m(e)h(actually)e(b)s (oard)e(with)f(192)j(pieces.)47 b(F)-8 b(or)330 5092 y(those)31 b(for)f(whom)g(Dai-dai)g(shogi)f(is)h(just)g(to)s(o)h(small) e(:-\))199 5230 y(8.)61 b(T)-8 b(ai)35 b(\(grand\))g(shogi,)h(pla)m(y)m -(ed)f(on)g(a)h(25x25)h(b)s(oard)d(with)g(377)i(pieces!)55 +(ed)f(on)g(a)h(25x25)h(b)s(oard)d(with)g(354)i(pieces!)55 b(Un)m(til)34 b(recen)m(tly)-8 b(,)38 b(this)c(w)m(as)330 5340 y(though)m(t)d(to)g(b)s(e)f(the)g(biggest)h(c)m(hess)g(game)g(ev)m (er)g(devised,)f(but)f(no)m(w)i(there)f(is...)p eop @@ -3250,18 +3250,18 @@ b(Chapter)e(4)i([xshogi],)150 5213 y(page)31 b(33.)p eop %%Page: 28 30 28 29 bop 150 -116 a Fj(28)2734 b(GNU)31 b(Shogi)f(man)m(ual)275 -299 y(BOOK)275 541 y(The)36 b(b)s(o)s(ok)g(gn)m(ushogi.tbk)h(consists)f -(of)h(a)g(sequence)h(of)f(op)s(enings.)59 b(An)36 b(op)s(ening)g(b)s -(egins)f(with)h(a)150 650 y(line)25 b(starting)h(with)f(a)i(#)g(\(the)g -(rest)f(of)h(the)g(line)e(is)g(a)i(commen)m(t\).)41 b(F)-8 -b(ollo)m(wing)26 b(this)g(is)f(a)i(series)f(of)h(mo)m(v)m(es)150 -760 y(in)33 b(algebraic)h(notation)g(alternating)g(blac)m(k)g(and)g -(white)f(separated)i(b)m(y)f(white)f(space.)53 b(A)35 -b(mo)m(v)m(e)g(ma)m(y)150 870 y(ha)m(v)m(e)j(a)f(?)59 -b(after)38 b(it)e(indicating)f(this)g(mo)m(v)m(e)j(should)d(nev)m(er)i -(b)s(e)f(made)h(in)e(this)h(p)s(osition.)58 b(Mo)m(v)m(es)39 -b(are)150 979 y(stored)30 b(as)h(p)s(osition:mo)m(v)m(e)f(so)h(transp)s -(ositions)d(b)s(et)m(w)m(een)j(op)s(enings)e(can)i(tak)m(e)g(place.)275 +299 y(BOOK)275 541 y(The)24 b(b)s(o)s(ok)g(gn)m(ushogi.tbk)g(consists)h +(of)g(a)g(sequence)g(of)g(op)s(enings.)38 b(An)24 b(op)s(ening)f(b)s +(egins)h(with)f(a)j(line)150 650 y(starting)k(with)f(a)h(#)g(\(the)h +(rest)f(of)g(the)h(line)d(is)h(a)i(commen)m(t\).)42 b(F)-8 +b(ollo)m(wing)29 b(this)g(is)h(a)g(series)f(of)i(mo)m(v)m(es)g(in)150 +760 y(algebraic)i(notation)h(alternating)f(b)s(et)m(w)m(een)h(blac)m(k) +f(and)g(white)g(separated)h(b)m(y)f(whitespace.)50 b(A)33 +b(mo)m(v)m(e)150 870 y(ma)m(y)i(ha)m(v)m(e)h(a)f(?)52 +b(after)35 b(it)f(indicating)f(this)g(mo)m(v)m(e)j(should)c(nev)m(er)j +(b)s(e)f(made)g(in)g(this)f(p)s(osition.)51 b(Mo)m(v)m(es)150 +979 y(are)31 b(stored)f(as)h(p)s(osition:mo)m(v)m(e)f(so)h(transp)s +(ositions)d(b)s(et)m(w)m(een)j(op)s(enings)e(can)h(tak)m(e)i(place.)275 1221 y(HASHFILE)275 1463 y(The)37 b(hash\014le)f(if)g(created)j(should) c(b)s(e)i(on)h(the)g(order)f(of)g(4)h(megab)m(ytes;)43 b(y)m(ou)38 b(can)g(create)h(suc)m(h)f(a)150 1573 y(hash\014le)h(b)m(y) @@ -3357,14 +3357,14 @@ Fg(book)p Fj(')238 b(turns)29 b(o\013)i(use)f(of)h(the)f(op)s(ening)f (library)-8 b(.)150 4268 y(`)p Fg(both)p Fj(')238 b(causes)31 b(the)f(computer)h(to)g(pla)m(y)f(b)s(oth)f(sides)h(of)g(a)h(shogi)f (game.)150 4427 y(`)p Fg(black)p Fj(')190 b(causes)31 -b(the)f(computer)h(to)g(tak)m(e)h(the)e(white)g(pieces,)g(if)f(the)i -(computer)f(is)g(to)h(mo)m(v)m(e)h(\014rst.)150 4585 -y(`)p Fg(bsave)p Fj(')190 b(sa)m(v)m(es)33 b(a)f(game)g(to)g(disk)e(as) -i(a)g(b)s(o)s(ok)e(text\014le.)44 b(The)31 b(program)h(will)c(prompt)j -(the)g(user)g(for)630 4695 y(a)g(\014le)e(name.)150 4853 -y(`)p Fg(gamein)p Fj(')142 b(toggles)36 b(game)g(mo)s(de)f(time)g(con)m -(trol.)55 b(Assumes)34 b(the)i(time)f(sp)s(eci\014ed)e(for)i(time)f -(con)m(trol)630 4963 y(is)d(the)h(time)f(for)g(a)h(complete)g(game.)46 +b(the)f(computer)h(to)g(pla)m(y)f(as)g(White,)h(if)e(the)i(computer)f +(w)m(as)h(to)g(mo)m(v)m(e)h(\014rst.)150 4585 y(`)p Fg(bsave)p +Fj(')190 b(sa)m(v)m(es)33 b(a)f(game)g(to)g(disk)e(as)i(a)g(b)s(o)s(ok) +e(text\014le.)44 b(The)31 b(program)h(will)c(prompt)j(the)g(user)g(for) +630 4695 y(a)g(\014le)e(name.)150 4853 y(`)p Fg(gamein)p +Fj(')142 b(toggles)36 b(game)g(mo)s(de)f(time)g(con)m(trol.)55 +b(Assumes)34 b(the)i(time)f(sp)s(eci\014ed)e(for)i(time)f(con)m(trol) +630 4963 y(is)d(the)h(time)f(for)g(a)h(complete)g(game.)46 b(Input)30 b(with)h(the)g(lev)m(el)h(command)f(should)f(b)s(e)h(the)630 5072 y(game)36 b(time)f(and)g(the)g(exp)s(ected)h(n)m(um)m(b)s(er)e(of) h(mo)m(v)m(es)i(in)d(a)i(game.)56 b(go)36 b(command)f(m)m(ust)630 @@ -3474,9 +3474,9 @@ b(causes)31 b(the)f(program)g(to)i(randomize)d(its)h(mo)m(v)m(e)i Fj(')190 b(set)31 b(recapture)f(mo)s(de.)150 2924 y(`)p Fg(remove)p Fj(')142 b(bac)m(k)m(out)32 b(the)e(last)h(lev)m(el)f(for)g (b)s(oth)g(sides.)39 b(Equal)29 b(to)j(2)e(undo's.)150 -3082 y(`)p Fg(reverse)p Fj(')94 b(causes)41 b(the)g(b)s(oard)f(displa)m -(y)f(to)j(b)s(e)e(rev)m(ersed.)72 b(That)41 b(is,)h(the)f(blac)m(k)g -(pieces)g(will)d(no)m(w)630 3192 y(app)s(ear)30 b(at)h(the)f(top)h(of)g +3082 y(`)p Fg(reverse)p Fj(')94 b(causes)36 b(the)g(b)s(oard)f(displa)m +(y)f(to)j(b)s(e)e(rev)m(ersed.)58 b(That)35 b(is,)i(the)f(Blac)m(k's)h +(pieces)f(will)d(no)m(w)630 3192 y(app)s(ear)d(at)h(the)f(top)h(of)g (the)f(b)s(oard.)150 3351 y(`)p Fg(rv)p Fj(')334 b(rev)m(erse)31 b(b)s(oard)e(displa)m(y)-8 b(.)150 3510 y(`)p Fg(save)p Fj(')238 b(sa)m(v)m(es)32 b(a)f(game)g(to)g(disk.)39 @@ -3503,10 +3503,10 @@ Fj(')238 b(undo)s(es)29 b(the)h(last)g(mo)m(v)m(e)h(whether)f(it)f(w)m b(ou)30 b(ma)m(y)630 4962 y(also)i(t)m(yp)s(e)g(\\remo)m(v)m(e".)47 b(This)30 b(is)g(equiv)-5 b(alen)m(t)31 b(to)i(t)m(w)m(o)g(\\undo"'s)f (\(e.g.)46 b(retract)32 b(one)g(mo)m(v)m(e)630 5071 y(for)e(eac)m(h)i -(side\).)150 5230 y(`)p Fg(white)p Fj(')190 b(causes)34 -b(the)h(computer)e(to)i(tak)m(e)h(the)e(blac)m(k)g(pieces,)h(if)e(the)h -(computer)g(is)f(to)h(mo)m(v)m(e)i(\014rst)630 5340 y(the)31 -b(go)g(command)f(m)m(ust)g(b)s(e)g(giv)m(en.)p eop +(side\).)150 5230 y(`)p Fg(white)p Fj(')190 b(causes)35 +b(the)g(computer)g(to)g(pla)m(y)f(as)h(Blac)m(k;)k(if)33 +b(the)i(computer)g(is)f(to)h(mo)m(v)m(e)h(\014rst)e(the)h(go)630 +5340 y(command)30 b(m)m(ust)g(b)s(e)g(giv)m(en.)p eop %%Page: 32 34 32 33 bop 150 -116 a Fj(32)2734 b(GNU)31 b(Shogi)f(man)m(ual)150 299 y(`)p Fg(xget)p Fj(')238 b(read)30 b(an)h(xshogi)e(p)s(osition)g @@ -3676,170 +3676,157 @@ h(pieces)h(and)f(squares)g(with)g(t)m(w)m(o)i(colors)f(or)630 1494 y(four.)42 b(Y)-8 b(ou)31 b(shouldn't)e(ha)m(v)m(e)j(to)g(sp)s (ecify)e(mono)s(c)m(hrome.)42 b(xshogi)31 b(will)d(determine)i(if)g (this)630 1604 y(is)f(necessary)-8 b(.)150 1763 y(`)p -Fg(-wpc)29 b(or)h(-blackPieceColor)c(color)p Fj(')630 -1873 y(Color)37 b(sp)s(eci\014cation)g(for)g(blac)m(k)h(pieces)f -(suitable)g(for)g(XP)m(arseColor\(3X11\).)66 b(Default:)630 -1983 y(#FFFF)m(CC.)24 b(These)f(colors)g(lo)s(ok)g(go)s(o)s(d)g(on)g(a) -h(DEC)f(w)m(orkstation.)38 b(If)23 b(y)m(ou)h(need)e(di\013eren)m(t)630 -2092 y(colors,)28 b(try)g(using)e(the)h(xcolors)h(application.)38 -b(Source)27 b(for)g(xcolors)h(can)g(b)s(e)e(found)h(in)f(the)630 -2202 y(X11)31 b(con)m(trib)f(directory)-8 b(.)150 2361 -y(`)p Fg(-bpc)29 b(or)h(-whitePieceColor)c(color)p Fj(')630 -2471 y(Same)k(for)h(white)e(pieces.)41 b(Default:)f(#202020.)150 -2630 y(`)p Fg(-lsc)29 b(or)h(-lightSquareColor)c(color)p -Fj(')630 2740 y(Same)k(for)h(ligh)m(t)e(squares.)40 b(Default:)h -(#C8C365.)150 2899 y(`)p Fg(-dsc)29 b(or)h(-darkSquareColor)c(color)p -Fj(')630 3009 y(Same)k(for)h(dark)e(squares.)41 b(Default:)g(#77A26D.) -150 3168 y(`)p Fg(-wps)29 b(or)h(-westernPieceSet)c(\(True)j(|)h -(False\))p Fj(')630 3278 y(Cho)s(ose)g(the)h(W)-8 b(estern)31 -b(st)m(yle)g(piece)f(set.)150 3437 y(`)p Fg(-npb)f(or)h -(-normalPawnBitmap)c(file)p Fj(')150 3572 y(`)p Fg(-nnb)j(or)h -(-normalKnightBitmap)25 b(file)p Fj(')150 3706 y(`)p -Fg(-nbb)k(or)h(-normalBishopBitmap)25 b(file)p Fj(')150 -3841 y(`)p Fg(-nrb)k(or)h(-normalRookBitmap)c(file)p -Fj(')150 3975 y(`)p Fg(-nkb)j(or)h(-normalKingBitmap)c(file)p -Fj(')630 4085 y(Names)31 b(of)f(the)h(bitmap)e(\014les)h(for)g(the)g -(bitmap)f(piece)i(icons.)150 4244 y(`)p Fg(-rpb)e(or)h -(-reversePawnBitmap)c(file)p Fj(')150 4379 y(`)p Fg(-rnb)j(or)h -(-reverseKnightBitmap)25 b(file)p Fj(')150 4513 y(`)p +Fg(-pc)30 b(or)f(-pieceColor)f(color)p Fj(')630 1873 +y(Color)i(sp)s(eci\014cation)f(for)h(pieces)g(suitable)f(for)h(XP)m +(arseColor\(\).)42 b(Default:)f(#FFFFD7.)150 2032 y(`)p +Fg(-sc)30 b(or)f(-squareColor)f(color)p Fj(')630 2142 +y(Same)i(for)h(squares.)40 b(Default:)h(#EBDFB0.)150 +2301 y(`)p Fg(-wps)29 b(or)h(-westernPieceSet)c(\(True)j(|)h(False\))p +Fj(')630 2411 y(Cho)s(ose)g(the)h(W)-8 b(estern)31 b(st)m(yle)g(piece)f +(set.)150 2570 y(`)p Fg(-npb)f(or)h(-normalPawnBitmap)c(file)p +Fj(')150 2705 y(`)p Fg(-nnb)j(or)h(-normalKnightBitmap)25 +b(file)p Fj(')150 2839 y(`)p Fg(-nbb)k(or)h(-normalBishopBitmap)25 +b(file)p Fj(')150 2974 y(`)p Fg(-nrb)k(or)h(-normalRookBitmap)c(file)p +Fj(')150 3108 y(`)p Fg(-nkb)j(or)h(-normalKingBitmap)c(file)p +Fj(')630 3218 y(Names)31 b(of)f(the)h(bitmap)e(\014les)h(for)g(the)g +(bitmap)f(piece)i(icons.)150 3377 y(`)p Fg(-rpb)e(or)h +(-reversePawnBitmap)c(file)p Fj(')150 3512 y(`)p Fg(-rnb)j(or)h +(-reverseKnightBitmap)25 b(file)p Fj(')150 3646 y(`)p Fg(-rbb)k(or)h(-reverseBishopBitmap)25 b(file)p Fj(')150 -4648 y(`)p Fg(-rrb)k(or)h(-reverseRookBitmap)c(file)p -Fj(')150 4782 y(`)p Fg(-rkb)j(or)h(-reverseKingBitmap)c(file)p -Fj(')630 4892 y(Names)31 b(of)f(the)h(bitmap)e(\014les)h(for)g(the)g -(outline)f(piece)i(icons.)150 5051 y(`)p Fg(-debug)e(or)h(-debugMode)d -(\(True)i(|)h(False\))p Fj(')630 5161 y(T)-8 b(urns)29 +3781 y(`)p Fg(-rrb)k(or)h(-reverseRookBitmap)c(file)p +Fj(')150 3915 y(`)p Fg(-rkb)j(or)h(-reverseKingBitmap)c(file)p +Fj(')630 4025 y(Names)31 b(of)f(the)h(bitmap)e(\014les)h(for)g(the)g +(outline)f(piece)i(icons.)150 4184 y(`)p Fg(-debug)e(or)h(-debugMode)d +(\(True)i(|)h(False\))p Fj(')630 4294 y(T)-8 b(urns)29 b(on)h(debugging)f(prin)m(tout.)p eop %%Page: 36 38 36 37 bop 150 -116 a Fj(36)2734 b(GNU)31 b(Shogi)f(man)m(ual)275 -299 y(OTHER)f(X)i(RESOUR)m(CES)150 542 y(`)p Fg(initString)p -Fj(')630 652 y(The)k(actual)h(string)f(that)h(is)f(sen)m(t)h(to)g +299 y(OTHER)f(X)i(RESOUR)m(CES)150 540 y(`)p Fg(initString)p +Fj(')630 650 y(The)k(actual)h(string)f(that)h(is)f(sen)m(t)h(to)g (initialize)d(the)j(shogi)f(program)g(can)h(b)s(e)f(set)h(from)630 -762 y(.Xdefaults.)k(It)29 b(can't)h(b)s(e)e(set)i(from)f(the)g(command) +759 y(.Xdefaults.)k(It)29 b(can't)h(b)s(e)e(set)i(from)f(the)g(command) g(line)e(b)s(ecause)i(of)h(syn)m(tax)f(problems.)630 -871 y(The)j(default)g(v)-5 b(alue)32 b(is)g(\\new)p Fg(\\)p +869 y(The)j(default)g(v)-5 b(alue)32 b(is)g(\\new)p Fg(\\)p Fj(n)m(b)s(eep)p Fg(\\)p Fj(nrandom)p Fg(\\)p Fj(neasy)p Fg(\\)p Fj(n".)45 b(The)32 b(\\new")i(and)e(\\b)s(eep")630 -981 y(commands)i(are)g(required.)51 b(Y)-8 b(ou)35 b(can)f(remo)m(v)m +978 y(commands)i(are)g(required.)51 b(Y)-8 b(ou)35 b(can)f(remo)m(v)m (e)i(the)e(\\random")h(command)f(if)f(y)m(ou)h(lik)m(e;)630 -1090 y(including)28 b(it)j(causes)g(gn)m(ushogi)g(to)h(randomize)e(its) +1088 y(including)28 b(it)j(causes)g(gn)m(ushogi)g(to)h(randomize)e(its) h(mo)m(v)m(e)i(selection)e(sligh)m(tly)e(so)j(that)f(it)630 -1200 y(do)s(esn't)c(pla)m(y)g(the)h(same)g(mo)m(v)m(es)g(in)e(ev)m(ery) +1198 y(do)s(esn't)c(pla)m(y)g(the)h(same)g(mo)m(v)m(es)g(in)e(ev)m(ery) i(game.)41 b(Ev)m(en)28 b(without)e(\\random",)j(gn)m(ushogi)630 -1310 y(randomizes)38 b(its)g(c)m(hoice)h(of)g(mo)m(v)m(es)h(from)e(its) +1307 y(randomizes)38 b(its)g(c)m(hoice)h(of)g(mo)m(v)m(es)h(from)e(its) f(op)s(ening)h(b)s(o)s(ok.)64 b(Y)-8 b(ou)39 b(can)g(also)f(remo)m(v)m -(e)630 1419 y(\\easy")30 b(if)d(y)m(ou)i(lik)m(e;)f(including)d(it)j +(e)630 1417 y(\\easy")30 b(if)d(y)m(ou)i(lik)m(e;)f(including)d(it)j (toggles)h(easy)g(mo)s(de)f(o\013,)h(causing)f(gn)m(ushogi)f(to)i -(think)630 1529 y(on)d(y)m(our)g(time.)39 b(That)25 b(is,)i(if)e +(think)630 1526 y(on)d(y)m(our)g(time.)39 b(That)25 b(is,)i(if)e (\\easy")i(is)e(included)e(in)i(the)h(initString,)e(GNU)j(Shogi)e -(thinks)630 1638 y(on)33 b(y)m(our)h(time;)h(if)d(not,)j(it)e(do)s(es)g +(thinks)630 1636 y(on)33 b(y)m(our)h(time;)h(if)d(not,)j(it)e(do)s(es)g (not.)50 b(\(Y)-8 b(es,)36 b(this)c(do)s(es)h(seem)h(bac)m(kw)m(ards,)h -(do)s(esn't)e(it.\))630 1748 y(Y)-8 b(ou)39 b(can)f(also)g(try)g +(do)s(esn't)e(it.\))630 1745 y(Y)-8 b(ou)39 b(can)f(also)g(try)g (adding)f(other)h(commands)g(to)h(the)f(initString;)h(see)g(the)g(gn)m -(ushogi)630 1857 y(do)s(cumen)m(tation)30 b(\(see)i(Chapter)d(3)i([gn)m -(ushogi],)g(page)g(27\))g(for)f(details.)150 2016 y(`)p -Fg(blackString)e(and)h(whiteString)p Fj(')630 2125 y(These)42 +(ushogi)630 1855 y(do)s(cumen)m(tation)30 b(\(see)i(Chapter)d(3)i([gn)m +(ushogi],)g(page)g(27\))g(for)f(details.)150 2008 y(`)p +Fg(blackString)e(and)h(whiteString)p Fj(')630 2118 y(These)42 b(resources)h(con)m(trol)g(what)f(is)g(sen)m(t)h(when)e(the)i(Mac)m -(hine)f(Blac)m(k)i(and)e(Mac)m(hine)630 2235 y(White)i(buttons)g(are)h +(hine)f(Blac)m(k)i(and)e(Mac)m(hine)630 2228 y(White)i(buttons)g(are)h (selected.)84 b(This)43 b(is)g(mostly)h(for)g(compatibilit)m(y)f(with)g -(obsolete)630 2345 y(v)m(ersions)30 b(of)g(gn)m(ushogi.)630 -2478 y(Alternate)e(bitmaps)e(for)h(piece)h(icons)f(can)h(b)s(e)f(sp)s +(obsolete)630 2337 y(v)m(ersions)30 b(of)g(gn)m(ushogi.)630 +2469 y(Alternate)e(bitmaps)e(for)h(piece)h(icons)f(can)h(b)s(e)f(sp)s (eci\014ed)e(either)i(b)m(y)h(c)m(ho)s(osing)f(one)h(of)g(the)630 -2588 y(built-in)j(sets)k(or)f(with)e(the)j(\014le)e(name)h(resources)g +2578 y(built-in)j(sets)k(or)f(with)e(the)j(\014le)e(name)h(resources)g (describ)s(ed)e(ab)s(o)m(v)m(e.)54 b(There)33 b(are)i(three)630 -2698 y(built-in)c(sets)j(of)g(piece)g(bitmaps)f(a)m(v)-5 +2688 y(built-in)c(sets)j(of)g(piece)g(bitmaps)f(a)m(v)-5 b(ailable,)34 b(large)g(\(the)g(default\),)h(medium,)e(or)h(small.)630 -2807 y(It)c(is)g(easiest)h(to)g(select)g(the)f(set)h(y)m(ou)g(prefer)f -(in)f(the)h(.Xdefaults)g(\014le:)630 2941 y(XShogi*b)s(oardSize:)39 -b(Medium)630 3075 y(The)25 b(fon)m(t)g(used)g(for)g(button)g(lab)s(els) +2798 y(It)c(is)g(easiest)h(to)g(select)g(the)f(set)h(y)m(ou)g(prefer)f +(in)f(the)h(.Xdefaults)g(\014le:)630 2929 y(XShogi*b)s(oardSize:)39 +b(Medium)630 3061 y(The)25 b(fon)m(t)g(used)g(for)g(button)g(lab)s(els) e(and)i(commen)m(ts)h(can)g(b)s(e)e(c)m(hanged)i(in)e(the)h(.Xdefaults) -630 3185 y(\014le.)40 b(Y)-8 b(ou)31 b(ma)m(y)g(w)m(an)m(t)g(to)g(c)m +630 3170 y(\014le.)40 b(Y)-8 b(ou)31 b(ma)m(y)g(w)m(an)m(t)g(to)g(c)m (ho)s(ose)g(a)g(smaller)e(fon)m(t)i(if)e(y)m(ou)i(are)g(using)e(the)h -(small)f(pieces:)630 3319 y(XShogi*fon)m(t:)41 b(helv)m(etica)p -1536 3319 28 4 v 33 w(oblique12)630 3453 y(The)26 b(fon)m(t)i(used)e +(small)f(pieces:)630 3302 y(XShogi*fon)m(t:)41 b(helv)m(etica)p +1536 3302 28 4 v 33 w(oblique12)630 3433 y(The)26 b(fon)m(t)i(used)e (for)g(co)s(ordinates)h(\(when)f(the)h(sho)m(wCo)s(ords)f(option)g(is)g -(T)-8 b(rue\))27 b(can)g(b)s(e)f(set)630 3562 y(similarly:)630 -3696 y(XShogi*co)s(ordF)-8 b(on)m(t:)42 b(helv)m(etica)p -1780 3696 V 33 w(10)630 3830 y(If)30 b(y)m(ou)h(are)f(using)f(a)i(gra)m +(T)-8 b(rue\))27 b(can)g(b)s(e)f(set)630 3543 y(similarly:)630 +3674 y(XShogi*co)s(ordF)-8 b(on)m(t:)42 b(helv)m(etica)p +1780 3674 V 33 w(10)630 3806 y(If)30 b(y)m(ou)h(are)f(using)f(a)i(gra)m (yscale)h(monitor,)e(try)g(setting)g(the)h(colors)f(to:)630 -3964 y(XShogi*blac)m(kPieceColor:)40 b(gra)m(y100)630 -4074 y(XShogi*whitePieceColor:)f(gra)m(y0)630 4183 y(XShogi*ligh)m -(tSquareColor:)g(gra)m(y60)630 4293 y(XShogi*darkSquareColor:)g(gra)m -(y40)275 4561 y(COMMAND)31 b(BUTTONS)e(AND)i(KEYS)150 -4804 y(`)p Fg(Quit)p Fj(')238 b(Quits)29 b(xshogi.)40 -b(Q)30 b(or)h(q)f(is)f(a)i(k)m(eyb)s(oard)f(equiv)-5 -b(alen)m(t.)150 4963 y(`)p Fg(Reset)p Fj(')190 b(Resets)34 -b(xshogi)e(to)h(the)g(b)s(eginning)e(of)h(a)i(shogi)e(game.)49 -b(It)33 b(also)g(deselects)g(an)m(y)g(game)h(or)630 5072 -y(p)s(osition)28 b(\014les.)150 5230 y(`)p Fg(Flip)h(View)p -Fj(')630 5340 y(in)m(v)m(erts)h(the)h(view)e(of)i(the)f(shogi)g(b)s -(oard.)p eop +3937 y(XShogi*pieceColor:)40 b(gra)m(y100)630 4047 y +(XShogi*squareColor:)g(gra)m(y60)275 4419 y(COMMAND)31 +b(BUTTONS)e(AND)i(KEYS)150 4661 y(`)p Fg(Quit)p Fj(')238 +b(Quits)29 b(xshogi.)40 b(Q)30 b(or)h(q)f(is)f(a)i(k)m(eyb)s(oard)f +(equiv)-5 b(alen)m(t.)150 4814 y(`)p Fg(Reset)p Fj(')190 +b(Resets)34 b(xshogi)e(to)h(the)g(b)s(eginning)e(of)h(a)i(shogi)e +(game.)49 b(It)33 b(also)g(deselects)g(an)m(y)g(game)h(or)630 +4924 y(p)s(osition)28 b(\014les.)150 5077 y(`)p Fg(Flip)h(View)p +Fj(')630 5187 y(in)m(v)m(erts)h(the)h(view)e(of)i(the)f(shogi)g(b)s +(oard.)150 5340 y(`)p Fg(Hint)p Fj(')238 b(displa)m(ys)28 +b(a)j(mo)m(v)m(e)h(hin)m(t)d(from)h(gn)m(ushogi.)p eop %%Page: 37 39 37 38 bop 150 -116 a Fj(Chapter)30 b(4:)41 b(xshogi)2793 -b(37)150 299 y(`)p Fg(Hint)p Fj(')238 b(displa)m(ys)28 -b(a)j(mo)m(v)m(e)h(hin)m(t)d(from)h(gn)m(ushogi.)150 -457 y(`)p Fg(Load)f(Game)p Fj(')630 567 y(pla)m(ys)34 +b(37)150 299 y(`)p Fg(Load)29 b(Game)p Fj(')630 408 y(pla)m(ys)34 b(a)h(game)g(from)f(a)h(record)f(\014le.)52 b(If)34 b(no)h(\014le)e(is) h(sp)s(eci\014ed)f(a)h(p)s(opup)f(dialog)h(asks)g(for)630 -676 y(a)39 b(\014lename.)63 b(Game)39 b(\014les)e(are)i(found)e(in)g +518 y(a)39 b(\014lename.)63 b(Game)39 b(\014les)e(are)i(found)e(in)g (the)h(directory)g(named)g(b)m(y)g(the)g(SHOGIDIR)630 -786 y(en)m(vironmen)m(t)26 b(v)-5 b(ariable.)39 b(If)26 +628 y(en)m(vironmen)m(t)26 b(v)-5 b(ariable.)39 b(If)26 b(this)g(v)-5 b(ariable)25 b(is)h(not)h(declared)f(then)h(the)g(curren) -m(t)f(directory)630 896 y(is)34 b(used)g(unless)f(the)j(\014le)e(name)h +m(t)f(directory)630 737 y(is)34 b(used)g(unless)f(the)j(\014le)e(name)h (starts)g(with)f(a)h(/.)55 b(G)35 b(or)g(g)g(is)f(a)h(k)m(eyb)s(oard)g -(equiv)-5 b(alen)m(t.)630 1005 y(The)24 b(game)i(\014le)d(parser)h -(will)e(accept)27 b(almost)d(an)m(y)h(\014le)f(that)h(con)m(tains)g(mo) -m(v)m(es)h(in)d(algebraic)630 1115 y(notation.)67 b(If)38 -b(the)i(\014rst)e(line)f(b)s(egins)g(with)h(`#',)k(it)c(is)g(assumed)h -(to)g(b)s(e)g(a)g(title)g(and)f(is)630 1224 y(displa)m(y)m(ed.)64 -b(T)-8 b(ext)39 b(enclosed)g(in)e(paren)m(theses)i(or)f(square)h(brac)m -(k)m(ets)h(is)d(assumed)h(to)i(b)s(e)630 1334 y(commen)m(tary)30 +(equiv)-5 b(alen)m(t.)630 847 y(The)24 b(game)i(\014le)d(parser)h(will) +e(accept)27 b(almost)d(an)m(y)h(\014le)f(that)h(con)m(tains)g(mo)m(v)m +(es)h(in)d(algebraic)630 956 y(notation.)67 b(If)38 b(the)i(\014rst)e +(line)f(b)s(egins)g(with)h(`#',)k(it)c(is)g(assumed)h(to)g(b)s(e)g(a)g +(title)g(and)f(is)630 1066 y(displa)m(y)m(ed.)64 b(T)-8 +b(ext)39 b(enclosed)g(in)e(paren)m(theses)i(or)f(square)h(brac)m(k)m +(ets)h(is)d(assumed)h(to)i(b)s(e)630 1176 y(commen)m(tary)30 b(and)f(is)f(displa)m(y)m(ed)g(in)g(a)h(p)s(op-up)f(windo)m(w.)38 b(An)m(y)30 b(other)f(text)h(in)e(the)i(\014le)e(is)630 -1443 y(ignored.)150 1602 y(`)p Fg(Load)h(Position)p Fj(')630 -1711 y(sets)f(up)f(a)h(p)s(osition)e(from)h(a)h(p)s(osition)e(\014le.) +1285 y(ignored.)150 1463 y(`)p Fg(Load)h(Position)p Fj(')630 +1573 y(sets)f(up)f(a)h(p)s(osition)e(from)h(a)h(p)s(osition)e(\014le.) 39 b(If)27 b(no)h(\014le)e(is)h(sp)s(eci\014ed)f(a)i(p)s(opup)e(dialog) -h(asks)630 1821 y(for)21 b(a)g(\014lename.)36 b(P)m(osition)21 +h(asks)630 1682 y(for)21 b(a)g(\014lename.)36 b(P)m(osition)21 b(\014les)e(are)i(found)f(in)f(the)i(directory)f(named)h(b)m(y)f(the)h -(SHOGIDIR)630 1931 y(en)m(vironmen)m(t)26 b(v)-5 b(ariable.)39 +(SHOGIDIR)630 1792 y(en)m(vironmen)m(t)26 b(v)-5 b(ariable.)39 b(If)26 b(this)g(v)-5 b(ariable)25 b(is)h(not)h(declared)f(then)h(the)g -(curren)m(t)f(directory)630 2040 y(is)g(used)g(unless)f(the)i(\014le)f +(curren)m(t)f(directory)630 1902 y(is)g(used)g(unless)f(the)i(\014le)f (name)h(starts)h(with)d(a)j(/.)40 b(P)m(osition)26 b(\014les)g(m)m(ust) -h(b)s(e)f(in)f(the)j(format)630 2150 y(that)j(the)g(Sa)m(v)m(e)g(P)m -(osition)f(command)g(writes.)150 2308 y(`)p Fg(Save)f(Game)p -Fj(')630 2418 y(sa)m(v)m(es)42 b(a)e(game)i(to)f(a)g(record)f(\014le.) +h(b)s(e)f(in)f(the)j(format)630 2011 y(that)j(the)g(Sa)m(v)m(e)g(P)m +(osition)f(command)g(writes.)150 2189 y(`)p Fg(Save)f(Game)p +Fj(')630 2299 y(sa)m(v)m(es)42 b(a)e(game)i(to)f(a)g(record)f(\014le.) 70 b(If)39 b(no)i(\014le)e(is)g(sp)s(eci\014ed)g(a)i(p)s(opup)d(dialog) -i(asks)g(for)630 2527 y(a)34 b(\014lename.)50 b(If)33 +i(asks)g(for)630 2408 y(a)34 b(\014lename.)50 b(If)33 b(the)h(\014lename)f(exists,)i(the)e(user)g(is)g(ask)m(ed)h(whether)g -(the)f(curren)m(t)h(game)630 2637 y(record)24 b(is)g(b)s(e)g(app)s +(the)f(curren)m(t)h(game)630 2518 y(record)24 b(is)g(b)s(e)g(app)s (ended)e(to)j(this)f(\014le)f(or)i(if)e(the)i(\014le)e(should)g(b)s(e)h -(replaced.)38 b(Game)25 b(\014les)f(are)630 2746 y(sa)m(v)m(ed)33 +(replaced.)38 b(Game)25 b(\014les)f(are)630 2628 y(sa)m(v)m(ed)33 b(in)d(the)i(directory)g(named)f(b)m(y)h(the)g(SHOGIDIR)f(en)m (vironmen)m(t)h(v)-5 b(ariable.)44 b(If)31 b(this)630 -2856 y(v)-5 b(ariable)31 b(is)f(not)i(declared)f(then)h(the)g(curren)m +2737 y(v)-5 b(ariable)31 b(is)f(not)i(declared)f(then)h(the)g(curren)m (t)f(directory)g(is)g(used)g(unless)f(the)i(\014le)f(name)630 -2966 y(starts)h(with)f(a)h(/.)46 b(Game)33 b(\014les)e(are)h(h)m +2847 y(starts)h(with)f(a)h(/.)46 b(Game)33 b(\014les)e(are)h(h)m (uman-readable,)g(and)f(can)h(also)g(b)s(e)g(read)f(bac)m(k)i(b)m(y)630 -3075 y(the)38 b(Load)g(Game)h(command.)63 b(F)-8 b(urthermore,)40 +2956 y(the)38 b(Load)g(Game)h(command.)63 b(F)-8 b(urthermore,)40 b(they)e(are)g(accepted)h(as)g(gn)m(ushogi)e(text)630 -3185 y(b)s(o)s(ok\014les.)150 3343 y(`)p Fg(Save)29 b(Position)p -Fj(')630 3453 y(sa)m(v)m(es)j(a)f(p)s(osition)d(to)k(a)e(p)s(osition)f +3066 y(b)s(o)s(ok\014les.)150 3244 y(`)p Fg(Save)29 b(Position)p +Fj(')630 3354 y(sa)m(v)m(es)j(a)f(p)s(osition)d(to)k(a)e(p)s(osition)f (\014le.)40 b(If)30 b(no)h(\014le)e(is)h(sp)s(eci\014ed)f(a)h(p)s(opup) -f(dialog)h(asks)g(for)630 3562 y(a)j(\014lename.)46 b(P)m(osition)32 +f(dialog)h(asks)g(for)630 3463 y(a)j(\014lename.)46 b(P)m(osition)32 b(\014les)g(are)h(sa)m(v)m(ed)g(in)e(the)i(directory)f(named)g(b)m(y)h -(the)f(SHOGIDIR)630 3672 y(en)m(vironmen)m(t)26 b(v)-5 +(the)f(SHOGIDIR)630 3573 y(en)m(vironmen)m(t)26 b(v)-5 b(ariable.)39 b(If)26 b(this)g(v)-5 b(ariable)25 b(is)h(not)h(declared) -f(then)h(the)g(curren)m(t)f(directory)630 3781 y(is)k(used)h(unless)e +f(then)h(the)g(curren)m(t)f(directory)630 3682 y(is)k(used)h(unless)e (the)j(\014le)e(name)h(starts)h(with)e(a)i(/.)43 b(P)m(osition)31 -b(\014les)f(are)i(h)m(uman-readable,)630 3891 y(and)e(can)g(also)h(b)s +b(\014les)f(are)i(h)m(uman-readable,)630 3792 y(and)e(can)g(also)h(b)s (e)e(read)i(bac)m(k)g(b)m(y)f(the)h(Load)f(P)m(osition)g(command.)150 -4049 y(`)p Fg(Machine)f(White)p Fj(')630 4159 y(forces)i(gn)m(ushogi)f -(to)h(pla)m(y)f(white.)150 4317 y(`)p Fg(Machine)f(Black)p -Fj(')630 4427 y(forces)i(gn)m(ushogi)f(to)h(pla)m(y)f(blac)m(k.)150 -4585 y(`)p Fg(Force)f(Moves)p Fj(')630 4695 y(forces)h(a)g(series)g(of) +3970 y(`)p Fg(Machine)f(White)p Fj(')630 4080 y(forces)i(gn)m(ushogi)f +(to)h(pla)m(y)f(white.)150 4258 y(`)p Fg(Machine)f(Black)p +Fj(')630 4367 y(forces)i(gn)m(ushogi)f(to)h(pla)m(y)f(blac)m(k.)150 +4545 y(`)p Fg(Force)f(Moves)p Fj(')630 4655 y(forces)h(a)g(series)g(of) g(mo)m(v)m(es.)41 b(That)30 b(is,)f(gn)m(ushogi)h(stops)f(pla)m(ying)g -(and)g(xshogi)g(allo)m(ws)h(y)m(ou)630 4804 y(to)h(mak)m(e)g(mo)m(v)m -(es)h(for)e(b)s(oth)g(white)f(and)h(blac)m(k.)150 4963 -y(`)p Fg(Two)g(Machines)p Fj(')630 5072 y(pla)m(ys)g(a)h(game)g(b)s(et) +(and)g(xshogi)g(allo)m(ws)h(y)m(ou)630 4765 y(to)h(mak)m(e)g(mo)m(v)m +(es)h(for)e(b)s(oth)g(white)f(and)h(blac)m(k.)150 4943 +y(`)p Fg(Two)g(Machines)p Fj(')630 5052 y(pla)m(ys)g(a)h(game)g(b)s(et) m(w)m(een)g(t)m(w)m(o)h(computer)e(programs.)150 5230 y(`)p Fg(Forward)p Fj(')94 b(mo)m(v)m(es)41 b(forw)m(ard)e(through)g(a) h(series)e(of)i(remem)m(b)s(ered)f(mo)m(v)m(es.)69 b(F)40 @@ -3871,30 +3858,30 @@ g(square)630 1614 y(or)g(clear)h(the)f(b)s(oard.)45 b(Y)-8 b(ou)33 b(can)g(set)f(the)h(side)e(to)i(pla)m(y)f(next)g(b)m(y)g(clic)m (king)f(on)i(the)f(Blac)m(k)630 1724 y(or)e(White)h(indicator)e(at)i (the)f(top)h(of)g(the)f(screen.)150 1888 y(`)p Fg(Challenge)p -Fj(')630 1998 y(allo)m(ws)41 b(to)i(mak)m(e)g(a)g(t)m(w)m(o)g(displa)m -(y)e(game)i(b)s(et)m(w)m(een)g(t)m(w)m(o)g(h)m(uman)f(pla)m(y)m(ers.)75 -b(En)m(ter)43 b(the)630 2108 y(displa)m(y)36 b(y)m(ou)j(w)m(an)m(t)g -(to)g(connect)g(to.)65 b(If)37 b(y)m(ou)i(are)g(allo)m(w)m(ed)f(to)g -(connect,)k(a)c(new)g(b)s(oard)630 2217 y(is)h(displa)m(y)m(ed)f(at)j -(the)f(remote)h(displa)m(y)-8 b(.)68 b(Challenge)38 b(mo)s(de)i(can)g -(only)f(b)s(e)g(stopp)s(ed)g(b)m(y)630 2327 y(pressing)29 -b(\\quit".)150 2491 y(`)p Fg(Select)g(Level)p Fj(')630 -2601 y(allo)m(ws)g(to)h(reset)g(the)f(clo)s(c)m(ks)h(for)f(b)s(oth)f -(pla)m(y)m(ers.)41 b(En)m(ter)29 b(the)h(n)m(um)m(b)s(er)e(of)h(mo)m(v) -m(es)i(and)e(the)630 2710 y(n)m(um)m(b)s(er)g(of)i(min)m(utes)e(in)g -(whic)m(h)g(the)i(mo)m(v)m(es)g(should)e(b)s(e)h(done.)150 -2875 y(`)p Fg(Move)f(NOW)p Fj(')65 b(force)31 b(computer)f(to)h(stop)g -(thinking)d(and)i(to)h(mak)m(e)g(the)g(curren)m(t)f(b)s(est)g(mo)m(v)m -(e.)150 3040 y(`)p Fg(Iconify)f(I,)g(i,)h(C)g(or)g(c)p -Fj(')630 3149 y(iconi\014es)f(xshogi.)275 3426 y(LIMIT)-8 -b(A)g(TIONS)275 3675 y(If)28 b(y)m(ou)g(press)g(the)h(P)m(ause)f -(button)h(during)d(GNU)j(Shogi's)e(turn,)h(xshogi)g(will)e(stop)j(the)f -(clo)s(c)m(ks,)i(but)150 3785 y(gn)m(ushogi)g(will)d(still)i(mak)m(e)i -(a)g(mo)m(v)m(e.)275 3924 y(After)d(a)h(mate)h(or)f(dra)m(w)f(when)g -(pla)m(ying)f(against)i(gn)m(ushogi,)g(if)e(y)m(ou)i(bac)m(k)h(up)d -(with)h(the)h(Bac)m(kw)m(ard)150 4034 y(button,)h(the)h(clo)s(c)m(ks)f -(are)h(reset)g(\(b)s(ecause)g(gn)m(ushogi)f(has)g(exited)g(and)g(m)m -(ust)g(b)s(e)g(restarted\).)275 4173 y(The)f(game)j(parser)e +Fj(')630 1998 y(allo)m(ws)f(y)m(ou)h(to)h(mak)m(e)g(a)f(t)m(w)m(o)h +(displa)m(y)d(game)j(b)s(et)m(w)m(een)f(t)m(w)m(o)h(h)m(uman)e(pla)m(y) +m(ers.)41 b(En)m(ter)30 b(the)630 2108 y(displa)m(y)36 +b(y)m(ou)j(w)m(an)m(t)g(to)g(connect)g(to.)65 b(If)37 +b(y)m(ou)i(are)g(allo)m(w)m(ed)f(to)g(connect,)k(a)c(new)g(b)s(oard)630 +2217 y(is)h(displa)m(y)m(ed)f(at)j(the)f(remote)h(displa)m(y)-8 +b(.)68 b(Challenge)38 b(mo)s(de)i(can)g(only)f(b)s(e)g(stopp)s(ed)g(b)m +(y)630 2327 y(pressing)29 b(\\quit".)150 2491 y(`)p Fg(Select)g(Level)p +Fj(')630 2601 y(allo)m(ws)f(y)m(ou)g(to)h(reset)g(the)f(clo)s(c)m(ks)h +(for)f(b)s(oth)f(pla)m(y)m(ers.)40 b(En)m(ter)28 b(the)h(n)m(um)m(b)s +(er)e(of)h(mo)m(v)m(es)i(and)630 2710 y(the)h(n)m(um)m(b)s(er)e(of)h +(min)m(utes)g(in)f(whic)m(h)g(the)h(mo)m(v)m(es)i(should)c(b)s(e)i +(done.)150 2875 y(`)p Fg(Move)f(NOW)p Fj(')65 b(force)31 +b(computer)f(to)h(stop)g(thinking)d(and)i(to)h(mak)m(e)g(the)g(curren)m +(t)f(b)s(est)g(mo)m(v)m(e.)150 3040 y(`)p Fg(Iconify)f(I,)g(i,)h(C)g +(or)g(c)p Fj(')630 3149 y(iconi\014es)f(xshogi.)275 3426 +y(LIMIT)-8 b(A)g(TIONS)275 3675 y(If)28 b(y)m(ou)g(press)g(the)h(P)m +(ause)f(button)h(during)d(GNU)j(Shogi's)e(turn,)h(xshogi)g(will)e(stop) +j(the)f(clo)s(c)m(ks,)i(but)150 3785 y(gn)m(ushogi)g(will)d(still)i +(mak)m(e)i(a)g(mo)m(v)m(e.)275 3924 y(After)d(a)h(mate)h(or)f(dra)m(w)f +(when)g(pla)m(ying)f(against)i(gn)m(ushogi,)g(if)e(y)m(ou)i(bac)m(k)h +(up)d(with)h(the)h(Bac)m(kw)m(ard)150 4034 y(button,)h(the)h(clo)s(c)m +(ks)f(are)h(reset)g(\(b)s(ecause)g(gn)m(ushogi)f(has)g(exited)g(and)g +(m)m(ust)g(b)s(e)g(restarted\).)275 4173 y(The)f(game)j(parser)e (recognizes)h(only)e(algebraic)h(notation.)275 4423 y(A)m(UTHORS)275 4672 y(Original)d(authors)j(of)h(XBoard:)41 b(Chris)28 b(Sears)i(and)g(Dan)h(Sears.)275 4812 y(Enhancemen)m(ts)f(for)g(XBoard) @@ -4028,15 +4015,15 @@ b(whic)m(h)f(he)i(published)35 b(for)k(70)h(issues)e(in)g(the)i(late)g (information)e(ab)s(out)h(shogi)g(in)g(English)e(than)j(y)m(ou)150 4127 y(will)c(ev)m(er)j(\014nd)e(an)m(ywhere)h(else.)275 4256 y(Here)g(are)h(some)g(useful)e(URLs:)150 4495 y(Pieter)h -(Stouten's)h(shogi)f(page:)41 b Fg(http://www.halcyon.com/s)o(tout)o -(en/s)o(hog)o(i.ht)o(ml)630 4604 y Fj(This)29 b(is)h(the)h(main)e -(shogi-related)i(site)f(on)h(the)g(in)m(ternet,)g(with)e(links)g(to)i -(almost)g(all)f(the)630 4714 y(other)h(sites.)150 4863 -y(Roger)g(Hare's)g(shogi)f(page:)42 b Fg(http://www.ed.ac.uk/~r)o(jhar) -o(e/sh)o(ogi)630 4972 y Fj(This)29 b(has)h(lots)g(of)g(information,)f -(including)e(full)h(rules)h(to)i(most)g(of)g(the)f(shogi)g(v)-5 -b(arian)m(ts.)150 5121 y(P)m(atric)m(k)31 b(Da)m(vin's)g(Shogi)e -(Nexus:)41 b Fg(http://www.vega.or.jp/~)o(patr)o(ick/)o(sho)o(gi/)630 +(Stouten's)h(shogi)f(page:)41 b Fg(http://www.shogi.net)630 +4604 y Fj(This)29 b(is)h(the)h(main)e(shogi-related)i(site)f(on)h(the)g +(in)m(ternet,)g(with)e(links)g(to)i(almost)g(all)f(the)630 +4714 y(other)h(sites.)150 4863 y(Roger)g(Hare's)g(shogi)f(page:)42 +b Fg(http://www.ed.ac.uk/~r)o(jhar)o(e/sh)o(ogi)630 4972 +y Fj(This)29 b(has)h(lots)g(of)g(information,)f(including)e(full)h +(rules)h(to)i(most)g(of)g(the)f(shogi)g(v)-5 b(arian)m(ts.)150 +5121 y(P)m(atric)m(k)31 b(Da)m(vin's)g(Shogi)e(Nexus:)41 +b Fg(http://www.vega.or.jp/~)o(patr)o(ick/)o(sho)o(gi/)630 5230 y Fj(There's)32 b(lots)h(of)f(co)s(ol)h(stu\013)f(on)h(this)e (site;)j(m)m(y)f(fa)m(v)m(orite)h(is)d(the)i(extensiv)m(e)g(collection) g(of)630 5340 y(Tsume-shogi)22 b(\(mating\))h(problems,)f(b)s(oth)g @@ -4083,17 +4070,16 @@ y(probably)i(nev)m(er)h(ha)m(v)m(e)i(heard)e(of)g(shogi,)h(for)f m(bassador)h(of)g(shogi)e(to)j(the)e(W)-8 b(est.)225 1923 y Fi(\017)60 b Fj(Pieter)30 b(Stouten,)g(for)g(ha)m(ving)g(the)g (most)h(comprehensiv)m(e)e(shogi)h(site)g(on)g(the)g(W)-8 -b(orld)30 b(Wide)f(W)-8 b(eb)330 2032 y Fg(http://www.halcyon.com/s)o -(tout)o(en/s)o(hog)o(i.ht)o(ml)p Fj(,)16 b(and)k(for)g(main)m(taining)f -(the)i(shogi-l)e(mail-)330 2142 y(ing)32 b(list.)47 b(Go)34 -b(to)g(Pieter's)f(w)m(eb)g(site)f(for)h(more)g(information)f(on)h -(subscribing)c(to)34 b(the)f(list.)47 b(Also)330 2252 -y(thanks)30 b(to)h(ev)m(ery)m(one)h(who)e(con)m(tributes)g(and)g(has)g -(con)m(tributed)f(to)j(that)f(list.)225 2386 y Fi(\017)60 -b Fj(Matt)24 b(Casters,)h(for)e(testing)g(GNU)h(shogi.)38 -b(Matt)24 b(and)e(I)h(will)e(b)s(e)h(w)m(orking)g(together)j(on)e -(impro)m(ving)330 2496 y(the)31 b(solution)e(engine)g(in)g(future)h(v)m -(ersions)g(of)g(this)f(program.)p eop +b(orld)30 b(Wide)f(W)-8 b(eb)330 2032 y(\()p Fg(http://www.shogi.net)p +Fj(\),)27 b(and)j(for)h(main)m(taining)e(the)i(shogi-l)f(mailing)f +(list.)41 b(Go)31 b(to)h(Pieter's)330 2142 y(w)m(eb)f(site)f(for)g +(more)h(information)e(on)i(subscribing)c(to)k(the)g(list.)40 +b(Also)31 b(thanks)f(to)h(ev)m(ery)m(one)h(who)330 2252 +y(con)m(tributes)e(and)g(has)g(con)m(tributed)f(to)j(that)f(list.)225 +2386 y Fi(\017)60 b Fj(Matt)24 b(Casters,)h(for)e(testing)g(GNU)h +(shogi.)38 b(Matt)24 b(and)e(I)h(will)e(b)s(e)h(w)m(orking)g(together)j +(on)e(impro)m(ving)330 2496 y(the)31 b(solution)e(engine)g(in)g(future) +h(v)m(ersions)g(of)g(this)f(program.)p eop %%Page: 44 46 44 45 bop 150 -116 a Fj(44)2734 b(GNU)31 b(Shogi)f(man)m(ual)p eop @@ -4104,12 +4090,12 @@ b(45)150 299 y Fh(7)80 b(Bugs)275 533 y Fj(The)39 b(motto)i(of)f(GNU)h b(:-\))41 b(In)e(the)h(extremely)150 643 y(unlik)m(ely)31 b(case)k(\(*ahem*\))g(that)f(y)m(ou)g(do)g(\014nd)e(a)i(bug,)g(please)f (send)g(me)h(\(Mik)m(e)g(V)-8 b(anier\))34 b(an)g(email)e(at)150 -752 y Fg(mvanier@bbb.caltech.edu)p Fj(.)i(Also,)c(feel)g(free)g(to)h -(send)e(me)h(commen)m(ts,)i(complain)m(ts,)d(out-and-out)150 -862 y(ra)m(v)m(es,)45 b(suggestions,)g(plane)40 b(tic)m(k)m(ets)j(to)f -(Ha)m(w)m(aii,)i(and/or)d(large)g(suitcases)h(\014lled)d(with)h(unmark) -m(ed,)150 971 y(un)m(traceable)31 b(h)m(undred-dollar)c(bills.)p -eop +752 y Fg(mvanier@cs.caltech.edu)p Fj(.)46 b(Also,)35 +b(feel)f(free)h(to)g(send)e(me)h(commen)m(ts,)j(complain)m(ts,)d +(out-and-out)150 862 y(ra)m(v)m(es,)45 b(suggestions,)g(plane)40 +b(tic)m(k)m(ets)j(to)f(Ha)m(w)m(aii,)i(and/or)d(large)g(suitcases)h +(\014lled)d(with)h(unmark)m(ed,)150 971 y(un)m(traceable)31 +b(h)m(undred-dollar)c(bills.)p eop %%Page: 46 48 46 47 bop 150 -116 a Fj(46)2734 b(GNU)31 b(Shogi)f(man)m(ual)p eop diff --git a/doc/gnushogi.texinfo b/doc/gnushogi.texinfo index 1fdccf1..c61f656 100644 --- a/doc/gnushogi.texinfo +++ b/doc/gnushogi.texinfo @@ -123,9 +123,9 @@ GNU shogi is a program that plays shogi, the Japanese version of chess, against a human (or computer) opponent. This file describes how to use GNU shogi and also gives background information about the game of shogi. -This file describes GNU shogi version 1.3. It was written by me, Mike +This file describes GNU shogi version 1.3.2. It was written by me, Mike Vanier, the current maintainer of GNU shogi. My email address is -@email{mvanier@@bbb.caltech.edu}. +@email{mvanier@@cs.caltech.edu}. GNU shogi is actually two programs: @@ -1396,14 +1396,14 @@ Black in hand: S, G | | bN | | f ----------------+ -Black in hand: S, G +Black in hand: 2G \endVerbatim @end tex @sp 1 -Here, Black plays G*2b, White plays K1c, and Black plays S*1d mate. +Here, Black plays G*2b, White plays K1c, and Black plays G*1d mate. More typical tsume problems range from 5 moves to arbitrarily high numbers of moves, and they can be quite brain-busting. Tsume problems may seem artificial, but in the closing stages of the game where both @@ -1505,7 +1505,7 @@ Maka-dai-dai (great-great-great) shogi, played on a 19x19 board with 192 pieces. For those for whom Dai-dai shogi is just too small :-) @item -Tai (grand) shogi, played on a 25x25 board with 377 pieces! Until +Tai (grand) shogi, played on a 25x25 board with 354 pieces! Until recently, this was thought to be the biggest chess game ever devised, but now there is... @@ -1736,12 +1736,12 @@ BOOK @sp 1 The book gnushogi.tbk consists of a sequence of openings. An opening -begins with a line starting with a # (the rest of the line is a -comment). Following this is a series of moves in algebraic notation -alternating black and white separated by white space. A move may have a -? after it indicating this move should never be made in this position. -Moves are stored as position:move so transpositions between openings can -take place. +begins with a line starting with a # (the rest of the line is a comment). +Following this is a series of moves in algebraic notation alternating +between black and white separated by whitespace. A move may have a ? +after it indicating this move should never be made in this position. Moves +are stored as position:move so transpositions between openings can take +place. @sp 1 @@ -1885,7 +1885,7 @@ turns off use of the opening library. causes the computer to play both sides of a shogi game. @item black -causes the computer to take the white pieces, if the computer is to move +causes the computer to play as White, if the computer was to move first. @item bsave @@ -2029,7 +2029,7 @@ set recapture mode. backout the last level for both sides. Equal to 2 undo's. @item reverse -causes the board display to be reversed. That is, the black pieces will +causes the board display to be reversed. That is, the Black's pieces will now appear at the top of the board. @item rv @@ -2062,7 +2062,7 @@ may also type ``remove''. This is equivalent to two ``undo'''s (e.g. retract one move for each side). @item white -causes the computer to take the black pieces, if the computer is to move +causes the computer to play as Black; if the computer is to move first the go command must be given. @item xget @@ -2239,20 +2239,12 @@ Determines whether xshogi displays its pieces and squares with two colors or four. You shouldn't have to specify monochrome. xshogi will determine if this is necessary. -@item -wpc or -blackPieceColor color -Color specification for black pieces suitable for XParseColor(3X11). -Default: #FFFFCC. These colors look good on a DEC workstation. If you -need different colors, try using the xcolors application. Source for -xcolors can be found in the X11 contrib directory. - -@item -bpc or -whitePieceColor color -Same for white pieces. Default: #202020. - -@item -lsc or -lightSquareColor color -Same for light squares. Default: #C8C365. +@item -pc or -pieceColor color +Color specification for pieces suitable for XParseColor(). +Default: #FFFFD7. -@item -dsc or -darkSquareColor color -Same for dark squares. Default: #77A26D. +@item -sc or -squareColor color +Same for squares. Default: #EBDFB0. @item -wps or -westernPieceSet (True | False) Choose the Western style piece set. @@ -2328,10 +2320,8 @@ be set similarly: If you are using a grayscale monitor, try setting the colors to: - XShogi*blackPieceColor: gray100 @* - XShogi*whitePieceColor: gray0 @* - XShogi*lightSquareColor: gray60 @* - XShogi*darkSquareColor: gray40 + XShogi*pieceColor: gray100 @* + XShogi*squareColor: gray60 @* @end table @@ -2430,14 +2420,14 @@ the side to play next by clicking on the Black or White indicator at the top of the screen. @item Challenge -allows to make a two display game between two human players. Enter the -display you want to connect to. If you are allowed to connect, a new -board is displayed at the remote display. Challenge mode can only be -stopped by pressing ``quit''. +allows you to make a two display game between two human players. Enter +the display you want to connect to. If you are allowed to connect, a +new board is displayed at the remote display. Challenge mode can only +be stopped by pressing ``quit''. @item Select Level -allows to reset the clocks for both players. Enter the number of moves -and the number of minutes in which the moves should be done. +allows you to reset the clocks for both players. Enter the number of +moves and the number of minutes in which the moves should be done. @item Move NOW force computer to stop thinking and to make the current best move. @@ -2605,7 +2595,7 @@ Here are some useful URLs: @table @asis -@item Pieter Stouten's shogi page: @uref{http://www.halcyon.com/stouten/shogi.html} +@item Pieter Stouten's shogi page: @uref{http://www.shogi.net} This is the main shogi-related site on the internet, with links to almost all the other sites. @@ -2664,7 +2654,7 @@ for being the ambassador of shogi to the West. @item Pieter Stouten, for having the most comprehensive shogi site on the -World Wide Web @uref{http://www.halcyon.com/stouten/shogi.html}, and for +World Wide Web (@uref{http://www.shogi.net}), and for maintaining the shogi-l mailing list. Go to Pieter's web site for more information on subscribing to the list. Also thanks to everyone who contributes and has contributed to that list. @@ -2687,7 +2677,7 @@ program. The motto of GNU shogi is ``100% bug-free or you don't pay!'' :-) In the extremely unlikely case (*ahem*) that you do find a bug, please send me -(Mike Vanier) an email at @email{mvanier@@bbb.caltech.edu}. Also, feel +(Mike Vanier) an email at @email{mvanier@@cs.caltech.edu}. Also, feel free to send me comments, complaints, out-and-out raves, suggestions, plane tickets to Hawaii, and/or large suitcases filled with unmarked, untraceable hundred-dollar bills. diff --git a/doc/gnushogi_1.html b/doc/gnushogi_1.html index 2b15dd5..de4eb33 100644 --- a/doc/gnushogi_1.html +++ b/doc/gnushogi_1.html @@ -1,61 +1,91 @@ + + + - +GNU Shogi manual: Introduction -GNU Shogi manual - Introduction - - - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

+ + + + + + -

Introduction

+ + + + + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+
+ +

1. Introduction

+

- - -

GNU shogi is a program that plays shogi, the Japanese version of chess, against a human (or computer) opponent. This file describes how to use GNU shogi and also gives background information about the game of shogi. +

- -

-This file describes GNU shogi version 1.3. It was written by me, Mike +This file describes GNU shogi version 1.3.2. It was written by me, Mike Vanier, the current maintainer of GNU shogi. My email address is -mvanier@bbb.caltech.edu. - +mvanier@cs.caltech.edu. +

-

GNU shogi is actually two programs: - +

`gnushogi' -
-is the text-based program which also contains the game-playing engine. +
is the text-based program which also contains the game-playing engine. +

`xshogi' -
-is the X-windows graphical interface to gnushogi. +
is the X-windows graphical interface to gnushogi. +

-

+ Since xshogi invokes gnushogi, most players will just type "xshogi" and start playing. +

- -

Disclaimer: I use the personal pronouns "him", "his" etc. to refer to a shogi player regardless of gender. That's easier than writing "his or her" all over the place. I don't mean to infer that women don't play shogi; in fact shogi is very popular in Japan among women as well as men. - - -

- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]   +

+ + +

+
+ +This document was generated +by Michael C. Vanier on July, 7 2004 +using texi2html diff --git a/doc/gnushogi_10.html b/doc/gnushogi_10.html index ddb906b..5302c76 100644 --- a/doc/gnushogi_10.html +++ b/doc/gnushogi_10.html @@ -1,80 +1,118 @@ + + + - - -GNU Shogi manual - Draws - - - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

+GNU Shogi manual: Drops + + + + + -

Draws

-

- - + + + + + + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+

+

2.1.4 Drops

+

-There are very few draws in shogi; only about 1-2% of professional games -end in a draw. One reason for this is that material can never be -depleted as in chess, because captured pieces are constantly re-entering -play as a consequence of the drop rule. In fact, most of the ways a -game can be drawn in chess are not allowed in shogi: - - - -

    - -
  • Draws cannot be offered. -
  • There is no fifty-move rule. +When a player captures a piece, that piece is not removed from play. +Instead, it becomes the property of the capturer and can re-enter play +by being placed on (almost) any vacant square during the player's move. +This is known as a "drop" and counts as a full move (in other words, +you can either move a piece on the board or drop a piece onto the board +during your move, but not both). All pieces drop in the unpromoted +state. Pieces may be legally dropped in their promotion zone, but they +do not promote on that turn. +

    -

  • A stalemate counts as a win for the stalemater. Stated otherwise: +There are several restrictions on drops: +

    -if you can't move, you lose. - -

  • Perpetual check is illegal (see below). - -
+
    +
  1. A pawn may not be dropped onto a file if there is already an +unpromoted pawn belonging to the same player on that file. It is legal +to drop a pawn on a file which contains a promoted pawn belonging +to the same player, however.

    -There are only two legal ways in which a draw can occur: - - -

      +
    1. A pawn may not be dropped to give immediate checkmate on the +move. A pawn is, however, permitted to be moved on the board to give +immediate checkmate. This is a curious rule, and if anyone knows the +reason for it I would appreciate it if they would contact me and explain +it to me :-) +

      -

    2. A position (including the pieces in hand) occurs 4 times with the same - -player to move (called "Sennichite"). However, if this is caused by -consecutive checks (direct attacks on the King, threatening to capture -it on the next move) by one side, the player giving these checks loses -the game. In other words, perpetual check results in a loss for the -attacker who recreates the same position the 4th time. - -
    3. Both players have moved their King into the the promotion zone (or they - -cannot be prevented from doing so) and the Kings cannot be checkmated. -A King who has entered the promotion zone is known as an "entering -King"; due to the forward orientation of most shogi pieces, it is very -hard to mate such a King. In that case the players may decide to count -their pieces as follows: the King does not count, the Rook and Bishop -count as 5 points, and all other pieces as one point. Promotion is -disregarded. If both players have at least 24 points the game is a draw -(called "Jishogi"). If a player has less, he loses the game. - -Of course, a player can refuse to count pieces when he still has mating -chances or chances to gain material which would affect the outcome of -the counting. There is no strict rule about what to do if this is not -the case, but nonetheless a player refuses to count up (e.g. because he -does not have enough points for a draw). It has been generally accepted -that in such a case the game ends and the pieces are counted after one -player has managed to get all his pieces protected in the promotion -zone. +
    4. A pawn or piece may not be dropped onto a square from which they +would have no legal move. This means that pawns and lances may not be +dropped onto the last rank, and the knight may not be dropped onto the +last or second-to-last rank. +

    +

    -

    - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]   +It is entirely permissible (and often advisable) to drop a piece or pawn +between one's King and an attacking ranging piece. For this reason, +the final checkmating move is nearly always an attack on the King from +an adjacent square (except for an attack by a Knight). +

    + +Captured pieces are said to be pieces "in hand". +

    + +The drop is the primary distinguishing feature of Japanese chess, shared +with no other popular chess-type game. It gives shogi a very aggressive +quality, and dramatically increases the number of possible moves once a +few pieces have been captured. Another interesting feature of shogi is +that exchanges complicate play rather than simplifying it (as in +international chess), because of the drop rule. +

    + + +

    + + + + + + + + + + +
    [ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
    +
    + +This document was generated +by Michael C. Vanier on July, 7 2004 +using texi2html diff --git a/doc/gnushogi_11.html b/doc/gnushogi_11.html index 7b8cb17..4b0b2e5 100644 --- a/doc/gnushogi_11.html +++ b/doc/gnushogi_11.html @@ -1,126 +1,64 @@ + + + - +GNU Shogi manual: Winning the game -GNU Shogi manual - Handicaps - - - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

    - - -

    Handicaps

    -

    - - - -

    -Unlike international chess, shogi has a well-established handicap system -which is used when players of different strengths play against each -other. Handicaps range from small to huge, which makes it possible for -weak players to play against even very strong players and have an even -chance of winning. - - -

    -Shogi players are ranked as follows: the weakest rank is around 15 -"kyu", which represents a beginner. 14 kyu is higher than 15 kyu, 13 -kyu is higher still, and so on until you get to 1 kyu. The next highest -rank is 1 "dan", followed by 2 dan, 3 dan and so forth. The highest -amateur rank is 6 dan; professionals go up to 9 dan. However, -professional ranks are not the same as amateur ranks; a professional 1 -dan is much stronger than an amateur 1 dan. This system is -similar to that used by go players (and also other Japanese sports such -as karate). - - -

    -A handicap consists of the stronger player playing White and removing -one or more pieces from his side of the board at the start of the game. -These pieces are permanently removed from play; they are not in hand. - - -

    -The following is a list of the accepted handicaps, from weakest to -strongest. The degree of the handicap, represented by the position in -the list, represents the difference in rank between the two players for -which the handicap is appropriate. These rules are taken from the books -"Shogi for Beginners" by John Fairbairn and "The Art of Shogi" by -Tony Hoskings (see section References and links) and, I believe, represent -current Japanese practice. - - - -

      - -
    1. - -The stronger player removes his left lance (on 1a). - -
    2. - -The players play a two-game match; in the first game the stronger player -removes his left lance (on 1a), while in the second game he removes his -bishop. - -
    3. - -The stronger player removes his bishop. - -
    4. - -The stronger player removes his rook. - -
    5. - -The stronger player removes his rook and left lance. - -
    6. - -The players play a two-game match; in the first game the stronger player -removes his rook and left lance (on 1a), while in the second game he -removes his rook and bishop. - -
    7. - -The stronger player removes his rook and bishop. This is usually called -a "two-piece" handicap. - -
    8. - -The stronger player removes his rook, bishop, and both lances. This is -called a "four-piece" handicap. - -
    9. - -The stronger player removes his rook, bishop, both lances, and both -knights. This is called a "six-piece" handicap. - -
    10. - -The stronger player removes his rook, bishop, both lances, both knights, -and both silvers. This is called an "eight-piece" handicap. - -
    - -

    -Another advantage of playing handicap games is that the handicaps alter -the optimal strategy for both players. For instance, handicaps all have -their own opening lines which may bear little or no resemblance to those -used in non-handicap shogi. This means that when learning handicap -shogi, you are essentially learning completely new games which use the -same equipment! + + + + + + + + + + + + + + + + + + + +
    [ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
    +

    +

    2.1.5 Winning the game

    +

    -The reader may wonder how on earth a player giving an eight-piece -handicap, say, could possibly hope to win. Don't forget, though, that -in shogi the opponent's pieces can be captured and then become part of -one's own army. Thus, if the opponent plays badly enough, the number of -pieces will soon even out. - -

    - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]   +A game of shogi is won by capturing the opponent's king. In general, +this is done by checkmating the king: attacking the king in such a way +that the king cannot be defended no matter what the defending player +moves. Note, though, that there is no rule that requires a player to +defend a king which is being attacked. However, if he does not defend +his king, the opponent is entirely free to capture it on the next move, +thus winning the game. As in international chess, in practice most +games end by resignation when one player realizes that he cannot escape +checkmate. +

    + + +

    +
    + +This document was generated +by Michael C. Vanier on July, 7 2004 +using texi2html diff --git a/doc/gnushogi_12.html b/doc/gnushogi_12.html index b5370f4..2273f7a 100644 --- a/doc/gnushogi_12.html +++ b/doc/gnushogi_12.html @@ -1,40 +1,126 @@ + + + - +GNU Shogi manual: Draws + + + + + + -GNU Shogi manual - Notes for chess players - - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

    + + + + + + + + + + + + + +
    [ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
    +
    +

    2.1.6 Draws

    + +

    + +There are very few draws in shogi; only about 1-2% of professional games +end in a draw. One reason for this is that material can never be +depleted as in chess, because captured pieces are constantly re-entering +play as a consequence of the drop rule. In fact, most of the ways a +game can be drawn in chess are not allowed in shogi: +

    -

    Notes for chess players

    +
      +
    • Draws cannot be offered.

      -Here are a few miscellaneous things that may confuse chess players. -Some of these have been mentioned elsewhere, but they bear repeating. +

    • There is no fifty-move rule. +

      +

    • A stalemate counts as a win for the stalemater. Stated otherwise: +if you can't move, you lose. +

      -

        -
      1. There is no queen. +
      2. Perpetual check is illegal (see below). +

        -

      3. Pawns capture the same way they move. There is no initial +
    +

    -two-space pawn move and no en-passant move. +There are only two legal ways in which a draw can occur: +

    -

  2. There is no special castling move. There are a large +
      -number of possible defensive formations referred to as "castles" -(see section Sample game) but there is no need for special moves to create -them. +
    1. A position (including the pieces in hand) occurs 4 times with the same +player to move (called "Sennichite"). However, if this is caused by +consecutive checks (direct attacks on the King, threatening to capture +it on the next move) by one side, the player giving these checks loses +the game. In other words, perpetual check results in a loss for the +attacker who recreates the same position the 4th time. +

      -

    2. A given piece can only promote to one other kind of piece. +
    3. Both players have moved their King into the the promotion zone (or they +cannot be prevented from doing so) and the Kings cannot be checkmated. +A King who has entered the promotion zone is known as an "entering +King"; due to the forward orientation of most shogi pieces, it is very +hard to mate such a King. In that case the players may decide to count +their pieces as follows: the King does not count, the Rook and Bishop +count as 5 points, and all other pieces as one point. Promotion is +disregarded. If both players have at least 24 points the game is a draw +(called "Jishogi"). If a player has less, he loses the game. +

      + +Of course, a player can refuse to count pieces when he still has mating +chances or chances to gain material which would affect the outcome of +the counting. There is no strict rule about what to do if this is not +the case, but nonetheless a player refuses to count up (e.g. because he +does not have enough points for a draw). It has been generally accepted +that in such a case the game ends and the pieces are counted after one +player has managed to get all his pieces protected in the promotion +zone. +

    +

    -

    - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]   + +
    + + + + + + + + + + +
    [ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
    +
    + +This document was generated +by Michael C. Vanier on July, 7 2004 +using texi2html diff --git a/doc/gnushogi_13.html b/doc/gnushogi_13.html index 4e6c703..1598b55 100644 --- a/doc/gnushogi_13.html +++ b/doc/gnushogi_13.html @@ -1,210 +1,164 @@ + + + - +GNU Shogi manual: Handicaps -GNU Shogi manual - Sample game - - - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

    - - -

    Sample game

    -

    - - - -

    -This game was annotated by Pieter Stouten (see section References and links). I have made some minor corrections. Note that captures are -denoted by the "x" symbol e.g. Rx3f and drops are denoted by the "*" -symbol e.g. R*3f. Check is indicated by a "+" after the move, -e.g. R3f+. I recommend you use gnushogi/xshogi to play along with this -game. In xshogi simply hit the "Force Moves" button after starting -up, while in gnushogi enter the word "force" at the prompt. This will -allow you to enter moves for both sides. - - -

    -Note also that the move numbering system used here is the chess-type -system where one move means one move by each player. The Japanese count -one move made by each player as two moves. - - -

    ---------------------------------------------------------------------------- - - -

    -Below you will find (the English translation of) an annotated game which -was published in the Dutch Shogi magazine "81" and in the Dutch -beginners booklet. It has proven to be a very useful game to explain -some basic principles of Shogi. Also, it is a rather straightforward -game compared to professional games where in most cases very diffuse -middle game fights take place. - - -

    - Pieter Stouten, 14th May 1990. - - -

    ---------------------------------------------------------------------------- - - -

    -Black: Michael Trent (1-dan). White: David Murphy (2-dan). - - -

    - 1. P2f P3d 2. P2e B3c
    -[ This move is necessary, as otherwise white can exchange pawns: 3. P2d -Px2d 4. Rx2d. He would thus get a pawn in hand and open up his rook -file. ] - - -

    - 3. P7f P4d
    -[ White closes the bishop diagonal again. He plans to play ranging rook -(the rook goes to 5b, 4b, 3 or 2b; a defensive strategy) and in that -case he'd better avoid an exchange of bishops. One of the reasons is -that he will have problems developing his pieces without leaving holes -for bishop drops. ] - - -

    - 4. S4h R3b 5. P3f S4b 6. K6h K6b
    -[ In general the rook plays an important role in the attacks. It is -wise to move the king away from the area where the initial fights will -be and both players act according to the Shogi proverb "keep the rook -and king apart". ] + + + + + + -

    - 7. K7h K7b 8. P5f P5d 9. G4i-5h G4a-5b
    -[ Both players use their second gold general to build their castle. ] - - -

    - 10. S6h
    -[ In itself this move is not bad. However, it will become clear that -black plans a quick attack and in that case it is wiser to omit this -move. ] - - -

    - 10... S5c 11. P1f P1d
    -[ The advance of the edge pawns must be timed very well. The remark at -black's tenth move applies here too: this move is good if black wants to -play a slow game, because it eliminates a future B1e. ] - - -

    - 12. P4f K8b 13. N3g S7b
    -[ Black develops his knight in order to start an attack over the second, -third and fourth files. White strengthens his king's position and -awaits the attack. He aims at a counterattack as soon as black has -broken through into the white camp. Probably white's breakthrough will -take place later, but he has good compensation in the form of a stronger -castle. This theme occurs very often in static rook versus ranging rook -games. ] - - -

    - 14. P4e R4b
    -[ Black starts his attack and white puts up a very passive defence. His -rook has a hard task now to penetrate the black position. Moreover, he -blocks his own bishop. It seems much better to start a counterattack -with 14... P3e, later to be followed by B2b, B5a or Bx4d in order to use -his rook more actively. ] - - -

    - 15. Px4d Sx4d 16. P*4e S5c
    -[ 16... Sx4e is more active. A silver general is normally more valuable -than a knight, but white gets two pawns in hand and black none, while -the knight might come in handy for white too. ] - - -

    - 17. Bx3c+ Nx3c 18. P2d Px2d
    -[ Black threatens to break through and white has to consider taking the -pawn on 2d or starting a counterattack with Nx4e. If he chooses the -latter, black can play Px2c+ followed by +P3c. The disadvantage is the -black "tokin" (=promoted pawn) that white will get in his camp; the -advantage is that it will cost black two more moves to promote his rook. -Because white did not trust that the result after engaging in a -"semeai" (=mutual attack) with 18...Nx4e would give a positive result, -he captured the pawn on 2d. Making the right decision in moments like -this often makes the difference between a win and a loss: miss one -attacking chance and you will be forced to defend the whole game until -the unavoidable defeat; on the other hand, an unsound attack can destroy -all "aji" (=potential, meaning possibilities, threats) without getting -anything in return. ] - - -

    - 19. Rx2d Nx4e 20. Nx4e Rx4e 21. R2a+ P*4g
    -[ Now it becomes clear why black's 10. S6h was not good. Had this move -been omitted, then white would not have had the time to play 13... S7b -and after R2a+ the gold on 6a would hang. Thus black would have kept -"sente" (=initiative). Instead of 21... P*4g, B*6d is a very good -move, because after 22. P*2h black does not have a pawn in hand anymore -and he is being threatened with the annoying 22... N*4f 23. G5g N3h+ -24. S4g +N4h also. Black can also counter 21... B*6d with 22. N*3g. -White would then reply with 22... R4b 23. B*3c P*4g 24. Bx4b+ Sx4b. The -white rook has played its role and instead of spending moves on saving -it white starts to scatter black's defences by successive pawn drops on -the fourth file: 25. Gx4g P*4f 26. G5g N*6e 27. G5h P4g+ 28. Gx4g P*4f. -This analysis was provided by Kato Hifumi, 9-dan professional (the -highest regular grade). Destroying the coherence of the enemy pieces -(their shape) by dropping pawns is one of the most important Shogi -techniques. With the actual move 21... P*4g white missed a good -chance. ] - - -

    - 22. Sx4g P*4f 23. B*3g Px4g+ 24. +Rx6a +Px3g
    -[ 23. B*3g seems pointless, but a closer look reveals that it is -actually quite mean. On move 24 white cannot capture black's "Ryu" -(=dragon =promoted rook) with his silver: 24... Sx6a 25. N*7d K7b -26. G*8b mate. By attacking the front of the white castle and -threatening to mate him there, black has the chance to break down the -white defences from the side. ] - - -

    - 25. +Rx5b S*6b
    -[ Here 25... B*4d would be much better, because it is defensive and -attacking at the same time. After e.g. 26. G*4c Bx9i+ 27. Gx5c black -threatens 28. +Rx7b Kx7b 29. S*6a K8b 30. S*7a Kx7a 31. G*7b mate. -White is one move quicker, however. He has the following beautiful -"tsume" (mating sequence where every move is check): 27... N*8f 28. Px8f -S*8g 29. Kx8g B*9h 30. K7h Bx8i+ 31. K8g +B8i-8h 32. K9f L*9e mate. -This illustrates the sharpness of Shogi: one move can make the -difference between winning and losing. ] - - -

    - 26. P*4f Rx4f
    -[ This move eliminates white's last chances. 26... R4b 27. +Rx4b Sx4b -28. R*4a seems annoying, but after 28... B*3c 29. S7g B*3b white wins -the rook and with his "tokin" on 3g there still is some hope. ] - + + + + + + + + + + + + +
    [ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
    +

    +

    2.1.7 Handicaps

    +

    - 27. N*6e +P4g
    -[ White cannot defend anymore, so he starts a desperate attack. Black -does not lose the right track, however. ] +Unlike international chess, shogi has a well-established handicap system +which is used when players of different strengths play against each +other. Handicaps range from small to huge, which makes it possible for +weak players to play against even very strong players and have an even +chance of winning. +

    -

    - 28. Nx5c+ +Px5h 29. +Nx6b +Px6h 30. Gx6h N*8f 31. Px8f B*6i 32. Gx6i - R4h+ 33. N*6h +Rx6h 34. Gx6h S*8g 35. Kx8g N*9e 36. K7h Resigns
    -[ White resigns here, because after 36... B*8g 27. K7g his attack has -petered out. ] +Shogi players are ranked as follows: the weakest rank is around 15 +"kyu", which represents a beginner. 14 kyu is higher than 15 kyu, 13 +kyu is higher still, and so on until you get to 1 kyu. The next highest +rank is 1 "dan", followed by 2 dan, 3 dan and so forth. The highest +amateur rank is 6 dan; professionals go up to 9 dan. However, +professional ranks are not the same as amateur ranks; a professional 1 +dan is much stronger than an amateur 1 dan. This system is +similar to that used by go players (and also other Japanese sports such +as karate). +

    + +A handicap consists of the stronger player playing White and removing +one or more pieces from his side of the board at the start of the game. +These pieces are permanently removed from play; they are not in hand. +

    + +The following is a list of the accepted handicaps, from weakest to +strongest. The degree of the handicap, represented by the position in +the list, represents the difference in rank between the two players for +which the handicap is appropriate. These rules are taken from the books +"Shogi for Beginners" by John Fairbairn and "The Art of Shogi" by +Tony Hoskings (see section 5. References and links) and, I believe, represent +current Japanese practice. +

    + +

      + +
    1. +The stronger player removes his left lance (on 1a). +

      + +

    2. +The players play a two-game match; in the first game the stronger player +removes his left lance (on 1a), while in the second game he removes his +bishop. +

      + +

    3. +The stronger player removes his bishop. +

      + +

    4. +The stronger player removes his rook. +

      + +

    5. +The stronger player removes his rook and left lance. +

      + +

    6. +The players play a two-game match; in the first game the stronger player +removes his rook and left lance (on 1a), while in the second game he +removes his rook and bishop. +

      + +

    7. +The stronger player removes his rook and bishop. This is usually called +a "two-piece" handicap. +

      + +

    8. +The stronger player removes his rook, bishop, and both lances. This is +called a "four-piece" handicap. +

      + +

    9. +The stronger player removes his rook, bishop, both lances, and both +knights. This is called a "six-piece" handicap. +

      + +

    10. +The stronger player removes his rook, bishop, both lances, both knights, +and both silvers. This is called an "eight-piece" handicap. +

      + +

    +

    + +Another advantage of playing handicap games is that the handicaps alter +the optimal strategy for both players. For instance, handicaps all have +their own opening lines which may bear little or no resemblance to those +used in non-handicap shogi. This means that when learning handicap +shogi, you are essentially learning completely new games which use the +same equipment! +

    +The reader may wonder how on earth a player giving an eight-piece +handicap, say, could possibly hope to win. Don't forget, though, that +in shogi the opponent's pieces can be captured and then become part of +one's own army. Thus, if the opponent plays badly enough, the number of +pieces will soon even out. +

    -

    - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]   + +
    + + + + + + + + + + +
    [ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
    +
    + +This document was generated +by Michael C. Vanier on July, 7 2004 +using texi2html diff --git a/doc/gnushogi_14.html b/doc/gnushogi_14.html index 7ee806c..6058e6d 100644 --- a/doc/gnushogi_14.html +++ b/doc/gnushogi_14.html @@ -1,72 +1,77 @@ + + + - - -GNU Shogi manual - Mating problems - - - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

    +GNU Shogi manual: Notes for chess players + + + + + -

    Mating problems

    + -

    -One good way to improve at shogi is to solve mating problems. There are -several types of these problems, but the most common is called a -"tsume-shogi" problem, or "tsume" problem for short. In a tsume -problem, all pieces that are not on the board are assumed to be in the -opponent's hand (except for your King, which is usually not shown). -Every move you make must be check until the final checkmate. Your -opponent may play any piece on the board or drop any of his pieces in -hand in order to prevent the mate. In a properly constructed tsume -problem, all of your pieces on the board and in hand must be essential -to the solution. One consequence of this is that all of your pieces in -hand must be played during the solution. There should only be one -correct solution for the given number of moves. Tsume problems use -Japanese-style move numbering; thus, a problem where you move (and give -check), your opponent moves, and you move to give checkmate is called a + -three-mover. Here is a really trivial three-mover: + + + + + + + + + + + +
    [ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
    +

    +

    2.1.8 Notes for chess players

    +

    -

     
-   3    2    1            
-----------------+         
- |    |    |    |  a         
-----------------+           
- |    |    | wK |  b         
-----------------+           
- |    |    |    |  c       
-----------------+         
- | bN |    |    |  d       
-----------------+         
- |    |    |    |  e       
-----------------+         
- |    | bN |    |  f       
-----------------+
+Here are a few miscellaneous things that may confuse chess players.
+Some of these have been mentioned elsewhere, but they bear repeating.
+
    
 
-Black in hand: S, G
+
      
+
    1. There is no queen.
+
      
 
-
    +
  3. Pawns capture the same way they move. There is no initial +two-space pawn move and no en-passant move. +

    +

  4. There is no special castling move. There are a large +number of possible defensive formations referred to as "castles" +(see section 2.2 Sample game) but there is no need for special moves to create +them. +

    +

  5. A given piece can only promote to one other kind of piece.

    -Here, Black plays G*2b, White plays K1c, and Black plays S*1d mate. -More typical tsume problems range from 5 moves to arbitrarily high -numbers of moves, and they can be quite brain-busting. Tsume problems -may seem artificial, but in the closing stages of the game where both -players have a lot of pieces in hand, it is often necessary to give -check at every move, or else your opponent will start a counterattack -and will mate you before you mate him. A tsume problem is a worst-case -scenario for the attacker: you have to mate your opponent even though he -has every piece not on the board in hand, which means you have to -develop sharp attacking skills. Many more tsume problems can be found -on the internet; I particularly recommend Patrick Davin's "Shogi -Nexus" (see section References and links). +

+

-

- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]   + +
+
+ +This document was generated +by Michael C. Vanier on July, 7 2004 +using texi2html diff --git a/doc/gnushogi_15.html b/doc/gnushogi_15.html index 63f7e24..2ac7677 100644 --- a/doc/gnushogi_15.html +++ b/doc/gnushogi_15.html @@ -1,129 +1,231 @@ + + + - +GNU Shogi manual: Sample game -GNU Shogi manual - Shogi variants - - - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

- - -

Shogi variants

-

- - - - - - - - - - - - - -

-Several historical variants of shogi exist. Most of these were invented -before modern shogi (in some cases hundreds of years before), are much -larger than modern shogi and are not played with drops. Thus, in many -ways they are really more like giant chess games than like modern shogi. -The only one of these games to have survived in Japan is Chu (middle) -shogi, which is still played a little bit. Thanks to the efforts of -George Hodges and John Fairbairn of the Shogi Association (two British -shogi enthusiasts), these games were resurrected and rules and sets for -them can still be purchased from George Hodges (see section References and links). I hope to eventually extend GNU shogi so that it can play at -least some of these games. There are also several non-historical -variants of shogi; I don't know much about them but you can find -information about them on the internet (see section References and links). + + + + + + + + + + + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+

+

2.2 Sample game

+

-The historical variants include: - - - -

    - -
  1. - -Tori (bird) shogi, played on a 7x7 board with 32 pieces in all; this is -the only variant that is known to have been played with drops. - -
  2. - -Wa shogi, played on an 11x11 board with 54 pieces. This game can be -played with or without drops but the historical evidence favors the view -that it was played without drops. However, most people who have tried -it claim it is a much better game with drops, being even more intricate -than standard shogi. - -
  3. - -Chu (middle) shogi, played on a 12x12 board with 92 pieces. This was -(and is) by far the most popular of the variants, and has 21 different -kinds of pieces in the starting line-up alone (along with several others -that appear upon promotion). Unlike modern shogi, there are a -tremendous number of ranging pieces and the game is definitely not -played with drops. There is also an amazing piece called the Lion which -has a double king move and can capture two pieces at once! Chu shogi -has a small but fanatical following, some of whom consider it better -than modern shogi. - -
  4. - -Dai (great) shogi, played on a 15x15 board with 130 pieces. Other than -the larger board, this game is very similar to Chu shogi. - -
  5. - -Tenjiku (exotic) shogi, played on a 16x16 board with 176 pieces. This -game is possibly the most complex tactical game in existence. There are -many astoundingly powerful pieces, including one (the Fire Demon) that -can capture up to eight opposing pieces in a single move! Despite the -size of the game, checkmates can occur very suddenly (and often very -early on) if one player makes a wrong move. Tenjiku also has a small -but fanatical following, one of whom (Colin Adams) has written a book on -the game which is available for download at -http://www.colina.demon.co.uk/tenjiku.html. - -
  6. - -Dai-dai (great-great) shogi, played on a 17x17 board with 192 pieces. -The opening setup alone has 64 different kinds of pieces! This game and -the larger ones that follow sound pretty outlandish, but they have -actually been played; a game of Dai-dai can supposedly be played in -about 12 hours. - -
  7. - -Maka-dai-dai (great-great-great) shogi, played on a 19x19 board with 192 -pieces. For those for whom Dai-dai shogi is just too small :-) - -
  8. - -Tai (grand) shogi, played on a 25x25 board with 377 pieces! Until -recently, this was thought to be the biggest chess game ever devised, -but now there is... - -
  9. - -Kyoku tai (extremely grand?) shogi, played on a 36x36 board with 402 -pieces. The rules for this have just been unearthed in an old Japanese -book. Hopefully someone will soon organize a postal Kyoku tai shogi -championship; maybe their distant ancestors could finish it :-) - -It is thought that the really huge games (Dai-dai and up) were never -really played to any significant extent (gee, wonder why?) and were -devised merely so that the creators could have the fun of inventing -enormous games, amazing their friends and confounding their enemies. -However, the games up to Tenjiku shogi at least appear to be quite -playable, assuming one has the time. - -
-

- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]   +This game was annotated by Pieter Stouten (see section 5. References and links). I have made some minor corrections. Note that captures are +denoted by the "x" symbol e.g. Rx3f and drops are denoted by the "*" +symbol e.g. R*3f. Check is indicated by a "+" after the move, +e.g. R3f+. I recommend you use gnushogi/xshogi to play along with this +game. In xshogi simply hit the "Force Moves" button after starting +up, while in gnushogi enter the word "force" at the prompt. This will +allow you to enter moves for both sides. +

+ +Note also that the move numbering system used here is the chess-type +system where one move means one move by each player. The Japanese count +one move made by each player as two moves. +

+ +--------------------------------------------------------------------------- +

+ +Below you will find (the English translation of) an annotated game which +was published in the Dutch Shogi magazine "81" and in the Dutch +beginners booklet. It has proven to be a very useful game to explain +some basic principles of Shogi. Also, it is a rather straightforward +game compared to professional games where in most cases very diffuse +middle game fights take place. +

+ + Pieter Stouten, 14th May 1990. +

+ +--------------------------------------------------------------------------- +

+ +Black: Michael Trent (1-dan). White: David Murphy (2-dan). +

+ + 1. P2f P3d 2. P2e B3c
+[ This move is necessary, as otherwise white can exchange pawns: 3. P2d +Px2d 4. Rx2d. He would thus get a pawn in hand and open up his rook +file. ] +

+ + 3. P7f P4d
+[ White closes the bishop diagonal again. He plans to play ranging rook +(the rook goes to 5b, 4b, 3 or 2b; a defensive strategy) and in that +case he'd better avoid an exchange of bishops. One of the reasons is +that he will have problems developing his pieces without leaving holes +for bishop drops. ] +

+ + 4. S4h R3b 5. P3f S4b 6. K6h K6b
+[ In general the rook plays an important role in the attacks. It is +wise to move the king away from the area where the initial fights will +be and both players act according to the Shogi proverb "keep the rook +and king apart". ] +

+ + 7. K7h K7b 8. P5f P5d 9. G4i-5h G4a-5b
+[ Both players use their second gold general to build their castle. ] +

+ + 10. S6h
+[ In itself this move is not bad. However, it will become clear that +black plans a quick attack and in that case it is wiser to omit this +move. ] +

+ + 10... S5c 11. P1f P1d
+[ The advance of the edge pawns must be timed very well. The remark at +black's tenth move applies here too: this move is good if black wants to +play a slow game, because it eliminates a future B1e. ] +

+ + 12. P4f K8b 13. N3g S7b
+[ Black develops his knight in order to start an attack over the second, +third and fourth files. White strengthens his king's position and +awaits the attack. He aims at a counterattack as soon as black has +broken through into the white camp. Probably white's breakthrough will +take place later, but he has good compensation in the form of a stronger +castle. This theme occurs very often in static rook versus ranging rook +games. ] +

+ + 14. P4e R4b
+[ Black starts his attack and white puts up a very passive defence. His +rook has a hard task now to penetrate the black position. Moreover, he +blocks his own bishop. It seems much better to start a counterattack +with 14... P3e, later to be followed by B2b, B5a or Bx4d in order to use +his rook more actively. ] +

+ + 15. Px4d Sx4d 16. P*4e S5c
+[ 16... Sx4e is more active. A silver general is normally more valuable +than a knight, but white gets two pawns in hand and black none, while +the knight might come in handy for white too. ] +

+ + 17. Bx3c+ Nx3c 18. P2d Px2d
+[ Black threatens to break through and white has to consider taking the +pawn on 2d or starting a counterattack with Nx4e. If he chooses the +latter, black can play Px2c+ followed by +P3c. The disadvantage is the +black "tokin" (=promoted pawn) that white will get in his camp; the +advantage is that it will cost black two more moves to promote his rook. +Because white did not trust that the result after engaging in a +"semeai" (=mutual attack) with 18...Nx4e would give a positive result, +he captured the pawn on 2d. Making the right decision in moments like +this often makes the difference between a win and a loss: miss one +attacking chance and you will be forced to defend the whole game until +the unavoidable defeat; on the other hand, an unsound attack can destroy +all "aji" (=potential, meaning possibilities, threats) without getting +anything in return. ] +

+ + 19. Rx2d Nx4e 20. Nx4e Rx4e 21. R2a+ P*4g
+[ Now it becomes clear why black's 10. S6h was not good. Had this move +been omitted, then white would not have had the time to play 13... S7b +and after R2a+ the gold on 6a would hang. Thus black would have kept +"sente" (=initiative). Instead of 21... P*4g, B*6d is a very good +move, because after 22. P*2h black does not have a pawn in hand anymore +and he is being threatened with the annoying 22... N*4f 23. G5g N3h+ +24. S4g +N4h also. Black can also counter 21... B*6d with 22. N*3g. +White would then reply with 22... R4b 23. B*3c P*4g 24. Bx4b+ Sx4b. The +white rook has played its role and instead of spending moves on saving +it white starts to scatter black's defences by successive pawn drops on +the fourth file: 25. Gx4g P*4f 26. G5g N*6e 27. G5h P4g+ 28. Gx4g P*4f. +This analysis was provided by Kato Hifumi, 9-dan professional (the +highest regular grade). Destroying the coherence of the enemy pieces +(their shape) by dropping pawns is one of the most important Shogi +techniques. With the actual move 21... P*4g white missed a good +chance. ] +

+ + 22. Sx4g P*4f 23. B*3g Px4g+ 24. +Rx6a +Px3g
+[ 23. B*3g seems pointless, but a closer look reveals that it is +actually quite mean. On move 24 white cannot capture black's "Ryu" +(=dragon =promoted rook) with his silver: 24... Sx6a 25. N*7d K7b +26. G*8b mate. By attacking the front of the white castle and +threatening to mate him there, black has the chance to break down the +white defences from the side. ] +

+ + 25. +Rx5b S*6b
+[ Here 25... B*4d would be much better, because it is defensive and +attacking at the same time. After e.g. 26. G*4c Bx9i+ 27. Gx5c black +threatens 28. +Rx7b Kx7b 29. S*6a K8b 30. S*7a Kx7a 31. G*7b mate. +White is one move quicker, however. He has the following beautiful +"tsume" (mating sequence where every move is check): 27... N*8f 28. Px8f +S*8g 29. Kx8g B*9h 30. K7h Bx8i+ 31. K8g +B8i-8h 32. K9f L*9e mate. +This illustrates the sharpness of Shogi: one move can make the +difference between winning and losing. ] +

+ + 26. P*4f Rx4f
+[ This move eliminates white's last chances. 26... R4b 27. +Rx4b Sx4b +28. R*4a seems annoying, but after 28... B*3c 29. S7g B*3b white wins +the rook and with his "tokin" on 3g there still is some hope. ] +

+ + 27. N*6e +P4g
+[ White cannot defend anymore, so he starts a desperate attack. Black +does not lose the right track, however. ] +

+ + 28. Nx5c+ +Px5h 29. +Nx6b +Px6h 30. Gx6h N*8f 31. Px8f B*6i 32. Gx6i + R4h+ 33. N*6h +Rx6h 34. Gx6h S*8g 35. Kx8g N*9e 36. K7h Resigns
+[ White resigns here, because after 36... B*8g 27. K7g his attack has +petered out. ] +

+ + +

+ + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+
+ +This document was generated +by Michael C. Vanier on July, 7 2004 +using texi2html diff --git a/doc/gnushogi_16.html b/doc/gnushogi_16.html index ca5716f..f6953fc 100644 --- a/doc/gnushogi_16.html +++ b/doc/gnushogi_16.html @@ -1,145 +1,114 @@ + + + - +GNU Shogi manual: Mating problems -GNU Shogi manual - Differences between shogi and chess - - - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

- - -

Differences between shogi and chess

-

- - - -

-Some differences between shogi and international chess have been -mentioned elsewhere in this document; I summarize them here for people -who are interested in game comparisons. I won't try to deal with the -thorny question of which game is "better" although my bias may have -already come through :-) In fact, the drop rule makes the two games so -different in character that arguing over which game is better is like -comparing apples to oranges (you'd be better off comparing chess to Chu -shogi (see section Shogi variants). However, I believe that if you are a -chess fan you'll really like shogi as well, and shogi is also popular -with many people who don't particularly like chess. - - -

-Here are the significant differences between chess and shogi: - - - -

    - -
  1. - -In shogi, captured pieces become the property of the capturer and can -re-enter play by being dropped onto almost any vacant square. In chess, -captured pieces are out of the game. Thus, in shogi, piece exchanges -complicate the play significantly while in chess they simplify it. - -
  2. - -The shogi board is 9x9; the chess board is 8x8. - -
  3. - -Shogi has five pieces with no counterpart in chess: the gold and silver -generals, the lance, the promoted rook and the promoted bishop. Chess -has one piece with no counterpart in shogi: the queen. The knight's -move in shogi is much more restrictive than in chess. Pieces in shogi -generally have a much smaller range of movement than in chess (unless -they are in hand). - -
  4. - -In shogi, all pieces except the gold general and the king can promote, -but only to one kind of piece. Promotion is easier in shogi because the -promotion zone is closer to the starting position of the pieces -(especially pawns). In chess, only the pawn can promote, but it can -promote to any other piece except the king. - -
  5. - -In shogi, pawns capture the same way they move. There is no initial -two-space pawn move and hence no en-passant captures. In chess, -pawns capture diagonally which means that opposing pawns can block each -other. + + + + + -
  6. - -In shogi, you only have one rook and one bishop. Note that the bishop -is not restricted to only one "color" square (squares in shogi aren't -colored, but never mind) because promoted bishops can also move one -square orthogonally. - -
  7. - -There is no special castling move in shogi. The term "castle" is -used in shogi to denote a defensive formation consisting of (usually) -three generals which protect the king. There are many such castles -(about 40 or so have names). See section Sample game. - -
  8. - -Draws are much rarer in shogi than in chess. Perpetual check is not -allowed. Stalemate is a virtual impossibility, and is a loss for the -stalematee. - -
  9. - -Since pieces are never out of play in shogi, chess-type endgames -involving only a few pieces do not occur. - -
  10. - -Shogi games are generally longer than chess games (about 60-70 moves is -typical). - -
  11. - -Shogi has a well-developed handicap system which is in general use; -chess does not. - -
+ + + + + + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+
+

2.3 Mating problems

+

-The effects of all these differences on play include (in my opinion): - - - -

    - -
  1. - -Piece/pawn structures in chess are more rigid than in shogi. Pawns -block each other and pawns, once advanced, cannot ever retreat. In -shogi, you can repair the hole caused by a pawn advance by exchanging -the pawn and dropping it back where you want it. Thus shogi is more -fluid than chess and less "structural". - -
  2. - -Counterattack is MUCH more common in shogi than in chess. Games -typically end in mutual mating attacks, where each player is trying to -checkmate the other player before being checkmated himself. This makes -tempo incredibly important and also makes sacrificial play quite common. - -
  3. - -Attacks involving only ranging pieces are more a feature of chess than -of shogi. A shogi attack typically uses a ranging piece or pieces to -support an attack by short-range pieces (especially generals). It is -very rare to mate a king with a non-adjacent ranging piece in shogi -since the player whose king is threatened can almost always interpose by -dropping a piece. - -
-

- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]   +One good way to improve at shogi is to solve mating problems. There are +several types of these problems, but the most common is called a +"tsume-shogi" problem, or "tsume" problem for short. In a tsume +problem, all pieces that are not on the board are assumed to be in the +opponent's hand (except for your King, which is usually not shown). +Every move you make must be check until the final checkmate. Your +opponent may play any piece on the board or drop any of his pieces in +hand in order to prevent the mate. In a properly constructed tsume +problem, all of your pieces on the board and in hand must be essential +to the solution. One consequence of this is that all of your pieces in +hand must be played during the solution. There should only be one +correct solution for the given number of moves. Tsume problems use +Japanese-style move numbering; thus, a problem where you move (and give +check), your opponent moves, and you move to give checkmate is called a +three-mover. Here is a really trivial three-mover: +

+ + 3 2 1
+----------------+
+| | | | a
+----------------+
+| | | wK | b
+----------------+
+| | | | c
+----------------+
+| bN | | | d
+----------------+
+| | | | e
+----------------+
+| | bN | | f
+----------------+
+

+ +Black in hand: S, G +

+ +Here, Black plays G*2b, White plays K1c, and Black plays G*1d mate. +More typical tsume problems range from 5 moves to arbitrarily high +numbers of moves, and they can be quite brain-busting. Tsume problems +may seem artificial, but in the closing stages of the game where both +players have a lot of pieces in hand, it is often necessary to give +check at every move, or else your opponent will start a counterattack +and will mate you before you mate him. A tsume problem is a worst-case +scenario for the attacker: you have to mate your opponent even though he +has every piece not on the board in hand, which means you have to +develop sharp attacking skills. Many more tsume problems can be found +on the internet; I particularly recommend Patrick Davin's "Shogi +Nexus" (see section 5. References and links). +

+ + +

+ + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+
+ +This document was generated +by Michael C. Vanier on July, 7 2004 +using texi2html diff --git a/doc/gnushogi_17.html b/doc/gnushogi_17.html index ce3a0f5..a822bd6 100644 --- a/doc/gnushogi_17.html +++ b/doc/gnushogi_17.html @@ -1,534 +1,162 @@ + + + - +GNU Shogi manual: Shogi variants -GNU Shogi manual - gnushogi - - - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

- - -

gnushogi

-

- - - -

-This section describes how to run the "gnushogi" program. - - -

-SYNOPSIS - - - -

-gnushogi [ [[-]a] [-b bookfile] [-B binbookfile] [-C] [-h langfile] -[-L langfile] [-r length] [-R] [-s pathname] [-l pathname] [-S binbooksize] -[-t] [-c size] [-T size] [-v] [-x] [-X] arg1 arg2 ] - - -

-DESCRIPTION - - -

-GNU shogi (gnushogi) plays a game of japanese chess (shogi) against the -user or it plays against itself. - - -

-At startup gnushogi reads the binbook file if it is present. It then -looks for a book file. If it is present it adds its contents to the -binbook data. If the binbook file is writable a new combined binbook -file is written. - - -

-Gnushogi is a modified version of the gnuchess program. It has a simple -alphanumeric board display, or it can be used with the xshogi program -under X windows. The program gets its opening moves from the file -gnushogi.bbk which is located in a directory specified in the Makefile. -To invoke the program type: - - -

- -
`gnushogi -C' -
-simple curses based version - -
`gnushogi -X (or just gnushogi)' -
-xshogi compatible version - -
`gnushogi -R' -
-raw test display version -
- -

-TIME CONTROLS - - -

-If one argument is given, it is the search time per move in -[minutes:]seconds. So gnushogi 30 will generate one move every 30 -seconds, while gnushogi 5:00 will generate one move every 5 minutes. - - -

-If two or more arguments are given, they will be used to set tournament -time controls with the first argument of each pair being the number of -moves and the second being the total clock time in minutes[:seconds]. -Thus, entering gnushogi 60 5 will set the clocks for 5 minutes (300 -seconds) for the first 60 moves, and gnushogi 30 3:30 will allow 3 -minutes and 30 seconds for 30 moves. - - -

-gnushogi 30 5 1 :30 will allow 5 minutes for the first 30 moves and 30 -seconds for each move after that. Up to 4 pairs of controls may be -specified. - - -

-If no argument is given the program will prompt the user for level of -play. - - -

-For use with xshogi see the documentation on that program. -See section xshogi. - - -

-BOOK - - -

-The book gnushogi.tbk consists of a sequence of openings. An opening -begins with a line starting with a # (the rest of the line is a -comment). Following this is a series of moves in algebraic notation -alternating black and white separated by white space. A move may have a -? after it indicating this move should never be made in this position. -Moves are stored as position:move so transpositions between openings can -take place. - - -

-HASHFILE - - -

-The hashfile if created should be on the order of 4 megabytes; you can -create such a hashfile by typing "gnushogi -c 22" (see below). This -file contains positions and moves learned from previous games. If a -hashfile is used the computer makes use of the experience it gained in -past games. Tests run so far show that it plays no worse with the -hashfile than without, but it is not clear yet whether it provides a -real advantage. - - -

-LEGAL MOVES - - -

-Note: Piece letters are determined by the language file. What is -specified here is the default (English). - - -

-Once gnushogi is invoked, the program will display the board and prompt -the user for a move. To enter a move, use the notation 7g7f where the -first letter-number pair indicates the origin square and the second -letter-number pair indicates the destination square. An alternative is -to use the notation P7f where the first letter indicates the piece type -(P,L,N,S,G,B,R,K). To promote append a + the type of the new piece to -the move, as in 2d2c+ or P2c+. Note that you must use capital letters -for the pieces by default. - - -

-COMMAND-LINE OPTIONS - - -

- -
`-a' -
-Do not search on opponent's time. - -
`a' -
-Do search on opponent's time. - -
`-b bookfile' -
-Use bookfile for opening book. - -
`-B binbookfile' -
-Use binbookfile for binary opening book. - -
`-c size' -
-Create a new HASHFILE. File size is 2^size entries of approximately 65+? -bytes. - -
`-C' -
-Use curses-based display mode. - -
`-h' -
-Do not use hashfile. - -
`h' -
-Do use hashfile. - -
`-l pathname' -
-Pathname of the loadfile used with get or xget. - -
`-L lang' -
-Use language lang from the file gnushogi.lang. If -L is not specified -it uses the first language in the file. + + + + + -
`-P plylevels' -
-Number of plys to include in the binbookfile. For generating a -binbookfile. - -
`-r length' -
-Rehash length times in searching entries for position in -transposition table. - -
`-R' -
-Use raw text display mode. This can be used for dumb terminals or for -systems that don't have curses. - -
`-s pathname' -
-Pathname of the save file to use with the save command. - -
`-S size' -
-Size of binbookfile for memory based books. For creating a binbookfile. - -
`-t' -
-Show statistics for HASHFILE. - -
`-T size' -
-Set the transposition table size to 2^size entries. - -
`-v' -
-Show version and patchlevel. - -
`-x value' -
-Use value as the evaluation window xwndw. - -
`-X' -
-Use xshogi display mode (the default). - -
- -

-COMMANDS - - -

-In addition to legal moves, the following commands can be entered at the -gnushogi prompt. Note: command names are determined by the language -file and may vary with the implementation. The default language is -English. - - -

- -
`alg' -
-allow algebraic input (not implemented). - -
`Awindow' -
-change Alpha window (default score + 90). - -
`Bwindow' -
-change Beta window (default score - 90). - -
`beep' -
-toggles beeping after each move (default: on). - -
`bd' -
-updates the current board position on the display. - -
`book' -
-turns off use of the opening library. - -
`both' -
-causes the computer to play both sides of a shogi game. - -
`black' -
-causes the computer to take the white pieces, if the computer is to move -first. - -
`bsave' -
-saves a game to disk as a book textfile. The program will prompt the -user for a file name. - -
`gamein' -
-toggles game mode time control. Assumes the time specified for time -control is the time for a complete game. Input with the level command -should be the game time and the expected number of moves in a game. go -command must be given. - -
`coords' -
-show coordinates on the display (visual only). - -
`contempt' -
-allows the value of contempt to be modified. - -
`debug' -
-asks for a piece as color piece, as wb or bn, and shows its calculated -value on each square. - -
`debuglevel' -
-sets level of debugging output if compiled with debug options. - -
`depth' -
-allows the user to change the search depth of the program. The maximum -depth is 29 ply. Normally the depth is set to 29 and the computer -terminates its search based on elapsed time rather than depth. If depth -is set to (say) 4 ply, the program will search until all moves have been -examined to a depth of 4 ply (with extensions up to 11 additional ply -for sequences of checks and captures). If you set a maximum time per -move and also use the depth command, the search will stop at the -specified time or the specified depth, whichever comes first. - -
`easy' -
-toggles easy mode (thinking on opponents time) on and off. The default -is easy mode ON. If easy mode is disabled, the keyboard is polled for -input every so often and when input is seen the search is terminated. It -may also be terminated with a sigint. - -
`edit' -
-allows the user to set up a board position. - -
    - -
  • # - -clear the board. - -
  • c - -toggle piece color. - -
  • . - -command will exit setup mode. - -
  • p3b - -place a pawn on 3b - -
  • p3b+ - -place a promoted pawn on 3b - -
  • p* - -place a pawn in hand (among the captured pieces) - -
- -Pieces are entered by typing a letter (p,l,n,s,g,b,r,k) for -the piece followed by the coordinate. Here, letter case is ignored. - -The usual warning about the language file applies. - -
`exit' -
-exits gnushogi. - -
`first' -
-tells the computer to move first. Computer begins searching for a move. -(same as "go"). - -
`force' -
-allows the user to enter moves for both sides. To get the program to -play after a sequence of moves has been entered use the "black" or -"white" commands. - -
`get' -
-retrieves a game from disk. The program will prompt the user for a file -name. - -
`go' -
-tells the computer to move first. Computer begins searching for a move. -(same as "first"). - -
`hash' -
-use/don't use hashfile. - -
`hashdepth' -
-allows the user to change the minimum depth for using the hashfile and -the number of moves from the beginning of the game to use it. - -
`help' -
-displays a short description of the commands and the current status of -options. - -
`hint' -
-causes the program to supply the user with its predicted move. - -
`level' -
-allows the user to set time controls such as 60 moves in 5 minutes etc. -In tournament mode, the program will vary the time it takes for each -move depending on the situation. If easy mode is disabled (using the -"easy" command), the program will often respond with its move -immediately, saving time on its clock for use later on. - -
`list' -
-writes the game moves and some statistics on search depth, nodes, and -time to the file "shogi.lst". - -
`material' -
-toggle material flag - draws on no pawns and both sides < rook. - -
`new' -
-starts a new game. - -
`p' -
-evaluates the board and shows the point score for each piece. The total -score for a position is the sum of these individual piece scores. - -
`post' -
-causes the program to display the principal variation and the score -during the search. A score of 100 is equivalent to a 1 pawn advantage -for the computer. - -
`quit' -
-exits the game. - -
`random' -
-causes the program to randomize its move selection slightly. - -
`rcptr' -
-set recapture mode. - -
`remove' -
-backout the last level for both sides. Equal to 2 undo's. - -
`reverse' -
-causes the board display to be reversed. That is, the black pieces will -now appear at the top of the board. - -
`rv' -
-reverse board display. - -
`save' -
-saves a game to disk. The program will prompt the user for a file name. - -
`switch' -
-causes the program to switch places with the opponent and begin -searching. - -
`test' -
-performs some speed tests for MoveList and CaptureList generation, and -ScorePosition position scoring for the current board. - -
`time' -
-set computer's time remaining, intended for synchronizing clocks among -multiple players. - -
`tsume' -
-toggle tsume mode. In tsume mode, not all possible moves will be -generated. If a king is in check, only moves that get the king out of -check are generated. If the king is not in check, only moves that give -check to the opponent's king are generated. - -
`undo' -
-undoes the last move whether it was the computer's or the human's. You -may also type "remove". This is equivalent to two "undo"'s -(e.g. retract one move for each side). - -
`white' -
-causes the computer to take the black pieces, if the computer is to move -first the go command must be given. - -
`xget' -
-read an xshogi position file. - -
`xsave' -
-save as an xshogi position file. - -
`xwndw' -
-change X window. The window around alpha/beta used to determine whether -the position should be scored or just estimated. Note: this has -nothing to do with xshogi or X windows; the terms are completely -separate. - -
+ -

- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]   + + + + + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+
+

2.4 Shogi variants

+ +

+ +Several historical variants of shogi exist. Most of these were invented +before modern shogi (in some cases hundreds of years before), are much +larger than modern shogi and are not played with drops. Thus, in many +ways they are really more like giant chess games than like modern shogi. +The only one of these games to have survived in Japan is Chu (middle) +shogi, which is still played a little bit. Thanks to the efforts of +George Hodges and John Fairbairn of the Shogi Association (two British +shogi enthusiasts), these games were resurrected and rules and sets for +them can still be purchased from George Hodges (see section 5. References and links). I hope to eventually extend GNU shogi so that it can play at +least some of these games. There are also several non-historical +variants of shogi; I don't know much about them but you can find +information about them on the internet (see section 5. References and links). +

+ +The historical variants include: +

+ +

    + +
  1. +Tori (bird) shogi, played on a 7x7 board with 32 pieces in all; this is +the only variant that is known to have been played with drops. +

    + +

  2. +Wa shogi, played on an 11x11 board with 54 pieces. This game can be +played with or without drops but the historical evidence favors the view +that it was played without drops. However, most people who have tried +it claim it is a much better game with drops, being even more intricate +than standard shogi. +

    + +

  3. +Chu (middle) shogi, played on a 12x12 board with 92 pieces. This was +(and is) by far the most popular of the variants, and has 21 different +kinds of pieces in the starting line-up alone (along with several others +that appear upon promotion). Unlike modern shogi, there are a +tremendous number of ranging pieces and the game is definitely not +played with drops. There is also an amazing piece called the Lion which +has a double king move and can capture two pieces at once! Chu shogi +has a small but fanatical following, some of whom consider it better +than modern shogi. +

    + +

  4. +Dai (great) shogi, played on a 15x15 board with 130 pieces. Other than +the larger board, this game is very similar to Chu shogi. +

    + +

  5. +Tenjiku (exotic) shogi, played on a 16x16 board with 176 pieces. This +game is possibly the most complex tactical game in existence. There are +many astoundingly powerful pieces, including one (the Fire Demon) that +can capture up to eight opposing pieces in a single move! Despite the +size of the game, checkmates can occur very suddenly (and often very +early on) if one player makes a wrong move. Tenjiku also has a small +but fanatical following, one of whom (Colin Adams) has written a book on +the game which is available for download at +http://www.colina.demon.co.uk/tenjiku.html. +

    + +

  6. +Dai-dai (great-great) shogi, played on a 17x17 board with 192 pieces. +The opening setup alone has 64 different kinds of pieces! This game and +the larger ones that follow sound pretty outlandish, but they have +actually been played; a game of Dai-dai can supposedly be played in +about 12 hours. +

    + +

  7. +Maka-dai-dai (great-great-great) shogi, played on a 19x19 board with 192 +pieces. For those for whom Dai-dai shogi is just too small :-) +

    + +

  8. +Tai (grand) shogi, played on a 25x25 board with 354 pieces! Until +recently, this was thought to be the biggest chess game ever devised, +but now there is... +

    + +

  9. +Kyoku tai (extremely grand?) shogi, played on a 36x36 board with 402 +pieces. The rules for this have just been unearthed in an old Japanese +book. Hopefully someone will soon organize a postal Kyoku tai shogi +championship; maybe their distant ancestors could finish it :-) +

    + +It is thought that the really huge games (Dai-dai and up) were never +really played to any significant extent (gee, wonder why?) and were +devised merely so that the creators could have the fun of inventing +enormous games, amazing their friends and confounding their enemies. +However, the games up to Tenjiku shogi at least appear to be quite +playable, assuming one has the time. +

    + +

+

+ + +

+ + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+
+ +This document was generated +by Michael C. Vanier on July, 7 2004 +using texi2html diff --git a/doc/gnushogi_18.html b/doc/gnushogi_18.html index e6ea7c9..090d18f 100644 --- a/doc/gnushogi_18.html +++ b/doc/gnushogi_18.html @@ -1,543 +1,186 @@ + + + - +GNU Shogi manual: Differences between shogi and chess -GNU Shogi manual - xshogi - - - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

- - -

xshogi

-

- - - -

-This section describes how to run the "xshogi" program. - - -

-SYNOPSIS - - -

-xshogi [ options ] - - -

-DESCRIPTION - - -

-xshogi provides an X11/Xt/Athena Widgets user interface for gnushogi. -With xshogi you can play gnushogi, set up arbitrary positions, force -variations, or watch xshogi manage a game between two shogi programs. -Furthermore, it can be used as an interface between two players on -different displays. - - -

-xshogi can also be used as a shogi board to play out games. It will -read through a game file or allow a player to play through a variation -manually (force mode). This is useful for keeping track of email postal -games or browsing games off the net. - - -

-After starting xshogi, you can make moves by pressing mouse button 1 -while the cursor is over a square with your piece on it and dragging the -mouse to another square. If the move is illegal, gnushogi will not -allow it. xshogi will then retract the move. - - -

-COMMAND-LINE OPTIONS - - -

-The following command line options also correspond to X resources that -you can set in your .Xdefaults file. - - -

- -
`[standard Xt options]' -
-xshogi accepts standard Xt options like -display, -geometry, and --iconic. - -
`-tc or -timeControl minutes[:seconds]' -
-Amount of time for a set of moves determined by movesPerSession. If -this number of moves is played within the time control period, xshogi -resets the time clocks. Default: 5 minutes. - -
`-mps or -movesPerSession moves' -
-Number of moves in a time control period. Default: 40 moves. - -
`-st or -searchTime minutes[:seconds]' -
-Tell gnushogi to spend at most the given amount of time searching for -each of its moves. Without this option, gnushogi chooses its search -time based on the number of moves and amount of time remaining until the -next time control. Setting this option also sets -clockMode to False. - -
`-sd or -searchDepth number' -
-Tell gnushogi to look ahead at most the given number of moves when -searching for a move to make. Without this option, gnushogi chooses -its search depth based on the number of moves and amount of time -remaining until the next time control. Setting this option also sets --clockMode to False. - -
`-clock or -clockMode (True | False)' -
-Determines whether or not to use the clock. If clockMode is False, the -clock does not run, but the side that is to play next is still -highlighted. - -
`-td or -timeDelay seconds' -
-Time delay between moves during "Load Game". This doesn't have to be -a round number. Try -td 0.4. Default: 1 second. - -
`-nsp or -noShogiProgram (True | False)' -
-If this option is True, xshogi acts as a passive shogi board; it does -not try to start a shogi program, not even to check whether moves made -in Force mode are legal. It also sets -clockMode to False. Default: -False. - -
`-fsp or -firstShogiProgram program' -
-Name of first shogi program. In matches between two machines, this -program plays white. Default: "gnushogi". - -
`-ssp or -secondShogiProgram program' -
-Name of second shogi program, if needed. In matches between two -machines, this program plays black; otherwise it is not started. -Default: "gnushogi". - -
`-fh or -firstHost host' -
-Name of host the first shogi program plays on. Default: "localhost". - -
`-sh or -secondHost host' -
-Name of host the second shogi program plays on. Default: "localhost". - -
`-rsh or -remoteShell shell_name' -
-Some systems do not use rsh as the remote shell. This option allows a -user to name the remote shell command. This should be done in the -resource file. - -
`-mm or -matchMode (False | Init | Position | Opening)' -
-Automatically run a game between firstShogiProgram and -secondShogiProgram. If matchMode is set to Init, xshogi will start the -game with the initial shogi position. If matchMode is set to Position, -xshogi will start the game with the position specified by the -loadPositionFile resource. If matchMode is set to Opening, xshogi will -play out the opening moves specified by the -loadGameFile resource. If -the -saveGameFile resource is set, a move record for the match will be -saved in the specified file. Default: "False". - -
`-lgf or -loadGameFile file' -
-Name of file to read a game record from. Game files are found in the -directory named by the SHOGIDIR environment variable. If this variable -is not set, the current directory is used unless the file name starts -with a /. - -
`-lpf or -loadPositionFile file' -
-Name of file to read a game position from. Position files are found in -the directory named by the SHOGIDIR environment variable. If this -variable is not set, the current directory is used unless the file name -starts with a /. - -
`-sgf or -saveGameFile file' -
-Name of file to save a game record to. Game files are saved in the -directory named by the SHOGIDIR environment variable. If this variable -is not set, the current directory is used unless the file name starts -with a /. - -
`-spf or -savePositionFile file' -
-Name of file to save a game position to. Position files are saved in -the directory named by the SHOGIDIR environment variable. If this -variable is not set, the current directory is used unless the file name -starts with a /. - -
`-coords or -showCoords (True | False)' -
-If this option is True, xshogi displays algebraic coordinates along the -board's left and bottom edges. The default is False. The coordFont -resource specifies what font to use. - -
`-mono or -monoMode (True | False)' -
-Determines whether xshogi displays its pieces and squares with two -colors or four. You shouldn't have to specify monochrome. xshogi will -determine if this is necessary. - -
`-wpc or -blackPieceColor color' -
-Color specification for black pieces suitable for XParseColor(3X11). -Default: #FFFFCC. These colors look good on a DEC workstation. If you -need different colors, try using the xcolors application. Source for -xcolors can be found in the X11 contrib directory. - -
`-bpc or -whitePieceColor color' -
-Same for white pieces. Default: #202020. - -
`-lsc or -lightSquareColor color' -
-Same for light squares. Default: #C8C365. - -
`-dsc or -darkSquareColor color' -
-Same for dark squares. Default: #77A26D. - -
`-wps or -westernPieceSet (True | False)' -
-Choose the Western style piece set. - -
`-npb or -normalPawnBitmap file' -
-
`-nnb or -normalKnightBitmap file' -
-
`-nbb or -normalBishopBitmap file' -
-
`-nrb or -normalRookBitmap file' -
-
`-nkb or -normalKingBitmap file' -
-Names of the bitmap files for the bitmap piece icons. - -
`-rpb or -reversePawnBitmap file' -
-
`-rnb or -reverseKnightBitmap file' -
-
`-rbb or -reverseBishopBitmap file' -
-
`-rrb or -reverseRookBitmap file' -
-
`-rkb or -reverseKingBitmap file' -
-Names of the bitmap files for the outline piece icons. - -
`-debug or -debugMode (True | False)' -
-Turns on debugging printout. + + + + + -
- -

-OTHER X RESOURCES - - -

- -
`initString' -
-The actual string that is sent to initialize the shogi program can be -set from .Xdefaults. It can't be set from the command line because of -syntax problems. The default value is "new\nbeep\nrandom\neasy\n". -The "new" and "beep" commands are required. You can remove the -"random" command if you like; including it causes gnushogi to -randomize its move selection slightly so that it doesn't play the same -moves in every game. Even without "random", gnushogi randomizes its -choice of moves from its opening book. You can also remove "easy" if -you like; including it toggles easy mode off, causing gnushogi to think -on your time. That is, if "easy" is included in the initString, GNU -Shogi thinks on your time; if not, it does not. (Yes, this does seem -backwards, doesn't it.) You can also try adding other commands to the -initString; see the gnushogi documentation (see section gnushogi) for -details. - -
`blackString and whiteString' -
-These resources control what is sent when the Machine Black and Machine -White buttons are selected. This is mostly for compatibility with -obsolete versions of gnushogi. - -Alternate bitmaps for piece icons can be specified either by choosing -one of the built-in sets or with the file name resources described -above. There are three built-in sets of piece bitmaps available, large -(the default), medium, or small. It is easiest to select the set you -prefer in the .Xdefaults file: - - XShogi*boardSize: Medium - -The font used for button labels and comments can be changed in the -.Xdefaults file. You may want to choose a smaller font if you are using -the small pieces: - - XShogi*font: helvetica_oblique12 - -The font used for coordinates (when the showCoords option is True) can -be set similarly: - - XShogi*coordFont: helvetica_10 - -If you are using a grayscale monitor, try setting the colors to: - - XShogi*blackPieceColor: gray100
- XShogi*whitePieceColor: gray0
- XShogi*lightSquareColor: gray60
- XShogi*darkSquareColor: gray40 - -
- -

-COMMAND BUTTONS AND KEYS - - -

- -
`Quit' -
-Quits xshogi. Q or q is a keyboard equivalent. - -
`Reset' -
-Resets xshogi to the beginning of a shogi game. It also deselects any -game or position files. - -
`Flip View' -
-inverts the view of the shogi board. - -
`Hint' -
-displays a move hint from gnushogi. - -
`Load Game' -
-plays a game from a record file. If no file is specified a popup dialog -asks for a filename. Game files are found in the directory named by the -SHOGIDIR environment variable. If this variable is not declared then -the current directory is used unless the file name starts with a /. G -or g is a keyboard equivalent. The game file parser will accept almost -any file that contains moves in algebraic notation. If the first line -begins with `#', it is assumed to be a title and is displayed. Text -enclosed in parentheses or square brackets is assumed to be commentary -and is displayed in a pop-up window. Any other text in the file is -ignored. - -
`Load Position' -
-sets up a position from a position file. If no file is specified a -popup dialog asks for a filename. Position files are found in the -directory named by the SHOGIDIR environment variable. If this variable -is not declared then the current directory is used unless the file name -starts with a /. Position files must be in the format that the Save -Position command writes. - -
`Save Game' -
-saves a game to a record file. If no file is specified a popup dialog -asks for a filename. If the filename exists, the user is asked whether -the current game record is be appended to this file or if the file -should be replaced. Game files are saved in the directory named by the -SHOGIDIR environment variable. If this variable is not declared then -the current directory is used unless the file name starts with a /. -Game files are human-readable, and can also be read back by the Load -Game command. Furthermore, they are accepted as gnushogi text bookfiles. - -
`Save Position' -
-saves a position to a position file. If no file is specified a popup -dialog asks for a filename. Position files are saved in the directory -named by the SHOGIDIR environment variable. If this variable is not -declared then the current directory is used unless the file name starts -with a /. Position files are human-readable, and can also be read back -by the Load Position command. - -
`Machine White' -
-forces gnushogi to play white. - -
`Machine Black' -
-forces gnushogi to play black. - -
`Force Moves' -
-forces a series of moves. That is, gnushogi stops playing and xshogi -allows you to make moves for both white and black. - -
`Two Machines' -
-plays a game between two computer programs. - -
`Forward' -
-moves forward through a series of remembered moves. F or f is a -keyboard equivalent. - -
`Backward' -
-moves backward through a series of remembered moves. As a side effect, -puts xshogi into Force Moves mode. B or b is a keyboard equivalent. - -
`Pause' -
-pauses the clocks or (in Load Game mode) pauses the game being loaded. -Press Pause again to continue. P or p is a keyboard equivalent. - -
`Edit Position' -
-lets you set up an arbitrary board position. Use mouse button 1 to drag -pieces to new squares, or to delete a piece by dragging it off the board -or dragging an empty square on top of it. To drop a new piece on a -square, press mouse button 2 or 3 over the square. This brings up a -menu of black pieces (button 2) or white pieces (button 3). Additional -menu choices let you empty the square or clear the board. You can set -the side to play next by clicking on the Black or White indicator at the -top of the screen. - -
`Challenge' -
-allows to make a two display game between two human players. Enter the -display you want to connect to. If you are allowed to connect, a new -board is displayed at the remote display. Challenge mode can only be -stopped by pressing "quit". - -
`Select Level' -
-allows to reset the clocks for both players. Enter the number of moves -and the number of minutes in which the moves should be done. - -
`Move NOW' -
-force computer to stop thinking and to make the current best move. - -
`Iconify I, i, C or c' -
-iconifies xshogi. + -
+ + + + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+
+

2.5 Differences between shogi and chess

+

-LIMITATIONS +Some differences between shogi and international chess have been +mentioned elsewhere in this document; I summarize them here for people +who are interested in game comparisons. I won't try to deal with the +thorny question of which game is "better" although my bias may have +already come through :-) In fact, the drop rule makes the two games so +different in character that arguing over which game is better is like +comparing apples to oranges (you'd be better off comparing chess to Chu +shogi (see section 2.4 Shogi variants). However, I believe that if you are a +chess fan you'll really like shogi as well, and shogi is also popular +with many people who don't particularly like chess. +

-

-If you press the Pause button during GNU Shogi's turn, -xshogi will stop the clocks, but gnushogi will still make a -move. +Here are the significant differences between chess and shogi: +

+

    +
  1. +In shogi, captured pieces become the property of the capturer and can +re-enter play by being dropped onto almost any vacant square. In chess, +captured pieces are out of the game. Thus, in shogi, piece exchanges +complicate the play significantly while in chess they simplify it.

    -After a mate or draw when playing against gnushogi, if you -back up with the Backward button, the clocks are reset -(because gnushogi has exited and must be restarted). - +

  2. +The shogi board is 9x9; the chess board is 8x8.

    -The game parser recognizes only algebraic notation. - - -

    -AUTHORS - +

  3. +Shogi has five pieces with no counterpart in chess: the gold and silver +generals, the lance, the promoted rook and the promoted bishop. Chess +has one piece with no counterpart in shogi: the queen. The knight's +move in shogi is much more restrictive than in chess. Pieces in shogi +generally have a much smaller range of movement than in chess (unless +they are in hand).

    -Original authors of XBoard: Chris Sears and Dan Sears. - +

  4. +In shogi, all pieces except the gold general and the king can promote, +but only to one kind of piece. Promotion is easier in shogi because the +promotion zone is closer to the starting position of the pieces +(especially pawns). In chess, only the pawn can promote, but it can +promote to any other piece except the king.

    -Enhancements for XBoard (Version 2.0): Tim Mann. - +

  5. +In shogi, pawns capture the same way they move. There is no initial +two-space pawn move and hence no en-passant captures. In chess, +pawns capture diagonally which means that opposing pawns can block each +other.

    -Conversion to XShogi (Version 1.1): Matthias Mutz. - +

  6. +In shogi, you only have one rook and one bishop. Note that the bishop +is not restricted to only one "color" square (squares in shogi aren't +colored, but never mind) because promoted bishops can also move one +square orthogonally.

    -Current maintainer: Mike Vanier. - +

  7. +There is no special castling move in shogi. The term "castle" is +used in shogi to denote a defensive formation consisting of (usually) +three generals which protect the king. There are many such castles +(about 40 or so have names). See section 2.2 Sample game.

    -COPYRIGHT INFORMATION - +

  8. +Draws are much rarer in shogi than in chess. Perpetual check is not +allowed. Stalemate is a virtual impossibility, and is a loss for the +stalematee.

    -XShogi borrows its piece bitmaps from CRANES Shogi. - +

  9. +Since pieces are never out of play in shogi, chess-type endgames +involving only a few pieces do not occur.

    -Copyright 1991 by Digital Equipment Corporation, Maynard, Massachusetts. -Enhancements Copyright 1992 Free Software Foundation, Inc. Enhancements -Copyright 1993 Matthias Mutz. Further enhancements copyright 1999 by -Michael Vanier and the Free Software Foundation, Inc. - +

  10. +Shogi games are generally longer than chess games (about 60-70 moves is +typical).

    -The following terms apply to Digital Equipment Corporation's copyright -interest in XBoard: - +

  11. +Shogi has a well-developed handicap system which is in general use; +chess does not.

    -All Rights Reserved - +

-Permission to use, copy, modify, and distribute this software and its -documentation for any purpose and without fee is hereby granted, -provided that the above copyright notice appear in all copies and that -both that copyright notice and this permission notice appear in -supporting documentation, and that the name of Digital not be used in -advertising or publicity pertaining to distribution of the software -without specific, written prior permission. - -

-DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING -ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL -DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR -ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, -WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, -ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS -SOFTWARE. +The effects of all these differences on play include (in my opinion): +

+

    +
  1. +Piece/pawn structures in chess are more rigid than in shogi. Pawns +block each other and pawns, once advanced, cannot ever retreat. In +shogi, you can repair the hole caused by a pawn advance by exchanging +the pawn and dropping it back where you want it. Thus shogi is more +fluid than chess and less "structural".

    -The following terms apply to the enhanced version of XShogi distributed -by the Free Software Foundation: - +

  2. +Counterattack is MUCH more common in shogi than in chess. Games +typically end in mutual mating attacks, where each player is trying to +checkmate the other player before being checkmated himself. This makes +tempo incredibly important and also makes sacrificial play quite common.

    -This file is part of XSHOGI. - +

  3. +Attacks involving only ranging pieces are more a feature of chess than +of shogi. A shogi attack typically uses a ranging piece or pieces to +support an attack by short-range pieces (especially generals). It is +very rare to mate a king with a non-adjacent ranging piece in shogi +since the player whose king is threatened can almost always interpose by +dropping a piece.

    -XSHOGI is distributed in the hope that it will be useful, but WITHOUT -ANY WARRANTY. No author or distributor accepts responsibility to anyone -for the consequences of using it or for whether it serves any particular -purpose or works at all, unless he says so in writing. Refer to the -XSHOGI General Public License for full details. - +

-Everyone is granted permission to copy, modify and redistribute XSHOGI, -but only under the conditions described in the XSHOGI General Public -License. A copy of this license is supposed to have been given to you -along with XSHOGI so you can know your rights and responsibilities. It -should be in a file named COPYING. Among other things, the copyright -notice and this notice must be preserved on all copies. - -

- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]   + +
+ + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+
+ +This document was generated +by Michael C. Vanier on July, 7 2004 +using texi2html diff --git a/doc/gnushogi_19.html b/doc/gnushogi_19.html index e6e2f82..2d6247f 100644 --- a/doc/gnushogi_19.html +++ b/doc/gnushogi_19.html @@ -1,121 +1,558 @@ + + + - +GNU Shogi manual: gnushogi + + + + + + -GNU Shogi manual - References and links - - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

+ + + + + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+
+

3. gnushogi

+ +

+ +This section describes how to run the "gnushogi" program. +

+ +SYNOPSIS + +

+ +gnushogi [ [[-]a] [-b bookfile] [-B binbookfile] [-C] [-h langfile] +[-L langfile] [-r length] [-R] [-s pathname] [-l pathname] [-S binbooksize] +[-t] [-c size] [-T size] [-v] [-x] [-X] arg1 arg2 ] +

+ +DESCRIPTION +

+ +GNU shogi (gnushogi) plays a game of japanese chess (shogi) against the +user or it plays against itself. +

+ +At startup gnushogi reads the binbook file if it is present. It then +looks for a book file. If it is present it adds its contents to the +binbook data. If the binbook file is writable a new combined binbook +file is written. +

+ +Gnushogi is a modified version of the gnuchess program. It has a simple +alphanumeric board display, or it can be used with the xshogi program +under X windows. The program gets its opening moves from the file +gnushogi.bbk which is located in a directory specified in the Makefile. +To invoke the program type: +

-

References and links

+
+ +
`gnushogi -C' +
simple curses based version

- - - - +

`gnushogi -X (or just gnushogi)' +
xshogi compatible version +

+ +

`gnushogi -R' +
raw test display version +
+

+ +TIME CONTROLS +

+ +If one argument is given, it is the search time per move in +[minutes:]seconds. So gnushogi 30 will generate one move every 30 +seconds, while gnushogi 5:00 will generate one move every 5 minutes. +

+ +If two or more arguments are given, they will be used to set tournament +time controls with the first argument of each pair being the number of +moves and the second being the total clock time in minutes[:seconds]. +Thus, entering gnushogi 60 5 will set the clocks for 5 minutes (300 +seconds) for the first 60 moves, and gnushogi 30 3:30 will allow 3 +minutes and 30 seconds for 30 moves. +

+ +gnushogi 30 5 1 :30 will allow 5 minutes for the first 30 moves and 30 +seconds for each move after that. Up to 4 pairs of controls may be +specified. +

+ +If no argument is given the program will prompt the user for level of +play. +

+ +For use with xshogi see the documentation on that program. +See section 4. xshogi. +

+ +BOOK +

+ +The book gnushogi.tbk consists of a sequence of openings. An opening +begins with a line starting with a # (the rest of the line is a comment). +Following this is a series of moves in algebraic notation alternating +between black and white separated by whitespace. A move may have a ? +after it indicating this move should never be made in this position. Moves +are stored as position:move so transpositions between openings can take +place. +

+ +HASHFILE +

+ +The hashfile if created should be on the order of 4 megabytes; you can +create such a hashfile by typing "gnushogi -c 22" (see below). This +file contains positions and moves learned from previous games. If a +hashfile is used the computer makes use of the experience it gained in +past games. Tests run so far show that it plays no worse with the +hashfile than without, but it is not clear yet whether it provides a +real advantage. +

+ +LEGAL MOVES +

+ +Note: Piece letters are determined by the language file. What is +specified here is the default (English). +

+ +Once gnushogi is invoked, the program will display the board and prompt +the user for a move. To enter a move, use the notation 7g7f where the +first letter-number pair indicates the origin square and the second +letter-number pair indicates the destination square. An alternative is +to use the notation P7f where the first letter indicates the piece type +(P,L,N,S,G,B,R,K). To promote append a + the type of the new piece to +the move, as in 2d2c+ or P2c+. Note that you must use capital letters +for the pieces by default. +

+ +COMMAND-LINE OPTIONS +

+ +

+ +
`-a' +
Do not search on opponent's time. +

+

`a' +
Do search on opponent's time.

-There are very few English-language books for people learning shogi. -The two I recommend are: +

`-b bookfile' +
Use bookfile for opening book. +

+

`-B binbookfile' +
Use binbookfile for binary opening book. +

-

    +
    `-c size' +
    Create a new HASHFILE. File size is 2^size entries of approximately 65+? +bytes. +

    -

  1. +
    `-C' +
    Use curses-based display mode. +

    -Shogi for Beginners, 2nd. Edition, by John Fairbairn. This is a -superb beginner's book in every way, covering all phases of the game. -It was out of print for a long time, but has now been reprinted and is -available either from Kiseido (http://www.labnet.or.jp/~kiseido) -or from George Hodges (see below). +

    `-h' +
    Do not use hashfile. +

    -

  2. +
    `h' +
    Do use hashfile. +

    -The Art of Shogi, by Tony Hoskings. This is one step up from the -Fairbairn book. It covers a lot of ground, and is especially noteworthy -for its detailed treatment of opening lines. You can order this book -from Amazon.com's UK branch (http://www.amazon.co.uk). +

    `-l pathname' +
    Pathname of the loadfile used with get or xget. +

    -

+
`-L lang' +
Use language lang from the file gnushogi.lang. If -L is not specified +it uses the first language in the file. +

+

`-P plylevels' +
Number of plys to include in the binbookfile. For generating a +binbookfile.

-Another book you may find is Shogi: Japan's Game of Strategy by -Trevor Leggett. This book is very elementary and is somewhat outdated, -having been published first in 1966. However, it does feature a paper -shogi board and punch-out pieces, so if you want a really cheap shogi -set you might pick this book up. It is still in print. +

`-r length' +
Rehash length times in searching entries for position in +transposition table. +

+

`-R' +
Use raw text display mode. This can be used for dumb terminals or for +systems that don't have curses.

-Two books that are no longer in print but are definitely worth getting -if you find them are Guide to Shogi Openings and Better -Moves for Better Shogi, both by Aono Teriuchi. They are published in a -bilingual edition (English/Japanese) and are the only books on shogi in -English written by a Japanese professional shogi player. John Fairbairn -did the translation from Japanese to English. +

`-s pathname' +
Pathname of the save file to use with the save command. +

+

`-S size' +
Size of binbookfile for memory based books. For creating a binbookfile.

-Shogi sets are available from: +

`-t' +
Show statistics for HASHFILE. +

+

`-T size' +
Set the transposition table size to 2^size entries. +

-

+
`-v' +
Show version and patchlevel.

-George F. Hodges
-P.O. Box 77
-Bromley, Kent
-United Kingdom BR1 2WT -

+
`-x value' +
Use value as the evaluation window xwndw.

-George also sells equipment for all the historical shogi variants -(see section Shogi variants) (except for Kyoku tai shogi) and also sells -back issues of the magazine "Shogi" which he published for 70 issues -in the late 70's to late 80's. This magazine is STRONGLY recommended; -it contains more information about shogi in English than you will ever -find anywhere else. +

`-X' +
Use xshogi display mode (the default). +

+

-Here are some useful URLs: +COMMANDS +

+ +In addition to legal moves, the following commands can be entered at the +gnushogi prompt. Note: command names are determined by the language +file and may vary with the implementation. The default language is +English. +

-
Pieter Stouten's shogi page: http://www.halcyon.com/stouten/shogi.html -
-This is the main shogi-related site on the internet, with links to -almost all the other sites. +
`alg' +
allow algebraic input (not implemented). +

+ +

`Awindow' +
change Alpha window (default score + 90). +

+ +

`Bwindow' +
change Beta window (default score - 90). +

+ +

`beep' +
toggles beeping after each move (default: on). +

+ +

`bd' +
updates the current board position on the display. +

+ +

`book' +
turns off use of the opening library. +

+ +

`both' +
causes the computer to play both sides of a shogi game. +

+ +

`black' +
causes the computer to play as White, if the computer was to move +first. +

+ +

`bsave' +
saves a game to disk as a book textfile. The program will prompt the +user for a file name. +

+ +

`gamein' +
toggles game mode time control. Assumes the time specified for time +control is the time for a complete game. Input with the level command +should be the game time and the expected number of moves in a game. go +command must be given. +

+ +

`coords' +
show coordinates on the display (visual only). +

+ +

`contempt' +
allows the value of contempt to be modified. +

+ +

`debug' +
asks for a piece as color piece, as wb or bn, and shows its calculated +value on each square. +

+ +

`debuglevel' +
sets level of debugging output if compiled with debug options. +

+ +

`depth' +
allows the user to change the search depth of the program. The maximum +depth is 29 ply. Normally the depth is set to 29 and the computer +terminates its search based on elapsed time rather than depth. If depth +is set to (say) 4 ply, the program will search until all moves have been +examined to a depth of 4 ply (with extensions up to 11 additional ply +for sequences of checks and captures). If you set a maximum time per +move and also use the depth command, the search will stop at the +specified time or the specified depth, whichever comes first. +

+ +

`easy' +
toggles easy mode (thinking on opponents time) on and off. The default +is easy mode ON. If easy mode is disabled, the keyboard is polled for +input every so often and when input is seen the search is terminated. It +may also be terminated with a sigint. +

+ +

`edit' +
allows the user to set up a board position. +
    + +
  • # +clear the board. +

    + +

  • c +toggle piece color. +

    + +

  • . +command will exit setup mode. +

    + +

  • p3b +place a pawn on 3b +

    + +

  • p3b+ +place a promoted pawn on 3b +

    + +

  • p* +place a pawn in hand (among the captured pieces) +

    + +

+

+ +Pieces are entered by typing a letter (p,l,n,s,g,b,r,k) for +the piece followed by the coordinate. Here, letter case is ignored. +

+ +The usual warning about the language file applies. +

+ +

`exit' +
exits gnushogi. +

+ +

`first' +
tells the computer to move first. Computer begins searching for a move. +(same as "go"). +

+ +

`force' +
allows the user to enter moves for both sides. To get the program to +play after a sequence of moves has been entered use the "black" or +"white" commands. +

+ +

`get' +
retrieves a game from disk. The program will prompt the user for a file +name. +

+ +

`go' +
tells the computer to move first. Computer begins searching for a move. +(same as "first"). +

+ +

`hash' +
use/don't use hashfile. +

+ +

`hashdepth' +
allows the user to change the minimum depth for using the hashfile and +the number of moves from the beginning of the game to use it. +

+ +

`help' +
displays a short description of the commands and the current status of +options. +

-

Roger Hare's shogi page: http://www.ed.ac.uk/~rjhare/shogi -
-This has lots of information, including full rules to most of the shogi -variants. +
`hint' +
causes the program to supply the user with its predicted move. +

-

Patrick Davin's Shogi Nexus: http://www.vega.or.jp/~patrick/shogi/ -
-There's lots of cool stuff on this site; my favorite is the extensive -collection of Tsume-shogi (mating) problems, both for beginners and -more advanced players. +
`level' +
allows the user to set time controls such as 60 moves in 5 minutes etc. +In tournament mode, the program will vary the time it takes for each +move depending on the situation. If easy mode is disabled (using the +"easy" command), the program will often respond with its move +immediately, saving time on its clock for use later on. +

-

Steve Evans' shogi page: http://www.netspace.net.au/~trout/index.html -
-Steve has written a program that plays almost all of the shogi variants, -unfortunately it only runs on Windows :-( +
`list' +
writes the game moves and some statistics on search depth, nodes, and +time to the file "shogi.lst". +

-

Hans Bodlaender's chess variant pages: http://www.cs.ruu.nl/~hansb/d.chessvar -
-This page has an almost unimaginable variety of rules for different -chess variants, including many shogi variants (historical and non-historical). +
`material' +
toggle material flag - draws on no pawns and both sides < rook. +

+ +

`new' +
starts a new game. +

+ +

`p' +
evaluates the board and shows the point score for each piece. The total +score for a position is the sum of these individual piece scores. +

+ +

`post' +
causes the program to display the principal variation and the score +during the search. A score of 100 is equivalent to a 1 pawn advantage +for the computer. +

+ +

`quit' +
exits the game. +

+ +

`random' +
causes the program to randomize its move selection slightly. +

+ +

`rcptr' +
set recapture mode. +

+ +

`remove' +
backout the last level for both sides. Equal to 2 undo's. +

+ +

`reverse' +
causes the board display to be reversed. That is, the Black's pieces will +now appear at the top of the board. +

+ +

`rv' +
reverse board display. +

+ +

`save' +
saves a game to disk. The program will prompt the user for a file name. +

+ +

`switch' +
causes the program to switch places with the opponent and begin +searching. +

+ +

`test' +
performs some speed tests for MoveList and CaptureList generation, and +ScorePosition position scoring for the current board. +

+ +

`time' +
set computer's time remaining, intended for synchronizing clocks among +multiple players. +

+ +

`tsume' +
toggle tsume mode. In tsume mode, not all possible moves will be +generated. If a king is in check, only moves that get the king out of +check are generated. If the king is not in check, only moves that give +check to the opponent's king are generated. +

+ +

`undo' +
undoes the last move whether it was the computer's or the human's. You +may also type "remove". This is equivalent to two "undo"'s +(e.g. retract one move for each side). +

+ +

`white' +
causes the computer to play as Black; if the computer is to move +first the go command must be given. +

+ +

`xget' +
read an xshogi position file. +

+ +

`xsave' +
save as an xshogi position file. +

+ +

`xwndw' +
change X window. The window around alpha/beta used to determine whether +the position should be scored or just estimated. Note: this has +nothing to do with xshogi or X windows; the terms are completely +separate. +

+

-

- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]   + +
+ + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+
+ +This document was generated +by Michael C. Vanier on July, 7 2004 +using texi2html diff --git a/doc/gnushogi_2.html b/doc/gnushogi_2.html index cc42638..961df44 100644 --- a/doc/gnushogi_2.html +++ b/doc/gnushogi_2.html @@ -1,461 +1,62 @@ + + + - +GNU Shogi manual: License -GNU Shogi manual - License - - - [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

+ + + + + + -

GNU GENERAL PUBLIC LICENSE

-

- - + + + + + + + + + + + + + +
[ < ][ > ]   [ << ][ Up ][ >> ]         [Top][Contents][Index][ ? ]
+

+

GNU GENERAL PUBLIC LICENSE

+
Version 2, June 1991
+

- - -

-Copyright (C) 1989, 1991 Free Software Foundation, Inc.
+
 
Copyright (C) 1989, 1991 Free Software Foundation, Inc.
 675 Mass Ave, Cambridge, MA 02139, USA
 
 Everyone is permitted to copy and distribute verbatim copies
 of this license document, but changing it is not allowed.
-

-
-
-
-
Preamble

-
-

-  The licenses for most software are designed to take away your
-freedom to share and change it.  By contrast, the GNU General Public
-License is intended to guarantee your freedom to share and change free
-software--to make sure the software is free for all its users.  This
-General Public License applies to most of the Free Software
-Foundation's software and to any other program whose authors commit to
-using it.  (Some other Free Software Foundation software is covered by
-the GNU Library General Public License instead.)  You can apply it to
-your programs, too.
-
-
-

-  When we speak of free software, we are referring to freedom, not
-price.  Our General Public Licenses are designed to make sure that you
-have the freedom to distribute copies of free software (and charge for
-this service if you wish), that you receive source code or can get it
-if you want it, that you can change the software or use pieces of it
-in new free programs; and that you know you can do these things.
-
-
-

-  To protect your rights, we need to make restrictions that forbid
-anyone to deny you these rights or to ask you to surrender the rights.
-These restrictions translate to certain responsibilities for you if you
-distribute copies of the software, or if you modify it.
-
-
-

-  For example, if you distribute copies of such a program, whether
-gratis or for a fee, you must give the recipients all the rights that
-you have.  You must make sure that they, too, receive or can get the
-source code.  And you must show them these terms so they know their
-rights.
-
-
-

-  We protect your rights with two steps: (1) copyright the software, and
-(2) offer you this license which gives you legal permission to copy,
-distribute and/or modify the software.
-
-
-

-  Also, for each author's protection and ours, we want to make certain
-that everyone understands that there is no warranty for this free
-software.  If the software is modified by someone else and passed on, we
-want its recipients to know that what they have is not the original, so
-that any problems introduced by others will not reflect on the original
-authors' reputations.
-
-
-

-  Finally, any free program is threatened constantly by software
-patents.  We wish to avoid the danger that redistributors of a free
-program will individually obtain patent licenses, in effect making the
-program proprietary.  To prevent this, we have made it clear that any
-patent must be licensed for everyone's free use or not licensed at all.
-
-
-

-  The precise terms and conditions for copying, distribution and
-modification follow.
-
-
-
-
-
TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION

-
-
-
    
-
  1. 
-
-This License applies to any program or other work which contains
-a notice placed by the copyright holder saying it may be distributed
-under the terms of this General Public License.  The "Program", below,
-refers to any such program or work, and a "work based on the Program"
-means either the Program or any derivative work under copyright law:
-that is to say, a work containing the Program or a portion of it,
-either verbatim or with modifications and/or translated into another
-language.  (Hereinafter, translation is included without limitation in
-the term "modification".)  Each licensee is addressed as "you".
-
-Activities other than copying, distribution and modification are not
-covered by this License; they are outside its scope.  The act of
-running the Program is not restricted, and the output from the Program
-is covered only if its contents constitute a work based on the
-Program (independent of having been made by running the Program).
-Whether that is true depends on what the Program does.
-
-
  2. 
-
-You may copy and distribute verbatim copies of the Program's
-source code as you receive it, in any medium, provided that you
-conspicuously and appropriately publish on each copy an appropriate
-copyright notice and disclaimer of warranty; keep intact all the
-notices that refer to this License and to the absence of any warranty;
-and give any other recipients of the Program a copy of this License
-along with the Program.
-
-You may charge a fee for the physical act of transferring a copy, and
-you may at your option offer warranty protection in exchange for a fee.
-
-
  3. 
-
-You may modify your copy or copies of the Program or any portion
-of it, thus forming a work based on the Program, and copy and
-distribute such modifications or work under the terms of Section 1
-above, provided that you also meet all of these conditions:
-
-
-
      
-
    1. 
-
-You must cause the modified files to carry prominent notices
-stating that you changed the files and the date of any change.
-
-
    2. 
-
-You must cause any work that you distribute or publish, that in
-whole or in part contains or is derived from the Program or any
-part thereof, to be licensed as a whole at no charge to all third
-parties under the terms of this License.
-
-
    3. 
-
-If the modified program normally reads commands interactively
-when run, you must cause it, when started running for such
-interactive use in the most ordinary way, to print or display an
-announcement including an appropriate copyright notice and a
-notice that there is no warranty (or else, saying that you provide
-a warranty) and that users may redistribute the program under
-these conditions, and telling the user how to view a copy of this
-License.  (Exception: if the Program itself is interactive but
-does not normally print such an announcement, your work based on
-the Program is not required to print an announcement.)
-
    
-
-These requirements apply to the modified work as a whole.  If
-identifiable sections of that work are not derived from the Program,
-and can be reasonably considered independent and separate works in
-themselves, then this License, and its terms, do not apply to those
-sections when you distribute them as separate works.  But when you
-distribute the same sections as part of a whole which is a work based
-on the Program, the distribution of the whole must be on the terms of
-this License, whose permissions for other licensees extend to the
-entire whole, and thus to each and every part regardless of who wrote it.
-
-Thus, it is not the intent of this section to claim rights or contest
-your rights to work written entirely by you; rather, the intent is to
-exercise the right to control the distribution of derivative or
-collective works based on the Program.
-
-In addition, mere aggregation of another work not based on the Program
-with the Program (or with a work based on the Program) on a volume of
-a storage or distribution medium does not bring the other work under
-the scope of this License.
-
-
  4. 
-
-You may copy and distribute the Program (or a work based on it,
-under Section 2) in object code or executable form under the terms of
-Sections 1 and 2 above provided that you also do one of the following:
-
-
-
      
-
    1. 
-
-Accompany it with the complete corresponding machine-readable
-source code, which must be distributed under the terms of Sections
-1 and 2 above on a medium customarily used for software interchange; or,
-
-
    2. 
-
-Accompany it with a written offer, valid for at least three
-years, to give any third party, for a charge no more than your
-cost of physically performing source distribution, a complete
-machine-readable copy of the corresponding source code, to be
-distributed under the terms of Sections 1 and 2 above on a medium
-customarily used for software interchange; or,
-
-
    3. 
-
-Accompany it with the information you received as to the offer
-to distribute corresponding source code.  (This alternative is
-allowed only for noncommercial distribution and only if you
-received the program in object code or executable form with such
-an offer, in accord with Subsection b above.)
-
    
-
-The source code for a work means the preferred form of the work for
-making modifications to it.  For an executable work, complete source
-code means all the source code for all modules it contains, plus any
-associated interface definition files, plus the scripts used to
-control compilation and installation of the executable.  However, as a
-special exception, the source code distributed need not include
-anything that is normally distributed (in either source or binary
-form) with the major components (compiler, kernel, and so on) of the
-operating system on which the executable runs, unless that component
-itself accompanies the executable.
-
-If distribution of executable or object code is made by offering
-access to copy from a designated place, then offering equivalent
-access to copy the source code from the same place counts as
-distribution of the source code, even though third parties are not
-compelled to copy the source along with the object code.
-
-
  5. 
-
-You may not copy, modify, sublicense, or distribute the Program
-except as expressly provided under this License.  Any attempt
-otherwise to copy, modify, sublicense or distribute the Program is
-void, and will automatically terminate your rights under this License.
-However, parties who have received copies, or rights, from you under
-this License will not have their licenses terminated so long as such
-parties remain in full compliance.
-
-
  6. 
-
-You are not required to accept this License, since you have not
-signed it.  However, nothing else grants you permission to modify or
-distribute the Program or its derivative works.  These actions are
-prohibited by law if you do not accept this License.  Therefore, by
-modifying or distributing the Program (or any work based on the
-Program), you indicate your acceptance of this License to do so, and
-all its terms and conditions for copying, distributing or modifying
-the Program or works based on it.
-
-
  7. 
-
-Each time you redistribute the Program (or any work based on the
-Program), the recipient automatically receives a license from the
-original licensor to copy, distribute or modify the Program subject to
-these terms and conditions.  You may not impose any further
-restrictions on the recipients' exercise of the rights granted herein.
-You are not responsible for enforcing compliance by third parties to
-this License.
-
-
  8. 
-
-If, as a consequence of a court judgment or allegation of patent
-infringement or for any other reason (not limited to patent issues),
-conditions are imposed on you (whether by court order, agreement or
-otherwise) that contradict the conditions of this License, they do not
-excuse you from the conditions of this License.  If you cannot
-distribute so as to satisfy simultaneously your obligations under this
-License and any other pertinent obligations, then as a consequence you
-may not distribute the Program at all.  For example, if a patent
-license would not permit royalty-free redistribution of the Program by
-all those who receive copies directly or indirectly through you, then
-the only way you could satisfy both it and this License would be to
-refrain entirely from distribution of the Program.
-
-If any portion of this section is held invalid or unenforceable under
-any particular circumstance, the balance of the section is intended to
-apply and the section as a whole is intended to apply in other
-circumstances.
-
-It is not the purpose of this section to induce you to infringe any
-patents or other property right claims or to contest validity of any
-such claims; this section has the sole purpose of protecting the
-integrity of the free software distribution system, which is
-implemented by public license practices.  Many people have made
-generous contributions to the wide range of software distributed
-through that system in reliance on consistent application of that
-system; it is up to the author/donor to decide if he or she is willing
-to distribute software through any other system and a licensee cannot
-impose that choice.
-
-This section is intended to make thoroughly clear what is believed to
-be a consequence of the rest of this License.
-
-
  9. 
-
-If the distribution and/or use of the Program is restricted in
-certain countries either by patents or by copyrighted interfaces, the
-original copyright holder who places the Program under this License
-may add an explicit geographical distribution limitation excluding
-those countries, so that distribution is permitted only in or among
-countries not thus excluded.  In such case, this License incorporates
-the limitation as if written in the body of this License.
-
-
  10. 
-
-The Free Software Foundation may publish revised and/or new versions
-of the General Public License from time to time.  Such new versions will
-be similar in spirit to the present version, but may differ in detail to
-address new problems or concerns.
-
-Each version is given a distinguishing version number.  If the Program
-specifies a version number of this License which applies to it and "any
-later version", you have the option of following the terms and conditions
-either of that version or of any later version published by the Free
-Software Foundation.  If the Program does not specify a version number of
-this License, you may choose any version ever published by the Free Software
-Foundation.
-
-
  11. 
-
-If you wish to incorporate parts of the Program into other free
-programs whose distribution conditions are different, write to the author
-to ask for permission.  For software which is copyrighted by the Free
-Software Foundation, write to the Free Software Foundation; we sometimes
-make exceptions for this.  Our decision will be guided by the two goals
-of preserving the free status of all derivatives of our free software and
-of promoting the sharing and reuse of software generally.
-
-
-
-
    NO WARRANTY
-
-
  12. 
-
-BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
-FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW.  EXCEPT WHEN
-OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
-PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
-OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
-MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE.  THE ENTIRE RISK AS
-TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU.  SHOULD THE
-PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
-REPAIR OR CORRECTION.
-
-
  13. 
-
-IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
-WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
-REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
-INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
-OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
-TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
-YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
-PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
-POSSIBILITY OF SUCH DAMAGES.
-

-
-
-
END OF TERMS AND CONDITIONS

-
-
-
-
How to Apply These Terms to Your New Programs

-
-

-  If you develop a new program, and you want it to be of the greatest
-possible use to the public, the best way to achieve this is to make it
-free software which everyone can redistribute and change under these terms.
-
-
-

-  To do so, attach the following notices to the program.  It is safest
-to attach them to the start of each source file to most effectively
-convey the exclusion of warranty; and each file should have at least
-the "copyright" line and a pointer to where the full notice is found.
-
-
-
-
-one line to give the program's name and a brief idea of what it does.
-Copyright (C) 19yy  name of author
-
-This program is free software; you can redistribute it and/or modify
-it under the terms of the GNU General Public License as published by
-the Free Software Foundation; either version 2 of the License, or
-(at your option) any later version.
-
-This program is distributed in the hope that it will be useful,
-but WITHOUT ANY WARRANTY; without even the implied warranty of
-MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-GNU General Public License for more details.
-
-You should have received a copy of the GNU General Public License
-along with this program; if not, write to the Free Software
-Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
-

-
-

-Also add information on how to contact you by electronic and paper mail.
-
-
-

-If the program is interactive, make it output a short notice like this
-when it starts in an interactive mode:
-
-
-
-
-Gnomovision version 69, Copyright (C) 19yy name of author
-Gnomovision comes with ABSOLUTELY NO WARRANTY; for details 
-type `show w'.
-This is free software, and you are welcome to redistribute it
-under certain conditions; type `show c' for details.
-

-
-

-The hypothetical commands `show w' and `show c' should show
-the appropriate parts of the General Public License.  Of course, the
-commands you use may be called something other than `show w' and
-`show c'; they could even be mouse-clicks or menu items--whatever
-suits your program.
-
-
-

-You should also get your employer (if you work as a programmer) or your
-school, if any, to sign a "copyright disclaimer" for the program, if
-necessary.  Here is a sample; alter the names:
-
-
-
-
-Yoyodyne, Inc., hereby disclaims all copyright interest in the program
-`Gnomovision' (which makes passes at compilers) written by James Hacker.
-
-signature of Ty Coon, 1 April 1989
-Ty Coon, President of Vice
-

-
-

-This General Public License does not permit incorporating your program into
-proprietary programs.  If your program is a subroutine library, you may
-consider it more useful to permit linking proprietary applications with the
-library.  If this is what you want to do, use the GNU Library General
-Public License instead of this License.
-
-
-

- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  
+

+
+

+
  
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
 
 
 
diff --git a/doc/gnushogi_20.html b/doc/gnushogi_20.html
index 618bc00..56c31c5 100644
--- a/doc/gnushogi_20.html
+++ b/doc/gnushogi_20.html
@@ -1,64 +1,547 @@
 
+
+
+
 
-
+GNU Shogi manual: xshogi
+
+
+
+
+
+
 
-GNU Shogi manual - Acknowledgements
 
-
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  


 
+
+
+
+
+
+
+
+
+
+
+
+
+
+
[ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]

+

+
 4. xshogi 

+
+

+
+This section describes how to run the "xshogi" program.
+

+
+SYNOPSIS
+

+
+xshogi [ options ]
+

+
+DESCRIPTION
+

+
+xshogi provides an X11/Xt/Athena Widgets user interface for gnushogi.
+With xshogi you can play gnushogi, set up arbitrary positions, force
+variations, or watch xshogi manage a game between two shogi programs.
+Furthermore, it can be used as an interface between two players on
+different displays.
+

+
+xshogi can also be used as a shogi board to play out games.  It will
+read through a game file or allow a player to play through a variation
+manually (force mode).  This is useful for keeping track of email postal
+games or browsing games off the net.
+

+
+After starting xshogi, you can make moves by pressing mouse button 1
+while the cursor is over a square with your piece on it and dragging the
+mouse to another square.  If the move is illegal, gnushogi will not
+allow it.  xshogi will then retract the move.
+

+
+COMMAND-LINE OPTIONS
+

+
+The following command line options also correspond to X resources that
+you can set in your .Xdefaults file.
+

+
+

+
+
`[standard Xt options]'
+
xshogi accepts standard Xt options like -display, -geometry, and
+-iconic.
+

+
+
`-tc or -timeControl minutes[:seconds]'
+
Amount of time for a set of moves determined by movesPerSession.  If
+this number of moves is played within the time control period, xshogi
+resets the time clocks.  Default: 5 minutes.
+

+
+
`-mps or -movesPerSession moves'
+
Number of moves in a time control period.  Default: 40 moves.
+

+
+
`-st or -searchTime minutes[:seconds]'
+
Tell gnushogi to spend at most the given amount of time searching for
+each of its moves.  Without this option, gnushogi chooses its search
+time based on the number of moves and amount of time remaining until the
+next time control.  Setting this option also sets -clockMode to False.
+

+
+
`-sd or -searchDepth number'
+
Tell gnushogi to look ahead at most the given number of moves when
+searching for a move to make.  Without this option, gnushogi chooses
+its search depth based on the number of moves and amount of time
+remaining until the next time control.  Setting this option also sets
+-clockMode to False.
+

+
+
`-clock or -clockMode (True | False)'
+
Determines whether or not to use the clock.  If clockMode is False, the
+clock does not run, but the side that is to play next is still
+highlighted.
+

+
+
`-td or -timeDelay seconds'
+
Time delay between moves during "Load Game".  This doesn't have to be
+a round number.  Try -td 0.4.  Default: 1 second.
+

+
+
`-nsp or -noShogiProgram (True | False)'
+
If this option is True, xshogi acts as a passive shogi board; it does
+not try to start a shogi program, not even to check whether moves made
+in Force mode are legal.  It also sets -clockMode to False.  Default:
+False.
+

+
+
`-fsp or -firstShogiProgram program'
+
Name of first shogi program.  In matches between two machines, this
+program plays white.  Default: "gnushogi".
+

+
+
`-ssp or -secondShogiProgram program'
+
Name of second shogi program, if needed.  In matches between two
+machines, this program plays black; otherwise it is not started.
+Default: "gnushogi".
+

+
+
`-fh or -firstHost host'
+
Name of host the first shogi program plays on.  Default: "localhost".
+

+
+
`-sh or -secondHost host'
+
Name of host the second shogi program plays on.  Default: "localhost".
+

+
+
`-rsh or -remoteShell shell_name'
+
Some systems do not use rsh as the remote shell.  This option allows a
+user to name the remote shell command.  This should be done in the
+resource file.
+

+
+
`-mm or -matchMode (False | Init | Position | Opening)'
+
Automatically run a game between firstShogiProgram and
+secondShogiProgram.  If matchMode is set to Init, xshogi will start the
+game with the initial shogi position.  If matchMode is set to Position,
+xshogi will start the game with the position specified by the
+loadPositionFile resource.  If matchMode is set to Opening, xshogi will
+play out the opening moves specified by the -loadGameFile resource.  If
+the -saveGameFile resource is set, a move record for the match will be
+saved in the specified file.  Default: "False".
+

+
+
`-lgf or -loadGameFile file'
+
Name of file to read a game record from.  Game files are found in the
+directory named by the SHOGIDIR environment variable.  If this variable
+is not set, the current directory is used unless the file name starts
+with a /.
+

+
+
`-lpf or -loadPositionFile file'
+
Name of file to read a game position from.  Position files are found in
+the directory named by the SHOGIDIR environment variable.  If this
+variable is not set, the current directory is used unless the file name
+starts with a /.
+

+
+
`-sgf or -saveGameFile file'
+
Name of file to save a game record to.  Game files are saved in the
+directory named by the SHOGIDIR environment variable.  If this variable
+is not set, the current directory is used unless the file name starts
+with a /.
+

+
+
`-spf or -savePositionFile file'
+
Name of file to save a game position to.  Position files are saved in
+the directory named by the SHOGIDIR environment variable.  If this
+variable is not set, the current directory is used unless the file name
+starts with a /.
+

+
+
`-coords or -showCoords (True | False)'
+
If this option is True, xshogi displays algebraic coordinates along the
+board's left and bottom edges.  The default is False.  The coordFont
+resource specifies what font to use.
+

+
+
`-mono or -monoMode (True | False)'
+
Determines whether xshogi displays its pieces and squares with two
+colors or four.  You shouldn't have to specify monochrome.  xshogi will
+determine if this is necessary.
+

+
+
`-pc or -pieceColor color'
+
Color specification for pieces suitable for XParseColor().
+Default: #FFFFD7.  
+

+
+
`-sc or -squareColor color'
+
Same for squares.  Default: #EBDFB0.
+

+
+
`-wps or -westernPieceSet (True | False)'
+
Choose the Western style piece set.
+

+
+
`-npb or -normalPawnBitmap file'
+
`-nnb or -normalKnightBitmap file'
+
`-nbb or -normalBishopBitmap file'
+
`-nrb or -normalRookBitmap file'
+
`-nkb or -normalKingBitmap file'
+
Names of the bitmap files for the bitmap piece icons.
+

+
+
`-rpb or -reversePawnBitmap file'
+
`-rnb or -reverseKnightBitmap file'
+
`-rbb or -reverseBishopBitmap file'
+
`-rrb or -reverseRookBitmap file'
+
`-rkb or -reverseKingBitmap file'
+
Names of the bitmap files for the outline piece icons.
+

+
+
`-debug or -debugMode (True | False)'
+
Turns on debugging printout.
+

+
+

+

+
+OTHER X RESOURCES
+

+
+

+
+
`initString'
+
The actual string that is sent to initialize the shogi program can be
+set from .Xdefaults.  It can't be set from the command line because of
+syntax problems.  The default value is "new\nbeep\nrandom\neasy\n".
+The "new" and "beep" commands are required. You can remove the
+"random" command if you like; including it causes gnushogi to
+randomize its move selection slightly so that it doesn't play the same
+moves in every game.  Even without "random", gnushogi randomizes its
+choice of moves from its opening book.  You can also remove "easy" if
+you like; including it toggles easy mode off, causing gnushogi to think
+on your time.  That is, if "easy" is included in the initString, GNU
+Shogi thinks on your time; if not, it does not.  (Yes, this does seem
+backwards, doesn't it.)  You can also try adding other commands to the
+initString; see the gnushogi documentation (see section 3. gnushogi) for
+details.
+

+
+
`blackString and whiteString'
+
These resources control what is sent when the Machine Black and Machine
+White buttons are selected.  This is mostly for compatibility with
+obsolete versions of gnushogi.
+

+
+Alternate bitmaps for piece icons can be specified either by choosing
+one of the built-in sets or with the file name resources described
+above.  There are three built-in sets of piece bitmaps available, large
+(the default), medium, or small.  It is easiest to select the set you
+prefer in the .Xdefaults file:
+

+
+     XShogi*boardSize:   Medium
+

+
+The font used for button labels and comments can be changed in the
+.Xdefaults file.  You may want to choose a smaller font if you are using
+the small pieces:
+

+
+     XShogi*font:    helvetica_oblique12
+

+
+The font used for coordinates (when the showCoords option is True) can
+be set similarly:
+

+
+     XShogi*coordFont:    helvetica_10
+

+
+If you are using a grayscale monitor, try setting the colors to:
+

+
+     XShogi*pieceColor:     gray100 

+     XShogi*squareColor:    gray60  

+

+
+

+

+
+COMMAND BUTTONS AND KEYS
+

+
+

+
+
`Quit'
+
Quits xshogi.  Q or q is a keyboard equivalent.
+

+
+
`Reset'
+
Resets xshogi to the beginning of a shogi game.  It also deselects any
+game or position files.
+

+
+
`Flip View'
+
inverts the view of the shogi board.
+

+
+
`Hint'
+
displays a move hint from gnushogi.
+

+
+
`Load Game'
+
plays a game from a record file.  If no file is specified a popup dialog
+asks for a filename.  Game files are found in the directory named by the
+SHOGIDIR environment variable.  If this variable is not declared then
+the current directory is used unless the file name starts with a /.  G
+or g is a keyboard equivalent.  The game file parser will accept almost
+any file that contains moves in algebraic notation.  If the first line
+begins with `#', it is assumed to be a title and is displayed.  Text
+enclosed in parentheses or square brackets is assumed to be commentary
+and is displayed in a pop-up window.  Any other text in the file is
+ignored.
+

+
+
`Load Position'
+
sets up a position from a position file.  If no file is specified a
+popup dialog asks for a filename.  Position files are found in the
+directory named by the SHOGIDIR environment variable.  If this variable
+is not declared then the current directory is used unless the file name
+starts with a /.  Position files must be in the format that the Save
+Position command writes.
+

+
+
`Save Game'
+
saves a game to a record file.  If no file is specified a popup dialog
+asks for a filename.  If the filename exists, the user is asked whether
+the current game record is be appended to this file or if the file
+should be replaced.  Game files are saved in the directory named by the
+SHOGIDIR environment variable.  If this variable is not declared then
+the current directory is used unless the file name starts with a /.
+Game files are human-readable, and can also be read back by the Load
+Game command. Furthermore, they are accepted as gnushogi text bookfiles.
+

+
+
`Save Position'
+
saves a position to a position file.  If no file is specified a popup
+dialog asks for a filename.  Position files are saved in the directory
+named by the SHOGIDIR environment variable.  If this variable is not
+declared then the current directory is used unless the file name starts
+with a /.  Position files are human-readable, and can also be read back
+by the Load Position command.
+

+
+
`Machine White'
+
forces gnushogi to play white.
+

+
+
`Machine Black'
+
forces gnushogi to play black.
+

+
+
`Force Moves'
+
forces a series of moves.  That is, gnushogi stops playing and xshogi
+allows you to make moves for both white and black.
+

+
+
`Two Machines'
+
plays a game between two computer programs.
+

+
+
`Forward'
+
moves forward through a series of remembered moves.  F or f is a
+keyboard equivalent.
+

+
+
`Backward'
+
moves backward through a series of remembered moves.  As a side effect,
+puts xshogi into Force Moves mode.  B or b is a keyboard equivalent.
+

+
+
`Pause'
+
pauses the clocks or (in Load Game mode) pauses the game being loaded.
+Press Pause again to continue.  P or p is a keyboard equivalent.
+

+
+
`Edit Position'
+
lets you set up an arbitrary board position.  Use mouse button 1 to drag
+pieces to new squares, or to delete a piece by dragging it off the board
+or dragging an empty square on top of it.  To drop a new piece on a
+square, press mouse button 2 or 3 over the square.  This brings up a
+menu of black pieces (button 2) or white pieces (button 3).  Additional
+menu choices let you empty the square or clear the board.  You can set
+the side to play next by clicking on the Black or White indicator at the
+top of the screen.
+

+
+
`Challenge'
+
allows you to make a two display game between two human players.  Enter
+the display you want to connect to.  If you are allowed to connect, a
+new board is displayed at the remote display.  Challenge mode can only
+be stopped by pressing "quit".
+

+
+
`Select Level'
+
allows you to reset the clocks for both players.  Enter the number of
+moves and the number of minutes in which the moves should be done.
+

 
-
Acknowledgements

+
`Move NOW'
+
force computer to stop thinking and to make the current best move.
 

-
 
+
`Iconify I, i, C or c'
+
iconifies xshogi.
+

 
+

 

-I would like to thank the following people:
 
+LIMITATIONS
+

+
+If you press the  Pause  button  during  GNU  Shogi's  turn,
+xshogi will stop the clocks, but gnushogi will still make a
+move.
+

+
+After a mate or draw when playing against gnushogi, if  you
+back  up  with  the  Backward  button,  the clocks are reset
+(because gnushogi has exited and must be restarted).
+

+
+The game parser recognizes only algebraic notation.
+

+
+AUTHORS
+

+
+Original authors of XBoard:  Chris Sears and Dan Sears.
+

+
+Enhancements for XBoard (Version 2.0):  Tim Mann.
+

 
+Conversion to XShogi (Version 1.1):  Matthias Mutz.
+

 
-
    
+Current maintainer: Mike Vanier.
+
    
 
-
  • 
+COPYRIGHT INFORMATION
+
    
 
-Matthias Mutz, who originally developed GNU shogi as a spin-off of GNU
-chess and who very kindly let me take over the maintenance of this very
-interesting project.
+XShogi borrows its piece bitmaps from CRANES Shogi.
+
    
 
-
  • 
+Copyright 1991 by Digital Equipment Corporation, Maynard, Massachusetts.
+Enhancements Copyright 1992 Free Software Foundation, Inc.  Enhancements
+Copyright 1993 Matthias Mutz.  Further enhancements copyright 1999 by
+Michael Vanier and the Free Software Foundation, Inc.
+
    
 
-Richard Stallman and the Free Software Foundation, for creating an
-organization where anyone can contribute software for the common good of
-all, for making GNU/Linux possible, and especially for writing emacs and
-gcc, without which my working life would be intolerable.
+The following terms apply to Digital Equipment Corporation's copyright
+interest in XBoard:
+
    
 
-
  • 
+All Rights Reserved
+
    
 
-Georges Hodges, for starting the Shogi Association in England, without
-which I would probably never have heard of shogi, for supplying shogi
-equipment, for publishing the excellent magazine "Shogi" (now sadly
-defunct), for personally answering all my silly questions by mail, and
-for being the ambassador of shogi to the West.
+Permission to use, copy, modify, and distribute this software and its
+documentation for any purpose and without fee is hereby granted,
+provided that the above copyright notice appear in all copies and that
+both that copyright notice and this permission notice appear in
+supporting documentation, and that the name of Digital not be used in
+advertising or publicity pertaining to distribution of the software
+without specific, written prior permission.
+
    
 
-
  • 
+DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING
+ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL
+DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR
+ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS,
+WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION,
+ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS
+SOFTWARE.
+
    
 
-Pieter Stouten, for having the most comprehensive shogi site on the
-World Wide Web http://www.halcyon.com/stouten/shogi.html, and for
-maintaining the shogi-l mailing list.  Go to Pieter's web site for more
-information on subscribing to the list.  Also thanks to everyone who
-contributes and has contributed to that list.
+The following terms apply to the enhanced version of XShogi distributed
+by the Free Software Foundation:
+
    
 
-
  • 
+This file is part of XSHOGI.
+
    
 
-Matt Casters, for testing GNU shogi.  Matt and I will be working
-together on improving the solution engine in future versions of this
-program.
+XSHOGI is distributed in the hope that it will be useful, but WITHOUT
+ANY WARRANTY.  No author or distributor accepts responsibility to anyone
+for the consequences of using it or for whether it serves any particular
+purpose or works at all, unless he says so in writing.  Refer to the
+XSHOGI General Public License for full details.
+
    
 
-

+Everyone is granted permission to copy, modify and redistribute XSHOGI,
+but only under the conditions described in the XSHOGI General Public
+License. A copy of this license is supposed to have been given to you
+along with XSHOGI so you can know your rights and responsibilities.  It
+should be in a file named COPYING.  Among other things, the copyright
+notice and this notice must be preserved on all copies.
+

 
-

- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  
+
+

+
+
+
+
+
+
+
+
+
+
+
[ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]

+
  
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
 
 
 
diff --git a/doc/gnushogi_21.html b/doc/gnushogi_21.html
index 12157db..cea9a7d 100644
--- a/doc/gnushogi_21.html
+++ b/doc/gnushogi_21.html
@@ -1,26 +1,156 @@
 
+
+
+
 
-
+GNU Shogi manual: References and links
+
+
+
+
+
+
 
-GNU Shogi manual - Bugs
 
-
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  


 
+
+
+
+
+
+
+
+
+
+
+
+
+
+
[ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]

+

+
 5. References and links 

+
+

+
+There are very few English-language books for people learning shogi.
+The two I recommend are:
+

+
+
    
+
+
  1. 
+Shogi for Beginners, 2nd. Edition, by John Fairbairn.  This is a
+superb beginner's book in every way, covering all phases of the game.
+It was out of print for a long time, but has now been reprinted and is
+available either from Kiseido (http://www.labnet.or.jp/~kiseido)
+or from George Hodges (see below).
+
    
+
+
  2. 
+The Art of Shogi, by Tony Hoskings.  This is one step up from the
+Fairbairn book.  It covers a lot of ground, and is especially noteworthy
+for its detailed treatment of opening lines.  You can order this book
+from Amazon.com's UK branch (http://www.amazon.co.uk).
+
    
+
+

+

 
-
Bugs

+Another book you may find is Shogi: Japan's Game of Strategy by
+Trevor Leggett.  This book is very elementary and is somewhat outdated,
+having been published first in 1966.  However, it does feature a paper
+shogi board and punch-out pieces, so if you want a really cheap shogi
+set you might pick this book up.  It is still in print.
+

 
+Two books that are no longer in print but are definitely worth getting
+if you find them are Guide to Shogi Openings and Better
+Moves for Better Shogi, both by Aono Teriuchi.  They are published in a
+bilingual edition (English/Japanese) and are the only books on shogi in
+English written by a Japanese professional shogi player.  John Fairbairn
+did the translation from Japanese to English.
+

+
+Shogi sets are available from:
+

+
+

+George F. Hodges 

+P.O. Box 77 

+Bromley, Kent 

+United Kingdom BR1 2WT
+

 

-The motto of GNU shogi is "100% bug-free or you don't pay!" :-)  In the
-extremely unlikely case (*ahem*) that you do find a bug, please send me
-(Mike Vanier) an email at mvanier@bbb.caltech.edu.  Also, feel
-free to send me comments, complaints, out-and-out raves, suggestions,
-plane tickets to Hawaii, and/or large suitcases filled with unmarked,
-untraceable hundred-dollar bills.
 
+George also sells equipment for all the historical shogi variants
+(see section 2.4 Shogi variants) (except for Kyoku tai shogi) and also sells
+back issues of the magazine "Shogi" which he published for 70 issues
+in the late 70's to late 80's.  This magazine is STRONGLY recommended;
+it contains more information about shogi in English than you will ever
+find anywhere else.
+

+
+Here are some useful URLs:
+

+
+

+
+
Pieter Stouten's shogi page: http://www.shogi.net
+
This is the main shogi-related site on the internet, with links to
+almost all the other sites.
+

+
+
Roger Hare's shogi page: http://www.ed.ac.uk/~rjhare/shogi
+
This has lots of information, including full rules to most of the shogi
+variants.
+

+
+
Patrick Davin's Shogi Nexus: http://www.vega.or.jp/~patrick/shogi/
+
There's lots of cool stuff on this site; my favorite is the extensive
+collection of Tsume-shogi (mating) problems, both for beginners and
+more advanced players.
+

+
+
Steve Evans' shogi page: http://www.netspace.net.au/~trout/index.html
+
Steve has written a program that plays almost all of the shogi variants,
+unfortunately it only runs on Windows :-(
+

+
+
Hans Bodlaender's chess variant pages: http://www.cs.ruu.nl/~hansb/d.chessvar
+
This page has an almost unimaginable variety of rules for different
+chess variants, including many shogi variants (historical and non-historical).
+

+
+

+

 
-

- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  
+
+

+
+
+
+
+
+
+
+
+
+
+
[ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]

+
  
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
 
 
 
diff --git a/doc/gnushogi_22.html b/doc/gnushogi_22.html
index 8654b9a..3475627 100644
--- a/doc/gnushogi_22.html
+++ b/doc/gnushogi_22.html
@@ -1,142 +1,96 @@
 
+
+
+
 
-
+GNU Shogi manual: Acknowledgements
+
+
+
+
+
+
 
-GNU Shogi manual - Index
 
-
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  


 
+
+
+
+
+
+
+
+
+
+
+
+
+
+
[ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]

+

+
 6. Acknowledgements 

+
+

+
+I would like to thank the following people:
+

+
+

+

 
-

- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  
+
+

+
  
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
 
 
 
diff --git a/doc/gnushogi_23.html b/doc/gnushogi_23.html
new file mode 100644
index 0000000..a157af7
--- /dev/null
+++ b/doc/gnushogi_23.html
@@ -0,0 +1,61 @@
+
+
+
+
+
+GNU Shogi manual: Bugs
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
[ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]

+

+
 7. Bugs 

+
+

+
+The motto of GNU shogi is "100% bug-free or you don't pay!" :-)  In the
+extremely unlikely case (*ahem*) that you do find a bug, please send me
+(Mike Vanier) an email at mvanier@cs.caltech.edu.  Also, feel
+free to send me comments, complaints, out-and-out raves, suggestions,
+plane tickets to Hawaii, and/or large suitcases filled with unmarked,
+untraceable hundred-dollar bills.
+

+
+
+

+
  
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
+
+
+
diff --git a/doc/gnushogi_24.html b/doc/gnushogi_24.html
new file mode 100644
index 0000000..fc5d9b5
--- /dev/null
+++ b/doc/gnushogi_24.html
@@ -0,0 +1,208 @@
+
+
+
+
+
+GNU Shogi manual: Index
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
[ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]

+

+
 8. Index 

+
+

+
+
Jump to:   A
+   
+B
+   
+C
+   
+D
+   
+G
+   
+H
+   
+I
+   
+K
+   
+L
+   
+M
+   
+O
+   
+P
+   
+R
+   
+S
+   
+T
+   
+V
+   
+W
+   
+X
+   
+


+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Index Entry Section
 
A
Acknowledgements6. Acknowledgements
 
B
Books5. References and links
 
C
Chu Shogi2.4 Shogi variants
 
D
Dai Shogi2.4 Shogi variants
Dai-dai Shogi2.4 Shogi variants
Draws2.1.6 Draws
Drops2.1.4 Drops
 
G
gnushogi3. gnushogi
GPLGNU GENERAL PUBLIC LICENSE
 
H
Handicaps2.1.7 Handicaps
 
I
Introduction1. Introduction
 
K
Kyoku Tai Shogi2.4 Shogi variants
 
L
LicenseGNU GENERAL PUBLIC LICENSE
 
M
Mailing lists5. References and links
Maka-dai-dai Shogi2.4 Shogi variants
 
O
Opening setup2.1.2 The opening setup
 
P
Piece moves2.1.1 The moves of the pieces
Piece promotion2.1.3 Promotion of pieces
 
R
References5. References and links
Rules2.1 The rules of shogi
 
S
Sample game2.2 Sample game
Shogi variants2.4 Shogi variants
Shogi vs. Chess2.5 Differences between shogi and chess
 
T
Tai Shogi2.4 Shogi variants
Tenjiku Shogi2.4 Shogi variants
Tori Shogi2.4 Shogi variants
 
V
Variants2.4 Shogi variants
 
W
Wa Shogi2.4 Shogi variants
Web sites5. References and links
Winning the game2.1.5 Winning the game
 
X
xshogi4. xshogi
 
Jump to:   A
+   
+B
+   
+C
+   
+D
+   
+G
+   
+H
+   
+I
+   
+K
+   
+L
+   
+M
+   
+O
+   
+P
+   
+R
+   
+S
+   
+T
+   
+V
+   
+W
+   
+X
+   
+


+
+

+
+
+
+
+
+
+
+
+
+
+
[ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]

+
  
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
+
+
+
diff --git a/doc/gnushogi_3.html b/doc/gnushogi_3.html
index a70fa51..07889c7 100644
--- a/doc/gnushogi_3.html
+++ b/doc/gnushogi_3.html
@@ -1,98 +1,405 @@
 
+
+
+
 
-
+GNU Shogi manual: Preamble
 
-GNU Shogi manual - About shogi
-
-
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  


+
+
+
+
+
 
+
 
-
About the game of shogi

+
+
+
+
+
+
+
+
+
+
+
+
+
+
[ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]

+

+
 Preamble 

+
 

-     
-
 
+  The licenses for most software are designed to take away your
+freedom to share and change it.  By contrast, the GNU General Public
+License is intended to guarantee your freedom to share and change free
+software--to make sure the software is free for all its users.  This
+General Public License applies to most of the Free Software
+Foundation's software and to any other program whose authors commit to
+using it.  (Some other Free Software Foundation software is covered by
+the GNU Library General Public License instead.)  You can apply it to
+your programs, too.
+

+
+  When we speak of free software, we are referring to freedom, not
+price.  Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+this service if you wish), that you receive source code or can get it
+if you want it, that you can change the software or use pieces of it
+in new free programs; and that you know you can do these things.
+

+
+  To protect your rights, we need to make restrictions that forbid
+anyone to deny you these rights or to ask you to surrender the rights.
+These restrictions translate to certain responsibilities for you if you
+distribute copies of the software, or if you modify it.
+

+
+  For example, if you distribute copies of such a program, whether
+gratis or for a fee, you must give the recipients all the rights that
+you have.  You must make sure that they, too, receive or can get the
+source code.  And you must show them these terms so they know their
+rights.
+

+
+  We protect your rights with two steps: (1) copyright the software, and
+(2) offer you this license which gives you legal permission to copy,
+distribute and/or modify the software.
+

+
+  Also, for each author's protection and ours, we want to make certain
+that everyone understands that there is no warranty for this free
+software.  If the software is modified by someone else and passed on, we
+want its recipients to know that what they have is not the original, so
+that any problems introduced by others will not reflect on the original
+authors' reputations.
+

+
+  Finally, any free program is threatened constantly by software
+patents.  We wish to avoid the danger that redistributors of a free
+program will individually obtain patent licenses, in effect making the
+program proprietary.  To prevent this, we have made it clear that any
+patent must be licensed for everyone's free use or not licensed at all.
+

+
+  The precise terms and conditions for copying, distribution and
+modification follow.
+

+
+

+ TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+

+

 
-

+
    
+
  1. 
+This License applies to any program or other work which contains
+a notice placed by the copyright holder saying it may be distributed
+under the terms of this General Public License.  The "Program", below,
+refers to any such program or work, and a "work based on the Program"
+means either the Program or any derivative work under copyright law:
+that is to say, a work containing the Program or a portion of it,
+either verbatim or with modifications and/or translated into another
+language.  (Hereinafter, translation is included without limitation in
+the term "modification".)  Each licensee is addressed as "you".
 
    
-"Japanese chess cedes nothing in depth or beauty to the European
-game... it is at least as interesting."
 
+Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope.  The act of
+running the Program is not restricted, and the output from the Program
+is covered only if its contents constitute a work based on the
+Program (independent of having been made by running the Program).
+Whether that is true depends on what the Program does.
+
    
 
+
  2. 
+You may copy and distribute verbatim copies of the Program's
+source code as you receive it, in any medium, provided that you
+conspicuously and appropriately publish on each copy an appropriate
+copyright notice and disclaimer of warranty; keep intact all the
+notices that refer to this License and to the absence of any warranty;
+and give any other recipients of the Program a copy of this License
+along with the Program.
 
    
---- Alexander Alekhine 
    
-(quoted in David Pritchard, The Encyclopedia of Chess Variants) 
 
+You may charge a fee for the physical act of transferring a copy, and
+you may at your option offer warranty protection in exchange for a fee.
+
    
 
+
  3. 
+You may modify your copy or copies of the Program or any portion
+of it, thus forming a work based on the Program, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
 
    
-"... shogi [is] by far the most complex form of chess that has ever
-achieved widespread popularity."
 
+
      
+
    1. 
+You must cause the modified files to carry prominent notices
+stating that you changed the files and the date of any change.
+
      
 
+
    2. 
+You must cause any work that you distribute or publish, that in
+whole or in part contains or is derived from the Program or any
+part thereof, to be licensed as a whole at no charge to all third
+parties under the terms of this License.
 
      
---- R. Wayne Schmittberger, New Rules for Classic Games
-

 
+
  • 
+If the modified program normally reads commands interactively
+when run, you must cause it, when started running for such
+interactive use in the most ordinary way, to print or display an
+announcement including an appropriate copyright notice and a
+notice that there is no warranty (or else, saying that you provide
+a warranty) and that users may redistribute the program under
+these conditions, and telling the user how to view a copy of this
+License.  (Exception: if the Program itself is interactive but
+does not normally print such an announcement, your work based on
+the Program is not required to print an announcement.)
+
 
    
-Shogi is the version of chess played in Japan.  It is strikingly
-different from standard chess (which I shall refer to henceforth as
-"international chess") and also to all other regional variants,
-because captured pieces can re-enter play on the side of the capturer.
-This has several interesting effects on the play of the game:
 
+These requirements apply to the modified work as a whole.  If
+identifiable sections of that work are not derived from the Program,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works.  But when you
+distribute the same sections as part of a whole which is a work based
+on the Program, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote it.
+
    
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Program.
+
    
+
+In addition, mere aggregation of another work not based on the Program
+with the Program (or with a work based on the Program) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
    
 
+
  • 
+You may copy and distribute the Program (or a work based on it,
+under Section 2) in object code or executable form under the terms of
+Sections 1 and 2 above provided that you also do one of the following:
+
    
 
 
      
 
    1. 
+Accompany it with the complete corresponding machine-readable
+source code, which must be distributed under the terms of Sections
+1 and 2 above on a medium customarily used for software interchange; or,
+
      
 
-Shogi is much more complex than international chess, at least in
-terms of the average number of possible moves per turn (estimated at
-about 35 for chess and at about 80 for shogi).
+
    2. 
+Accompany it with a written offer, valid for at least three
+years, to give any third party, for a charge no more than your
+cost of physically performing source distribution, a complete
+machine-readable copy of the corresponding source code, to be
+distributed under the terms of Sections 1 and 2 above on a medium
+customarily used for software interchange; or,
+
      
 
 
    3. 
+Accompany it with the information you received as to the offer
+to distribute corresponding source code.  (This alternative is
+allowed only for noncommercial distribution and only if you
+received the program in object code or executable form with such
+an offer, in accord with Subsection b above.)
+
    
+
    
 
-There are almost no draws (about 1-2% of all games in professional play).
+The source code for a work means the preferred form of the work for
+making modifications to it.  For an executable work, complete source
+code means all the source code for all modules it contains, plus any
+associated interface definition files, plus the scripts used to
+control compilation and installation of the executable.  However, as a
+special exception, the source code distributed need not include
+anything that is normally distributed (in either source or binary
+form) with the major components (compiler, kernel, and so on) of the
+operating system on which the executable runs, unless that component
+itself accompanies the executable.
+
    
+
+If distribution of executable or object code is made by offering
+access to copy from a designated place, then offering equivalent
+access to copy the source code from the same place counts as
+distribution of the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
    
 
 
  • 
-
-Exchanges complicate the play rather than simplifying it.
+You may not copy, modify, sublicense, or distribute the Program
+except as expressly provided under this License.  Any attempt
+otherwise to copy, modify, sublicense or distribute the Program is
+void, and will automatically terminate your rights under this License.
+However, parties who have received copies, or rights, from you under
+this License will not have their licenses terminated so long as such
+parties remain in full compliance.
+
    
 
 
  • 
+You are not required to accept this License, since you have not
+signed it.  However, nothing else grants you permission to modify or
+distribute the Program or its derivative works.  These actions are
+prohibited by law if you do not accept this License.  Therefore, by
+modifying or distributing the Program (or any work based on the
+Program), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Program or works based on it.
+
    
 
-There are no "endgames" in the standard chess sense; all pieces remain
-in play throughout the game.  Games typically end in a race to
-checkmate the other player before being checkmated oneself.
+
  • 
+Each time you redistribute the Program (or any work based on the
+Program), the recipient automatically receives a license from the
+original licensor to copy, distribute or modify the Program subject to
+these terms and conditions.  You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties to
+this License.
+
    
 
 
  • 
+If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License.  If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Program at all.  For example, if a patent
+license would not permit royalty-free redistribution of the Program by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Program.
+
    
 
-Ownership of a piece is not indicated by the color of the piece;
-instead, pieces are wedge-shaped and point towards the opponent.  The
-name of the piece is inscribed in Kanji characters on the front of the
-piece.
+If any portion of this section is held invalid or unenforceable under
+any particular circumstance, the balance of the section is intended to
+apply and the section as a whole is intended to apply in other
+circumstances.
+
    
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system, which is
+implemented by public license practices.  Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
    
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
    
 
 
  • 
+If the distribution and/or use of the Program is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Program under this License
+may add an explicit geographical distribution limitation excluding
+those countries, so that distribution is permitted only in or among
+countries not thus excluded.  In such case, this License incorporates
+the limitation as if written in the body of this License.
+
    
 
-Most importantly: it's more fun than other forms of chess :-)
+
  • 
+The Free Software Foundation may publish revised and/or new versions
+of the General Public License from time to time.  Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
    
 
-
+Each version is given a distinguishing version number.  If the Program
+specifies a version number of this License which applies to it and "any
+later version", you have the option of following the terms and conditions
+either of that version or of any later version published by the Free
+Software Foundation.  If the Program does not specify a version number of
+this License, you may choose any version ever published by the Free Software
+Foundation.
+
    
 
+
  • 
+If you wish to incorporate parts of the Program into other free
+programs whose distribution conditions are different, write to the author
+to ask for permission.  For software which is copyrighted by the Free
+Software Foundation, write to the Free Software Foundation; we sometimes
+make exceptions for this.  Our decision will be guided by the two goals
+of preserving the free status of all derivatives of our free software and
+of promoting the sharing and reuse of software generally.
 
    
-Shogi is extremely popular in Japan; it has been estimated that 20
-million Japanese can play shogi, of which perhaps 1 million are active
-players.  It is even more popular there than the game of go, Japan's
-other favorite board game.  There are a number of professional players
-who make a considerable amount of money playing in shogi tournaments,
-and the game receives extensive newpaper and television coverage.
-Despite this, the game has yet to become popular outside of Japan.  Part
-of this is because the Kanji characters on the pieces scare away some
-people, but mostly it's due, I think, to lack of exposure to the game
-and to the difficulty of finding opponents.  I hope that GNU shogi will
-help introduce shogi to a wider audience.
 
+
    
+ NO WARRANTY
+
    
+
    
+
+
  • 
+BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
+FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW.  EXCEPT WHEN
+OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
+PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
+OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE.  THE ENTIRE RISK AS
+TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU.  SHOULD THE
+PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
+REPAIR OR CORRECTION.
+
    
+
+
  • 
+IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
+REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
+INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
+OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
+TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
+YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
+PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGES.
+
+
    
 
-
    
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  
+
    
+ END OF TERMS AND CONDITIONS
+
    
+
    
+
+
    
+
+
+
+
+
+
+
+
+
+
+
    [ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]
    
+
      
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
 
 
 
diff --git a/doc/gnushogi_4.html b/doc/gnushogi_4.html
index 4f4f45e..016b2a5 100644
--- a/doc/gnushogi_4.html
+++ b/doc/gnushogi_4.html
@@ -1,46 +1,133 @@
 
+
+
+
 
-
+GNU Shogi manual: How to Apply These Terms to Your New Programs
+
+
+
+
+
+
 
-GNU Shogi manual - The rules of shogi
 
-
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

    
 
+
 
-
    The rules of shogi
    
+
+
+
+
+
+
+
+
+
+
+
+
    [ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]
    
+
    
+
     How to Apply These Terms to Your New Programs 
    
+
 
    
-
 
+  If you develop a new program, and you want it to be of the greatest
+possible use to the public, the best way to achieve this is to make it
+free software which everyone can redistribute and change under these terms.
+
    
 
-
    
-Shogi is a two-person abstract strategy board game with full information
-(i.e. all pieces and moves are visible to both players at all times).
-It is in the chess family, being descended from the same ancestral game
-as international chess: the Indian game of Chaturanga.  The two players
-are referred to as "Black" and "White", with Black moving first
-(unlike in international chess, where White moves first), and with
-movement alternating between the two players.  Note that "Black" and
-"White" are just names; the pieces are not colored.  Instead, they are
-flat, wedge-shaped pieces which point towards the opponent.  The
-identity of a given piece is indicated by two Japanese Kanji characters
-on each piece.  In fact, only the top character is needed to identify
-the piece and thus only the top character is used in shogi diagrams.  I
-will use alphabetical equivalents in the diagrams here; to see what the
-Kanji characters look like, start up xshogi (see section xshogi) and compare
-the starting setup there with the starting setup in this file
-(see section The opening setup).
+  To do so, attach the following notices to the program.  It is safest
+to attach them to the start of each source file to most effectively
+convey the exclusion of warranty; and each file should have at least
+the "copyright" line and a pointer to where the full notice is found.
+
    
 
+
     
    one line to give the program's name and a brief idea of what it does.
+Copyright (C) 19yy  name of author
 
-
    
-The object of the game is to capture the opponent's King.  The board is
-a grid of 9x9 uncolored squares, and pieces are placed on the squares.
-Each player begins with 20 pieces, described in the next section.
-Capture is by displacement, as in international chess.
+This program is free software; you can redistribute it and/or modify
+it under the terms of the GNU General Public License as published by
+the Free Software Foundation; either version 2 of the License, or
+(at your option) any later version.
+
+This program is distributed in the hope that it will be useful,
+but WITHOUT ANY WARRANTY; without even the implied warranty of
+MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+GNU General Public License for more details.
+
+You should have received a copy of the GNU General Public License
+along with this program; if not, write to the Free Software
+Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+
    
+
+Also add information on how to contact you by electronic and paper mail.
+
    
+
+If the program is interactive, make it output a short notice like this
+when it starts in an interactive mode:
+
    
+
+
     
    Gnomovision version 69, Copyright (C) 19yy name of author
+Gnomovision comes with ABSOLUTELY NO WARRANTY; for details 
+type `show w'.
+This is free software, and you are welcome to redistribute it
+under certain conditions; type `show c' for details.
+
    
+
+The hypothetical commands `show w' and `show c' should show
+the appropriate parts of the General Public License.  Of course, the
+commands you use may be called something other than `show w' and
+`show c'; they could even be mouse-clicks or menu items--whatever
+suits your program.
+
    
+
+You should also get your employer (if you work as a programmer) or your
+school, if any, to sign a "copyright disclaimer" for the program, if
+necessary.  Here is a sample; alter the names:
+
    
+
+
     
    Yoyodyne, Inc., hereby disclaims all copyright interest in the program
+`Gnomovision' (which makes passes at compilers) written by James Hacker.
+
+signature of Ty Coon, 1 April 1989
+Ty Coon, President of Vice
+
    
 
+This General Public License does not permit incorporating your program into
+proprietary programs.  If your program is a subroutine library, you may
+consider it more useful to permit linking proprietary applications with the
+library.  If this is what you want to do, use the GNU Library General
+Public License instead of this License.
+
    
 
-
    
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  
+
+
    
+
+
+
+
+
+
+
+
+
+
+
    [ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]
    
+
      
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
 
 
 
diff --git a/doc/gnushogi_5.html b/doc/gnushogi_5.html
index 6de8e61..962bf94 100644
--- a/doc/gnushogi_5.html
+++ b/doc/gnushogi_5.html
@@ -1,97 +1,146 @@
 
+
+
+
 
-
+GNU Shogi manual: About shogi
 
-GNU Shogi manual - The moves of the pieces
-
-
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

    
+
+
+
+
+
 
+
 
-
    The moves of the pieces
    
+
+
+
+
+
+
+
+
+
+
+
+
+
+
    [ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]
    
+
    
+
     2. About the game of shogi 
    
+
+     
 
    
-
-
 
+
    
+"Japanese chess cedes nothing in depth or beauty to the European
+game... it is at least as interesting."
 
    
-Each player at the beginning of a shogi game has a total of 20 pieces of
-eight different types.  The moves of the shogi pieces can be divided
-into three classes: "stepping" pieces, that only move one square at a
-time; "ranging" pieces that move any number of unobstructed squares in
-a line, and "jumping" pieces that can jump over obstructing pieces to
-reach their destination squares.  Most pieces can also promote to
-different (usually stronger) pieces under certain circumstances (see the
-next section).  All pieces capture the same way that they move (even
-pawns).  The piece moves and promotions are as follows; each piece name
-is followed by the standard piece abbreviation:
-
 
+--- Alexander Alekhine 
    
+(quoted in David Pritchard, The Encyclopedia of Chess Variants) 
+
    
 
-
      
-
-
    1. 
+"... shogi [is] by far the most complex form of chess that has ever
+achieved widespread popularity."
+
      
 
-The king (K).  The king can move one square in any horizontal, vertical,
-or diagonal direction, just like the king in international chess.  The
-king does not promote.
-
-
    2. 
+--- R. Wayne Schmittberger, New Rules for Classic Games
+
    
+
    
 
-The rook (R).  The rook can move any number of squares in a horizontal
-or vertical direction.  The rook is the same as the rook in
-international chess (except that it can promote).  A rook promotes to a
-"dragon king" or "dragon" for short (often just referred to as a
-"promoted rook"), which can move as a rook or can move one square in
-any diagonal direction.
+Shogi is the version of chess played in Japan.  It is strikingly
+different from standard chess (which I shall refer to henceforth as
+"international chess") and also to all other regional variants,
+because captured pieces can re-enter play on the side of the capturer.
+This has several interesting effects on the play of the game:
+
    
 
+
      
 
    1. 
-
-The bishop (B).  The bishop can move any number of squares in a diagonal
-direction.  The bishop is the same as the bishop in international chess
-(except that it can promote).  A bishop promotes to a "dragon horse"
-or "horse" for short (often just referred to as a "promoted
-bishop"), which can move as a bishop or can move one square in any
-horizontal or vertical direction.  Note: the horse should not be
-confused with a knight (see below), as they are two completely different
-pieces.
+Shogi is much more complex than international chess, at least in
+terms of the average number of possible moves per turn (estimated at
+about 35 for chess and at about 80 for shogi).
+
      
 
 
    2. 
-
-The gold general (G).  A gold general can move one square in any
-horizontal or vertical direction, or one square in a forward diagonal
-direction.  Gold generals do not promote.
+There are almost no draws (about 1-2% of all games in professional play).
+
      
 
 
    3. 
-
-The silver general (S).  A silver general can move one square in any
-diagonal direction, or one square straight forward.  A silver general
-promotes to a gold general.
+Exchanges complicate the play rather than simplifying it.
+
      
 
 
    4. 
-
-The knight (N).  A knight can move one square straight forward followed
-by one square to either forward diagonal, jumping over intervening
-pieces if any.  In other words, a knight moves like its international
-chess counterpart, but forward only.  A knight promotes to a gold
-general.  The knight is the only jumping piece, as in chess.
+There are no "endgames" in the standard chess sense; all pieces remain
+in play throughout the game.  Games typically end in a race to
+checkmate the other player before being checkmated oneself.
+
      
 
 
    5. 
-
-The lance (L).  A lance can move any number of squares straight forward.
-A lance promotes to a gold general.
+Ownership of a piece is not indicated by the color of the piece;
+instead, pieces are wedge-shaped and point towards the opponent.  The
+name of the piece is inscribed in Kanji characters on the front of the
+piece.
+
      
 
 
    6. 
-
-The pawn (P).  A pawn can move one square straight forward.  The pawn
-captures the same way that it moves, in contrast to international chess.
-There is also no initial two-space move for pawns and no
-en-passant capture.  A pawn promotes to a gold general; a
-promoted pawn is usually known as a "Tokin".
+Most importantly: it's more fun than other forms of chess :-)
+
      
 
 
    
+
    
+
+Shogi is extremely popular in Japan; it has been estimated that 20
+million Japanese can play shogi, of which perhaps 1 million are active
+players.  It is even more popular there than the game of go, Japan's
+other favorite board game.  There are a number of professional players
+who make a considerable amount of money playing in shogi tournaments,
+and the game receives extensive newpaper and television coverage.
+Despite this, the game has yet to become popular outside of Japan.  Part
+of this is because the Kanji characters on the pieces scare away some
+people, but mostly it's due, I think, to lack of exposure to the game
+and to the difficulty of finding opponents.  I hope that GNU shogi will
+help introduce shogi to a wider audience.
+
    
+
+
     
+
+
+
+
+
+
    2.1 The rules of shogi  
    2.2 Sample game  
    2.3 Mating problems  
    2.4 Shogi variants  
    2.5 Differences between shogi and chess  
    
+
    
 
-
    
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  
+
+
    
+
+
+
+
+
+
+
+
+
+
+
    [ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]
    
+
      
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
 
 
 
diff --git a/doc/gnushogi_6.html b/doc/gnushogi_6.html
index 1027529..24910cf 100644
--- a/doc/gnushogi_6.html
+++ b/doc/gnushogi_6.html
@@ -1,57 +1,100 @@
 
+
+
+
 
-
-
-GNU Shogi manual - The opening setup
-
-
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

    
+GNU Shogi manual: The rules of shogi
 
+
+
+
+
+
 
-
    The opening setup
    
-
    
-
+
 
+
 
+
+
+
+
+
+
+
+
+
+
+
+
    [ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]
    
+
    
+
     2.1 The rules of shogi 
    
+
 
    
 
-The opening setup for shogi is as follows:
-
    
-
    -   9    8    7    6    5    4    3    2    1
-+--------------------------------------------+     
-| wL | wN | wS | wG | wK | wG | wS | wN | wL |  a     
-+--------------------------------------------+       
-|    | wR |    |    |    |    |    | wB |    |  b     
-+--------------------------------------------+       
-| wP | wP | wP | wP | wP | wP | wP | wP | wP |  c   
-+--------------------------------------------+     
-|    |    |    |    |    |    |    |    |    |  d   
-+--------------------------------------------+     
-|    |    |    |    |    |    |    |    |    |  e   
-+--------------------------------------------+     
-|    |    |    |    |    |    |    |    |    |  f   
-+--------------------------------------------+     
-| bP | bP | bP | bP | bP | bP | bP | bP | bP |  g   
-+--------------------------------------------+       
-|    | bB |    |    |    |    |    | bR |    |  h   
-+--------------------------------------------+       
-| bL | bN | bS | bG | bK | bG | bS | bN | bL |  i    
-+--------------------------------------------+
-
    
+Shogi is a two-person abstract strategy board game with full information
+(i.e. all pieces and moves are visible to both players at all times).
+It is in the chess family, being descended from the same ancestral game
+as international chess: the Indian game of Chaturanga.  The two players
+are referred to as "Black" and "White", with Black moving first
+(unlike in international chess, where White moves first), and with
+movement alternating between the two players.  Note that "Black" and
+"White" are just names; the pieces are not colored.  Instead, they are
+flat, wedge-shaped pieces which point towards the opponent.  The
+identity of a given piece is indicated by two Japanese Kanji characters
+on each piece.  In fact, only the top character is needed to identify
+the piece and thus only the top character is used in shogi diagrams.  I
+will use alphabetical equivalents in the diagrams here; to see what the
+Kanji characters look like, start up xshogi (see section 4. xshogi) and compare
+the starting setup there with the starting setup in this file
+(see section 2.1.2 The opening setup).
+
    
 
+The object of the game is to capture the opponent's King.  The board is
+a grid of 9x9 uncolored squares, and pieces are placed on the squares.
+Each player begins with 20 pieces, described in the next section.
+Capture is by displacement, as in international chess.
+
    
 
+
     
+
+
+
+
+
+
+
+
+
    2.1.1 The moves of the pieces  
    2.1.2 The opening setup  
    2.1.3 Promotion of pieces  
    2.1.4 Drops  
    2.1.5 Winning the game  
    2.1.6 Draws  
    2.1.7 Handicaps  
    2.1.8 Notes for chess players  
    
 
    
-Here, "b" stands for "black" and "w" stands for "white", so
-that, for instance, "bL" means "black lance".  The numbers above the
-files and the letters to the right of the ranks represent the most
-common notation system used for shogi by westerners (the Japanese also
-use Arabic numerals for the files but use Japanese numerals for the
-ranks).  
-
 
-
    
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  
+
+
    
+
+
+
+
+
+
+
+
+
+
+
    [ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]
    
+
      
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
 
 
 
diff --git a/doc/gnushogi_7.html b/doc/gnushogi_7.html
index fa7a28e..8e17843 100644
--- a/doc/gnushogi_7.html
+++ b/doc/gnushogi_7.html
@@ -1,94 +1,140 @@
 
+
+
+
 
-
+GNU Shogi manual: The moves of the pieces
 
-GNU Shogi manual - Promotion of pieces
-
-
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

    
-
-
-
    Promotion of pieces
    
-
    
-
+
+
+
+
+
 
+
 
+
+
+
+
+
+
+
+
+
+
+
+
+
+
    [ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]
    
+
    
+
     2.1.1 The moves of the pieces 
    
+
 
    
-In sharp contrast to international chess, where only pawns can promote
-to higher-ranked pieces, most of the pieces in shogi can promote.  The
-promoted ranks are discussed in the section on piece moves (see section The moves of the pieces) but are repeated here for reference:
-
-
-
    
-
-
    Pawn
-
    
-promotes to gold general (called a `tokin' in this case only).
-
-
    Lance
-
    
-promotes to gold general.
-
-
    Knight
-
    
-promotes to gold general.
-
-
    Silver general
-
    
-promotes to gold general.
-
-
    Gold general
-
    
-does not promote.
-
-
    Bishop
-
    
-promotes to "dragon horse" or just "horse" for short.  The horse can
-move as a bishop or can move one square in any orthogonal direction.
-
-
    Rook
-
    
-promotes to "dragon king" or just "dragon" for short.  The dragon
-can move as a rook or can move one square in any diagonal direction.
 
-
    King
-
    
-does not promote.
+Each player at the beginning of a shogi game has a total of 20 pieces of
+eight different types.  The moves of the shogi pieces can be divided
+into three classes: "stepping" pieces, that only move one square at a
+time; "ranging" pieces that move any number of unobstructed squares in
+a line, and "jumping" pieces that can jump over obstructing pieces to
+reach their destination squares.  Most pieces can also promote to
+different (usually stronger) pieces under certain circumstances (see the
+next section).  All pieces capture the same way that they move (even
+pawns).  The piece moves and promotions are as follows; each piece name
+is followed by the standard piece abbreviation:
+
    
 
-
    
+
      
 
+
    1. 
+The king (K).  The king can move one square in any horizontal, vertical,
+or diagonal direction, just like the king in international chess.  The
+king does not promote.
 
      
-The three ranks furthest away from each player constitute his/her
-"promotion zone".  A player may, but is not required to, promote a
-piece after making a move in which the piece begins and/or ends in the
-promotion zone.  Thus you can promote a piece when moving the piece into
-the promotion zone, out of the promotion zone, or entirely within the
-promotion zone.  Promotion is mandatory in these cases:
-
 
+
    2. 
+The rook (R).  The rook can move any number of squares in a horizontal
+or vertical direction.  The rook is the same as the rook in
+international chess (except that it can promote).  A rook promotes to a
+"dragon king" or "dragon" for short (often just referred to as a
+"promoted rook"), which can move as a rook or can move one square in
+any diagonal direction.
+
      
 
-
        
-
-
      1. You must promote a pawn or a lance after moving it to the last rank.
-
-
      2. You must promote a knight after moving it to either of the last
+
      3. 
+The bishop (B).  The bishop can move any number of squares in a diagonal
+direction.  The bishop is the same as the bishop in international chess
+(except that it can promote).  A bishop promotes to a "dragon horse"
+or "horse" for short (often just referred to as a "promoted
+bishop"), which can move as a bishop or can move one square in any
+horizontal or vertical direction.  Note: the horse should not be
+confused with a knight (see below), as they are two completely different
+pieces.
+
        
 
-two ranks.
+
      4. 
+The gold general (G).  A gold general can move one square in any
+horizontal or vertical direction, or one square in a forward diagonal
+direction.  Gold generals do not promote.
+
        
 
-
      
+
    3. 
+The silver general (S).  A silver general can move one square in any
+diagonal direction, or one square straight forward.  A silver general
+promotes to a gold general.
+
      
 
+
    4. 
+The knight (N).  A knight can move one square straight forward followed
+by one square to either forward diagonal, jumping over intervening
+pieces if any.  In other words, a knight moves like its international
+chess counterpart, but forward only.  A knight promotes to a gold
+general.  The knight is the only jumping piece, as in chess.
 
      
-These forced promotions ensure that a piece cannot be moved to a square
-from which it would have no further move.
 
+
    5. 
+The lance (L).  A lance can move any number of squares straight forward.
+A lance promotes to a gold general.
+
      
 
+
    6. 
+The pawn (P).  A pawn can move one square straight forward.  The pawn
+captures the same way that it moves, in contrast to international chess.
+There is also no initial two-space move for pawns and no
+en-passant capture.  A pawn promotes to a gold general; a
+promoted pawn is usually known as a "Tokin".
 
      
-Pieces "dropped" onto the board (see section Drops) always drop in the
-unpromoted state, even if they drop into the promotion zone.
 
+
    
+
    
 
-
    
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  
+
+
    
+
+
+
+
+
+
+
+
+
+
+
    [ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]
    
+
      
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
 
 
 
diff --git a/doc/gnushogi_8.html b/doc/gnushogi_8.html
index ba24091..131365f 100644
--- a/doc/gnushogi_8.html
+++ b/doc/gnushogi_8.html
@@ -1,79 +1,86 @@
 
+
+
+
 
-
+GNU Shogi manual: The opening setup
 
-GNU Shogi manual - Drops
-
-
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

    
-
-
-
    Drops
    
-
    
-
-
-
-
    
-When a player captures a piece, that piece is not removed from play.
-Instead, it becomes the property of the capturer and can re-enter play
-by being placed on (almost) any vacant square during the player's move.
-This is known as a "drop" and counts as a full move (in other words,
-you can either move a piece on the board or drop a piece onto the board
-during your move, but not both).  All pieces drop in the unpromoted
-state.  Pieces may be legally dropped in their promotion zone, but they
-do not promote on that turn.
-
-
-
    
-There are several restrictions on drops:
-
-
-
-
      
-
-
    1. A pawn may not be dropped onto a file if there is already an
-
-unpromoted pawn belonging to the same player on that file.  It is legal
-to drop a pawn on a file which contains a promoted pawn belonging
-to the same player, however.
-
-
    2. A pawn may not be dropped to give immediate checkmate on the
-
-move.  A pawn is, however, permitted to be moved on the board to give
-immediate checkmate.  This is a curious rule, and if anyone knows the
-reason for it I would appreciate it if they would contact me and explain
-it to me :-)
-
-
    3. A pawn or piece may not be dropped onto a square from which they
-
-would have no legal move.  This means that pawns and lances may not be
-dropped onto the last rank, and the knight may not be dropped onto the
-last or second-to-last rank.
-
-
    
-
-
    
-It is entirely permissible (and often advisable) to drop a piece or pawn
-between one's King and an attacking ranging piece.  For this reason,
-the final checkmating move is nearly always an attack on the King from
-an adjacent square (except for an attack by a Knight).
-
-
-
    
-Captured pieces are said to be pieces "in hand".
+
+
+
+
+
 
+
 
+
+
+
+
+
+
+
+
+
+
+
+
+
+
    [ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]
    
+
    
+
     2.1.2 The opening setup 
    
+
 
    
-The drop is the primary distinguishing feature of Japanese chess, shared
-with no other popular chess-type game.  It gives shogi a very aggressive
-quality, and dramatically increases the number of possible moves once a
-few pieces have been captured.  Another interesting feature of shogi is
-that exchanges complicate play rather than simplifying it (as in
-international chess), because of the drop rule.
-
 
-
    
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  
+The opening setup for shogi is as follows:
+
    
+
+   9    8    7    6    5    4    3    2    1
++---------------------------------------------+     
    
+| wL | wN | wS | wG | wK | wG | wS | wN | wL |  a   
      
++---------------------------------------------+     
      
+|    | wR |    |    |    |    |    | wB |    |  b   
      
++---------------------------------------------+     
      
+| wP | wP | wP | wP | wP | wP | wP | wP | wP |  c   
    
++---------------------------------------------+     
    
+|    |    |    |    |    |    |    |    |    |  d   
    
++---------------------------------------------+     
    
+|    |    |    |    |    |    |    |    |    |  e   
    
++---------------------------------------------+     
    
+|    |    |    |    |    |    |    |    |    |  f   
    
++---------------------------------------------+     
    
+| bP | bP | bP | bP | bP | bP | bP | bP | bP |  g   
    
++---------------------------------------------+     
      
+|    | bB |    |    |    |    |    | bR |    |  h   
    
++---------------------------------------------+     
      
+| bL | bN | bS | bG | bK | bG | bS | bN | bL |  i   
     
++---------------------------------------------+
+
    
+
+Here, "b" stands for "black" and "w" stands for "white", so
+that, for instance, "bL" means "black lance".  The numbers above the
+files and the letters to the right of the ranks represent the most
+common notation system used for shogi by westerners (the Japanese also
+use Arabic numerals for the files but use Japanese numerals for the
+ranks).  
+
    
+
+
+
    
+
      
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
 
 
 
diff --git a/doc/gnushogi_9.html b/doc/gnushogi_9.html
index ad6ecb6..0c08b13 100644
--- a/doc/gnushogi_9.html
+++ b/doc/gnushogi_9.html
@@ -1,32 +1,136 @@
 
+
+
+
 
-
+GNU Shogi manual: Promotion of pieces
+
+
+
+
+
+
 
-GNU Shogi manual - Winning the game
 
-
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  

    
 
+
+
+
+
+
+
+
+
+
+
+
+
+
+
    [ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]
    
+
    
+
     2.1.3 Promotion of pieces 
    
+
+
    
+
+In sharp contrast to international chess, where only pawns can promote
+to higher-ranked pieces, most of the pieces in shogi can promote.  The
+promoted ranks are discussed in the section on piece moves (see section 2.1.1 The moves of the pieces) but are repeated here for reference:
+
    
+
+
    
+
+
    Pawn
+
    promotes to gold general (called a `tokin' in this case only).
+
    
+
+
    Lance
+
    promotes to gold general.
+
    
+
+
    Knight
+
    promotes to gold general.
+
    
 
-
    Winning the game
    
+
    Silver general
+
    promotes to gold general.
 
    
-
 
+
    Gold general
+
    does not promote.
+
    
+
+
    Bishop
+
    promotes to "dragon horse" or just "horse" for short.  The horse can
+move as a bishop or can move one square in any orthogonal direction.
+
    
 
+
    Rook
+
    promotes to "dragon king" or just "dragon" for short.  The dragon
+can move as a rook or can move one square in any diagonal direction.
 
    
-A game of shogi is won by capturing the opponent's king.  In general,
-this is done by checkmating the king: attacking the king in such a way
-that the king cannot be defended no matter what the defending player
-moves.  Note, though, that there is no rule that requires a player to
-defend a king which is being attacked.  However, if he does not defend
-his king, the opponent is entirely free to capture it on the next move,
-thus winning the game.  As in international chess, in practice most
-games end by resignation when one player realizes that he cannot escape
-checkmate. 
 
+
    King
+
    does not promote.
+
    
+
+
    
+
    
+
+The three ranks furthest away from each player constitute his/her
+"promotion zone".  A player may, but is not required to, promote a
+piece after making a move in which the piece begins and/or ends in the
+promotion zone.  Thus you can promote a piece when moving the piece into
+the promotion zone, out of the promotion zone, or entirely within the
+promotion zone.  Promotion is mandatory in these cases:
+
    
+
+
      
+
+
    1. You must promote a pawn or a lance after moving it to the last rank.
+
      
+
+
    2. You must promote a knight after moving it to either of the last
+two ranks.
+
      
+
+
    
+
    
+
+These forced promotions ensure that a piece cannot be moved to a square
+from which it would have no further move.
+
    
+
+Pieces "dropped" onto the board (see section 2.1.4 Drops) always drop in the
+unpromoted state, even if they drop into the promotion zone.
+
    
 
-
    
- [Contents]   [Back]   [Prev]   [Up]   [Next]   [Forward]  
+
+
    
+
+
+
+
+
+
+
+
+
+
+
    [ < ][ > ]   [ << ][ Up ][ >> ]            [Top][Contents][Index][ ? ]
    
+
      
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
 
 
 
diff --git a/doc/gnushogi_abt.html b/doc/gnushogi_abt.html
new file mode 100644
index 0000000..1d685a1
--- /dev/null
+++ b/doc/gnushogi_abt.html
@@ -0,0 +1,202 @@
+
+
+
+
+
+GNU Shogi manual: About this document
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
    [Top][Contents][Index][ ? ]
    
+
    
+
    About this document
    
+This document was generated by Michael C. Vanier on July, 7  2004
+using texi2html
+
      
+The buttons in the navigation panels have the following meaning:
+
    
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
     Button  Name  Go to  From 1.2.3 go to
    
+ [ < ] 
+Back
+
+previous section in reading order
+
+1.2.2
+
    
+ [ > ] 
+Forward
+
+next section in reading order
+
+1.2.4
+
    
+ [ << ] 
+FastBack
+
+previous or up-and-previous section 
+
+1.1
+
    
+ [ Up ] 
+Up
+
+up section
+
+1.2
+
    
+ [ >> ] 
+FastForward
+
+next or up-and-next section
+
+1.3
+
    
+ [Top] 
+Top
+
+cover (top) of document
+
+   
+
    
+ [Contents] 
+Contents
+
+table of contents
+
+   
+
    
+ [Index] 
+Index
+
+concept index
+
+   
+
    
+ [ ? ] 
+About
+
+this page
+
+   
+
    
+
    
+where the  Example  assumes that the current position 
+is at  Subsubsection One-Two-Three  of a document of 
+the following structure:
+
      
+
    •  1. Section One  
      • 
+
        
+
      • 1.1 Subsection One-One
        • 
+
          
+
        •  ... 
          • 
+
        
+
      • 1.2 Subsection One-Two
        • 
+
          
+
        • 1.2.1 Subsubsection One-Two-One
+
        • 1.2.2 Subsubsection One-Two-Two
+
        • 1.2.3 Subsubsection One-Two-Three     
+<== Current Position 
+
        • 1.2.4 Subsubsection One-Two-Four
+
        
+
      • 1.3 Subsection One-Three
        • 
+
          
+
        •  ... 
          • 
+
        
+
      • 1.4 Subsection One-Four
        • 
+
      
+
    
+
+
    
+
      
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
+
+
+
diff --git a/doc/gnushogi_ovr.html b/doc/gnushogi_ovr.html
new file mode 100644
index 0000000..b31d284
--- /dev/null
+++ b/doc/gnushogi_ovr.html
@@ -0,0 +1,65 @@
+
+
+
+
+
+GNU Shogi manual: Short Table of Contents
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
    [Top][Contents][Index][ ? ]
    
+
    
+
    Short Table of Contents
    
+
    
+1. Introduction
+
    
+GNU GENERAL PUBLIC LICENSE
+
    
+2. About the game of shogi
+
    
+3. gnushogi
+
    
+4. xshogi
+
    
+5. References and links
+
    
+6. Acknowledgements
+
    
+7. Bugs
+
    
+8. Index
+
    
+
+
    
+
    
+
      
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
+
+
+
diff --git a/doc/gnushogi_stoc.html b/doc/gnushogi_stoc.html
deleted file mode 100644
index 9be1680..0000000
--- a/doc/gnushogi_stoc.html
+++ /dev/null
@@ -1,37 +0,0 @@
-
-
-
-
-GNU Shogi manual - Short Table of Contents
-
-
-
    GNU Shogi manual
    
-
    Mike Vanier
    
-
    
-
    
-
    
-
    
-This document was generated on June 29,  1999 using
-texi2html 1.57.
-
-
-
diff --git a/doc/gnushogi_toc.html b/doc/gnushogi_toc.html
index 57e3731..eec04f7 100644
--- a/doc/gnushogi_toc.html
+++ b/doc/gnushogi_toc.html
@@ -1,50 +1,100 @@
 
+
+
+
 
-
+GNU Shogi manual: Table of Contents
+
+
+
+
+
+
 
-GNU Shogi manual - Table of Contents
 
-
-
    GNU Shogi manual
    
-
    Mike Vanier
    
-
    
-
    
+
+
+
+
+
+
+
+
+
+
    [Top][Contents][Index][ ? ]
    
+
    
+
    Table of Contents
    
+
+3. gnushogi
+
    
+4. xshogi
+
    
+5. References and links
+
    
+6. Acknowledgements
+
    
+7. Bugs
+
    
+8. Index
+
    
+
+
    
+
      
+
+This document was generated
+by Michael C. Vanier on July, 7  2004
+using texi2html
 
 
 
diff --git a/doc/listserv.ref b/doc/listserv.ref
deleted file mode 100644
index d27c1d6..0000000
--- a/doc/listserv.ref
+++ /dev/null
@@ -1,69 +0,0 @@
-NOTE: this file may be seriously outdated.  I haven't had time to go over
-it yet.  Let me know if there are problems.
-
--- Mike (mvanier@bbb.caltech.edu)
-
-
-
-This is a message from Pieter Stouten, one of the owners of a listserver
-for the game of Shogi.
-------------------------------------------------------------------------
-
-
-H O W   T O   D E A L   W I T H   T E C H N I O N
-=================================================
-
-There is still some confusion about posting to SHOGI-L. Therefore this
-explanation about how it all works. This file will also automatically
-be sent to all new subscribers to the list.
-One thing that must be clear is the fundamental difference between
-
-the List Server  
-or 
-
-                      and
-
-the Shogi Discussion List  or 
-.
-
-
-LISTSERV
---------
-
-Basically, the List Server must be addressed in two cases:
-1) when you want to register with a specific list or, after registering,
-   when you want to change or query your options related to this registration.
-2) when you want to retrieve files from an archive maintained by this
-   List Server.
-Addressing the List Server must be done using standard commands e.g.
-1) "Subscribe a_nice_list first_name last_name" or
-   "Set a_nice_list repro"
-2) "Get file_name file_type"
-(without the quotes, of course). In order to find out which files are
-available for retrieval, you must send the command "Index Shogi-L" to the
-List Server. If you want to know your distribution options, you must send
-the command "Query Shogi-L". To find out who else subscribes, you send
-the command "Review Shogi-L". Everything must be sent to the List Server !
-
-
-SHOGI-L
--------
-
-The Shogi Discussion List is a redistribution list, which redistributes all
-incoming mail to the subscribers to the list. This mail does not need special
-headers or commands. The only restriction is that lines must not exceed 80
-characters. It is redistributed unmoderated and unchanged.
-Everybody who subscribes to SHOGI-L is authorized to have his/her mail
-redistributed. If you (as subscriber) suddenly get a message that you are not
-authorized, please check whether you are working from the same node as the
-one you registered from or whether the full path to your node is still the
-same or if there are any known problems with gateways affecting you. In any
-case, if you experience this problem, please check with your local network
-personnel first, before bombarding us with requests and complaints.
-
-Having said this all, there should be no obstruction anymore and everybody
-now can post all his/her Shogi information, requests and musings (?).
-
-Pieter Stouten 
-17-th September 1990.
-
diff --git a/doc/xshogi.6 b/doc/xshogi.6
index 1dfc857..717a0e0 100644
--- a/doc/xshogi.6
+++ b/doc/xshogi.6
@@ -159,11 +159,13 @@ to get all his pieces protected in the promotion zone.
 The following command line options also correspond to X resources
 that you can set in your
 .IR \&.Xdefaults
+or
+.IR \&.Xresources
 file.
 .TP 8
 .B standard Xt options
 .IR xshogi
-accepts standard Xt options like -display, -geometry, and -iconic.
+accepts standard Xt options like -display, -geometry, -iconic, -bg etc.
 .TP 8
 .B -tc or -timeControl minutes[:seconds]
 Amount of time for a set of moves determined by
@@ -300,36 +302,18 @@ The default is False.  The
 resource specifies what font to use.  
 .TP 8
 .B -mono or -monoMode "(True | False)"
-Determines whether
-.IR xshogi
-displays its pieces and squares with two colors or four.
-You shouldn't have to specify monochrome.
+Monochrome mode.  You shouldn't have to specify monochrome.
 .IR xshogi
 will determine if this is necessary.
 .TP 8
-.B -wpc or -blackPieceColor color
-Color specification for black pieces
-suitable for
-.IR XParseColor (3X11).
-Default: #FFFFCC.
-These colors look good on a DEC workstation.
-If you need different colors, try using the
-.IR xcolors
-application.  Source for
-.IR xcolors
-can be found in the X11/R4 contrib directory.
-.TP 8
-.B -bpc or -whitePieceColor color
-Same for white pieces.
-Default: #202020.
-.TP 8
-.B -lsc or -lightSquareColor color
-Same for light squares.
-Default: #C8C365.
-.TP 8
-.B -dsc or -darkSquareColor color
-Same for dark squares.
-Default: #77A26D.
+.B -pc or -pieceColor color
+Color specification for pieces suitable for
+.IR XParseColor().
+Default: #FFFFD7.
+.TP 8
+.B -sc or -squareColor color
+Same for squares.
+Default: #EBDFB0.
 .TP 8
 .B -wps or -westernPieceSet (True | False)
 Choose the Western style piece set.
@@ -416,13 +400,10 @@ XShogi*coordFont:    helvetica_10
 If you are using a grayscale monitor, try setting the colors to:
 .sp 1
 .br
-XShogi*blackPieceColor:     gray100
+XShogi*pieceColor:     gray100
 .br
-XShogi*whitePieceColor:     gray0
+XShogi*squareColor:    gray60
 .br
-XShogi*lightSquareColor:    gray60
-.br
-XShogi*darkSquareColor:     gray40
 .SH COMMAND BUTTONS AND KEYS
 .TP 8
 .B Quit
@@ -524,13 +505,13 @@ clear the board.  You can set the side to play next
 by clicking on the Black or White indicator at the top of the screen.
 .TP 8
 .B Challenge
-allows to make a two display game between two human players.
+allows you to make a two display game between two human players.
 Enter the display you want to connect to. If you are allowed to
 connect, a new board is displayed at the remote display.
 Challenge mode can only be stopped by pressing "quit".
 .TP 8
 .B Select Level
-allows to reset the clocks for both players.
+allows you to reset the clocks for both players.
 Enter the number of moves and the number of minutes in which the
 moves should be done.
 .TP 8
@@ -565,8 +546,10 @@ Original authors of XBoard:  Chris Sears and Dan Sears.
 Enhancements for XBoard (Version 2.0):  Tim Mann.
 .LP
 Conversion to XShogi (Version 1.1):  Matthias Mutz.
+.LP
+Current maintainer: Mike Vanier.
 .SH COPYRIGHT
-XShogi borrows its piece bitmaps from CRANES Shogi.
+XShogi borrows some of its piece bitmaps from CRANES Shogi.
 .LP
 Copyright 1991 by Digital Equipment Corporation, Maynard, Massachusetts.
 Enhancements Copyright 1992 Free Software Foundation, Inc.
diff --git a/gnushogi/Makefile.in b/gnushogi/Makefile.in
index 55b7aea..1fb7f4f 100644
--- a/gnushogi/Makefile.in
+++ b/gnushogi/Makefile.in
@@ -142,6 +142,8 @@ pat2inc:
 sizetest:
 	$(CC) $(CFLAGS) -o sizetest sizetest.o $(LIBS)
 
+profile:
+	$(MAKE) -f Makefile.profile gnushogi
 
 #
 # Object files.
diff --git a/gnushogi/Makefile.profile.in b/gnushogi/Makefile.profile.in
new file mode 100644
index 0000000..3bc0092
--- /dev/null
+++ b/gnushogi/Makefile.profile.in
@@ -0,0 +1,289 @@
+#
+# Makefile for GNU Shogi
+#
+# Copyright (c) 1993, 1994 Matthias Mutz
+# Copyright (c) 1998, 1999 Michael Vanier and the Free Software Foundation
+#
+# GNU Shogi is based on GNU Chess
+# Copyright (c) 1992 Free Software Foundation
+#
+# This file is part of GNU Shogi.
+#
+# GNU Shogi is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either ../version 1, or (at your option)
+# any later ../version.
+#
+# GNU Shogi is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with GNU Shogi; see the file COPYING.  If not, write to
+# the Free Software Foundation, 675 Mass Ave, Cambridge, MA 02139, USA.
+#
+
+#
+# gnushogi   is GNU shogi, for raw text, curses, or x output.
+# pat2inc    converts pattern textfile to "pattern.inc" include file.
+# sizetest   shows the memory usage of the main data structures.
+#
+
+SHELL           = /bin/sh
+VERS            = 1.3
+INSTALL         = @INSTALL@
+INSTALL_DATA    = @INSTALL_DATA@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+ROOT            = ..
+
+
+# Installation directory.
+prefix  =   @prefix@
+
+# Where the binaries live.
+BINDIR  =   $(prefix)/bin
+
+# Where the language description, the book, and the 
+# persistent hashtable live.
+LIBDIR  =   $(prefix)/lib/gnushogi
+
+# Where the man page goes.
+MANDIR  = $(prefix)/man/man6
+
+# Where the info file goes.
+INFODIR = $(prefix)/info
+
+# For _pow external 
+LIBS    = -lm
+
+# Display routines.
+LCURSES =   -lcurses -ltermcap
+
+
+#
+# C compiler and compiler options.
+#
+
+CC          = @CC@
+CWARNINGS   = @WARNINGS@
+CEXTRAFLAGS = @CEXTRAFLAGS2@
+CFLAGS      = -g $(CEXTRAFLAGS) $(CWARNINGS) -I..
+
+
+# The hashfile is a record of positions seen. It is used by
+# GNU Shogi to avoid making the same mistakes, a form of learning.
+
+HASH       = -DHASHFILE=\"$(LIBDIR)/gnushogi.hsh\"
+
+
+# The "book" is a record of the first few moves, for playing good
+# moves easily and quickly, saving time, and irritating the human
+# opponent.
+
+TEXTBOOK   = -DBOOK=\"$(LIBDIR)/gnushogi.tbk\"
+BINBOOK    = -DBINBOOK=\"$(LIBDIR)/gnushogi.bbk\"
+
+
+# The language file describes capabilities of the program.  It may
+# be useful for customizing gnushogi for non-English-speaking players.
+
+LANGF      = -DLANGFILE=\"../misc/gnushogi.lng\"
+
+
+# The pattern file contains various opening patterns. The program tries to
+# obtain such a pattern in the opening stage. Sequences of opening
+# patterns may be described in order to support the correct order of moves.
+
+PATTERN    = -DPATTERNFILE=\"../misc/gnushogi.pat\"
+
+
+all:
+	@echo No target specified.
+
+
+#
+# Source files.
+#
+
+COMMONFILES = \
+                attacks.o      \
+                book.o         \
+                commondsp.o    \
+                cursesdsp.o    \
+                dspwrappers.o  \
+                eval.o         \
+                genmove.o      \
+                globals.o      \
+                init.o         \
+                pattern.o      \
+                rawdsp.o       \
+                search.o       \
+                sysdeps.o      \
+                tcontrl.o      \
+                util.o
+
+GNUSHOGI_FILES  = $(COMMONFILES) main.o      
+
+
+PAT2INCFILES    = $(COMMONFILES) makepattern.o pat2inc.o
+
+
+#
+# Primary targets.
+#
+
+gnushogi:
+	$(CC) $(CFLAGS) -o gnushogi $(GNUSHOGI_FILES) $(LCURSES) $(LIBS)
+
+pat2inc:
+	$(CC) $(CFLAGS) -o pat2inc $(PAT2INCFILES) $(LCURSES) $(LIBS)
+
+sizetest:
+	$(CC) $(CFLAGS) -o sizetest sizetest.o $(LIBS)
+
+
+#
+# Object files.
+#
+
+# Common files.
+
+attacks.o:
+	$(CC) $(CFLAGS) -c attacks.c
+
+book.o:
+	$(CC) $(CFLAGS) $(TEXTBOOK) $(BINBOOK) -c book.c 
+
+commondsp.o:
+	$(CC) $(CFLAGS) -c commondsp.c 
+
+cursesdsp.o:
+	$(CC) $(CFLAGS) -c cursesdsp.c
+
+dspwrappers.o:
+	$(CC) $(CFLAGS) -c dspwrappers.c
+
+genmove.o:
+	$(CC) $(CFLAGS) -c genmove.c
+
+globals.o:
+	$(CC) $(CFLAGS) -c globals.c
+
+eval.o:
+	$(CC) $(CFLAGS) -c eval.c
+
+init.o:
+	$(CC)  $(CFLAGS) $(LANGF) -c init.c
+
+main.o:
+	$(CC) $(CFLAGS) $(BINBOOK) -c main.c
+
+# To create "pattern.inc" with "pat2inc", the external
+# pattern textfile must be used.
+
+makepattern.o:
+	$(CC) $(CFLAGS) $(PATTERN) -c makepattern.c
+
+pattern.o:
+	$(CC)  $(CFLAGS) -c pattern.c
+
+rawdsp.o:
+	$(CC) $(CFLAGS) -c rawdsp.c 
+
+search.o:
+	$(CC) $(CFLAGS) -c search.c
+
+sysdeps.o:
+	$(CC) $(CFLAGS) -c sysdeps.c 
+
+tcontrl.o:
+	$(CC) $(CFLAGS) -c tcontrl.c
+
+util.o:
+	$(CC) $(CFLAGS) -c util.c
+
+
+# Files specific to particular targets.
+
+pat2inc.o:
+	$(CC) $(CFLAGS) $(LANGF) $(BINBOOK) $(PATTERN) -c pat2inc.c
+
+sizetest.o:
+	$(CC) $(CFLAGS) -c sizetest.c
+
+
+#
+# Other targets.
+#
+
+gnushogi.bbk: 
+	@if [ -f ./gnushogi.bbk ]; then rm ./gnushogi.bbk; fi
+	echo quit > test
+	cat ../misc/gnushogi.tbk > _tmp_t
+	cat test | ./gnushogi -R -b _tmp_t -B ./gnushogi.bbk -S 8000 -P 40 3 0
+	rm test _tmp_t
+	@echo
+
+
+#
+# Installation.
+#
+
+install: gnushogi
+	strip gnushogi
+	$(INSTALL_PROGRAM) -d $(BINDIR)
+	$(INSTALL_PROGRAM) -d $(LIBDIR)
+	$(INSTALL_PROGRAM) -d $(MANDIR)
+	$(INSTALL_PROGRAM) -d $(INFODIR)
+	$(INSTALL_PROGRAM) gnushogi $(BINDIR)
+	$(INSTALL_DATA)    $(ROOT)/doc/gnushogi.6     $(MANDIR)
+	$(INSTALL_DATA)    $(ROOT)/doc/gnushogi.info* $(INFODIR)
+	$(INSTALL_DATA)    gnushogi.bbk $(LIBDIR)/gnushogi.bbk
+
+
+#
+# Cleanup.
+#
+
+CLEANFILES = *.o gnushogi sizetest pat2inc CLp* *.bbk
+
+clean: 
+	@for file in $(CLEANFILES); do \
+	if [ -f $$file ]; then rm $$file; fi; \
+	done
+	@-find . -name gmon.out  -exec rm {} \;
+	@-find . -name '*.bb'    -exec rm {} \;
+	@-find . -name '*.bbg'   -exec rm {} \;
+	@-find . -name '*.da'    -exec rm {} \;
+	@-find . -name '*.gcov'  -exec rm {} \;
+
+
+#
+# Dependencies.
+#
+
+gnushogi:   $(GNUSHOGI_FILES)
+pat2inc:       $(PAT2INCFILES)
+sizetest:      sizetest.o 
+attacks.o:     attacks.c gnushogi.h ../version.h
+book.o:        book.c gnushogi.h ../version.h 
+commondsp.o:   commondsp.c gnushogi.h ../version.h
+cursesdsp.o:   cursesdsp.c gnushogi.h ../version.h
+dspwrappers.o: dspwrappers.c gnushogi.h ../version.h
+genmove.o:     genmove.c gnushogi.h ../version.h
+globals.o:     globals.c gnushogi.h ../version.h
+eval.o:        eval.c eval.h gnushogi.h ../version.h pattern.h
+init.o:        init.c gnushogi.h ../version.h pattern.h
+main.o:        main.c gnushogi.h ../version.h
+makepattern.o: pattern.c gnushogi.h pattern.h
+pattern.o:     pattern.c gnushogi.h pattern.h pattern.inc
+rawdsp.o:      rawdsp.c gnushogi.h ../version.h
+search.o:      search.c gnushogi.h ../version.h 
+sysdeps.o:     sysdeps.c gnushogi.h ../version.h
+tcontrl.o:     tcontrl.c gnushogi.h ../version.h 
+util.o:        util.c gnushogi.h ../version.h
+pat2inc.o:     pat2inc.c pattern.h gnushogi.h 
+sizetest.o:    sizetest.c gnushogi.h eval.h
+gnushogi.bbk:  gnushogi
+
diff --git a/gnushogi/TRANS.TBL b/gnushogi/TRANS.TBL
deleted file mode 100644
index 17a8a33..0000000
--- a/gnushogi/TRANS.TBL
+++ /dev/null
@@ -1,30 +0,0 @@
-F ATTACKS.C;1                       	attacks.c
-F BOOK.C;1                          	book.c
-F BOOK.H;1                          	book.h
-F COMMONDS.C;1                      	commondsp.c
-F CURSESDS.C;1                      	cursesdsp.c
-F CURSESDS.H;1                      	cursesdsp.h
-F DEBUG.H;1                         	debug.h
-F DSPWRAPP.C;1                      	dspwrappers.c
-F DSPWRAPP.H;1                      	dspwrappers.h
-F EVAL.C;1                          	eval.c
-F EVAL.H;1                          	eval.h
-F GENMOVE.C;1                       	genmove.c
-F GLOBALS.C;1                       	globals.c
-F GNUSHOGI.H;1                      	gnushogi.h
-F INIT.C;1                          	init.c
-F MAIN.C;1                          	main.c
-F MAKEFILE.IN;1                     	Makefile.in
-F MAKEPATT.C;1                      	makepattern.c
-F OPTS.H;1                          	opts.h
-F PAT2INC.C;1                       	pat2inc.c
-F PATTERN.C;1                       	pattern.c
-F PATTERN.H;1                       	pattern.h
-F PATTERN.INC;1                     	pattern.inc
-F RAWDSP.C;1                        	rawdsp.c
-F RAWDSP.H;1                        	rawdsp.h
-F SEARCH.C;1                        	search.c
-F SIZETEST.C;1                      	sizetest.c
-F SYSDEPS.C;1                       	sysdeps.c
-F TCONTRL.C;1                       	tcontrl.c
-F UTIL.C;1                          	util.c
diff --git a/gnushogi/commondsp.c b/gnushogi/commondsp.c
index 73afb95..b5b59d7 100644
--- a/gnushogi/commondsp.c
+++ b/gnushogi/commondsp.c
@@ -31,17 +31,10 @@
  *
  */
 
-#include "gnushogi.h"
-
 #if defined HAVE_GETTIMEOFDAY
 #include 
 #endif
 
-char mvstr[4][6];
-char *InPtr;
-int InBackground = false;
-
-
 #include 
 #include 
 
@@ -50,6 +43,11 @@ int InBackground = false;
 #include 
 
 #include 
+#include "gnushogi.h"
+
+char mvstr[4][6];
+char *InPtr;
+int InBackground = false;
 
 
 #if defined(BOOKTEST)
diff --git a/gnushogi/cursesdsp.c b/gnushogi/cursesdsp.c
index d8d7391..692ffa8 100644
--- a/gnushogi/cursesdsp.c
+++ b/gnushogi/cursesdsp.c
@@ -57,7 +57,7 @@ char *DRAW;
 /* Forward declarations. */
 /* FIXME: change this name, puh-leeze! */
 
-static void UpdateCatched();
+static void UpdateCatched(void);
 
 
 /****************************************
diff --git a/gnushogi/eval.c b/gnushogi/eval.c
index 2cfa756..15509e2 100644
--- a/gnushogi/eval.c
+++ b/gnushogi/eval.c
@@ -1206,7 +1206,7 @@ AttackedPieceValue(short sq, short side)
 
     s = 0;
 
-    ds += (ds = -fv1[HUNGP]);
+	ds = -fv1[HUNGP] * 2;
     hung[c1]++;
     shung[sq]++;
 
diff --git a/gnushogi/genmove.c b/gnushogi/genmove.c
index 6490319..da4fa76 100644
--- a/gnushogi/genmove.c
+++ b/gnushogi/genmove.c
@@ -40,8 +40,6 @@ static short sqking, sqxking;
 static short InCheck = false, GenerateAllMoves = false;
 static short check_determined = false;
 
-static short INCscore = 0;
-
 short deepsearchcut = true;
 short tas = false, taxs = false, ssa = false;
 
diff --git a/gnushogi/globals.c b/gnushogi/globals.c
index 5308ab0..5018e6d 100644
--- a/gnushogi/globals.c
+++ b/gnushogi/globals.c
@@ -77,7 +77,7 @@ short svalue[NO_SQUARES];
 struct flags flag;
 
 short opponent, computer, WAwindow, WBwindow, BAwindow, BBwindow, dither,
-    INCscore;
+    INCscore = 0;
 long ResponseTime = 0, ExtraTime = 0, MaxResponseTime = 0,
     et = 0, et0 = 0, time0 = 0, ft = 0;
 
diff --git a/gnushogi/gnushogi.h b/gnushogi/gnushogi.h
index 37972f4..423a864 100644
--- a/gnushogi/gnushogi.h
+++ b/gnushogi/gnushogi.h
@@ -31,6 +31,9 @@
  *
  */
 
+/* Hack for anal-retentive ANSI-compliance if desired: */
+#define inline
+
 /* FIXME: this file needs to be reorganized in some rational manner. */
 
 #ifndef _GNUSHOGI_H_
@@ -136,6 +139,10 @@ typedef unsigned long  ULONG;
 #  endif
 #endif
 
+#ifdef HAVE_SETLINEBUF
+/* Not necessarily included in  */
+extern void setlinebuf(FILE *__stream);
+#endif
 
 #define RWA_ACC "r+"
 #define WA_ACC "w+"
@@ -217,8 +224,13 @@ extern void movealgbr(short m, char *s);
 #define OPENING_HINT 0x141d /* P7g-7f (20->29) */
 
 /* truth values */
+#ifndef false
 #define false 0
+#endif
+
+#ifndef true
 #define true  1
+#endif
 
 /* colors */
 #define black   0
@@ -1075,7 +1087,6 @@ typedef enum
 } VerifyMove_mode;
 
 extern int VerifyMove(char *s, VerifyMove_mode iop, unsigned short *mv);
-extern void AgeTT();
 extern unsigned short TTage;
 
 #endif /* _GNUSHOGI_H_ */
diff --git a/gnushogi/search.c b/gnushogi/search.c
index 7a89ef7..3d49b8b 100644
--- a/gnushogi/search.c
+++ b/gnushogi/search.c
@@ -32,7 +32,7 @@
 #include "gnushogi.h"
 
 #if !defined OLDTIME && defined HAVE_GETTIMEOFDAY
-double pow();
+double pow(double x, double y);
 #endif
 
 short background = 0;
diff --git a/gnushogi/sysdeps.c b/gnushogi/sysdeps.c
index c88dc43..9752e96 100644
--- a/gnushogi/sysdeps.c
+++ b/gnushogi/sysdeps.c
@@ -42,6 +42,10 @@
 #include 
 #endif
 
+#if HAVE_ERRNO_H
+/* Definition of errno(). */
+#include 
+#endif
 
 /* Forward declarations. */
 
diff --git a/misc/TRANS.TBL b/misc/TRANS.TBL
deleted file mode 100644
index 73d0499..0000000
--- a/misc/TRANS.TBL
+++ /dev/null
@@ -1,3 +0,0 @@
-F GNUSHOGI.LNG;1                    	gnushogi.lng
-F GNUSHOGI.PAT;1                    	gnushogi.pat
-F GNUSHOGI.TBK;1                    	gnushogi.tbk
diff --git a/version.h b/version.h
index be0866c..d55758c 100644
--- a/version.h
+++ b/version.h
@@ -34,7 +34,7 @@
 #ifndef _VERSION_H_
 #define _VERSION_H_
 
-char version[]    = "1.3";
+char version[]    = "1.3.2";
 char patchlevel[] = "0";
 
 #endif /* _VERSION_H_ */
diff --git a/xshogi/BUGS b/xshogi/BUGS
index 6538a3b..0965693 100644
--- a/xshogi/BUGS
+++ b/xshogi/BUGS
@@ -1,7 +1,25 @@
-KNOWN BUGS OR PROBLEMS
-----------------------
+KNOWN BUGS, PROBLEMS, AND MISFEATURES
+-------------------------------------
 
 We only have Western-style piece bitmaps for the small-size board, which is
 not very pleasant to use.  If you try to use the medium- or large-size
-board with Western bitmaps you get garbage bitmaps instead.
+board with Western bitmaps you get garbage bitmaps instead.  The small
+bitmaps are pretty lame, too; we need new Western bitmaps at all sizes.
+
+I'd prefer if the True/False options were changed to -opt e.g.
+-mono or -no_mono (not necessary to have -no_opt in all cases, though).
+
+charPieceColor has no effect; the piece bitmap is *always* black.
+
+I've seen pawns disappear for no obvious reason; they come back on the next
+move.  This is extremely hard to reproduce.  I call this the "disappearing
+pawn bug"; the pawn is still there, but you can't see it.  It almost always
+happens with this opening: P2f P3d P2e B3c and the pawn on 3d disappears.
+
+The coordinate printing is pretty lame.
+
+When you hit "Pause" and then move, the move isn't shown on the screen
+until the computer makes its next move.
+
+
 
diff --git a/xshogi/Makefile.in b/xshogi/Makefile.in
index 20ae0ac..7840912 100644
--- a/xshogi/Makefile.in
+++ b/xshogi/Makefile.in
@@ -61,7 +61,7 @@ CC          = @CC@
 XINCLUDES   = @X_CFLAGS@
 CWARNINGS   = @WARNINGS@
 CEXTRAFLAGS = @CEXTRAFLAGS@
-CFLAGS      = @CFLAGS@ $(XINCLUDES) -I..
+CFLAGS      = @CFLAGS@ $(CEXTRAFLAGS) $(XINCLUDES) -I..
 LIBS        =
 XLIBS       = @X_LIBS@ -lXaw -lXmu -lXt -lXext -lX11
 LDFLAGS     = $(XLIBS) $(LIBS)
diff --git a/xshogi/TRANS.TBL b/xshogi/TRANS.TBL
deleted file mode 100644
index 14678b7..0000000
--- a/xshogi/TRANS.TBL
+++ /dev/null
@@ -1,15 +0,0 @@
-F BITMAPS.H;1                       	bitmaps.h
-F BUGS.;1                           	BUGS
-D EASTERN_                          	eastern_bitmaps
-F MAKEFILE.IN;1                     	Makefile.in
-F NEWS.;1                           	NEWS
-F PARSER.Y;1                        	parser.y
-F README.;1                         	README
-F README.XBO;1                      	README.xboard
-F REMOTEHO.;1                       	REMOTEHOSTS
-F SCANNER.L;1                       	scanner.l
-F SYSDEPS.H;1                       	sysdeps.h
-D WESTERN_                          	western_bitmaps
-F XSHOGI.C;1                        	xshogi.c
-F XSHOGI.H;1                        	xshogi.h
-F XSHOGIFN.H;1                      	xshogifn.h
diff --git a/xshogi/bitmaps.h b/xshogi/bitmaps.h
index 3e01dc7..5209805 100644
--- a/xshogi/bitmaps.h
+++ b/xshogi/bitmaps.h
@@ -13,7 +13,7 @@
  * Modified implementation of ISS mode for XShogi:  Matthias Mutz
  * Current maintainer:                              Michael C. Vanier
  *
- * XShogi borrows its piece bitmaps from CRANES Shogi.
+ * XShogi borrows some of its piece bitmaps from CRANES Shogi.
  *
  * Copyright 1991 by Digital Equipment Corporation, Maynard, Massachusetts.
  * Enhancements Copyright 1992 Free Software Foundation, Inc.
@@ -64,15 +64,15 @@
 #ifndef _BITMAPS_H_
 #define _BITMAPS_H_
 
-/* 
+/*
  * Naming conventions:
  *
  * R  -- reverse orientation
  * P  -- promoted piece
  * W  -- westernized bitmap
- * _m -- medium-sized piece (49x49)
  * _l -- large-sized piece  (64x64)
- * (default is small-sized piece) (32x32)
+ * _m -- medium-sized piece (49x49)
+ * (default name: small-sized piece) (32x32)
  *
  */
 
@@ -83,9 +83,11 @@
 #include "eastern_bitmaps/bigsolidR.xbm"
 #include "eastern_bitmaps/smallsolidR.xbm"
 
-/* 
- * Westernized piece bitmaps.
- * Thanks to Paul Raines for making the "westernized" bitmaps available.
+/*** Westernized piece bitmaps. ***/
+
+/*
+ * Thanks to Bernhard Maerz for the new westernized bitmaps.
+ * These are only available in the large size.
  */
 
 #include "western_bitmaps/kingW.xbm"
@@ -119,7 +121,9 @@
 #include "western_bitmaps/pawnPRW.xbm"
 
 
-/* Eastern piece bitmaps. */
+/*** Eastern piece bitmaps. ***/
+
+/* Small sized bitmaps. */
 
 #include "eastern_bitmaps/king.xbm"
 #include "eastern_bitmaps/rook.xbm"
@@ -147,6 +151,33 @@
 #include "eastern_bitmaps/pawnR.xbm"
 #include "eastern_bitmaps/pawnPR.xbm"
 
+/*
+ * Alternative top bitmaps for eastern pieces (promoted rook and bishop
+ * only).  Thanks to Ken'ichi Nakayama for providing these bitmaps.
+ * Similar comments apply for medium and large-sized bitmaps.
+ */
+
+#if defined(TOP_PART_BITMAPS)
+
+#include "eastern_bitmaps/rookP.top.xbm"
+#include "eastern_bitmaps/bishopP.top.xbm"
+
+#include "eastern_bitmaps/rookPR.top.xbm"
+#include "eastern_bitmaps/bishopPR.top.xbm"
+
+#else   /* !TOP_PART_BITMAPS */
+
+#include "eastern_bitmaps/rookP.xbm"
+#include "eastern_bitmaps/bishopP.xbm"
+
+#include "eastern_bitmaps/rookPR.xbm"
+#include "eastern_bitmaps/bishopPR.xbm"
+
+#endif  /* TOP_PART_BITMAPS  */
+
+
+/*** Medium-sized bitmaps. ***/
+
 #include "eastern_bitmaps/bigsolid_m.xbm"
 #include "eastern_bitmaps/smallsolid_m.xbm"
 #include "eastern_bitmaps/bigsolidR_m.xbm"
@@ -178,6 +209,32 @@
 #include "eastern_bitmaps/pawnR_m.xbm"
 #include "eastern_bitmaps/pawnPR_m.xbm"
 
+#if defined(TOP_PART_BITMAPS)
+
+#include "eastern_bitmaps/rookP_m.top.xbm"
+#include "eastern_bitmaps/bishopP_m.top.xbm"
+
+#include "eastern_bitmaps/rookPR_m.top.xbm"
+#include "eastern_bitmaps/bishopPR_m.top.xbm"
+
+#else   /* !TOP_PART_BITMAPS */
+
+#include "eastern_bitmaps/rookP_m.xbm"
+#include "eastern_bitmaps/bishopP_m.xbm"
+
+#include "eastern_bitmaps/rookPR_m.xbm"
+#include "eastern_bitmaps/bishopPR_m.xbm"
+
+#endif  /* TOP_PART_BITMAPS  */
+
+
+/*** Large bitmaps. ***/
+
+/*
+ * The new large eastern bitmaps were kindly provided by Bernhard Maerz.
+ * Thanks Bernhard!
+ */
+
 #include "eastern_bitmaps/bigsolid_l.xbm"
 #include "eastern_bitmaps/smallsolid_l.xbm"
 #include "eastern_bitmaps/bigsolidR_l.xbm"
@@ -209,25 +266,8 @@
 #include "eastern_bitmaps/pawnR_l.xbm"
 #include "eastern_bitmaps/pawnPR_l.xbm"
 
-/* 
- * Alternative top bitmaps for eastern pieces (promoted rook and bishop
- * only).  Thanks to Ken'ichi Nakayama for providing these bitmaps.  
- */
-
 #if defined(TOP_PART_BITMAPS)
 
-#include "eastern_bitmaps/rookP.top.xbm"
-#include "eastern_bitmaps/bishopP.top.xbm"
-
-#include "eastern_bitmaps/rookPR.top.xbm"
-#include "eastern_bitmaps/bishopPR.top.xbm"
-
-#include "eastern_bitmaps/rookP_m.top.xbm"
-#include "eastern_bitmaps/bishopP_m.top.xbm"
-
-#include "eastern_bitmaps/rookPR_m.top.xbm"
-#include "eastern_bitmaps/bishopPR_m.top.xbm"
-
 #include "eastern_bitmaps/rookP_l.top.xbm"
 #include "eastern_bitmaps/bishopP_l.top.xbm"
 
@@ -236,25 +276,13 @@
 
 #else   /* !TOP_PART_BITMAPS */
 
-#include "eastern_bitmaps/rookP.xbm"
-#include "eastern_bitmaps/bishopP.xbm"
-
-#include "eastern_bitmaps/rookPR.xbm"
-#include "eastern_bitmaps/bishopPR.xbm"
-
-#include "eastern_bitmaps/rookP_m.xbm"
-#include "eastern_bitmaps/bishopP_m.xbm"
-
-#include "eastern_bitmaps/rookPR_m.xbm"
-#include "eastern_bitmaps/bishopPR_m.xbm"
-
 #include "eastern_bitmaps/rookP_l.xbm"
 #include "eastern_bitmaps/bishopP_l.xbm"
 
 #include "eastern_bitmaps/rookPR_l.xbm"
 #include "eastern_bitmaps/bishopPR_l.xbm"
 
-#endif  /* TOP_PART_BITMAPS */
+#endif  /* TOP_PART_BITMAPS  */
 
 #endif /* _BITMAPS_H_ */
 
diff --git a/xshogi/eastern_bitmaps/TRANS.TBL b/xshogi/eastern_bitmaps/TRANS.TBL
deleted file mode 100644
index 3c2b9d4..0000000
--- a/xshogi/eastern_bitmaps/TRANS.TBL
+++ /dev/null
@@ -1,118 +0,0 @@
-F BIGBLANK.000;1                    	bigblankR.xbm
-F BIGBLANK.XBM;1                    	bigblank.xbm
-F BIGLIGHT.XBM;1                    	biglight.xbm
-F BIGSOLID.000;1                    	bigsolid_m.xbm
-F BIGSOLID.001;1                    	bigsolid_l.xbm
-F BIGSOLID.002;1                    	bigsolidR_m.xbm
-F BIGSOLID.003;1                    	bigsolidR_l.xbm
-F BIGSOLID.004;1                    	bigsolidR.xbm
-F BIGSOLID.XBM;1                    	bigsolid.xbm
-F BISHOP.XBM;1                      	bishop.xbm
-F BISHOPP.XBM;1                     	bishopP.xbm
-F BISHOPPR.000;1                    	bishopPR_m.xbm
-F BISHOPPR.001;1                    	bishopPR_m.top.xbm
-F BISHOPPR.002;1                    	bishopPR_l.xbm
-F BISHOPPR.003;1                    	bishopPR_l.top.xbm
-F BISHOPPR.004;1                    	bishopPR.xbm
-F BISHOPPR.XBM;1                    	bishopPR.top.xbm
-F BISHOPP_.000;1                    	bishopP_m.xbm
-F BISHOPP_.001;1                    	bishopP_m.top.xbm
-F BISHOPP_.002;1                    	bishopP_l.xbm
-F BISHOPP_.003;1                    	bishopP_l.top.xbm
-F BISHOPP_.XBM;1                    	bishopP.top.xbm
-F BISHOPR.XBM;1                     	bishopR.xbm
-F BISHOPR_.000;1                    	bishopR_m.xbm
-F BISHOPR_.XBM;1                    	bishopR_l.xbm
-F BISHOP_L.XBM;1                    	bishop_l.xbm
-F BISHOP_M.XBM;1                    	bishop_m.xbm
-F GOLD.XBM;1                        	gold.xbm
-F GOLDR.XBM;1                       	goldR.xbm
-F GOLDR_L.XBM;1                     	goldR_l.xbm
-F GOLDR_M.XBM;1                     	goldR_m.xbm
-F GOLD_L.XBM;1                      	gold_l.xbm
-F GOLD_M.XBM;1                      	gold_m.xbm
-F ICON.XBM;1                        	icon.xbm
-F KING.XBM;1                        	king.xbm
-F KINGR.XBM;1                       	kingR.xbm
-F KINGR_L.XBM;1                     	kingR_l.xbm
-F KINGR_M.XBM;1                     	kingR_m.xbm
-F KING_L.XBM;1                      	king_l.xbm
-F KING_M.XBM;1                      	king_m.xbm
-F KNIGHT.XBM;1                      	knight.xbm
-F KNIGHTP.XBM;1                     	knightP.xbm
-F KNIGHTPR.000;1                    	knightPR_m.xbm
-F KNIGHTPR.001;1                    	knightPR_l.xbm
-F KNIGHTPR.XBM;1                    	knightPR.xbm
-F KNIGHTP_.000;1                    	knightP_m.xbm
-F KNIGHTP_.XBM;1                    	knightP_l.xbm
-F KNIGHTR.XBM;1                     	knightR.xbm
-F KNIGHTR_.000;1                    	knightR_m.xbm
-F KNIGHTR_.XBM;1                    	knightR_l.xbm
-F KNIGHT_L.XBM;1                    	knight_l.xbm
-F KNIGHT_M.XBM;1                    	knight_m.xbm
-F LANCE.XBM;1                       	lance.xbm
-F LANCEP.XBM;1                      	lanceP.xbm
-F LANCEPR.XBM;1                     	lancePR.xbm
-F LANCEPR_.000;1                    	lancePR_m.xbm
-F LANCEPR_.XBM;1                    	lancePR_l.xbm
-F LANCEP_L.XBM;1                    	lanceP_l.xbm
-F LANCEP_M.XBM;1                    	lanceP_m.xbm
-F LANCER.XBM;1                      	lanceR.xbm
-F LANCER_L.XBM;1                    	lanceR_l.xbm
-F LANCER_M.XBM;1                    	lanceR_m.xbm
-F LANCE_L.XBM;1                     	lance_l.xbm
-F LANCE_M.XBM;1                     	lance_m.xbm
-F NONE.XBM;1                        	none.xbm
-F NONE_L.XBM;1                      	none_l.xbm
-F NONE_M.XBM;1                      	none_m.xbm
-F PAWN.XBM;1                        	pawn.xbm
-F PAWNP.XBM;1                       	pawnP.xbm
-F PAWNPR.XBM;1                      	pawnPR.xbm
-F PAWNPR_L.XBM;1                    	pawnPR_l.xbm
-F PAWNPR_M.XBM;1                    	pawnPR_m.xbm
-F PAWNP_L.XBM;1                     	pawnP_l.xbm
-F PAWNP_M.XBM;1                     	pawnP_m.xbm
-F PAWNR.XBM;1                       	pawnR.xbm
-F PAWNR_L.XBM;1                     	pawnR_l.xbm
-F PAWNR_M.XBM;1                     	pawnR_m.xbm
-F PAWN_L.XBM;1                      	pawn_l.xbm
-F PAWN_M.XBM;1                      	pawn_m.xbm
-F ROOK.XBM;1                        	rook.xbm
-F ROOKP.XBM;1                       	rookP.xbm
-F ROOKPR.XBM;1                      	rookPR.xbm
-F ROOKPR_L.000;1                    	rookPR_l.xbm
-F ROOKPR_L.XBM;1                    	rookPR_l.top.xbm
-F ROOKPR_M.000;1                    	rookPR_m.xbm
-F ROOKPR_M.XBM;1                    	rookPR_m.top.xbm
-F ROOKPR_T.XBM;1                    	rookPR.top.xbm
-F ROOKP_L.XBM;1                     	rookP_l.xbm
-F ROOKP_L_.XBM;1                    	rookP_l.top.xbm
-F ROOKP_M.XBM;1                     	rookP_m.xbm
-F ROOKP_M_.XBM;1                    	rookP_m.top.xbm
-F ROOKP_TO.XBM;1                    	rookP.top.xbm
-F ROOKR.XBM;1                       	rookR.xbm
-F ROOKR_L.XBM;1                     	rookR_l.xbm
-F ROOKR_M.XBM;1                     	rookR_m.xbm
-F ROOK_L.XBM;1                      	rook_l.xbm
-F ROOK_M.XBM;1                      	rook_m.xbm
-F SILVER.XBM;1                      	silver.xbm
-F SILVERP.XBM;1                     	silverP.xbm
-F SILVERPR.000;1                    	silverPR_m.xbm
-F SILVERPR.001;1                    	silverPR_l.xbm
-F SILVERPR.XBM;1                    	silverPR.xbm
-F SILVERP_.000;1                    	silverP_m.xbm
-F SILVERP_.XBM;1                    	silverP_l.xbm
-F SILVERR.XBM;1                     	silverR.xbm
-F SILVERR_.000;1                    	silverR_m.xbm
-F SILVERR_.XBM;1                    	silverR_l.xbm
-F SILVER_L.XBM;1                    	silver_l.xbm
-F SILVER_M.XBM;1                    	silver_m.xbm
-F SMALLBLA.000;1                    	smallblankR.xbm
-F SMALLBLA.XBM;1                    	smallblank.xbm
-F SMALLLIG.XBM;1                    	smalllight.xbm
-F SMALLSOL.000;1                    	smallsolid_m.xbm
-F SMALLSOL.001;1                    	smallsolid_l.xbm
-F SMALLSOL.002;1                    	smallsolidR_m.xbm
-F SMALLSOL.003;1                    	smallsolidR_l.xbm
-F SMALLSOL.004;1                    	smallsolidR.xbm
-F SMALLSOL.XBM;1                    	smallsolid.xbm
diff --git a/xshogi/eastern_bitmaps/bigblank.xbm b/xshogi/eastern_bitmaps/bigblank.xbm
index e89f7bb..94ec816 100644
--- a/xshogi/eastern_bitmaps/bigblank.xbm
+++ b/xshogi/eastern_bitmaps/bigblank.xbm
@@ -1,6 +1,6 @@
 #define bigblank_width 32
 #define bigblank_height 32
-static char bigblank_bits[] = {
+static unsigned char bigblank_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0xe0,0x03,0x00,0x00,0x18,0x0c,0x00,0x00,0x06,0x30,
  0x00,0x80,0x01,0xc0,0x00,0x40,0x00,0x00,0x01,0x40,0x00,0x00,0x03,0x40,0x00,
  0x00,0x03,0x40,0x00,0x00,0x03,0x20,0x00,0x00,0x02,0x20,0x00,0x00,0x06,0x20,
diff --git a/xshogi/eastern_bitmaps/bigblankR.xbm b/xshogi/eastern_bitmaps/bigblankR.xbm
index 50dfbb3..2cd7d01 100644
--- a/xshogi/eastern_bitmaps/bigblankR.xbm
+++ b/xshogi/eastern_bitmaps/bigblankR.xbm
@@ -1,6 +1,6 @@
 #define bigblankR_width 32
 #define bigblankR_height 32
-static char bigblankR_bits[] = {
+static unsigned char bigblankR_bits[] = {
  0xff,0xff,0xff,0x7f,0x01,0x00,0x00,0xc0,0x01,0x00,0x00,0xc0,0x01,0x00,0x00,
  0xc0,0x01,0x00,0x00,0xc0,0x02,0x00,0x00,0x60,0x02,0x00,0x00,0x60,0x02,0x00,
  0x00,0x60,0x02,0x00,0x00,0x60,0x04,0x00,0x00,0x30,0x04,0x00,0x00,0x30,0x04,
diff --git a/xshogi/eastern_bitmaps/biglight.xbm b/xshogi/eastern_bitmaps/biglight.xbm
index 7d273dd..550c535 100644
--- a/xshogi/eastern_bitmaps/biglight.xbm
+++ b/xshogi/eastern_bitmaps/biglight.xbm
@@ -2,7 +2,7 @@
 #define biglight_height 32
 #define biglight_x_hot -1
 #define biglight_y_hot -1
-static char biglight_bits[] = {
+static unsigned char biglight_bits[] = {
    0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x03, 0x00, 0x00, 0x18, 0x00, 0x00,
    0x00, 0x06, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00,
    0x40, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x00,
diff --git a/xshogi/eastern_bitmaps/bigsolid.xbm b/xshogi/eastern_bitmaps/bigsolid.xbm
index d4ec248..a97ed30 100644
--- a/xshogi/eastern_bitmaps/bigsolid.xbm
+++ b/xshogi/eastern_bitmaps/bigsolid.xbm
@@ -1,6 +1,6 @@
 #define bigsolid_width 32
 #define bigsolid_height 32
-static char bigsolid_bits[] = {
+static unsigned char bigsolid_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0xf0,0x07,0x00,0x00,0xfc,0x1f,
  0x00,0x00,0xff,0x7f,0x00,0xc0,0xff,0xff,0x01,0xe0,0xff,0xff,0x03,0xe0,0xff,
  0xff,0x07,0xe0,0xff,0xff,0x07,0xe0,0xff,0xff,0x07,0xf0,0xff,0xff,0x07,0xf0,
diff --git a/xshogi/eastern_bitmaps/bigsolidR.xbm b/xshogi/eastern_bitmaps/bigsolidR.xbm
index 651fa03..4eb83a7 100644
--- a/xshogi/eastern_bitmaps/bigsolidR.xbm
+++ b/xshogi/eastern_bitmaps/bigsolidR.xbm
@@ -1,6 +1,6 @@
 #define bigsolidR_width 32
 #define bigsolidR_height 32
-static char bigsolidR_bits[] = {
+static unsigned char bigsolidR_bits[] = {
  0xff,0xff,0xff,0x7f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
  0xff,0xff,0xff,0xff,0xff,0xfe,0xff,0xff,0x7f,0xfe,0xff,0xff,0x7f,0xfe,0xff,
  0xff,0x7f,0xfe,0xff,0xff,0x7f,0xfc,0xff,0xff,0x3f,0xfc,0xff,0xff,0x3f,0xfc,
diff --git a/xshogi/eastern_bitmaps/bigsolidR_l.xbm b/xshogi/eastern_bitmaps/bigsolidR_l.xbm
index 2dfe8ae..805f712 100644
--- a/xshogi/eastern_bitmaps/bigsolidR_l.xbm
+++ b/xshogi/eastern_bitmaps/bigsolidR_l.xbm
@@ -1,38 +1,46 @@
 #define bigsolidR_l_width 64
 #define bigsolidR_l_height 64
-static char bigsolidR_l_bits[] = {
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0xff,0xff,0xff,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xfc,0xff,
- 0xff,0xff,0xff,0xff,0xff,0x3f,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xfc,
- 0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,
- 0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x3f,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xf0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,
- 0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,
- 0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xc0,0xff,
- 0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,
- 0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x03,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,
- 0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,
- 0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,
- 0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,
- 0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,
- 0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,
- 0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,
- 0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xf0,0xff,0xff,0xff,
- 0xff,0x0f,0x00,0x00,0xf0,0xff,0xff,0xff,0xff,0x0f,0x00,0x00,0x00,0xff,0xff,
- 0xff,0xff,0x03,0x00,0x00,0x00,0xff,0xff,0xff,0xff,0x03,0x00,0x00,0x00,0xf0,
- 0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0xf0,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,
- 0x00,0xff,0xff,0x03,0x00,0x00,0x00,0x00,0x00,0xff,0xff,0x03,0x00,0x00,0x00,
- 0x00,0x00,0xf0,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x3f,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char bigsolidR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0xfe, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x1f, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0xfc, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x7f, 0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f,
+  0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0xfc, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x7f, 0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f,
+  0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0xfc, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x3f, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0xf8, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x3f, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0xf8, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x1f, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x1f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x0f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x0f, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f,
+  0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x07, 0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03,
+  0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x03, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01,
+  0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0x00, 0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0xf8, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0x00, 0xf0, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00,
+  0x00, 0xe0, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00, 0x00, 0x80, 0xff, 0xff,
+  0xff, 0xff, 0x00, 0x00, 0x00, 0x00, 0xf8, 0xff, 0xff, 0x0f, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0xff, 0xff, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfc,
+  0x1f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/bigsolidR_m.xbm b/xshogi/eastern_bitmaps/bigsolidR_m.xbm
index fca1013..eed0abd 100644
--- a/xshogi/eastern_bitmaps/bigsolidR_m.xbm
+++ b/xshogi/eastern_bitmaps/bigsolidR_m.xbm
@@ -1,6 +1,6 @@
 #define bigsolidR_m_width 49
 #define bigsolidR_m_height 49
-static char bigsolidR_m_bits[] = {
+static unsigned char bigsolidR_m_bits[] = {
  0xff,0xff,0xff,0xff,0xff,0xff,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0xfe,0xff,
  0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
  0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
diff --git a/xshogi/eastern_bitmaps/bigsolid_l.xbm b/xshogi/eastern_bitmaps/bigsolid_l.xbm
index c38b73d..43c4554 100644
--- a/xshogi/eastern_bitmaps/bigsolid_l.xbm
+++ b/xshogi/eastern_bitmaps/bigsolid_l.xbm
@@ -1,38 +1,46 @@
 #define bigsolid_l_width 64
 #define bigsolid_l_height 64
-static char bigsolid_l_bits[] = {
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,0xff,0x3f,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0xff,0xff,0x03,0x00,0x00,0x00,0x00,0xf0,0xff,
- 0xff,0x03,0x00,0x00,0x00,0x00,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0xff,
- 0xff,0xff,0x3f,0x00,0x00,0x00,0xf0,0xff,0xff,0xff,0xff,0x03,0x00,0x00,0xf0,
- 0xff,0xff,0xff,0xff,0x03,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x0f,0x00,0x00,
- 0xfc,0xff,0xff,0xff,0xff,0x0f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,
- 0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,
- 0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,
- 0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xff,0xff,0xff,0xff,
- 0xff,0x3f,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xff,0xff,0xff,
- 0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,
- 0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,
- 0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0xc0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x00,
- 0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xf0,0xff,0xff,0xff,
- 0xff,0xff,0xff,0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,
- 0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,
- 0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,
- 0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x3f,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xfc,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x3f,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xfc,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x3f,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xff,0xff,0xff,0xff,
- 0xff,0xff,0xff,0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xff,0xff,0xff,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xfc,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff};
+static unsigned char bigsolid_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0xfe, 0x3f, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0xff,
+  0xff, 0x03, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0x3f, 0x00, 0x00,
+  0x00, 0xe0, 0xff, 0xff, 0xff, 0xff, 0x03, 0x00, 0x00, 0xfc, 0xff, 0xff,
+  0xff, 0xff, 0x1f, 0x00, 0x00, 0xfc, 0xff, 0xff, 0xff, 0xff, 0x1f, 0x00,
+  0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00, 0x00, 0xfe, 0xff, 0xff,
+  0xff, 0xff, 0x7f, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00,
+  0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00, 0x00, 0xfe, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03,
+  0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03,
+  0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x0f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x0f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x1f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0xf8, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x1f, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0xf8, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x3f, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0xfc, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x3f, 0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0xfc, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x7f, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x7f, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/bigsolid_m.xbm b/xshogi/eastern_bitmaps/bigsolid_m.xbm
index cb104c6..97c3ede 100644
--- a/xshogi/eastern_bitmaps/bigsolid_m.xbm
+++ b/xshogi/eastern_bitmaps/bigsolid_m.xbm
@@ -1,6 +1,6 @@
 #define bigsolid_m_width 49
 #define bigsolid_m_height 49
-static char bigsolid_m_bits[] = {
+static unsigned char bigsolid_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,
  0xf8,0x3f,0x00,0x00,0xfe,0x00,0x00,0xff,0xff,0x01,0x00,0xfe,0x00,0x00,0xff,
diff --git a/xshogi/eastern_bitmaps/bishop.xbm b/xshogi/eastern_bitmaps/bishop.xbm
index 3c8198e..db3b7c3 100644
--- a/xshogi/eastern_bitmaps/bishop.xbm
+++ b/xshogi/eastern_bitmaps/bishop.xbm
@@ -1,6 +1,6 @@
 #define bishop_width 32
 #define bishop_height 32
-static char bishop_bits[] = {
+static unsigned char bishop_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,
  0x00,0x00,0x03,0x60,0x00,0xc0,0x00,0x80,0x01,0x20,0xe0,0x03,0x02,0x20,0x18,
  0x03,0x06,0x20,0x80,0x01,0x06,0x20,0xfc,0x0f,0x06,0x10,0xcc,0x0c,0x04,0x10,
diff --git a/xshogi/eastern_bitmaps/bishopP.top.xbm b/xshogi/eastern_bitmaps/bishopP.top.xbm
index d48e8b6..03fe3a0 100644
--- a/xshogi/eastern_bitmaps/bishopP.top.xbm
+++ b/xshogi/eastern_bitmaps/bishopP.top.xbm
@@ -1,6 +1,6 @@
 #define bishopP_width 32
 #define bishopP_height 32
-static char bishopP_bits[] = {
+static unsigned char bishopP_bits[] = {
    0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
    0x00, 0x0c, 0x18, 0x00, 0x00, 0x03, 0x60, 0x00, 0xc0, 0x00, 0x80, 0x01,
    0x20, 0x00, 0x00, 0x02, 0x20, 0x00, 0x00, 0x06, 0x20, 0x00, 0x00, 0x06,
diff --git a/xshogi/eastern_bitmaps/bishopP.xbm b/xshogi/eastern_bitmaps/bishopP.xbm
index 8a6118d..1877296 100644
--- a/xshogi/eastern_bitmaps/bishopP.xbm
+++ b/xshogi/eastern_bitmaps/bishopP.xbm
@@ -1,6 +1,6 @@
 #define bishopP_width 32
 #define bishopP_height 32
-static char bishopP_bits[] = {
+static unsigned char bishopP_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,
  0x00,0x00,0x03,0x60,0x00,0xc0,0x00,0x80,0x01,0x20,0x00,0x00,0x02,0x20,0x08,
  0x03,0x06,0x20,0x7e,0x1f,0x06,0x20,0x34,0x03,0x06,0x10,0x7e,0x3f,0x04,0x10,
diff --git a/xshogi/eastern_bitmaps/bishopPR.top.xbm b/xshogi/eastern_bitmaps/bishopPR.top.xbm
index c71f6bd..598d676 100644
--- a/xshogi/eastern_bitmaps/bishopPR.top.xbm
+++ b/xshogi/eastern_bitmaps/bishopPR.top.xbm
@@ -2,7 +2,7 @@
 #define bishopPR_height 32
 #define bishopPR_x_hot -1
 #define bishopPR_y_hot -1
-static char bishopPR_bits[] = {
+static unsigned char bishopPR_bits[] = {
    0xff, 0xff, 0xff, 0x7f, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0,
    0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x02, 0x00, 0x00, 0xc0,
    0x02, 0x18, 0x00, 0x60, 0x02, 0xbc, 0xcd, 0x60, 0x02, 0x8c, 0xcd, 0x60,
diff --git a/xshogi/eastern_bitmaps/bishopPR.xbm b/xshogi/eastern_bitmaps/bishopPR.xbm
index 4f4f4c1..7e97a61 100644
--- a/xshogi/eastern_bitmaps/bishopPR.xbm
+++ b/xshogi/eastern_bitmaps/bishopPR.xbm
@@ -1,6 +1,6 @@
 #define bishopPR_width 32
 #define bishopPR_height 32
-static char bishopPR_bits[] = {
+static unsigned char bishopPR_bits[] = {
  0xff,0xff,0xff,0x7f,0x01,0x00,0x00,0xc0,0x01,0x00,0x00,0xc0,0x01,0xd4,0x36,
  0xc0,0x01,0x06,0x00,0xc0,0x02,0xfe,0x1f,0x60,0x02,0x80,0x19,0x60,0x02,0xf8,
  0x1f,0x60,0x02,0x80,0x19,0x60,0x04,0xf8,0x1f,0x30,0x04,0x80,0x19,0x30,0x04,
diff --git a/xshogi/eastern_bitmaps/bishopPR_l.top.xbm b/xshogi/eastern_bitmaps/bishopPR_l.top.xbm
index ad1a6ab..f568b7c 100644
--- a/xshogi/eastern_bitmaps/bishopPR_l.top.xbm
+++ b/xshogi/eastern_bitmaps/bishopPR_l.top.xbm
@@ -1,6 +1,6 @@
 #define bishopPR_l_width 64
 #define bishopPR_l_height 64
-static char bishopPR_l_bits[] = {
+static unsigned char bishopPR_l_bits[] = {
    0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0xff, 0xff, 0xff, 0xff,
    0xff, 0xff, 0xff, 0x3f, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
    0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00, 0x00, 0x00,
diff --git a/xshogi/eastern_bitmaps/bishopPR_l.xbm b/xshogi/eastern_bitmaps/bishopPR_l.xbm
index 436f5f0..6071589 100644
--- a/xshogi/eastern_bitmaps/bishopPR_l.xbm
+++ b/xshogi/eastern_bitmaps/bishopPR_l.xbm
@@ -1,38 +1,46 @@
 #define bishopPR_l_width 64
 #define bishopPR_l_height 64
-static char bishopPR_l_bits[] = {
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0xc0,0xcc,0xf3,0x3c,0x00,0xc0,0x0f,0x00,0xc0,
- 0xcc,0xf3,0x3c,0x00,0xc0,0x0c,0x00,0xf0,0x00,0x00,0x00,0x00,0xc0,0x0c,0x00,
- 0xf0,0x00,0x00,0x00,0x00,0xc0,0x3c,0x00,0xf0,0xff,0xff,0x0f,0x00,0x30,0x3c,
- 0x00,0xf0,0xff,0xff,0x0f,0x00,0x30,0x3c,0x00,0x00,0x00,0x0f,0x0f,0x00,0x30,
- 0x3c,0x00,0x00,0x00,0x0f,0x0f,0x00,0x30,0x3c,0x00,0x00,0xff,0xff,0x0f,0x00,
- 0x30,0x3c,0x00,0x00,0xff,0xff,0x0f,0x00,0x30,0x30,0x00,0x00,0x00,0x0f,0x0f,
- 0x00,0x30,0x30,0x00,0x00,0x00,0x0f,0x0f,0x00,0x30,0xf0,0x00,0x00,0xff,0xff,
- 0x0f,0x00,0x0c,0xf0,0x00,0x00,0xff,0xff,0x0f,0x00,0x0c,0xf0,0x00,0x00,0x00,
- 0x0f,0x0f,0x00,0x0c,0xf0,0x00,0x00,0x00,0x0f,0x0f,0x00,0x0c,0xf0,0x00,0xc0,
- 0xff,0xff,0x0f,0x00,0x0c,0xf0,0x00,0xc0,0xff,0xff,0x0f,0x00,0x0c,0xc0,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0c,0xc0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xc0,
- 0x03,0xf0,0x3f,0x3c,0x30,0x00,0x03,0xc0,0x03,0xf0,0x3f,0x3c,0x30,0x00,0x03,
- 0xc0,0x03,0xf0,0xff,0xfc,0x3f,0x00,0x03,0xc0,0x03,0xf0,0xff,0xfc,0x3f,0x00,
- 0x03,0xc0,0x03,0x00,0xf0,0x3c,0x3c,0x00,0x03,0xc0,0x03,0x00,0xf0,0x3c,0x3c,
- 0x00,0x03,0x00,0x03,0xf0,0xff,0xfc,0x3f,0x00,0x03,0x00,0x03,0xf0,0xff,0xfc,
- 0x3f,0x00,0x03,0x00,0x0f,0x00,0xf0,0x3c,0x3c,0xc0,0x00,0x00,0x0f,0x00,0xf0,
- 0x3c,0x3c,0xc0,0x00,0x00,0x0f,0xf0,0xff,0xfc,0x3f,0xc0,0x00,0x00,0x0f,0xf0,
- 0xff,0xfc,0x3f,0xc0,0x00,0x00,0x0f,0xf0,0x00,0x00,0x00,0xc0,0x00,0x00,0x0f,
- 0xf0,0x00,0x00,0x00,0xc0,0x00,0x00,0x0c,0xf0,0xff,0xfc,0x3f,0xc0,0x00,0x00,
- 0x0c,0xf0,0xff,0xfc,0x3f,0xc0,0x00,0x00,0x3c,0x00,0xf0,0xf0,0x0c,0x30,0x00,
- 0x00,0x3c,0x00,0xf0,0xf0,0x0c,0x30,0x00,0x00,0x3c,0xc0,0xff,0xfc,0x3f,0x30,
- 0x00,0x00,0x3c,0xc0,0xff,0xfc,0x3f,0x30,0x00,0x00,0x3c,0x00,0xf0,0x00,0x03,
- 0x30,0x00,0x00,0x3c,0x00,0xf0,0x00,0x03,0x30,0x00,0x00,0x30,0x00,0x00,0x00,
- 0x00,0x30,0x00,0x00,0x30,0x00,0x00,0x00,0x00,0x30,0x00,0x00,0xc0,0x03,0x00,
- 0x00,0x00,0x0f,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x0f,0x00,0x00,0x00,0x3c,
- 0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char bishopPR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0xc0,
+  0x3f, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0xf0, 0xff, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0xf0, 0x83, 0x03, 0x00, 0x20, 0x44, 0x00, 0x00, 0x38,
+  0x18, 0x07, 0x00, 0x20, 0x48, 0x00, 0x00, 0x1c, 0x38, 0x07, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x0c, 0xf8, 0x03, 0x00, 0x20, 0x48, 0x00, 0x00, 0x0c,
+  0xf0, 0x03, 0x00, 0x20, 0x48, 0x00, 0x00, 0xf8, 0x0f, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0xf8, 0x06, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00,
+  0x1f, 0x00, 0x00, 0x10, 0x88, 0x00, 0x00, 0xc0, 0x0f, 0x00, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0xc0, 0xe1, 0x03, 0x00, 0x10, 0x90, 0x00, 0x00, 0xfe,
+  0xff, 0x03, 0x00, 0x10, 0x90, 0x00, 0x00, 0xfc, 0xbf, 0x03, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0x0c,
+  0x00, 0x00, 0x00, 0x08, 0x10, 0x01, 0x80, 0x0f, 0x30, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0xf0, 0x01, 0x78, 0x00, 0x00, 0x08, 0x20, 0x01, 0x78, 0x00,
+  0xd8, 0x81, 0x00, 0x08, 0x20, 0x01, 0x3c, 0x30, 0x98, 0xe1, 0x00, 0x08,
+  0x20, 0x01, 0x1c, 0x7e, 0x98, 0x71, 0x00, 0x04, 0x20, 0x01, 0xfc, 0x37,
+  0xf8, 0x31, 0x00, 0x04, 0x20, 0x01, 0xf8, 0x30, 0x3c, 0x38, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x16, 0x3f, 0x1c, 0x00, 0x04, 0x20, 0x02, 0x80, 0xf3,
+  0x1b, 0x0e, 0x00, 0x04, 0x40, 0x02, 0xe0, 0xe1, 0x19, 0x0f, 0x00, 0x04,
+  0x40, 0x02, 0xe0, 0xf0, 0xb0, 0x03, 0x00, 0x02, 0x40, 0x02, 0x00, 0x7c,
+  0xc0, 0x01, 0x00, 0x02, 0x40, 0x02, 0x00, 0x7e, 0xf0, 0x1f, 0x00, 0x02,
+  0x40, 0x02, 0x80, 0x6f, 0xf8, 0x7f, 0x00, 0x02, 0x40, 0x04, 0xc0, 0x63,
+  0xfc, 0x03, 0x00, 0x02, 0x80, 0x04, 0xe0, 0x61, 0x3e, 0x00, 0x00, 0x02,
+  0x80, 0x04, 0x70, 0x60, 0x80, 0x03, 0x00, 0x01, 0x80, 0x04, 0x00, 0x70,
+  0xf0, 0x03, 0x00, 0x01, 0x80, 0x04, 0x00, 0x70, 0x70, 0x03, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x70, 0x00, 0x03, 0x00, 0x01, 0x80, 0x08, 0x00, 0x70,
+  0xc0, 0x1f, 0x00, 0x01, 0x80, 0x08, 0x00, 0x70, 0xf0, 0x0f, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0xf0, 0x30, 0x03, 0x00, 0x01, 0x00, 0x09, 0x00, 0xe0,
+  0x00, 0x03, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00, 0x00, 0x06, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/bishopPR_m.top.xbm b/xshogi/eastern_bitmaps/bishopPR_m.top.xbm
index 3760b6d..b553df2 100644
--- a/xshogi/eastern_bitmaps/bishopPR_m.top.xbm
+++ b/xshogi/eastern_bitmaps/bishopPR_m.top.xbm
@@ -1,6 +1,6 @@
 #define bishopPR_m_width 49
 #define bishopPR_m_height 49
-static char bishopPR_m_bits[] = {
+static unsigned char bishopPR_m_bits[] = {
    0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff,
    0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0x00, 0x00,
    0x00, 0x00, 0x80, 0xff, 0x07, 0x00, 0x00, 0x00, 0x00, 0x80, 0xff, 0x07,
diff --git a/xshogi/eastern_bitmaps/bishopPR_m.xbm b/xshogi/eastern_bitmaps/bishopPR_m.xbm
index 9c4eeaf..ae33281 100644
--- a/xshogi/eastern_bitmaps/bishopPR_m.xbm
+++ b/xshogi/eastern_bitmaps/bishopPR_m.xbm
@@ -1,6 +1,6 @@
 #define bishopPR_m_width 49
 #define bishopPR_m_height 49
-static char bishopPR_m_bits[] = {
+static unsigned char bishopPR_m_bits[] = {
  0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,
  0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x00,
  0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/bishopP_l.top.xbm b/xshogi/eastern_bitmaps/bishopP_l.top.xbm
index 96f215c..b39734d 100644
--- a/xshogi/eastern_bitmaps/bishopP_l.top.xbm
+++ b/xshogi/eastern_bitmaps/bishopP_l.top.xbm
@@ -1,6 +1,6 @@
 #define bishopP_l_width 64
 #define bishopP_l_height 64
-static char bishopP_l_bits[] = {
+static unsigned char bishopP_l_bits[] = {
    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
    0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0f,
diff --git a/xshogi/eastern_bitmaps/bishopP_l.xbm b/xshogi/eastern_bitmaps/bishopP_l.xbm
index fb7927c..3d4ea2c 100644
--- a/xshogi/eastern_bitmaps/bishopP_l.xbm
+++ b/xshogi/eastern_bitmaps/bishopP_l.xbm
@@ -1,38 +1,46 @@
 #define bishopP_l_width 64
 #define bishopP_l_height 64
-static char bishopP_l_bits[] = {
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0xf0,0x00,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0x00,0x0f,
- 0x00,0x00,0x3c,0x00,0x00,0x00,0xf0,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0xf0,
- 0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0x0c,0x00,0x00,0x00,0x00,0x0c,0x00,0x00,
- 0x0c,0x00,0x00,0x00,0x00,0x0c,0x00,0x00,0x0c,0xc0,0x00,0x0f,0x00,0x3c,0x00,
- 0x00,0x0c,0xc0,0x00,0x0f,0x00,0x3c,0x00,0x00,0x0c,0xfc,0x3f,0xff,0x03,0x3c,
- 0x00,0x00,0x0c,0xfc,0x3f,0xff,0x03,0x3c,0x00,0x00,0x0c,0x30,0x0f,0x0f,0x00,
- 0x3c,0x00,0x00,0x0c,0x30,0x0f,0x0f,0x00,0x3c,0x00,0x00,0x03,0xfc,0x3f,0xff,
- 0x0f,0x30,0x00,0x00,0x03,0xfc,0x3f,0xff,0x0f,0x30,0x00,0x00,0x03,0x00,0x00,
- 0x00,0x0f,0xf0,0x00,0x00,0x03,0x00,0x00,0x00,0x0f,0xf0,0x00,0x00,0x03,0xfc,
- 0x3f,0xff,0x0f,0xf0,0x00,0x00,0x03,0xfc,0x3f,0xff,0x0f,0xf0,0x00,0x00,0x03,
- 0x3c,0x3c,0x0f,0x00,0xf0,0x00,0x00,0x03,0x3c,0x3c,0x0f,0x00,0xf0,0x00,0xc0,
- 0x00,0xfc,0x3f,0xff,0x0f,0xc0,0x00,0xc0,0x00,0xfc,0x3f,0xff,0x0f,0xc0,0x00,
- 0xc0,0x00,0x3c,0x3c,0x0f,0x00,0xc0,0x03,0xc0,0x00,0x3c,0x3c,0x0f,0x00,0xc0,
- 0x03,0xc0,0x00,0xfc,0x3f,0xff,0x0f,0xc0,0x03,0xc0,0x00,0xfc,0x3f,0xff,0x0f,
- 0xc0,0x03,0xc0,0x00,0x0c,0x3c,0xfc,0x0f,0xc0,0x03,0xc0,0x00,0x0c,0x3c,0xfc,
- 0x0f,0xc0,0x03,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x03,0x30,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x03,0x30,0x00,0xf0,0xff,0xff,0x03,0x00,0x0f,0x30,0x00,0xf0,
- 0xff,0xff,0x03,0x00,0x0f,0x30,0x00,0xf0,0xf0,0x00,0x00,0x00,0x0f,0x30,0x00,
- 0xf0,0xf0,0x00,0x00,0x00,0x0f,0x30,0x00,0xf0,0xff,0xff,0x00,0x00,0x0f,0x30,
- 0x00,0xf0,0xff,0xff,0x00,0x00,0x0f,0x0c,0x00,0xf0,0xf0,0x00,0x00,0x00,0x0c,
- 0x0c,0x00,0xf0,0xf0,0x00,0x00,0x00,0x0c,0x0c,0x00,0xf0,0xff,0xff,0x00,0x00,
- 0x3c,0x0c,0x00,0xf0,0xff,0xff,0x00,0x00,0x3c,0x0c,0x00,0xf0,0xf0,0x00,0x00,
- 0x00,0x3c,0x0c,0x00,0xf0,0xf0,0x00,0x00,0x00,0x3c,0x0c,0x00,0xf0,0xff,0xff,
- 0x0f,0x00,0x3c,0x0c,0x00,0xf0,0xff,0xff,0x0f,0x00,0x3c,0x03,0x00,0x00,0x00,
- 0x00,0x0f,0x00,0x30,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x30,0x03,0x00,0x3c,
- 0xcf,0x33,0x03,0x00,0xf0,0x03,0x00,0x3c,0xcf,0x33,0x03,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xfc,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff};
+static unsigned char bishopP_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00, 0x00, 0x12, 0x60, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x11, 0xc0, 0x00, 0x07, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0xc0, 0x0c, 0x0f, 0x00, 0x80, 0x00, 0x00, 0x09, 0xf0, 0x0f,
+  0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0xf8, 0x03, 0x0e, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0xc0, 0x00, 0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0xc0, 0x0e,
+  0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0xc0, 0x0f, 0x0e, 0x00, 0x00, 0x01,
+  0x80, 0x08, 0xc0, 0x01, 0x06, 0x0e, 0x00, 0x01, 0x80, 0x08, 0x00, 0x7c,
+  0x86, 0x07, 0x00, 0x01, 0x80, 0x04, 0xc0, 0x3f, 0xc6, 0x03, 0x00, 0x01,
+  0x80, 0x04, 0xfe, 0x1f, 0xf6, 0x01, 0x00, 0x01, 0x80, 0x04, 0xf8, 0x0f,
+  0x7e, 0x00, 0x00, 0x01, 0x80, 0x04, 0x80, 0x03, 0x3e, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0xc0, 0x0d, 0x0f, 0x07, 0x00, 0x02, 0x40, 0x04, 0xf0, 0x98,
+  0x87, 0x07, 0x00, 0x02, 0x40, 0x02, 0x70, 0xd8, 0xcf, 0x01, 0x00, 0x02,
+  0x40, 0x02, 0x38, 0xfc, 0x68, 0x00, 0x00, 0x02, 0x40, 0x02, 0x1c, 0x3c,
+  0x0c, 0x1f, 0x00, 0x02, 0x40, 0x02, 0x8c, 0x1f, 0xec, 0x3f, 0x00, 0x02,
+  0x40, 0x02, 0x8e, 0x19, 0x7e, 0x38, 0x00, 0x04, 0x20, 0x02, 0x87, 0x19,
+  0x0c, 0x3c, 0x00, 0x04, 0x20, 0x02, 0x81, 0x1b, 0x00, 0x1e, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0x1e, 0x80, 0x0f, 0x00, 0x04, 0x20, 0x01, 0x00, 0x0c,
+  0xf0, 0x01, 0x00, 0x04, 0x20, 0x01, 0x00, 0x00, 0x30, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x20, 0x01, 0xc0, 0xfd,
+  0x3f, 0x00, 0x00, 0x08, 0x10, 0x01, 0xc0, 0xff, 0x7f, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0xc0, 0x87, 0x03, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0xf0,
+  0x03, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0xf8, 0x00, 0x00, 0x00, 0x08,
+  0x90, 0x00, 0x00, 0x60, 0x1f, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xf0,
+  0x1f, 0x00, 0x00, 0x10, 0x90, 0x00, 0xc0, 0x0f, 0x30, 0x00, 0x00, 0x10,
+  0x88, 0x00, 0xc0, 0x1f, 0x30, 0x00, 0x00, 0x10, 0x48, 0x00, 0xe0, 0x1c,
+  0x38, 0x00, 0x00, 0x10, 0x48, 0x00, 0xe0, 0x18, 0x1c, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0xc0, 0xc1, 0x0f, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0xff,
+  0x0f, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0xfc, 0x03, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/bishopP_m.top.xbm b/xshogi/eastern_bitmaps/bishopP_m.top.xbm
index e4913ec..d2720c5 100644
--- a/xshogi/eastern_bitmaps/bishopP_m.top.xbm
+++ b/xshogi/eastern_bitmaps/bishopP_m.top.xbm
@@ -1,6 +1,6 @@
 #define bishopP_m_width 49
 #define bishopP_m_height 49
-static char bishopP_m_bits[] = {
+static unsigned char bishopP_m_bits[] = {
    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00,
    0x00, 0xfe, 0x00, 0x00, 0xc0, 0x07, 0x00, 0x00, 0xfe, 0x00, 0x00, 0xc0,
    0x07, 0x00, 0x00, 0xfe, 0x00, 0x00, 0x38, 0x38, 0x00, 0x00, 0xfe, 0x00,
diff --git a/xshogi/eastern_bitmaps/bishopP_m.xbm b/xshogi/eastern_bitmaps/bishopP_m.xbm
index 8f68cc9..c459922 100644
--- a/xshogi/eastern_bitmaps/bishopP_m.xbm
+++ b/xshogi/eastern_bitmaps/bishopP_m.xbm
@@ -1,6 +1,6 @@
 #define bishopP_m_width 49
 #define bishopP_m_height 49
-static char bishopP_m_bits[] = {
+static unsigned char bishopP_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,
  0x38,0x38,0x00,0x00,0xfe,0x00,0x00,0x07,0xc0,0x01,0x00,0xfe,0x00,0x00,0x07,
diff --git a/xshogi/eastern_bitmaps/bishopR.xbm b/xshogi/eastern_bitmaps/bishopR.xbm
index 7880a8b..0b47d04 100644
--- a/xshogi/eastern_bitmaps/bishopR.xbm
+++ b/xshogi/eastern_bitmaps/bishopR.xbm
@@ -1,6 +1,6 @@
 #define bishopR_width 32
 #define bishopR_height 32
-static char bishopR_bits[] = {
+static unsigned char bishopR_bits[] = {
  0xff,0xff,0xff,0x7f,0x01,0x00,0x00,0xc0,0x01,0x00,0x00,0xc0,0x01,0x38,0x18,
  0xc0,0x01,0x18,0x18,0xc0,0x02,0x18,0x18,0x60,0x02,0x18,0x58,0x60,0x02,0x18,
  0x38,0x60,0x02,0xfe,0x19,0x60,0x04,0x00,0x48,0x30,0x04,0x00,0x24,0x30,0x04,
diff --git a/xshogi/eastern_bitmaps/bishopR_l.xbm b/xshogi/eastern_bitmaps/bishopR_l.xbm
index 6d160b2..a8f0f96 100644
--- a/xshogi/eastern_bitmaps/bishopR_l.xbm
+++ b/xshogi/eastern_bitmaps/bishopR_l.xbm
@@ -1,38 +1,46 @@
 #define bishopR_l_width 64
 #define bishopR_l_height 64
-static char bishopR_l_bits[] = {
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,
- 0x00,0x00,0x00,0x00,0xc0,0x0c,0x00,0x00,0x3c,0x00,0x0f,0x00,0xc0,0x0c,0x00,
- 0x00,0x3c,0x00,0x0f,0x00,0xc0,0x3c,0x00,0x00,0x0f,0x00,0x0f,0x00,0x30,0x3c,
- 0x00,0x00,0x0f,0x00,0x0f,0x00,0x30,0x3c,0x00,0x00,0x0f,0x00,0x0f,0x00,0x30,
- 0x3c,0x00,0x00,0x0f,0x00,0x0f,0x00,0x30,0x3c,0x00,0x00,0x0f,0x00,0xcf,0x00,
- 0x30,0x3c,0x00,0x00,0x0f,0x00,0xcf,0x00,0x30,0x30,0x00,0x00,0x0f,0x00,0x3f,
- 0x00,0x30,0x30,0x00,0x00,0x0f,0x00,0x3f,0x00,0x30,0xf0,0x00,0xf0,0xff,0x0f,
- 0x0f,0x00,0x0c,0xf0,0x00,0xf0,0xff,0x0f,0x0f,0x00,0x0c,0xf0,0x00,0x00,0x00,
- 0x00,0xc3,0x00,0x0c,0xf0,0x00,0x00,0x00,0x00,0xc3,0x00,0x0c,0xf0,0x00,0x00,
- 0x00,0xc0,0x30,0x00,0x0c,0xf0,0x00,0x00,0x00,0xc0,0x30,0x00,0x0c,0xc0,0x00,
- 0xc0,0xff,0x03,0x0c,0x00,0x0c,0xc0,0x00,0xc0,0xff,0x03,0x0c,0x00,0x0c,0xc0,
- 0x03,0x00,0x00,0x00,0x00,0x00,0x03,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x03,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x03,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,
- 0x03,0xc0,0x03,0x00,0x3f,0x00,0x3c,0x00,0x03,0xc0,0x03,0x00,0x3f,0x00,0x3c,
- 0x00,0x03,0x00,0x03,0x00,0x0f,0x00,0x0f,0x00,0x03,0x00,0x03,0x00,0x0f,0x00,
- 0x0f,0x00,0x03,0x00,0x0f,0x00,0xff,0xff,0x0f,0xc0,0x00,0x00,0x0f,0x00,0xff,
- 0xff,0x0f,0xc0,0x00,0x00,0x0f,0x00,0x0f,0x0f,0x0f,0xc0,0x00,0x00,0x0f,0x00,
- 0x0f,0x0f,0x0f,0xc0,0x00,0x00,0x0f,0x00,0xff,0xff,0x0f,0xc0,0x00,0x00,0x0f,
- 0x00,0xff,0xff,0x0f,0xc0,0x00,0x00,0x0c,0x00,0x0f,0x0f,0x0f,0xc0,0x00,0x00,
- 0x0c,0x00,0x0f,0x0f,0x0f,0xc0,0x00,0x00,0x3c,0x00,0xff,0xff,0x0f,0x30,0x00,
- 0x00,0x3c,0x00,0xff,0xff,0x0f,0x30,0x00,0x00,0x3c,0x00,0xc0,0x03,0x00,0x30,
- 0x00,0x00,0x3c,0x00,0xc0,0x03,0x00,0x30,0x00,0x00,0x3c,0x00,0xf0,0xc0,0x03,
- 0x30,0x00,0x00,0x3c,0x00,0xf0,0xc0,0x03,0x30,0x00,0x00,0x30,0x00,0xf0,0x3f,
- 0x00,0x30,0x00,0x00,0x30,0x00,0xf0,0x3f,0x00,0x30,0x00,0x00,0xc0,0x03,0x00,
- 0x00,0x00,0x0f,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x0f,0x00,0x00,0x00,0x3c,
- 0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char bishopR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0xc0, 0x00, 0x80, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0xe0, 0x03, 0x80, 0x01, 0x00, 0x20, 0x48, 0x00, 0x60, 0x07,
+  0x80, 0x01, 0x00, 0x20, 0x48, 0x00, 0x60, 0x0e, 0x80, 0x01, 0x00, 0x20,
+  0x48, 0x00, 0x60, 0x18, 0x80, 0x01, 0x00, 0x10, 0x48, 0x00, 0x60, 0x30,
+  0x80, 0x19, 0x00, 0x10, 0x88, 0x00, 0x60, 0x00, 0x80, 0x0f, 0x00, 0x10,
+  0x90, 0x00, 0x40, 0x00, 0x00, 0x07, 0x00, 0x10, 0x90, 0x00, 0x40, 0xf0,
+  0x81, 0x03, 0x00, 0x10, 0x90, 0x00, 0xe0, 0xff, 0xc1, 0x01, 0x00, 0x10,
+  0x90, 0x00, 0xf0, 0x1f, 0xe0, 0x18, 0x00, 0x08, 0x90, 0x00, 0x00, 0x00,
+  0x78, 0x0c, 0x00, 0x08, 0x10, 0x01, 0x80, 0xff, 0x78, 0x07, 0x00, 0x08,
+  0x10, 0x01, 0x80, 0x7f, 0xa0, 0x03, 0x00, 0x08, 0x20, 0x01, 0x00, 0x00,
+  0xc0, 0x01, 0x00, 0x08, 0x20, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x08,
+  0x20, 0x01, 0x00, 0x00, 0xc0, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x0c,
+  0x00, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x1c, 0x00, 0x00, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x04, 0x00, 0x00, 0x00, 0x04, 0x20, 0x02, 0x00, 0x0c,
+  0xf8, 0x01, 0x00, 0x04, 0x40, 0x02, 0x00, 0xfc, 0xbf, 0x01, 0x00, 0x04,
+  0x40, 0x02, 0x00, 0xfc, 0x87, 0x01, 0x00, 0x02, 0x40, 0x02, 0x00, 0x0c,
+  0xf6, 0x01, 0x00, 0x02, 0x40, 0x02, 0x00, 0xdc, 0xff, 0x01, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0xfc, 0x87, 0x01, 0x00, 0x02, 0x40, 0x04, 0x00, 0x0c,
+  0xc6, 0x01, 0x00, 0x02, 0x80, 0x04, 0x00, 0x8c, 0xff, 0x00, 0x00, 0x02,
+  0x80, 0x04, 0x00, 0xf8, 0xff, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0x00, 0x04, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x00, 0x07, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x80,
+  0x63, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0xc0, 0x71, 0x00, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0xc0, 0x3f, 0x00, 0x00, 0x01, 0x00, 0x09, 0x00, 0xc0,
+  0x1b, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00, 0x08, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/bishopR_m.xbm b/xshogi/eastern_bitmaps/bishopR_m.xbm
index 13cd5f7..d9948e0 100644
--- a/xshogi/eastern_bitmaps/bishopR_m.xbm
+++ b/xshogi/eastern_bitmaps/bishopR_m.xbm
@@ -1,6 +1,6 @@
 #define bishopR_m_width 49
 #define bishopR_m_height 49
-static char bishopR_m_bits[] = {
+static unsigned char bishopR_m_bits[] = {
  0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,
  0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x00,
  0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/bishop_l.xbm b/xshogi/eastern_bitmaps/bishop_l.xbm
index d9ed4f9..07e0189 100644
--- a/xshogi/eastern_bitmaps/bishop_l.xbm
+++ b/xshogi/eastern_bitmaps/bishop_l.xbm
@@ -1,38 +1,46 @@
 #define bishop_l_width 64
 #define bishop_l_height 64
-static char bishop_l_bits[] = {
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0xf0,0x00,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0x00,0x0f,
- 0x00,0x00,0x3c,0x00,0x00,0x00,0xf0,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0xf0,
- 0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0x0c,0x00,0xfc,0x0f,0x00,0x0c,0x00,0x00,
- 0x0c,0x00,0xfc,0x0f,0x00,0x0c,0x00,0x00,0x0c,0xc0,0x03,0x0f,0x00,0x3c,0x00,
- 0x00,0x0c,0xc0,0x03,0x0f,0x00,0x3c,0x00,0x00,0x0c,0x00,0xc0,0x03,0x00,0x3c,
- 0x00,0x00,0x0c,0x00,0xc0,0x03,0x00,0x3c,0x00,0x00,0x0c,0xf0,0xff,0xff,0x00,
- 0x3c,0x00,0x00,0x0c,0xf0,0xff,0xff,0x00,0x3c,0x00,0x00,0x03,0xf0,0xf0,0xf0,
- 0x00,0x30,0x00,0x00,0x03,0xf0,0xf0,0xf0,0x00,0x30,0x00,0x00,0x03,0xf0,0xff,
- 0xff,0x00,0xf0,0x00,0x00,0x03,0xf0,0xff,0xff,0x00,0xf0,0x00,0x00,0x03,0xf0,
- 0xf0,0xf0,0x00,0xf0,0x00,0x00,0x03,0xf0,0xf0,0xf0,0x00,0xf0,0x00,0x00,0x03,
- 0xf0,0xff,0xff,0x00,0xf0,0x00,0x00,0x03,0xf0,0xff,0xff,0x00,0xf0,0x00,0xc0,
- 0x00,0xf0,0x00,0xf0,0x00,0xc0,0x00,0xc0,0x00,0xf0,0x00,0xf0,0x00,0xc0,0x00,
- 0xc0,0x00,0x3c,0x00,0xfc,0x00,0xc0,0x03,0xc0,0x00,0x3c,0x00,0xfc,0x00,0xc0,
- 0x03,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0xc0,0x00,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0xc0,0x00,0x00,0x00,0x00,
- 0x00,0xc0,0x03,0x30,0x00,0x30,0xc0,0xff,0x03,0x00,0x03,0x30,0x00,0x30,0xc0,
- 0xff,0x03,0x00,0x03,0x30,0x00,0x0c,0x03,0x00,0x00,0x00,0x0f,0x30,0x00,0x0c,
- 0x03,0x00,0x00,0x00,0x0f,0x30,0x00,0xc3,0x00,0x00,0x00,0x00,0x0f,0x30,0x00,
- 0xc3,0x00,0x00,0x00,0x00,0x0f,0x30,0x00,0xf0,0xf0,0xff,0x0f,0x00,0x0f,0x30,
- 0x00,0xf0,0xf0,0xff,0x0f,0x00,0x0f,0x0c,0x00,0xfc,0x00,0xf0,0x00,0x00,0x0c,
- 0x0c,0x00,0xfc,0x00,0xf0,0x00,0x00,0x0c,0x0c,0x00,0xf3,0x00,0xf0,0x00,0x00,
- 0x3c,0x0c,0x00,0xf3,0x00,0xf0,0x00,0x00,0x3c,0x0c,0x00,0xf0,0x00,0xf0,0x00,
- 0x00,0x3c,0x0c,0x00,0xf0,0x00,0xf0,0x00,0x00,0x3c,0x0c,0x00,0xf0,0x00,0xf0,
- 0x00,0x00,0x3c,0x0c,0x00,0xf0,0x00,0xf0,0x00,0x00,0x3c,0x03,0x00,0xf0,0x00,
- 0x3c,0x00,0x00,0x30,0x03,0x00,0xf0,0x00,0x3c,0x00,0x00,0x30,0x03,0x00,0x00,
- 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xfc,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff};
+static unsigned char bishop_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0x10,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x11, 0x00, 0xd8, 0x03, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0x00, 0xfc, 0x03, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x8e,
+  0x03, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0xc6, 0x01, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0xe0, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x20,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x80, 0x08, 0x00, 0xff, 0x1f, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0xff,
+  0x31, 0x00, 0x00, 0x01, 0x80, 0x04, 0x80, 0x63, 0x30, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x80, 0xe1, 0x3f, 0x00, 0x00, 0x01, 0x80, 0x04, 0x80, 0xff,
+  0x3b, 0x00, 0x00, 0x01, 0x80, 0x04, 0x80, 0x6f, 0x30, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x80, 0xe1, 0x3f, 0x00, 0x00, 0x02, 0x40, 0x04, 0x80, 0xfd,
+  0x3f, 0x00, 0x00, 0x02, 0x40, 0x02, 0x80, 0x1f, 0x30, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x00, 0x20, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x00,
+  0x38, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x00, 0x30, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x03, 0x00, 0x00, 0x00, 0x04, 0x20, 0x02, 0x80, 0x03,
+  0x00, 0x00, 0x00, 0x04, 0x20, 0x02, 0x80, 0x03, 0x00, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0xc0, 0x05, 0xfe, 0x01, 0x00, 0x04, 0x20, 0x01, 0xe0, 0x1e,
+  0xff, 0x01, 0x00, 0x04, 0x20, 0x01, 0x30, 0x1e, 0x00, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x18, 0x07, 0xf8, 0x0f, 0x00, 0x08, 0x20, 0x01, 0x80, 0x83,
+  0xff, 0x07, 0x00, 0x08, 0x10, 0x01, 0xc0, 0x81, 0x0f, 0x02, 0x00, 0x08,
+  0x10, 0x01, 0xe0, 0x00, 0x00, 0x02, 0x00, 0x08, 0x90, 0x00, 0xf0, 0x01,
+  0x00, 0x06, 0x00, 0x08, 0x90, 0x00, 0x98, 0x01, 0x0c, 0x06, 0x00, 0x08,
+  0x90, 0x00, 0x80, 0x01, 0x18, 0x06, 0x00, 0x10, 0x90, 0x00, 0x80, 0x01,
+  0x70, 0x06, 0x00, 0x10, 0x90, 0x00, 0x80, 0x01, 0xe0, 0x06, 0x00, 0x10,
+  0x88, 0x00, 0x80, 0x01, 0xc0, 0x07, 0x00, 0x10, 0x48, 0x00, 0x00, 0x01,
+  0x00, 0x03, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/bishop_m.xbm b/xshogi/eastern_bitmaps/bishop_m.xbm
index 50cc6d1..0df516d 100644
--- a/xshogi/eastern_bitmaps/bishop_m.xbm
+++ b/xshogi/eastern_bitmaps/bishop_m.xbm
@@ -1,6 +1,6 @@
 #define bishop_m_width 49
 #define bishop_m_height 49
-static char bishop_m_bits[] = {
+static unsigned char bishop_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,
  0x38,0x38,0x00,0x00,0xfe,0x00,0x00,0x07,0xc0,0x01,0x00,0xfe,0x00,0x00,0x07,
diff --git a/xshogi/eastern_bitmaps/gold.xbm b/xshogi/eastern_bitmaps/gold.xbm
index ef0f942..5382abb 100644
--- a/xshogi/eastern_bitmaps/gold.xbm
+++ b/xshogi/eastern_bitmaps/gold.xbm
@@ -1,6 +1,6 @@
 #define gold_width 32
 #define gold_height 32
-static char gold_bits[] = {
+static unsigned char gold_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,
  0x00,0x00,0x03,0x60,0x00,0xc0,0x00,0x80,0x01,0x20,0xc0,0x00,0x02,0x20,0x30,
  0x03,0x06,0x20,0x0c,0x0c,0x06,0x20,0xf3,0x33,0x06,0x10,0xc0,0x00,0x04,0x10,
diff --git a/xshogi/eastern_bitmaps/goldR.xbm b/xshogi/eastern_bitmaps/goldR.xbm
index 975f6e8..7f54439 100644
--- a/xshogi/eastern_bitmaps/goldR.xbm
+++ b/xshogi/eastern_bitmaps/goldR.xbm
@@ -1,6 +1,6 @@
 #define goldR_width 32
 #define goldR_height 32
-static char goldR_bits[] = {
+static unsigned char goldR_bits[] = {
  0xff,0xff,0xff,0x7f,0x01,0x00,0x00,0xc0,0x01,0x00,0x00,0xc0,0x01,0x1c,0x4c,
  0xc0,0x01,0x4c,0x2c,0xc0,0x02,0x8c,0x2c,0x60,0x02,0x0c,0x2c,0x60,0x02,0xff,
  0x7d,0x60,0x02,0x00,0x0c,0x60,0x04,0x94,0x7c,0x30,0x04,0x22,0x2d,0x30,0x04,
diff --git a/xshogi/eastern_bitmaps/goldR_l.xbm b/xshogi/eastern_bitmaps/goldR_l.xbm
index c4aff55..3e9048e 100644
--- a/xshogi/eastern_bitmaps/goldR_l.xbm
+++ b/xshogi/eastern_bitmaps/goldR_l.xbm
@@ -1,38 +1,46 @@
 #define goldR_l_width 64
 #define goldR_l_height 64
-static char goldR_l_bits[] = {
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x0f,0xc0,0xc3,0x00,0xc0,0x0f,0x00,0x00,
- 0x0f,0xc0,0xc3,0x00,0xc0,0x0c,0x00,0xc0,0xc3,0xc0,0xc3,0x00,0xc0,0x0c,0x00,
- 0xc0,0xc3,0xc0,0xc3,0x00,0xc0,0x3c,0x00,0xc0,0x03,0xc3,0x33,0x00,0x30,0x3c,
- 0x00,0xc0,0x03,0xc3,0x33,0x00,0x30,0x3c,0x00,0xc0,0x03,0xc0,0x33,0x00,0x30,
- 0x3c,0x00,0xc0,0x03,0xc0,0x33,0x00,0x30,0x3c,0x00,0xfc,0xff,0xcf,0xff,0x00,
- 0x30,0x3c,0x00,0xfc,0xff,0xcf,0xff,0x00,0x30,0x30,0x00,0xc0,0x03,0xc0,0x03,
- 0x00,0x30,0x30,0x00,0xc0,0x03,0xc0,0x03,0x00,0x30,0xf0,0x00,0x00,0x00,0xc3,
- 0xff,0x00,0x0c,0xf0,0x00,0x00,0x00,0xc3,0xff,0x00,0x0c,0xf0,0x00,0xc0,0x0c,
- 0xcf,0x33,0x00,0x0c,0xf0,0x00,0xc0,0x0c,0xcf,0x33,0x00,0x0c,0xf0,0x00,0xf0,
- 0x3c,0xcc,0x33,0x00,0x0c,0xf0,0x00,0xf0,0x3c,0xcc,0x33,0x00,0x0c,0xc0,0x00,
- 0x30,0xf0,0xcf,0x33,0x00,0x0c,0xc0,0x00,0x30,0xf0,0xcf,0x33,0x00,0x0c,0xc0,
- 0x03,0xf0,0x0f,0x00,0x00,0x00,0x03,0xc0,0x03,0xf0,0x0f,0x00,0x00,0x00,0x03,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x03,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,
- 0x03,0xc0,0x03,0xc0,0xff,0xff,0x3f,0x00,0x03,0xc0,0x03,0xc0,0xff,0xff,0x3f,
- 0x00,0x03,0x00,0x03,0x00,0x30,0xcf,0x00,0x00,0x03,0x00,0x03,0x00,0x30,0xcf,
- 0x00,0x00,0x03,0x00,0x0f,0x00,0x0c,0x0f,0x03,0xc0,0x00,0x00,0x0f,0x00,0x0c,
- 0x0f,0x03,0xc0,0x00,0x00,0x0f,0x00,0x00,0x0f,0x00,0xc0,0x00,0x00,0x0f,0x00,
- 0x00,0x0f,0x00,0xc0,0x00,0x00,0x0f,0x00,0xff,0xff,0x0f,0xc0,0x00,0x00,0x0f,
- 0x00,0xff,0xff,0x0f,0xc0,0x00,0x00,0x0c,0x00,0x00,0x0f,0x00,0xc0,0x00,0x00,
- 0x0c,0x00,0x00,0x0f,0x00,0xc0,0x00,0x00,0x3c,0xf0,0xf0,0xff,0xf0,0x30,0x00,
- 0x00,0x3c,0xf0,0xf0,0xff,0xf0,0x30,0x00,0x00,0x3c,0x00,0x0f,0x00,0x0f,0x30,
- 0x00,0x00,0x3c,0x00,0x0f,0x00,0x0f,0x30,0x00,0x00,0x3c,0x00,0xf0,0xf0,0x00,
- 0x30,0x00,0x00,0x3c,0x00,0xf0,0xf0,0x00,0x30,0x00,0x00,0x30,0x00,0x00,0x0f,
- 0x00,0x30,0x00,0x00,0x30,0x00,0x00,0x0f,0x00,0x30,0x00,0x00,0xc0,0x03,0x00,
- 0x00,0x00,0x0f,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x0f,0x00,0x00,0x00,0x3c,
- 0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char goldR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x0f, 0x80, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x0b,
+  0xc0, 0x01, 0x00, 0x20, 0x48, 0x00, 0x00, 0xc3, 0xe0, 0x01, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0xe3, 0x60, 0x03, 0x00, 0x10, 0x48, 0x00, 0x00, 0x63,
+  0x60, 0x18, 0x00, 0x10, 0x88, 0x00, 0x00, 0x26, 0x60, 0x1c, 0x00, 0x10,
+  0x90, 0x00, 0xe0, 0xe7, 0x63, 0x0c, 0x00, 0x10, 0x90, 0x00, 0xf0, 0xff,
+  0x63, 0x0c, 0x00, 0x10, 0x90, 0x00, 0x00, 0x06, 0x60, 0x04, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0x60, 0x20, 0x1f, 0x00, 0x08, 0x90, 0x00, 0x00, 0x7c,
+  0xa0, 0x0f, 0x00, 0x08, 0x10, 0x01, 0x00, 0x1c, 0x21, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0x06, 0x63, 0x0c, 0x00, 0x08, 0x20, 0x01, 0x00, 0x66,
+  0xe3, 0x1f, 0x00, 0x08, 0x20, 0x01, 0x00, 0x7e, 0xe0, 0x06, 0x00, 0x08,
+  0x20, 0x01, 0x00, 0x5c, 0x20, 0x03, 0x00, 0x04, 0x20, 0x01, 0x00, 0xc0,
+  0x61, 0x03, 0x00, 0x04, 0x20, 0x01, 0x00, 0xe0, 0x63, 0x01, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x78, 0x60, 0x01, 0x00, 0x04, 0x20, 0x02, 0x00, 0x18,
+  0x60, 0x00, 0x00, 0x04, 0x40, 0x02, 0x00, 0x08, 0x20, 0x00, 0x00, 0x04,
+  0x40, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0xfc,
+  0xff, 0x01, 0x00, 0x02, 0x40, 0x02, 0x00, 0xfe, 0xff, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x00, 0x03, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x38,
+  0x3b, 0x00, 0x00, 0x02, 0x80, 0x04, 0x00, 0x1c, 0x73, 0x00, 0x00, 0x02,
+  0x80, 0x04, 0x00, 0x0c, 0x63, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xe0,
+  0x1f, 0x00, 0x00, 0x01, 0x80, 0x04, 0x80, 0xfb, 0x1f, 0x0e, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x07, 0x83, 0x07, 0x00, 0x01, 0x80, 0x08, 0x00, 0xdc,
+  0xcf, 0x03, 0x00, 0x01, 0x80, 0x08, 0x00, 0x98, 0xe7, 0x00, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0x70, 0x70, 0x00, 0x00, 0x01, 0x00, 0x09, 0x00, 0x60,
+  0x38, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0xc0, 0x1c, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0xc0, 0x07, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x03, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/goldR_m.xbm b/xshogi/eastern_bitmaps/goldR_m.xbm
index 8d2cba4..a199927 100644
--- a/xshogi/eastern_bitmaps/goldR_m.xbm
+++ b/xshogi/eastern_bitmaps/goldR_m.xbm
@@ -1,6 +1,6 @@
 #define goldR_m_width 49
 #define goldR_m_height 49
-static char goldR_m_bits[] = {
+static unsigned char goldR_m_bits[] = {
  0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,
  0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x00,
  0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/gold_l.xbm b/xshogi/eastern_bitmaps/gold_l.xbm
index 89dee45..2f93718 100644
--- a/xshogi/eastern_bitmaps/gold_l.xbm
+++ b/xshogi/eastern_bitmaps/gold_l.xbm
@@ -1,38 +1,46 @@
 #define gold_l_width 64
 #define gold_l_height 64
-static char gold_l_bits[] = {
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0xf0,0x00,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0x00,0x0f,
- 0x00,0x00,0x3c,0x00,0x00,0x00,0xf0,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0xf0,
- 0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0x0c,0x00,0xf0,0x00,0x00,0x0c,0x00,0x00,
- 0x0c,0x00,0xf0,0x00,0x00,0x0c,0x00,0x00,0x0c,0x00,0x0f,0x0f,0x00,0x3c,0x00,
- 0x00,0x0c,0x00,0x0f,0x0f,0x00,0x3c,0x00,0x00,0x0c,0xf0,0x00,0xf0,0x00,0x3c,
- 0x00,0x00,0x0c,0xf0,0x00,0xf0,0x00,0x3c,0x00,0x00,0x0c,0x0f,0xff,0x0f,0x0f,
- 0x3c,0x00,0x00,0x0c,0x0f,0xff,0x0f,0x0f,0x3c,0x00,0x00,0x03,0x00,0xf0,0x00,
- 0x00,0x30,0x00,0x00,0x03,0x00,0xf0,0x00,0x00,0x30,0x00,0x00,0x03,0xf0,0xff,
- 0xff,0x00,0xf0,0x00,0x00,0x03,0xf0,0xff,0xff,0x00,0xf0,0x00,0x00,0x03,0x00,
- 0xf0,0x00,0x00,0xf0,0x00,0x00,0x03,0x00,0xf0,0x00,0x00,0xf0,0x00,0x00,0x03,
- 0xc0,0xf0,0x30,0x00,0xf0,0x00,0x00,0x03,0xc0,0xf0,0x30,0x00,0xf0,0x00,0xc0,
- 0x00,0x00,0xf3,0x0c,0x00,0xc0,0x00,0xc0,0x00,0x00,0xf3,0x0c,0x00,0xc0,0x00,
- 0xc0,0x00,0xfc,0xff,0xff,0x03,0xc0,0x03,0xc0,0x00,0xfc,0xff,0xff,0x03,0xc0,
- 0x03,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0xc0,0x00,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0xc0,0x00,0x00,0x00,0xf0,0x0f,0xc0,0x03,0xc0,0x00,0x00,0x00,0xf0,
- 0x0f,0xc0,0x03,0x30,0x00,0xcc,0xf3,0x0f,0x0c,0x00,0x03,0x30,0x00,0xcc,0xf3,
- 0x0f,0x0c,0x00,0x03,0x30,0x00,0xcc,0x33,0x3c,0x0f,0x00,0x0f,0x30,0x00,0xcc,
- 0x33,0x3c,0x0f,0x00,0x0f,0x30,0x00,0xcc,0xf3,0x30,0x03,0x00,0x0f,0x30,0x00,
- 0xcc,0xf3,0x30,0x03,0x00,0x0f,0x30,0x00,0xff,0xc3,0x00,0x00,0x00,0x0f,0x30,
- 0x00,0xff,0xc3,0x00,0x00,0x00,0x0f,0x0c,0x00,0xc0,0x03,0xc0,0x03,0x00,0x0c,
- 0x0c,0x00,0xc0,0x03,0xc0,0x03,0x00,0x0c,0x0c,0x00,0xff,0xf3,0xff,0x3f,0x00,
- 0x3c,0x0c,0x00,0xff,0xf3,0xff,0x3f,0x00,0x3c,0x0c,0x00,0xcc,0x03,0xc0,0x03,
- 0x00,0x3c,0x0c,0x00,0xcc,0x03,0xc0,0x03,0x00,0x3c,0x0c,0x00,0xcc,0xc3,0xc0,
- 0x03,0x00,0x3c,0x0c,0x00,0xcc,0xc3,0xc0,0x03,0x00,0x3c,0x03,0x00,0xc3,0x03,
- 0xc3,0x03,0x00,0x30,0x03,0x00,0xc3,0x03,0xc3,0x03,0x00,0x30,0x03,0x00,0xc3,
- 0x03,0xf0,0x00,0x00,0xf0,0x03,0x00,0xc3,0x03,0xf0,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xfc,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff};
+static unsigned char gold_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0xc0, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0xe0, 0x03, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0x38,
+  0x03, 0x00, 0x80, 0x00, 0x00, 0x11, 0x00, 0x1c, 0x06, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0x00, 0x0e, 0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0xe7,
+  0x19, 0x00, 0x80, 0x00, 0x00, 0x09, 0xc0, 0xf3, 0x3b, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0xe0, 0xc1, 0xe0, 0x00, 0x80, 0x00, 0x00, 0x09, 0x70, 0xf8,
+  0xdf, 0x01, 0x80, 0x00, 0x00, 0x09, 0x00, 0xf8, 0x07, 0x00, 0x00, 0x01,
+  0x80, 0x08, 0x00, 0xc6, 0x30, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0xce,
+  0x38, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xdc, 0x1c, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0xc0, 0x00, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xff,
+  0x7f, 0x00, 0x00, 0x01, 0x80, 0x04, 0x80, 0xff, 0x3f, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x04,
+  0x10, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x06, 0x18, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x80, 0x06, 0x1e, 0x00, 0x00, 0x02, 0x40, 0x02, 0x80, 0xc6,
+  0x07, 0x00, 0x00, 0x02, 0x40, 0x02, 0xc0, 0x86, 0x03, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0xc0, 0x04, 0x3a, 0x00, 0x00, 0x04, 0x20, 0x02, 0x60, 0x07,
+  0x7e, 0x00, 0x00, 0x04, 0x20, 0x02, 0xf8, 0xc7, 0x66, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x30, 0xc6, 0x60, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x84,
+  0x38, 0x00, 0x00, 0x04, 0x20, 0x01, 0xf0, 0x05, 0x3e, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0xf8, 0x04, 0x06, 0x00, 0x00, 0x08, 0x20, 0x01, 0x20, 0x06,
+  0x60, 0x00, 0x00, 0x08, 0x10, 0x01, 0x30, 0xc6, 0xff, 0x0f, 0x00, 0x08,
+  0x10, 0x01, 0x30, 0xc6, 0xe7, 0x07, 0x00, 0x08, 0x90, 0x00, 0x38, 0x06,
+  0x64, 0x00, 0x00, 0x08, 0x90, 0x00, 0x18, 0x06, 0xc6, 0x00, 0x00, 0x08,
+  0x90, 0x00, 0xc0, 0x06, 0xc7, 0x00, 0x00, 0x10, 0x90, 0x00, 0x80, 0x07,
+  0xc3, 0x00, 0x00, 0x10, 0x90, 0x00, 0x80, 0x03, 0xd0, 0x00, 0x00, 0x10,
+  0x88, 0x00, 0x00, 0x01, 0xf0, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00,
+  0x60, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/gold_m.xbm b/xshogi/eastern_bitmaps/gold_m.xbm
index 79a73c4..a643a3d 100644
--- a/xshogi/eastern_bitmaps/gold_m.xbm
+++ b/xshogi/eastern_bitmaps/gold_m.xbm
@@ -1,6 +1,6 @@
 #define gold_m_width 49
 #define gold_m_height 49
-static char gold_m_bits[] = {
+static unsigned char gold_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,
  0x38,0x38,0x00,0x00,0xfe,0x00,0x00,0x07,0xc0,0x01,0x00,0xfe,0x00,0x00,0x07,
diff --git a/xshogi/eastern_bitmaps/icon.xbm b/xshogi/eastern_bitmaps/icon.xbm
index 2819b4a..d220e38 100644
--- a/xshogi/eastern_bitmaps/icon.xbm
+++ b/xshogi/eastern_bitmaps/icon.xbm
@@ -1,6 +1,6 @@
 #define icon_width 32
 #define icon_height 32
-static char icon_bits[] = {
+static unsigned char icon_bits[] = {
    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x03, 0x00, 0x00, 0xc0, 0x0c, 0x00,
    0x00, 0x20, 0x10, 0x00, 0x00, 0x20, 0x30, 0x00, 0x00, 0x20, 0x30, 0x00,
    0x00, 0x10, 0x20, 0x00, 0x00, 0x10, 0x60, 0x00, 0x00, 0x10, 0x67, 0x00,
diff --git a/xshogi/eastern_bitmaps/king.xbm b/xshogi/eastern_bitmaps/king.xbm
index f582929..ecce340 100644
--- a/xshogi/eastern_bitmaps/king.xbm
+++ b/xshogi/eastern_bitmaps/king.xbm
@@ -1,6 +1,6 @@
 #define king_width 32
 #define king_height 32
-static char king_bits[] = {
+static unsigned char king_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,
  0x00,0x00,0x03,0x60,0x00,0xc0,0x00,0x80,0x01,0x20,0x00,0x00,0x02,0x20,0xfc,
  0x0f,0x06,0x20,0xc0,0x00,0x06,0x20,0xc0,0x00,0x06,0x10,0xc0,0x00,0x04,0x10,
diff --git a/xshogi/eastern_bitmaps/kingR.xbm b/xshogi/eastern_bitmaps/kingR.xbm
index 186e7f9..4a5d56d 100644
--- a/xshogi/eastern_bitmaps/kingR.xbm
+++ b/xshogi/eastern_bitmaps/kingR.xbm
@@ -1,6 +1,6 @@
 #define kingR_width 32
 #define kingR_height 32
-static char kingR_bits[] = {
+static unsigned char kingR_bits[] = {
  0xff,0xff,0xff,0x7f,0x01,0x00,0x00,0xc0,0x01,0x00,0x00,0xc0,0x01,0x18,0x4c,
  0xc0,0x01,0x4c,0x4c,0xc0,0x02,0x8c,0x2c,0x60,0x02,0x0c,0x2c,0x60,0x02,0xff,
  0x7d,0x60,0x02,0x0c,0x0c,0x60,0x04,0x80,0x7c,0x30,0x04,0x94,0x2d,0x30,0x04,
diff --git a/xshogi/eastern_bitmaps/kingR_l.xbm b/xshogi/eastern_bitmaps/kingR_l.xbm
index 7767c33..3da731a 100644
--- a/xshogi/eastern_bitmaps/kingR_l.xbm
+++ b/xshogi/eastern_bitmaps/kingR_l.xbm
@@ -1,38 +1,46 @@
 #define kingR_l_width 64
 #define kingR_l_height 64
-static char kingR_l_bits[] = {
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x0f,0xc0,0xc3,0x00,0xc0,0x0f,0x00,0x00,
- 0x0f,0xc0,0xc3,0x00,0xc0,0x0c,0x00,0xc0,0xc3,0xc0,0xc3,0x00,0xc0,0x0c,0x00,
- 0xc0,0xc3,0xc0,0xc3,0x00,0xc0,0x3c,0x00,0xc0,0x03,0xc3,0x33,0x00,0x30,0x3c,
- 0x00,0xc0,0x03,0xc3,0x33,0x00,0x30,0x3c,0x00,0xc0,0x03,0xc0,0x33,0x00,0x30,
- 0x3c,0x00,0xc0,0x03,0xc0,0x33,0x00,0x30,0x3c,0x00,0xfc,0xff,0xcf,0xff,0x00,
- 0x30,0x3c,0x00,0xfc,0xff,0xcf,0xff,0x00,0x30,0x30,0x00,0xc0,0x03,0xc0,0x03,
- 0x00,0x30,0x30,0x00,0xc0,0x03,0xc0,0x03,0x00,0x30,0xf0,0x00,0x00,0x00,0xc3,
- 0xff,0x00,0x0c,0xf0,0x00,0x00,0x00,0xc3,0xff,0x00,0x0c,0xf0,0x00,0xc0,0x0c,
- 0xcf,0x33,0x00,0x0c,0xf0,0x00,0xc0,0x0c,0xcf,0x33,0x00,0x0c,0xf0,0x00,0xf0,
- 0x3c,0xcc,0x33,0x00,0x0c,0xf0,0x00,0xf0,0x3c,0xcc,0x33,0x00,0x0c,0xc0,0x00,
- 0x30,0xf0,0xcf,0x33,0x00,0x0c,0xc0,0x00,0x30,0xf0,0xcf,0x33,0x00,0x0c,0xc0,
- 0x03,0xf0,0x0f,0x00,0x00,0x00,0x03,0xc0,0x03,0xf0,0x0f,0x00,0x00,0x00,0x03,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x03,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,
- 0x03,0xc0,0x03,0xc0,0xff,0xff,0x3f,0x00,0x03,0xc0,0x03,0xc0,0xff,0xff,0x3f,
- 0x00,0x03,0x00,0x03,0x00,0x00,0x0f,0x00,0x00,0x03,0x00,0x03,0x00,0x00,0x0f,
- 0x00,0x00,0x03,0x00,0x0f,0x00,0x00,0x0f,0x00,0xc0,0x00,0x00,0x0f,0x00,0x00,
- 0x0f,0x00,0xc0,0x00,0x00,0x0f,0x00,0x00,0x0f,0x00,0xc0,0x00,0x00,0x0f,0x00,
- 0x00,0x0f,0x00,0xc0,0x00,0x00,0x0f,0x00,0xff,0xff,0x0f,0xc0,0x00,0x00,0x0f,
- 0x00,0xff,0xff,0x0f,0xc0,0x00,0x00,0x0c,0x00,0x00,0x0f,0x00,0xc0,0x00,0x00,
- 0x0c,0x00,0x00,0x0f,0x00,0xc0,0x00,0x00,0x3c,0x00,0x00,0x0f,0x00,0x30,0x00,
- 0x00,0x3c,0x00,0x00,0x0f,0x00,0x30,0x00,0x00,0x3c,0x00,0x00,0x0f,0x00,0x30,
- 0x00,0x00,0x3c,0x00,0x00,0x0f,0x00,0x30,0x00,0x00,0x3c,0x00,0xff,0xff,0x0f,
- 0x30,0x00,0x00,0x3c,0x00,0xff,0xff,0x0f,0x30,0x00,0x00,0x30,0x00,0x00,0x00,
- 0x00,0x30,0x00,0x00,0x30,0x00,0x00,0x00,0x00,0x30,0x00,0x00,0xc0,0x03,0x00,
- 0x00,0x00,0x0f,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x0f,0x00,0x00,0x00,0x3c,
- 0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char kingR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x0f, 0x80, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x0b,
+  0xc0, 0x01, 0x00, 0x20, 0x48, 0x00, 0x00, 0xc3, 0xe0, 0x01, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0xe3, 0x60, 0x03, 0x00, 0x10, 0x48, 0x00, 0x00, 0x63,
+  0x60, 0x18, 0x00, 0x10, 0x88, 0x00, 0x00, 0x26, 0x60, 0x1c, 0x00, 0x10,
+  0x90, 0x00, 0xe0, 0xe7, 0x63, 0x0c, 0x00, 0x10, 0x90, 0x00, 0xf0, 0xff,
+  0x63, 0x0c, 0x00, 0x10, 0x90, 0x00, 0x00, 0x06, 0x60, 0x04, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0x60, 0x20, 0x1f, 0x00, 0x08, 0x90, 0x00, 0x00, 0x7c,
+  0xa0, 0x0f, 0x00, 0x08, 0x10, 0x01, 0x00, 0x1c, 0x21, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0x06, 0x23, 0x0c, 0x00, 0x08, 0x20, 0x01, 0x00, 0x66,
+  0xe3, 0x1f, 0x00, 0x08, 0x20, 0x01, 0x00, 0x7e, 0xe0, 0x06, 0x00, 0x08,
+  0x20, 0x01, 0x00, 0x5c, 0x20, 0x03, 0x00, 0x04, 0x20, 0x01, 0x00, 0xc0,
+  0x61, 0x03, 0x00, 0x04, 0x20, 0x01, 0x00, 0xe0, 0x63, 0x01, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x78, 0x60, 0x01, 0x00, 0x04, 0x20, 0x02, 0x00, 0x18,
+  0x60, 0x00, 0x00, 0x04, 0x40, 0x02, 0x00, 0x08, 0x20, 0x00, 0x00, 0x04,
+  0x40, 0x02, 0x00, 0x00, 0xc0, 0x00, 0x00, 0x02, 0x40, 0x02, 0x80, 0xff,
+  0xff, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0xfe, 0x1f, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x80, 0x01, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x80,
+  0x01, 0x00, 0x00, 0x02, 0x80, 0x04, 0x00, 0x80, 0x01, 0x00, 0x00, 0x02,
+  0x80, 0x04, 0x00, 0xe0, 0x3f, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xf8,
+  0x0f, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0x9c, 0x01, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x80, 0x01, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x80,
+  0x01, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x80, 0xe3, 0x00, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0xfe, 0x7f, 0x00, 0x00, 0x01, 0x00, 0x09, 0x00, 0xff,
+  0x1f, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x02, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/kingR_m.xbm b/xshogi/eastern_bitmaps/kingR_m.xbm
index e8f3c4e..7feda1b 100644
--- a/xshogi/eastern_bitmaps/kingR_m.xbm
+++ b/xshogi/eastern_bitmaps/kingR_m.xbm
@@ -1,6 +1,6 @@
 #define kingR_m_width 49
 #define kingR_m_height 49
-static char kingR_m_bits[] = {
+static unsigned char kingR_m_bits[] = {
  0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,
  0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x00,
  0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/king_l.xbm b/xshogi/eastern_bitmaps/king_l.xbm
index 7577123..b849c75 100644
--- a/xshogi/eastern_bitmaps/king_l.xbm
+++ b/xshogi/eastern_bitmaps/king_l.xbm
@@ -1,38 +1,46 @@
 #define king_l_width 64
 #define king_l_height 64
-static char king_l_bits[] = {
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0xf0,0x00,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0x00,0x0f,
- 0x00,0x00,0x3c,0x00,0x00,0x00,0xf0,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0xf0,
- 0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0x0c,0x00,0x00,0x00,0x00,0x0c,0x00,0x00,
- 0x0c,0x00,0x00,0x00,0x00,0x0c,0x00,0x00,0x0c,0xf0,0xff,0xff,0x00,0x3c,0x00,
- 0x00,0x0c,0xf0,0xff,0xff,0x00,0x3c,0x00,0x00,0x0c,0x00,0xf0,0x00,0x00,0x3c,
- 0x00,0x00,0x0c,0x00,0xf0,0x00,0x00,0x3c,0x00,0x00,0x0c,0x00,0xf0,0x00,0x00,
- 0x3c,0x00,0x00,0x0c,0x00,0xf0,0x00,0x00,0x3c,0x00,0x00,0x03,0x00,0xf0,0x00,
- 0x00,0x30,0x00,0x00,0x03,0x00,0xf0,0x00,0x00,0x30,0x00,0x00,0x03,0xf0,0xff,
- 0xff,0x00,0xf0,0x00,0x00,0x03,0xf0,0xff,0xff,0x00,0xf0,0x00,0x00,0x03,0x00,
- 0xf0,0x00,0x00,0xf0,0x00,0x00,0x03,0x00,0xf0,0x00,0x00,0xf0,0x00,0x00,0x03,
- 0x00,0xf0,0x00,0x00,0xf0,0x00,0x00,0x03,0x00,0xf0,0x00,0x00,0xf0,0x00,0xc0,
- 0x00,0x00,0xf0,0x00,0x00,0xc0,0x00,0xc0,0x00,0x00,0xf0,0x00,0x00,0xc0,0x00,
- 0xc0,0x00,0xfc,0xff,0xff,0x03,0xc0,0x03,0xc0,0x00,0xfc,0xff,0xff,0x03,0xc0,
- 0x03,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0xc0,0x00,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0xc0,0x00,0x00,0x00,0xf0,0x0f,0xc0,0x03,0xc0,0x00,0x00,0x00,0xf0,
- 0x0f,0xc0,0x03,0x30,0x00,0xcc,0xf3,0x0f,0x0c,0x00,0x03,0x30,0x00,0xcc,0xf3,
- 0x0f,0x0c,0x00,0x03,0x30,0x00,0xcc,0x33,0x3c,0x0f,0x00,0x0f,0x30,0x00,0xcc,
- 0x33,0x3c,0x0f,0x00,0x0f,0x30,0x00,0xcc,0xf3,0x30,0x03,0x00,0x0f,0x30,0x00,
- 0xcc,0xf3,0x30,0x03,0x00,0x0f,0x30,0x00,0xff,0xc3,0x00,0x00,0x00,0x0f,0x30,
- 0x00,0xff,0xc3,0x00,0x00,0x00,0x0f,0x0c,0x00,0xc0,0x03,0xc0,0x03,0x00,0x0c,
- 0x0c,0x00,0xc0,0x03,0xc0,0x03,0x00,0x0c,0x0c,0x00,0xff,0xf3,0xff,0x3f,0x00,
- 0x3c,0x0c,0x00,0xff,0xf3,0xff,0x3f,0x00,0x3c,0x0c,0x00,0xcc,0x03,0xc0,0x03,
- 0x00,0x3c,0x0c,0x00,0xcc,0x03,0xc0,0x03,0x00,0x3c,0x0c,0x00,0xcc,0xc3,0xc0,
- 0x03,0x00,0x3c,0x0c,0x00,0xcc,0xc3,0xc0,0x03,0x00,0x3c,0x03,0x00,0xc3,0x03,
- 0xc3,0x03,0x00,0x30,0x03,0x00,0xc3,0x03,0xc3,0x03,0x00,0x30,0x03,0x00,0xc3,
- 0x03,0xf0,0x00,0x00,0xf0,0x03,0x00,0xc3,0x03,0xf0,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xfc,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff};
+static unsigned char king_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0x00,
+  0x40, 0x00, 0x80, 0x00, 0x00, 0x11, 0x00, 0xf8, 0xff, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0x00, 0xfe, 0x7f, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0xc7,
+  0x01, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x80, 0x01, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x80, 0x01, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x80,
+  0x39, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0xf0, 0x1f, 0x00, 0x00, 0x01,
+  0x80, 0x08, 0x00, 0xfc, 0x07, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x80,
+  0x01, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0x80, 0x01, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x80, 0x01, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xf8,
+  0x7f, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xff, 0xff, 0x01, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x03, 0x00, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x04,
+  0x10, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x06, 0x18, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x80, 0x06, 0x1e, 0x00, 0x00, 0x02, 0x40, 0x02, 0x80, 0xc6,
+  0x07, 0x00, 0x00, 0x02, 0x40, 0x02, 0xc0, 0x86, 0x03, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0xc0, 0x04, 0x3a, 0x00, 0x00, 0x04, 0x20, 0x02, 0x60, 0x07,
+  0x7e, 0x00, 0x00, 0x04, 0x20, 0x02, 0xf8, 0xc7, 0x66, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x30, 0xc4, 0x60, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x84,
+  0x38, 0x00, 0x00, 0x04, 0x20, 0x01, 0xf0, 0x05, 0x3e, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0xf8, 0x04, 0x06, 0x00, 0x00, 0x08, 0x20, 0x01, 0x20, 0x06,
+  0x60, 0x00, 0x00, 0x08, 0x10, 0x01, 0x30, 0xc6, 0xff, 0x0f, 0x00, 0x08,
+  0x10, 0x01, 0x30, 0xc6, 0xe7, 0x07, 0x00, 0x08, 0x90, 0x00, 0x38, 0x06,
+  0x64, 0x00, 0x00, 0x08, 0x90, 0x00, 0x18, 0x06, 0xc6, 0x00, 0x00, 0x08,
+  0x90, 0x00, 0xc0, 0x06, 0xc7, 0x00, 0x00, 0x10, 0x90, 0x00, 0x80, 0x07,
+  0xc3, 0x00, 0x00, 0x10, 0x90, 0x00, 0x80, 0x03, 0xd0, 0x00, 0x00, 0x10,
+  0x88, 0x00, 0x00, 0x01, 0xf0, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00,
+  0x60, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/king_m.xbm b/xshogi/eastern_bitmaps/king_m.xbm
index f0dfe7f..d5bba07 100644
--- a/xshogi/eastern_bitmaps/king_m.xbm
+++ b/xshogi/eastern_bitmaps/king_m.xbm
@@ -1,6 +1,6 @@
 #define king_m_width 49
 #define king_m_height 49
-static char king_m_bits[] = {
+static unsigned char king_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,
  0x38,0x38,0x00,0x00,0xfe,0x00,0x00,0x07,0xc0,0x01,0x00,0xfe,0x00,0x00,0x07,
diff --git a/xshogi/eastern_bitmaps/knight.xbm b/xshogi/eastern_bitmaps/knight.xbm
index 93161b8..580e74b 100644
--- a/xshogi/eastern_bitmaps/knight.xbm
+++ b/xshogi/eastern_bitmaps/knight.xbm
@@ -1,6 +1,6 @@
 #define knight_width 32
 #define knight_height 32
-static char knight_bits[] = {
+static unsigned char knight_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x01,
  0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,0x00,0x00,0x03,0x60,0x00,0x80,0x00,
  0x80,0x00,0x80,0x00,0x80,0x01,0x80,0x18,0x83,0x01,0x40,0x18,0x03,0x01,0x40,
diff --git a/xshogi/eastern_bitmaps/knightP.xbm b/xshogi/eastern_bitmaps/knightP.xbm
index 7183455..9b1e6ae 100644
--- a/xshogi/eastern_bitmaps/knightP.xbm
+++ b/xshogi/eastern_bitmaps/knightP.xbm
@@ -1,6 +1,6 @@
 #define knightP_width 32
 #define knightP_height 32
-static char knightP_bits[] = {
+static unsigned char knightP_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x01,
  0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,0x00,0x00,0x03,0x60,0x00,0x80,0x00,
  0x84,0x00,0x80,0x80,0x81,0x01,0x80,0xfc,0x8f,0x01,0x40,0x8c,0x01,0x01,0x40,
diff --git a/xshogi/eastern_bitmaps/knightPR.xbm b/xshogi/eastern_bitmaps/knightPR.xbm
index 873ee73..0d5885e 100644
--- a/xshogi/eastern_bitmaps/knightPR.xbm
+++ b/xshogi/eastern_bitmaps/knightPR.xbm
@@ -1,6 +1,6 @@
 #define knightPR_width 32
 #define knightPR_height 32
-static char knightPR_bits[] = {
+static unsigned char knightPR_bits[] = {
  0xfc,0xff,0xff,0x1f,0x04,0x00,0x00,0x30,0x04,0x00,0x00,0x30,0x04,0xfe,0x0d,
  0x30,0x04,0x30,0x0c,0x30,0x08,0x30,0x0c,0x18,0x08,0xfc,0x0c,0x18,0x08,0x30,
  0x2c,0x18,0x08,0xfe,0x1e,0x18,0x10,0x30,0x0c,0x0c,0x10,0xfc,0x3e,0x0c,0x10,
diff --git a/xshogi/eastern_bitmaps/knightPR_l.xbm b/xshogi/eastern_bitmaps/knightPR_l.xbm
index 069ed86..af6c836 100644
--- a/xshogi/eastern_bitmaps/knightPR_l.xbm
+++ b/xshogi/eastern_bitmaps/knightPR_l.xbm
@@ -1,38 +1,46 @@
 #define knightPR_l_width 64
 #define knightPR_l_height 64
-static char knightPR_l_bits[] = {
- 0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x0c,0xf0,0x00,0xf0,0xff,0xcf,0x03,0x00,0x0c,0xf0,0x00,0xf0,
- 0xff,0xcf,0x03,0x00,0x0c,0xc0,0x00,0x00,0x3c,0xc0,0x03,0x00,0x0c,0xc0,0x00,
- 0x00,0x3c,0xc0,0x03,0x00,0x0c,0xc0,0x03,0x00,0x3c,0xc0,0x03,0x00,0x03,0xc0,
- 0x03,0x00,0x3c,0xc0,0x03,0x00,0x03,0xc0,0x03,0xc0,0xff,0xc3,0x03,0x00,0x03,
- 0xc0,0x03,0xc0,0xff,0xc3,0x03,0x00,0x03,0xc0,0x03,0x00,0x3c,0xc0,0x33,0x00,
- 0x03,0xc0,0x03,0x00,0x3c,0xc0,0x33,0x00,0x03,0x00,0x03,0xf0,0xff,0xf3,0x0f,
- 0x00,0x03,0x00,0x03,0xf0,0xff,0xf3,0x0f,0x00,0x03,0x00,0x0f,0x00,0x3c,0xc0,
- 0x03,0xc0,0x00,0x00,0x0f,0x00,0x3c,0xc0,0x03,0xc0,0x00,0x00,0x0f,0xc0,0xff,
- 0xf3,0x3f,0xc0,0x00,0x00,0x0f,0xc0,0xff,0xf3,0x3f,0xc0,0x00,0x00,0x0f,0x00,
- 0x3c,0xc0,0x03,0xc0,0x00,0x00,0x0f,0x00,0x3c,0xc0,0x03,0xc0,0x00,0x00,0x0c,
- 0x00,0x3c,0xc0,0x03,0xc0,0x00,0x00,0x0c,0x00,0x3c,0xc0,0x03,0xc0,0x00,0x00,
- 0x3c,0x00,0x00,0x00,0x00,0x30,0x00,0x00,0x3c,0x00,0x00,0x00,0x00,0x30,0x00,
- 0x00,0x3c,0x00,0x03,0x3c,0x0c,0x30,0x00,0x00,0x3c,0x00,0x03,0x3c,0x0c,0x30,
- 0x00,0x00,0x3c,0xc0,0xcf,0x3c,0x0f,0x30,0x00,0x00,0x3c,0xc0,0xcf,0x3c,0x0f,
- 0x30,0x00,0x00,0x30,0x00,0x3c,0x3c,0x0f,0x30,0x00,0x00,0x30,0x00,0x3c,0x3c,
- 0x0f,0x30,0x00,0x00,0xf0,0x00,0x3f,0x3c,0x0f,0x0c,0x00,0x00,0xf0,0x00,0x3f,
- 0x3c,0x0f,0x0c,0x00,0x00,0xf0,0xc0,0xf3,0xfc,0x0f,0x0c,0x00,0x00,0xf0,0xc0,
- 0xf3,0xfc,0x0f,0x0c,0x00,0x00,0xf0,0x00,0xf0,0x00,0x0f,0x0c,0x00,0x00,0xf0,
- 0x00,0xf0,0x00,0x0f,0x0c,0x00,0x00,0xc0,0x00,0xc0,0x03,0x0f,0x0c,0x00,0x00,
- 0xc0,0x00,0xc0,0x03,0x0f,0x0c,0x00,0x00,0xc0,0x03,0xff,0xff,0x0f,0x03,0x00,
- 0x00,0xc0,0x03,0xff,0xff,0x0f,0x03,0x00,0x00,0xc0,0x03,0xc0,0x03,0x00,0x03,
- 0x00,0x00,0xc0,0x03,0xc0,0x03,0x00,0x03,0x00,0x00,0x00,0x03,0x0c,0x00,0x00,
- 0x03,0x00,0x00,0x00,0x03,0x0c,0x00,0x00,0x03,0x00,0x00,0x00,0x3c,0x00,0x00,
- 0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0xc0,0x03,
- 0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0x00,
- 0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,
- 0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char knightPR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0xf0, 0x03, 0x00, 0x80, 0x00,
+  0x20, 0x02, 0x00, 0xf8, 0x0f, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x0c, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x0c, 0x00, 0x80, 0x00,
+  0x20, 0x04, 0x00, 0x00, 0x1e, 0x00, 0x40, 0x00, 0x20, 0x04, 0x00, 0x00,
+  0x7e, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0xe7, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x80, 0xc3, 0x01, 0x40, 0x00, 0x40, 0x04, 0x00, 0xc0,
+  0xe1, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0xe0, 0x7f, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0xe0, 0x07, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x70,
+  0x00, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x18, 0x3c, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0xf8, 0x0f, 0x00, 0x20, 0x00, 0x80, 0x08, 0x1f, 0xf8,
+  0x00, 0x78, 0x20, 0x00, 0x80, 0x08, 0x3e, 0x00, 0x00, 0x0c, 0x20, 0x00,
+  0x80, 0x08, 0xfc, 0x80, 0x07, 0x07, 0x20, 0x00, 0x80, 0x10, 0xf0, 0xe1,
+  0x83, 0x03, 0x10, 0x00, 0x80, 0x10, 0xc0, 0xe3, 0xc0, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0x07, 0x60, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x0e,
+  0x38, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x18, 0x1c, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0x30, 0x0e, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x60,
+  0x07, 0x00, 0x10, 0x00, 0x00, 0x21, 0x00, 0xe0, 0x07, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0x80, 0x03, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x80,
+  0x03, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0xc0, 0x03, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0xc0, 0x01, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0xc0,
+  0x01, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0xc0, 0x01, 0x00, 0x08, 0x00,
+  0x00, 0x48, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00,
+  0x00, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x00,
+  0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00, 0xc0, 0x01, 0x00,
+  0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+  0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/knightPR_m.xbm b/xshogi/eastern_bitmaps/knightPR_m.xbm
index 6e7ee6c..bbfb1fa 100644
--- a/xshogi/eastern_bitmaps/knightPR_m.xbm
+++ b/xshogi/eastern_bitmaps/knightPR_m.xbm
@@ -1,6 +1,6 @@
 #define knightPR_m_width 49
 #define knightPR_m_height 49
-static char knightPR_m_bits[] = {
+static unsigned char knightPR_m_bits[] = {
  0xf8,0xff,0xff,0xff,0xff,0x0f,0xfe,0xf8,0xff,0xff,0xff,0xff,0x0f,0xfe,0xf8,
  0xff,0xff,0xff,0xff,0x1f,0xfe,0xf8,0xff,0xff,0xff,0xff,0x1f,0xfe,0x38,0x00,
  0x00,0x00,0x00,0x10,0xfe,0x38,0x00,0x00,0x00,0x00,0x10,0xfe,0x38,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/knightP_l.xbm b/xshogi/eastern_bitmaps/knightP_l.xbm
index b241af4..e5fd24b 100644
--- a/xshogi/eastern_bitmaps/knightP_l.xbm
+++ b/xshogi/eastern_bitmaps/knightP_l.xbm
@@ -1,38 +1,38 @@
 #define knightP_l_width 64
 #define knightP_l_height 64
-static char knightP_l_bits[] = {
+static unsigned char knightP_l_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x00,0x00,0xe0,0x01,0x00,0x00,0x64,0x00,0x00,0x00,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x00,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x00,0x00,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0x80,0x03,0x00,0x04,0x00,0x00,0x12,0x00,0x80,0x03,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0x80,0x03,0x00,0x04,0x00,0x00,0x11,0x00,0xc0,
+ 0x03,0x00,0x04,0x00,0x00,0x11,0x00,0xc0,0x01,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0xc0,0x01,0x00,0x04,0x00,0x00,0x11,0x00,0xe0,0x07,0x00,0x04,0x00,0x00,0x09,
+ 0x00,0xe0,0x06,0x00,0x08,0x00,0x80,0x08,0x00,0x70,0x0c,0x00,0x08,0x00,0x80,
+ 0x08,0x00,0x38,0x18,0x00,0x08,0x00,0x80,0x08,0x00,0x1c,0x70,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x06,0xe0,0x00,0x08,0x00,0x80,0x08,0x00,0x03,0xc7,0x03,0x08,
+ 0x00,0x80,0x08,0xc0,0xc1,0x87,0x0f,0x08,0x00,0x40,0x04,0xe0,0xe0,0x01,0x3f,
+ 0x10,0x00,0x40,0x04,0x30,0x00,0x00,0x7c,0x10,0x00,0x40,0x04,0x1e,0x00,0x1f,
+ 0xf8,0x10,0x00,0x40,0x04,0x00,0xf0,0x1f,0x00,0x10,0x00,0x40,0x04,0x00,0x3c,
+ 0x18,0x00,0x10,0x00,0x40,0x04,0x00,0x00,0x0e,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0xe0,0x07,0x00,0x20,0x00,0x20,0x02,0x00,0xfe,0x07,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x87,0x03,0x00,0x20,0x00,0x20,0x02,0x80,0xc3,0x01,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0xe7,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x7e,0x00,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x78,0x00,0x00,0x20,0x00,0x10,0x01,0x00,0x30,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x30,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0xf0,0x1f,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0xc0,0x0f,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,
- 0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,
- 0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0xc0,0x00,0x00,0x30,0xc0,0x00,0x00,
- 0x00,0xc0,0x00,0x00,0x30,0xc0,0x00,0x00,0x00,0xc0,0x00,0xc0,0x03,0xc0,0x03,
- 0x00,0x00,0xc0,0x00,0xc0,0x03,0xc0,0x03,0x00,0x00,0xc0,0xf0,0xff,0xff,0xc0,
- 0x03,0x00,0x00,0xc0,0xf0,0xff,0xff,0xc0,0x03,0x00,0x00,0x30,0xf0,0xc0,0x03,
- 0x00,0x03,0x00,0x00,0x30,0xf0,0xc0,0x03,0x00,0x03,0x00,0x00,0x30,0xf0,0x00,
- 0x0f,0x00,0x0f,0x00,0x00,0x30,0xf0,0x00,0x0f,0x00,0x0f,0x00,0x00,0x30,0xf0,
- 0x3f,0xcf,0x03,0x0f,0x00,0x00,0x30,0xf0,0x3f,0xcf,0x03,0x0f,0x00,0x00,0x30,
- 0xf0,0x3c,0xfc,0x00,0x0f,0x00,0x00,0x30,0xf0,0x3c,0xfc,0x00,0x0f,0x00,0x00,
- 0x0c,0xf0,0x3c,0x3c,0x00,0x0c,0x00,0x00,0x0c,0xf0,0x3c,0x3c,0x00,0x0c,0x00,
- 0x00,0x0c,0xf0,0x3c,0xf3,0x03,0x3c,0x00,0x00,0x0c,0xf0,0x3c,0xf3,0x03,0x3c,
- 0x00,0x00,0x0c,0x30,0x3c,0xc0,0x00,0x3c,0x00,0x00,0x0c,0x30,0x3c,0xc0,0x00,
- 0x3c,0x00,0x00,0x0c,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0x0c,0x00,0x00,0x00,
- 0x00,0x3c,0x00,0x00,0x03,0xc0,0x03,0x3c,0x00,0x30,0x00,0x00,0x03,0xc0,0x03,
- 0x3c,0x00,0x30,0x00,0x00,0x03,0xc0,0x03,0x3c,0x00,0xf0,0x00,0x00,0x03,0xc0,
- 0x03,0x3c,0x00,0xf0,0x00,0x00,0x03,0xfc,0xcf,0xff,0x03,0xf0,0x00,0x00,0x03,
- 0xfc,0xcf,0xff,0x03,0xf0,0x00,0x00,0x03,0xc0,0x03,0x3c,0x00,0xf0,0x00,0x00,
- 0x03,0xc0,0x03,0x3c,0x00,0xf0,0x00,0xc0,0x00,0xf0,0xcf,0xff,0x0f,0xc0,0x00,
- 0xc0,0x00,0xf0,0xcf,0xff,0x0f,0xc0,0x00,0xc0,0x00,0xcc,0x03,0x3c,0x00,0xc0,
- 0x03,0xc0,0x00,0xcc,0x03,0x3c,0x00,0xc0,0x03,0xc0,0x00,0xc0,0xc3,0xff,0x03,
- 0xc0,0x03,0xc0,0x00,0xc0,0xc3,0xff,0x03,0xc0,0x03,0xc0,0x00,0xc0,0x03,0x3c,
- 0x00,0xc0,0x03,0xc0,0x00,0xc0,0x03,0x3c,0x00,0xc0,0x03,0x30,0x00,0xc0,0x03,
- 0x3c,0x00,0x00,0x03,0x30,0x00,0xc0,0x03,0x3c,0x00,0x00,0x03,0x30,0x00,0xc0,
- 0xf3,0xff,0x0f,0x00,0x0f,0x30,0x00,0xc0,0xf3,0xff,0x0f,0x00,0x0f,0x30,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0f,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x30,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,
- 0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f};
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/eastern_bitmaps/knightP_m.xbm b/xshogi/eastern_bitmaps/knightP_m.xbm
index 6ab8dd9..a91cc6d 100644
--- a/xshogi/eastern_bitmaps/knightP_m.xbm
+++ b/xshogi/eastern_bitmaps/knightP_m.xbm
@@ -1,6 +1,6 @@
 #define knightP_m_width 49
 #define knightP_m_height 49
-static char knightP_m_bits[] = {
+static unsigned char knightP_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,
  0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,
diff --git a/xshogi/eastern_bitmaps/knightR.xbm b/xshogi/eastern_bitmaps/knightR.xbm
index 8db7098..79c3b31 100644
--- a/xshogi/eastern_bitmaps/knightR.xbm
+++ b/xshogi/eastern_bitmaps/knightR.xbm
@@ -1,6 +1,6 @@
 #define knightR_width 32
 #define knightR_height 32
-static char knightR_bits[] = {
+static unsigned char knightR_bits[] = {
  0xfc,0xff,0xff,0x1f,0x04,0x00,0x00,0x30,0x04,0x00,0x00,0x30,0x04,0x4c,0x15,
  0x30,0x04,0x06,0x00,0x30,0x08,0xfe,0x0f,0x18,0x08,0xc0,0x0c,0x18,0x08,0xf8,
  0x0f,0x18,0x08,0xc0,0x0c,0x18,0x10,0xf8,0x0f,0x0c,0x10,0xc0,0x0c,0x0c,0x10,
diff --git a/xshogi/eastern_bitmaps/knightR_l.xbm b/xshogi/eastern_bitmaps/knightR_l.xbm
index 6c1052b..20cb8e6 100644
--- a/xshogi/eastern_bitmaps/knightR_l.xbm
+++ b/xshogi/eastern_bitmaps/knightR_l.xbm
@@ -1,38 +1,46 @@
 #define knightR_l_width 64
 #define knightR_l_height 64
-static char knightR_l_bits[] = {
- 0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x0c,0xf0,0x00,0xc0,0xc3,0xcc,0x0c,0x00,0x0c,0xf0,0x00,0xc0,
- 0xc3,0xcc,0x0c,0x00,0x0c,0xc0,0x00,0xf0,0x00,0x00,0x00,0x00,0x0c,0xc0,0x00,
- 0xf0,0x00,0x00,0x00,0x00,0x0c,0xc0,0x03,0xf0,0xff,0xff,0x03,0x00,0x03,0xc0,
- 0x03,0xf0,0xff,0xff,0x03,0x00,0x03,0xc0,0x03,0x00,0xc0,0xc3,0x03,0x00,0x03,
- 0xc0,0x03,0x00,0xc0,0xc3,0x03,0x00,0x03,0xc0,0x03,0x00,0xff,0xff,0x03,0x00,
- 0x03,0xc0,0x03,0x00,0xff,0xff,0x03,0x00,0x03,0x00,0x03,0x00,0xc0,0xc3,0x03,
- 0x00,0x03,0x00,0x03,0x00,0xc0,0xc3,0x03,0x00,0x03,0x00,0x0f,0x00,0xff,0xff,
- 0x03,0xc0,0x00,0x00,0x0f,0x00,0xff,0xff,0x03,0xc0,0x00,0x00,0x0f,0x00,0xc0,
- 0xc3,0x03,0xc0,0x00,0x00,0x0f,0x00,0xc0,0xc3,0x03,0xc0,0x00,0x00,0x0f,0xc0,
- 0xff,0xff,0x03,0xc0,0x00,0x00,0x0f,0xc0,0xff,0xff,0x03,0xc0,0x00,0x00,0x0c,
- 0x00,0x00,0x00,0x00,0xc0,0x00,0x00,0x0c,0x00,0x00,0x00,0x00,0xc0,0x00,0x00,
- 0x3c,0xf0,0xff,0xcf,0x03,0x30,0x00,0x00,0x3c,0xf0,0xff,0xcf,0x03,0x30,0x00,
- 0x00,0x3c,0x00,0xf0,0xc0,0x03,0x30,0x00,0x00,0x3c,0x00,0xf0,0xc0,0x03,0x30,
- 0x00,0x00,0x3c,0x00,0xff,0xcf,0x03,0x30,0x00,0x00,0x3c,0x00,0xff,0xcf,0x03,
- 0x30,0x00,0x00,0x30,0x00,0xf0,0xc0,0x33,0x30,0x00,0x00,0x30,0x00,0xf0,0xc0,
- 0x33,0x30,0x00,0x00,0xf0,0xc0,0xff,0xcf,0x0f,0x0c,0x00,0x00,0xf0,0xc0,0xff,
- 0xcf,0x0f,0x0c,0x00,0x00,0xf0,0x00,0xf0,0xc0,0x03,0x0c,0x00,0x00,0xf0,0x00,
- 0xf0,0xc0,0x03,0x0c,0x00,0x00,0xf0,0x00,0xff,0xcf,0x3f,0x0c,0x00,0x00,0xf0,
- 0x00,0xff,0xcf,0x3f,0x0c,0x00,0x00,0xc0,0x00,0xf0,0xc0,0x03,0x0c,0x00,0x00,
- 0xc0,0x00,0xf0,0xc0,0x03,0x0c,0x00,0x00,0xc0,0x03,0xf0,0xc0,0x03,0x03,0x00,
- 0x00,0xc0,0x03,0xf0,0xc0,0x03,0x03,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x03,
- 0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x03,0x00,0x00,0x00,0x03,0x00,0x00,0x00,
- 0x03,0x00,0x00,0x00,0x03,0x00,0x00,0x00,0x03,0x00,0x00,0x00,0x3c,0x00,0x00,
- 0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0xc0,0x03,
- 0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0x00,
- 0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,
- 0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char knightR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x1e,
+  0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x1f, 0x00, 0x00, 0x80, 0x00,
+  0x10, 0x02, 0x00, 0x1f, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x80, 0x31,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0xc0, 0x31, 0x00, 0x00, 0x80, 0x00,
+  0x20, 0x02, 0xc0, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x60, 0x38,
+  0xe7, 0x0e, 0x80, 0x00, 0x20, 0x02, 0x70, 0x38, 0xe7, 0x0e, 0x80, 0x00,
+  0x20, 0x04, 0x30, 0x70, 0xc6, 0x0c, 0x40, 0x00, 0x20, 0x04, 0x30, 0x60,
+  0x8c, 0x08, 0x40, 0x00, 0x40, 0x04, 0x70, 0x00, 0x00, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0xf0, 0x7f, 0x00, 0x00, 0x40, 0x00, 0x40, 0x04, 0xe0, 0xff,
+  0x7f, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0xfc, 0x6f, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x00, 0x63, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0xf0,
+  0x7f, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0x63, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0xf0, 0x7f, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00,
+  0x63, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0xe0, 0x7f, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0xf0, 0x5f, 0x00, 0x20, 0x00, 0x80, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x10, 0x00, 0x80, 0x10, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0x00, 0x40, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x00,
+  0x62, 0x00, 0x10, 0x00, 0x00, 0x11, 0xe0, 0xff, 0xe3, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0xe0, 0xff, 0xe1, 0x04, 0x10, 0x00, 0x00, 0x11, 0x40, 0x1c,
+  0x60, 0x06, 0x10, 0x00, 0x00, 0x21, 0x00, 0x98, 0x61, 0x07, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0xff, 0xe0, 0x03, 0x08, 0x00, 0x00, 0x22, 0x80, 0x3f,
+  0xe0, 0x01, 0x08, 0x00, 0x00, 0x22, 0x00, 0xd8, 0xe1, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0xff, 0xe0, 0x00, 0x08, 0x00, 0x00, 0x24, 0x80, 0x3f,
+  0x60, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0x98, 0x61, 0x0e, 0x08, 0x00,
+  0x00, 0x48, 0x00, 0xfe, 0xf8, 0x07, 0x04, 0x00, 0x00, 0x50, 0x00, 0xff,
+  0xf0, 0x03, 0x04, 0x00, 0x00, 0x50, 0x00, 0x18, 0x60, 0x00, 0x04, 0x00,
+  0x00, 0x60, 0x00, 0x18, 0x60, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x18,
+  0x20, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x08, 0x00, 0xc0, 0x01, 0x00,
+  0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+  0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/knightR_m.xbm b/xshogi/eastern_bitmaps/knightR_m.xbm
index 6d60cdd..3d62be5 100644
--- a/xshogi/eastern_bitmaps/knightR_m.xbm
+++ b/xshogi/eastern_bitmaps/knightR_m.xbm
@@ -1,6 +1,6 @@
 #define knightR_m_width 49
 #define knightR_m_height 49
-static char knightR_m_bits[] = {
+static unsigned char knightR_m_bits[] = {
  0xf8,0xff,0xff,0xff,0xff,0x0f,0xfe,0xf8,0xff,0xff,0xff,0xff,0x0f,0xfe,0xf8,
  0xff,0xff,0xff,0xff,0x1f,0xfe,0xf8,0xff,0xff,0xff,0xff,0x1f,0xfe,0x38,0x00,
  0x00,0x00,0x00,0x10,0xfe,0x38,0x00,0x00,0x00,0x00,0x10,0xfe,0x38,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/knight_l.xbm b/xshogi/eastern_bitmaps/knight_l.xbm
index 911f593..4977efb 100644
--- a/xshogi/eastern_bitmaps/knight_l.xbm
+++ b/xshogi/eastern_bitmaps/knight_l.xbm
@@ -1,38 +1,38 @@
 #define knight_l_width 64
 #define knight_l_height 64
-static char knight_l_bits[] = {
+static unsigned char knight_l_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x00,0x10,0xe0,0x01,0x00,0x00,0x64,0x00,0x04,0x18,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x06,0x18,0x00,0x02,0x00,0x00,0x22,0x00,0x06,0x18,0x00,0x02,
+ 0x00,0x00,0x22,0xc0,0x0f,0xff,0x00,0x02,0x00,0x00,0x22,0xe0,0x1f,0x7f,0x00,
+ 0x02,0x00,0x00,0x12,0x70,0x86,0x19,0x00,0x04,0x00,0x00,0x12,0x00,0x06,0xfc,
+ 0x01,0x04,0x00,0x00,0x11,0x00,0x07,0xff,0x00,0x04,0x00,0x00,0x11,0x00,0x87,
+ 0x1b,0x00,0x04,0x00,0x00,0x11,0x80,0x07,0xfc,0x01,0x04,0x00,0x00,0x11,0xc0,
+ 0x07,0xff,0x00,0x04,0x00,0x00,0x11,0xe0,0x86,0x19,0x00,0x04,0x00,0x00,0x09,
+ 0x60,0x06,0x38,0x02,0x08,0x00,0x80,0x08,0x20,0x87,0xff,0x07,0x08,0x00,0x80,
+ 0x08,0x00,0xc7,0xff,0x07,0x08,0x00,0x80,0x08,0x00,0x46,0x00,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x02,0x00,0x00,0x08,0x00,0x80,0x08,0x00,0x00,0x00,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x00,0x00,0x00,0x08,0x00,0x40,0x04,0x00,0xfa,0x0f,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0xfe,0x07,0x00,0x10,0x00,0x40,0x04,0x00,0xc6,0x00,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0xfe,0x0f,0x00,0x10,0x00,0x40,0x04,0x00,0xc6,
+ 0x00,0x00,0x10,0x00,0x40,0x04,0x00,0xfe,0x0f,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0xc6,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0xf6,0x3f,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0xfe,0xff,0x07,0x20,0x00,0x20,0x02,0x00,0x00,0xfe,0x0f,0x20,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x0e,0x20,0x00,0x20,0x02,0x10,0x31,0x06,0x0c,0x20,0x00,
+ 0x10,0x02,0x30,0x63,0x0e,0x0c,0x20,0x00,0x10,0x01,0x70,0xe7,0x1c,0x0e,0x40,
+ 0x00,0x10,0x01,0x70,0xe7,0x1c,0x06,0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x03,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x8c,0x03,0x40,0x00,0x20,0x01,0x00,0x00,0x8c,
+ 0x01,0x40,0x00,0x20,0x01,0x00,0x00,0xf8,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0xf8,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x78,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,
- 0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,
- 0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x00,0x00,
- 0x00,0xc0,0x00,0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x03,
- 0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0xc0,0xc0,0x03,0x0f,0xc0,
- 0x03,0x00,0x00,0xc0,0xc0,0x03,0x0f,0xc0,0x03,0x00,0x00,0x30,0xc0,0x03,0x0f,
- 0x00,0x03,0x00,0x00,0x30,0xc0,0x03,0x0f,0x00,0x03,0x00,0x00,0x30,0xfc,0xf3,
- 0xff,0x00,0x0f,0x00,0x00,0x30,0xfc,0xf3,0xff,0x00,0x0f,0x00,0x00,0x30,0xc0,
- 0x03,0x0f,0x00,0x0f,0x00,0x00,0x30,0xc0,0x03,0x0f,0x00,0x0f,0x00,0x00,0x30,
- 0xf0,0xf3,0xff,0x03,0x0f,0x00,0x00,0x30,0xf0,0xf3,0xff,0x03,0x0f,0x00,0x00,
- 0x0c,0xcc,0x03,0x0f,0x00,0x0c,0x00,0x00,0x0c,0xcc,0x03,0x0f,0x00,0x0c,0x00,
- 0x00,0x0c,0xc0,0xf3,0xff,0x00,0x3c,0x00,0x00,0x0c,0xc0,0xf3,0xff,0x00,0x3c,
- 0x00,0x00,0x0c,0xc0,0x03,0x0f,0x00,0x3c,0x00,0x00,0x0c,0xc0,0x03,0x0f,0x00,
- 0x3c,0x00,0x00,0x0c,0xc0,0xf3,0xff,0x0f,0x3c,0x00,0x00,0x0c,0xc0,0xf3,0xff,
- 0x0f,0x3c,0x00,0x00,0x03,0x00,0x00,0x00,0x00,0x30,0x00,0x00,0x03,0x00,0x00,
- 0x00,0x00,0x30,0x00,0x00,0x03,0xc0,0xff,0xff,0x03,0xf0,0x00,0x00,0x03,0xc0,
- 0xff,0xff,0x03,0xf0,0x00,0x00,0x03,0xc0,0xc3,0x03,0x00,0xf0,0x00,0x00,0x03,
- 0xc0,0xc3,0x03,0x00,0xf0,0x00,0x00,0x03,0xc0,0xff,0xff,0x00,0xf0,0x00,0x00,
- 0x03,0xc0,0xff,0xff,0x00,0xf0,0x00,0xc0,0x00,0xc0,0xc3,0x03,0x00,0xc0,0x00,
- 0xc0,0x00,0xc0,0xc3,0x03,0x00,0xc0,0x00,0xc0,0x00,0xc0,0xff,0xff,0x00,0xc0,
- 0x03,0xc0,0x00,0xc0,0xff,0xff,0x00,0xc0,0x03,0xc0,0x00,0xc0,0xc3,0x03,0x00,
- 0xc0,0x03,0xc0,0x00,0xc0,0xc3,0x03,0x00,0xc0,0x03,0xc0,0x00,0xc0,0xff,0xff,
- 0x0f,0xc0,0x03,0xc0,0x00,0xc0,0xff,0xff,0x0f,0xc0,0x03,0x30,0x00,0x00,0x00,
- 0x00,0x0f,0x00,0x03,0x30,0x00,0x00,0x00,0x00,0x0f,0x00,0x03,0x30,0x00,0x30,
- 0x33,0xc3,0x03,0x00,0x0f,0x30,0x00,0x30,0x33,0xc3,0x03,0x00,0x0f,0x30,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0f,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x30,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,
- 0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f};
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/eastern_bitmaps/knight_m.xbm b/xshogi/eastern_bitmaps/knight_m.xbm
index 492672e..c73de5e 100644
--- a/xshogi/eastern_bitmaps/knight_m.xbm
+++ b/xshogi/eastern_bitmaps/knight_m.xbm
@@ -1,6 +1,6 @@
 #define knight_m_width 49
 #define knight_m_height 49
-static char knight_m_bits[] = {
+static unsigned char knight_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,
  0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,
diff --git a/xshogi/eastern_bitmaps/lance.xbm b/xshogi/eastern_bitmaps/lance.xbm
index acdb78b..9128d57 100644
--- a/xshogi/eastern_bitmaps/lance.xbm
+++ b/xshogi/eastern_bitmaps/lance.xbm
@@ -1,6 +1,6 @@
 #define lance_width 32
 #define lance_height 32
-static char lance_bits[] = {
+static unsigned char lance_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x01,
  0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,0x00,0x00,0x03,0x60,0x00,0x80,0x00,
  0x87,0x00,0x80,0xf0,0x87,0x01,0x80,0x80,0x81,0x01,0x40,0xfe,0x3f,0x01,0x40,
diff --git a/xshogi/eastern_bitmaps/lanceP.xbm b/xshogi/eastern_bitmaps/lanceP.xbm
index bc77e48..0f2a0a2 100644
--- a/xshogi/eastern_bitmaps/lanceP.xbm
+++ b/xshogi/eastern_bitmaps/lanceP.xbm
@@ -1,6 +1,6 @@
 #define lanceP_width 32
 #define lanceP_height 32
-static char lanceP_bits[] = {
+static unsigned char lanceP_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xe0,0x00,
  0x00,0x00,0x18,0x03,0x00,0x00,0x06,0x0c,0x00,0x80,0x01,0x30,0x00,0x40,0x00,
  0x42,0x00,0x40,0xc0,0xc0,0x00,0x40,0xfe,0xc7,0x00,0x20,0xc6,0x80,0x00,0x20,
diff --git a/xshogi/eastern_bitmaps/lancePR.xbm b/xshogi/eastern_bitmaps/lancePR.xbm
index 4bb4c42..7dde20e 100644
--- a/xshogi/eastern_bitmaps/lancePR.xbm
+++ b/xshogi/eastern_bitmaps/lancePR.xbm
@@ -1,6 +1,6 @@
 #define lancePR_width 32
 #define lancePR_height 32
-static char lancePR_bits[] = {
+static unsigned char lancePR_bits[] = {
  0xfc,0xff,0xff,0x1f,0x04,0x00,0x00,0x30,0x04,0xf8,0x07,0x30,0x04,0x18,0x06,
  0x30,0x04,0xf8,0x07,0x30,0x08,0x1b,0x36,0x18,0x08,0xfe,0x1f,0x18,0x08,0xcc,
  0x0c,0x18,0x08,0xd8,0x06,0x18,0x10,0xfe,0x1f,0x0c,0x10,0xc0,0x00,0x0c,0x10,
diff --git a/xshogi/eastern_bitmaps/lancePR_l.xbm b/xshogi/eastern_bitmaps/lancePR_l.xbm
index 5b8dd9a..36bc4d4 100644
--- a/xshogi/eastern_bitmaps/lancePR_l.xbm
+++ b/xshogi/eastern_bitmaps/lancePR_l.xbm
@@ -1,38 +1,46 @@
 #define lancePR_l_width 64
 #define lancePR_l_height 64
-static char lancePR_l_bits[] = {
- 0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xc0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x3f,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x30,0xc0,0x03,0x00,0x00,0x00,
- 0x00,0x00,0x30,0xc0,0x03,0x00,0xfc,0xff,0x03,0x00,0x30,0xc0,0x03,0x00,0xfc,
- 0xff,0x03,0x00,0x30,0xc0,0x03,0x00,0x3c,0xc0,0x03,0x00,0x30,0xc0,0x03,0x00,
- 0x3c,0xc0,0x03,0x00,0x30,0x00,0x03,0x00,0xfc,0xff,0x03,0x00,0x30,0x00,0x03,
- 0x00,0xfc,0xff,0x03,0x00,0x30,0x00,0x0f,0xf0,0x3c,0xc0,0xf3,0x00,0x0c,0x00,
- 0x0f,0xf0,0x3c,0xc0,0xf3,0x00,0x0c,0x00,0x0f,0xc0,0xff,0xff,0x3f,0x00,0x0c,
- 0x00,0x0f,0xc0,0xff,0xff,0x3f,0x00,0x0c,0x00,0x0f,0x00,0x0f,0x0f,0x0f,0x00,
- 0x0c,0x00,0x0f,0x00,0x0f,0x0f,0x0f,0x00,0x0c,0x00,0x0c,0x00,0x3c,0xcf,0x03,
- 0x00,0x0c,0x00,0x0c,0x00,0x3c,0xcf,0x03,0x00,0x0c,0x00,0x3c,0xc0,0xff,0xff,
- 0x3f,0x00,0x03,0x00,0x3c,0xc0,0xff,0xff,0x3f,0x00,0x03,0x00,0x3c,0x00,0x00,
- 0x0f,0x00,0x00,0x03,0x00,0x3c,0x00,0x00,0x0f,0x00,0x00,0x03,0x00,0x3c,0x00,
- 0xfc,0xff,0x03,0x00,0x03,0x00,0x3c,0x00,0xfc,0xff,0x03,0x00,0x03,0x00,0x30,
- 0x00,0xfc,0x00,0x00,0x00,0x03,0x00,0x30,0x00,0xfc,0x00,0x00,0x00,0x03,0x00,
- 0xf0,0x00,0x00,0x00,0x00,0xc0,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0xc0,0x00,
- 0x00,0xf0,0x00,0x0c,0xc0,0x30,0xc0,0x00,0x00,0xf0,0x00,0x0c,0xc0,0x30,0xc0,
- 0x00,0x00,0xf0,0x00,0x3f,0xf3,0x3c,0xc0,0x00,0x00,0xf0,0x00,0x3f,0xf3,0x3c,
- 0xc0,0x00,0x00,0xc0,0x00,0xf0,0xf0,0x3c,0xc0,0x00,0x00,0xc0,0x00,0xf0,0xf0,
- 0x3c,0xc0,0x00,0x00,0xc0,0x03,0xfc,0xf0,0x3c,0x30,0x00,0x00,0xc0,0x03,0xfc,
- 0xf0,0x3c,0x30,0x00,0x00,0xc0,0x03,0xcf,0xf3,0x3f,0x30,0x00,0x00,0xc0,0x03,
- 0xcf,0xf3,0x3f,0x30,0x00,0x00,0xc0,0x03,0xc0,0x03,0x3c,0x30,0x00,0x00,0xc0,
- 0x03,0xc0,0x03,0x3c,0x30,0x00,0x00,0x00,0x03,0x00,0x0f,0x3c,0x30,0x00,0x00,
- 0x00,0x03,0x00,0x0f,0x3c,0x30,0x00,0x00,0x00,0x0f,0xfc,0xff,0x3f,0x0c,0x00,
- 0x00,0x00,0x0f,0xfc,0xff,0x3f,0x0c,0x00,0x00,0x00,0x0f,0x00,0x0f,0x00,0x0c,
- 0x00,0x00,0x00,0x0f,0x00,0x0f,0x00,0x0c,0x00,0x00,0x00,0x0c,0x30,0x00,0x00,
- 0x0c,0x00,0x00,0x00,0x0c,0x30,0x00,0x00,0x0c,0x00,0x00,0x00,0xf0,0x00,0x00,
- 0xc0,0x03,0x00,0x00,0x00,0xf0,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,
- 0x00,0x3c,0x00,0x00,0x00,0x00,0x00,0x0f,0x00,0x3c,0x00,0x00,0x00,0x00,0x00,
- 0xf0,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0xf0,0xc0,0x03,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x3f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char lancePR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0xc0,
+  0x0f, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0xf0, 0x1f, 0x00, 0x80, 0x00,
+  0x20, 0x04, 0x00, 0xf0, 0x1f, 0x00, 0x40, 0x00, 0x20, 0x04, 0x00, 0x60,
+  0x38, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x30, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x00, 0x30, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00,
+  0x18, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x1c, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x00, 0x3e, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x80,
+  0x7f, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0xe0, 0xff, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0xe0, 0xe7, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00,
+  0xe7, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0xe3, 0x01, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0x3f, 0xe3, 0x01, 0x20, 0x00, 0x80, 0x10, 0x80, 0x1f,
+  0xc3, 0x00, 0x10, 0x00, 0x80, 0x10, 0xc0, 0x07, 0x03, 0x1c, 0x10, 0x00,
+  0x00, 0x11, 0xc0, 0x03, 0x03, 0x1e, 0x10, 0x00, 0x00, 0x11, 0xc0, 0xff,
+  0xbf, 0x1f, 0x10, 0x00, 0x00, 0x11, 0x80, 0xff, 0x7f, 0x0f, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0x1f, 0x03, 0x07, 0x10, 0x00, 0x00, 0x11, 0x00, 0x00,
+  0xbb, 0x03, 0x10, 0x00, 0x00, 0x21, 0x00, 0xe0, 0x1f, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0xf0, 0x1f, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00,
+  0x0e, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x80, 0x07, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0x80, 0x07, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0x80,
+  0x03, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0x80, 0x01, 0x00, 0x08, 0x00,
+  0x00, 0x48, 0x00, 0x80, 0x07, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00,
+  0x06, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x00,
+  0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00, 0xc0, 0x01, 0x00,
+  0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+  0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/lancePR_m.xbm b/xshogi/eastern_bitmaps/lancePR_m.xbm
index e18b961..a87e065 100644
--- a/xshogi/eastern_bitmaps/lancePR_m.xbm
+++ b/xshogi/eastern_bitmaps/lancePR_m.xbm
@@ -1,6 +1,6 @@
 #define lancePR_m_width 49
 #define lancePR_m_height 49
-static char lancePR_m_bits[] = {
+static unsigned char lancePR_m_bits[] = {
  0xf0,0xff,0xff,0xff,0xff,0x1f,0xfe,0xf0,0xff,0xff,0xff,0xff,0x1f,0xfe,0xf0,
  0xff,0xff,0xff,0xff,0x7f,0xfe,0xf0,0xff,0xff,0xff,0xff,0x7f,0xfe,0x70,0x00,
  0x00,0x00,0x00,0x60,0xfe,0x70,0x00,0xf8,0xff,0x00,0x60,0xfe,0x70,0x00,0xf8,
diff --git a/xshogi/eastern_bitmaps/lanceP_l.xbm b/xshogi/eastern_bitmaps/lanceP_l.xbm
index 24ec0f5..ce6c8eb 100644
--- a/xshogi/eastern_bitmaps/lanceP_l.xbm
+++ b/xshogi/eastern_bitmaps/lanceP_l.xbm
@@ -1,38 +1,38 @@
 #define lanceP_l_width 64
 #define lanceP_l_height 64
-static char lanceP_l_bits[] = {
+static unsigned char lanceP_l_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x00,0x00,0xe0,0x01,0x00,0x00,0x64,0x00,0x00,0x00,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x00,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x60,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0xe0,0x01,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0x80,0x01,0x00,0x04,0x00,0x00,0x12,0x00,0xc0,0x01,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0xe0,0x01,0x00,0x04,0x00,0x00,0x11,0x00,0xe0,
+ 0x01,0x00,0x04,0x00,0x00,0x11,0x00,0x70,0x00,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0xf8,0x0f,0x00,0x04,0x00,0x00,0x11,0x00,0xf8,0x07,0x00,0x04,0x00,0x00,0x09,
+ 0xc0,0xdd,0x00,0x00,0x08,0x00,0x80,0x08,0xe0,0xc0,0xf8,0x00,0x08,0x00,0x80,
+ 0x08,0xf0,0xfe,0xff,0x01,0x08,0x00,0x80,0x08,0xf8,0xfd,0xff,0x03,0x08,0x00,
+ 0x80,0x08,0x78,0xc0,0xc0,0x03,0x08,0x00,0x80,0x08,0x38,0xc0,0xe0,0x03,0x08,
+ 0x00,0x80,0x08,0x00,0xc3,0xf8,0x01,0x08,0x00,0x40,0x04,0x80,0xc7,0xfc,0x00,
+ 0x10,0x00,0x40,0x04,0x80,0xc7,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0xe7,0x00,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0xe7,0x07,0x00,0x10,0x00,0x40,0x04,0x00,0xff,
+ 0x07,0x00,0x10,0x00,0x40,0x04,0x00,0xfe,0x01,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0x7c,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x38,0x00,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x18,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x0c,0x00,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0x0c,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x1c,0x06,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0xf8,0x0f,0x00,0x20,0x00,0x10,0x01,0x00,0xf8,0x0f,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0xf0,0x03,0x00,0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xfc,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xfc,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0x0f,0x00,0x00,0x00,0x00,0x00,0xc0,
- 0x03,0x0f,0x00,0x00,0x00,0x00,0x00,0x3c,0x00,0xf0,0x00,0x00,0x00,0x00,0x00,
- 0x3c,0x00,0xf0,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0x0f,0x00,0x00,0x00,
- 0xc0,0x03,0x00,0x00,0x0f,0x00,0x00,0x00,0x30,0x00,0x00,0x0c,0x30,0x00,0x00,
- 0x00,0x30,0x00,0x00,0x0c,0x30,0x00,0x00,0x00,0x30,0x00,0xf0,0x00,0xf0,0x00,
- 0x00,0x00,0x30,0x00,0xf0,0x00,0xf0,0x00,0x00,0x00,0x30,0xfc,0xff,0x3f,0xf0,
- 0x00,0x00,0x00,0x30,0xfc,0xff,0x3f,0xf0,0x00,0x00,0x00,0x0c,0x3c,0xf0,0x00,
- 0xc0,0x00,0x00,0x00,0x0c,0x3c,0xf0,0x00,0xc0,0x00,0x00,0x00,0x0c,0x3c,0xc0,
- 0x03,0xc0,0x03,0x00,0x00,0x0c,0x3c,0xc0,0x03,0xc0,0x03,0x00,0x00,0x0c,0xfc,
- 0xcf,0xf3,0xc0,0x03,0x00,0x00,0x0c,0xfc,0xcf,0xf3,0xc0,0x03,0x00,0x00,0x0c,
- 0x3c,0x0f,0x3f,0xc0,0x03,0x00,0x00,0x0c,0x3c,0x0f,0x3f,0xc0,0x03,0x00,0x00,
- 0x03,0x3c,0x0f,0x0f,0x00,0x03,0x00,0x00,0x03,0x3c,0x0f,0x0f,0x00,0x03,0x00,
- 0x00,0x03,0x3c,0xcf,0xfc,0x00,0x0f,0x00,0x00,0x03,0x3c,0xcf,0xfc,0x00,0x0f,
- 0x00,0x00,0x03,0x0c,0x03,0x30,0x00,0x0f,0x00,0x00,0x03,0x0c,0x03,0x30,0x00,
- 0x0f,0x00,0x00,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x03,0x00,0x00,0x00,
- 0x00,0x0f,0x00,0xc0,0x00,0x00,0x00,0x3f,0x00,0x0c,0x00,0xc0,0x00,0x00,0x00,
- 0x3f,0x00,0x0c,0x00,0xc0,0x00,0xc0,0xff,0x3f,0x00,0x3c,0x00,0xc0,0x00,0xc0,
- 0xff,0x3f,0x00,0x3c,0x00,0xc0,0x00,0x00,0xf0,0x00,0x00,0x3c,0x00,0xc0,0x00,
- 0x00,0xf0,0x00,0x00,0x3c,0x00,0xc0,0x00,0xfc,0xff,0xff,0x03,0x3c,0x00,0xc0,
- 0x00,0xfc,0xff,0xff,0x03,0x3c,0x00,0x30,0x00,0xc0,0xf3,0x3c,0x00,0x30,0x00,
- 0x30,0x00,0xc0,0xf3,0x3c,0x00,0x30,0x00,0x30,0x00,0xf0,0xf0,0xf0,0x00,0xf0,
- 0x00,0x30,0x00,0xf0,0xf0,0xf0,0x00,0xf0,0x00,0x30,0x00,0xfc,0xff,0xff,0x03,
- 0xf0,0x00,0x30,0x00,0xfc,0xff,0xff,0x03,0xf0,0x00,0x30,0x00,0xcf,0x03,0x3c,
- 0x0f,0xf0,0x00,0x30,0x00,0xcf,0x03,0x3c,0x0f,0xf0,0x00,0x0c,0x00,0xc0,0xff,
- 0x3f,0x00,0xc0,0x00,0x0c,0x00,0xc0,0xff,0x3f,0x00,0xc0,0x00,0x0c,0x00,0xc0,
- 0x03,0x3c,0x00,0xc0,0x03,0x0c,0x00,0xc0,0x03,0x3c,0x00,0xc0,0x03,0x0c,0x00,
- 0xc0,0xff,0x3f,0x00,0xc0,0x03,0x0c,0x00,0xc0,0xff,0x3f,0x00,0xc0,0x03,0x0c,
- 0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0x0c,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,
- 0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xf0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x03};
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/eastern_bitmaps/lanceP_m.xbm b/xshogi/eastern_bitmaps/lanceP_m.xbm
index f16e4b5..bdf9ab1 100644
--- a/xshogi/eastern_bitmaps/lanceP_m.xbm
+++ b/xshogi/eastern_bitmaps/lanceP_m.xbm
@@ -1,6 +1,6 @@
 #define lanceP_m_width 49
 #define lanceP_m_height 49
-static char lanceP_m_bits[] = {
+static unsigned char lanceP_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,
  0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0xf0,0x01,0x00,0x00,0xfe,0x00,0x00,0xf0,
diff --git a/xshogi/eastern_bitmaps/lanceR.xbm b/xshogi/eastern_bitmaps/lanceR.xbm
index cfe07ea..2769f5d 100644
--- a/xshogi/eastern_bitmaps/lanceR.xbm
+++ b/xshogi/eastern_bitmaps/lanceR.xbm
@@ -1,6 +1,6 @@
 #define lanceR_width 32
 #define lanceR_height 32
-static char lanceR_bits[] = {
+static unsigned char lanceR_bits[] = {
  0xfc,0xff,0xff,0x1f,0x04,0x00,0x00,0x30,0x04,0xc0,0x00,0x30,0x04,0xfe,0x1f,
  0x30,0x04,0xc0,0x00,0x30,0x08,0xfc,0x0f,0x18,0x08,0xcc,0x0c,0x18,0x08,0xfc,
  0x0f,0x18,0x08,0xcc,0x0c,0x18,0x10,0xfc,0x0f,0x0c,0x10,0xc0,0x00,0x0c,0x10,
diff --git a/xshogi/eastern_bitmaps/lanceR_l.xbm b/xshogi/eastern_bitmaps/lanceR_l.xbm
index a3571d3..9fcb0c8 100644
--- a/xshogi/eastern_bitmaps/lanceR_l.xbm
+++ b/xshogi/eastern_bitmaps/lanceR_l.xbm
@@ -1,38 +1,46 @@
 #define lanceR_l_width 64
 #define lanceR_l_height 64
-static char lanceR_l_bits[] = {
- 0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x0c,0xf0,0x00,0x00,0xc0,0x03,0x00,0x00,0x0c,0xf0,0x00,0x00,0xc0,
- 0x03,0x00,0x00,0x0c,0xf0,0x00,0xf0,0xff,0xff,0x0f,0x00,0x0c,0xf0,0x00,0xf0,
- 0xff,0xff,0x0f,0x00,0x0c,0xc0,0x00,0x00,0xc0,0x03,0x00,0x00,0x0c,0xc0,0x00,
- 0x00,0xc0,0x03,0x00,0x00,0x0c,0xc0,0x03,0xc0,0xff,0xff,0x03,0x00,0x03,0xc0,
- 0x03,0xc0,0xff,0xff,0x03,0x00,0x03,0xc0,0x03,0xc0,0xc3,0xc3,0x03,0x00,0x03,
- 0xc0,0x03,0xc0,0xc3,0xc3,0x03,0x00,0x03,0xc0,0x03,0xc0,0xff,0xff,0x03,0x00,
- 0x03,0xc0,0x03,0xc0,0xff,0xff,0x03,0x00,0x03,0x00,0x03,0xc0,0xc3,0xc3,0x03,
- 0x00,0x03,0x00,0x03,0xc0,0xc3,0xc3,0x03,0x00,0x03,0x00,0x0f,0xc0,0xff,0xff,
- 0x03,0xc0,0x00,0x00,0x0f,0xc0,0xff,0xff,0x03,0xc0,0x00,0x00,0x0f,0x00,0xc0,
- 0x03,0x00,0xc0,0x00,0x00,0x0f,0x00,0xc0,0x03,0x00,0xc0,0x00,0x00,0x0f,0xc0,
- 0xff,0xff,0x03,0xc0,0x00,0x00,0x0f,0xc0,0xff,0xff,0x03,0xc0,0x00,0x00,0x0c,
- 0x00,0xc0,0x03,0x00,0xc0,0x00,0x00,0x0c,0x00,0xc0,0x03,0x00,0xc0,0x00,0x00,
- 0x3c,0x00,0x00,0x00,0x00,0x30,0x00,0x00,0x3c,0x00,0x00,0x00,0x00,0x30,0x00,
- 0x00,0x3c,0x00,0xff,0xff,0x00,0x30,0x00,0x00,0x3c,0x00,0xff,0xff,0x00,0x30,
- 0x00,0x00,0x3c,0x00,0x0f,0xf0,0x00,0x30,0x00,0x00,0x3c,0x00,0x0f,0xf0,0x00,
- 0x30,0x00,0x00,0x30,0x3c,0xff,0xff,0x3c,0x30,0x00,0x00,0x30,0x3c,0xff,0xff,
- 0x3c,0x30,0x00,0x00,0xf0,0xf0,0x0f,0xf0,0x0f,0x0c,0x00,0x00,0xf0,0xf0,0x0f,
- 0xf0,0x0f,0x0c,0x00,0x00,0xf0,0xc0,0xff,0xff,0x03,0x0c,0x00,0x00,0xf0,0xc0,
- 0xff,0xff,0x03,0x0c,0x00,0x00,0xf0,0x00,0xcf,0xf3,0x00,0x0c,0x00,0x00,0xf0,
- 0x00,0xcf,0xf3,0x00,0x0c,0x00,0x00,0xc0,0xf0,0xff,0xff,0x3f,0x0c,0x00,0x00,
- 0xc0,0xf0,0xff,0xff,0x3f,0x0c,0x00,0x00,0xc0,0x03,0xc0,0x03,0x00,0x03,0x00,
- 0x00,0xc0,0x03,0xc0,0x03,0x00,0x03,0x00,0x00,0xc0,0x03,0xfc,0xff,0x00,0x03,
- 0x00,0x00,0xc0,0x03,0xfc,0xff,0x00,0x03,0x00,0x00,0x00,0x03,0xfc,0x00,0x00,
- 0x03,0x00,0x00,0x00,0x03,0xfc,0x00,0x00,0x03,0x00,0x00,0x00,0x3c,0x00,0x00,
- 0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0xc0,0x03,
- 0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0x00,
- 0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,
- 0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char lanceR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x20, 0x02, 0x00, 0x00, 0x01, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x01, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x01, 0x00, 0x80, 0x00,
+  0x20, 0x04, 0xc0, 0xff, 0xff, 0x03, 0x40, 0x00, 0x20, 0x04, 0x80, 0xff,
+  0x3f, 0x07, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x01, 0x04, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0xfc, 0x7f, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x3c,
+  0x61, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x06, 0xe1, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0xff, 0xff, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x03,
+  0xc1, 0x01, 0x20, 0x00, 0x80, 0x08, 0x00, 0x07, 0xc1, 0x01, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0xff, 0x7f, 0x01, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00,
+  0x03, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0xf8, 0x1f, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0x00, 0x3f, 0x00, 0x20, 0x00, 0x80, 0x10, 0x00, 0x00,
+  0x01, 0x00, 0x10, 0x00, 0x80, 0x10, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0xe0, 0x07, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x20,
+  0x0c, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0xf0, 0x08, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0xf8, 0x1f, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x18,
+  0x18, 0x00, 0x10, 0x00, 0x00, 0x21, 0x00, 0xf0, 0x1f, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x0c,
+  0x33, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x1c, 0x19, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0xb8, 0x1d, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0x80,
+  0x01, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0xf0, 0x1f, 0x00, 0x08, 0x00,
+  0x00, 0x48, 0x00, 0x30, 0x39, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00,
+  0x01, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00, 0x06, 0x00, 0x04, 0x00,
+  0x00, 0x60, 0x00, 0x80, 0x03, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0xc0,
+  0x01, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0xc0, 0x00, 0xc0, 0x01, 0x00,
+  0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+  0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/lanceR_m.xbm b/xshogi/eastern_bitmaps/lanceR_m.xbm
index 4e78199..6792508 100644
--- a/xshogi/eastern_bitmaps/lanceR_m.xbm
+++ b/xshogi/eastern_bitmaps/lanceR_m.xbm
@@ -1,6 +1,6 @@
 #define lanceR_m_width 49
 #define lanceR_m_height 49
-static char lanceR_m_bits[] = {
+static unsigned char lanceR_m_bits[] = {
  0xf8,0xff,0xff,0xff,0xff,0x0f,0xfe,0xf8,0xff,0xff,0xff,0xff,0x0f,0xfe,0xf8,
  0xff,0xff,0xff,0xff,0x1f,0xfe,0xf8,0xff,0xff,0xff,0xff,0x1f,0xfe,0x38,0x00,
  0x00,0x00,0x00,0x10,0xfe,0x38,0x00,0xc0,0x03,0x00,0x10,0xfe,0x38,0x00,0xc0,
diff --git a/xshogi/eastern_bitmaps/lance_l.xbm b/xshogi/eastern_bitmaps/lance_l.xbm
index 2ed5d4b..c605e65 100644
--- a/xshogi/eastern_bitmaps/lance_l.xbm
+++ b/xshogi/eastern_bitmaps/lance_l.xbm
@@ -1,38 +1,38 @@
 #define lance_l_width 64
 #define lance_l_height 64
-static char lance_l_bits[] = {
+static unsigned char lance_l_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x00,0x03,0xe0,0x01,0x00,0x00,0x64,0x00,0x80,0x03,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0xc0,0x01,0x00,0x02,0x00,0x00,0x22,0x00,0x60,0x00,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x80,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x9c,0x0c,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0xf8,0x0f,0x00,0x04,0x00,0x00,0x12,0x00,0x80,0x01,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0xb8,0x1d,0x00,0x04,0x00,0x00,0x11,0x00,0x98,
+ 0x38,0x00,0x04,0x00,0x00,0x11,0x00,0xcc,0x30,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0xf8,0x0f,0x00,0x04,0x00,0x00,0x09,
+ 0x00,0x18,0x18,0x00,0x08,0x00,0x80,0x08,0x00,0xf8,0x1f,0x00,0x08,0x00,0x80,
+ 0x08,0x00,0x10,0x0f,0x00,0x08,0x00,0x80,0x08,0x00,0x30,0x04,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0xe0,0x07,0x00,0x08,0x00,0x80,0x08,0x00,0x00,0x00,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x40,0x04,0x00,0xfc,0x00,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0xf8,0x1f,0x00,0x10,0x00,0x40,0x04,0x00,0xc0,0x00,
+ 0x00,0x10,0x00,0x40,0x04,0x80,0xfe,0xff,0x00,0x10,0x00,0x40,0x04,0x80,0x83,
+ 0xe0,0x00,0x10,0x00,0x40,0x04,0x80,0x83,0xc0,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0xff,0xff,0x00,0x20,0x00,0x20,0x02,0x00,0x87,0x60,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x86,0x3c,0x00,0x20,0x00,0x20,0x02,0x00,0xfe,0x3f,0x00,0x20,0x00,0x20,
+ 0x02,0x20,0x80,0x00,0x00,0x20,0x00,0x20,0x02,0xe0,0xfc,0xff,0x01,0x20,0x00,
+ 0x10,0x02,0xc0,0xff,0xff,0x03,0x20,0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0x80,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,
- 0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,
- 0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0xc0,0x00,0x00,0x3f,0xc0,0x00,0x00,
- 0x00,0xc0,0x00,0x00,0x3f,0xc0,0x00,0x00,0x00,0xc0,0x00,0xff,0x3f,0xc0,0x03,
- 0x00,0x00,0xc0,0x00,0xff,0x3f,0xc0,0x03,0x00,0x00,0xc0,0x00,0xc0,0x03,0xc0,
- 0x03,0x00,0x00,0xc0,0x00,0xc0,0x03,0xc0,0x03,0x00,0x00,0x30,0xfc,0xff,0xff,
- 0x0f,0x03,0x00,0x00,0x30,0xfc,0xff,0xff,0x0f,0x03,0x00,0x00,0x30,0x00,0xcf,
- 0xf3,0x00,0x0f,0x00,0x00,0x30,0x00,0xcf,0xf3,0x00,0x0f,0x00,0x00,0x30,0xc0,
- 0xff,0xff,0x03,0x0f,0x00,0x00,0x30,0xc0,0xff,0xff,0x03,0x0f,0x00,0x00,0x30,
- 0xf0,0x0f,0xf0,0x0f,0x0f,0x00,0x00,0x30,0xf0,0x0f,0xf0,0x0f,0x0f,0x00,0x00,
- 0x0c,0x3c,0xff,0xff,0x3c,0x0c,0x00,0x00,0x0c,0x3c,0xff,0xff,0x3c,0x0c,0x00,
- 0x00,0x0c,0x00,0x0f,0xf0,0x00,0x3c,0x00,0x00,0x0c,0x00,0x0f,0xf0,0x00,0x3c,
- 0x00,0x00,0x0c,0x00,0xff,0xff,0x00,0x3c,0x00,0x00,0x0c,0x00,0xff,0xff,0x00,
- 0x3c,0x00,0x00,0x0c,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0x0c,0x00,0x00,0x00,
- 0x00,0x3c,0x00,0x00,0x03,0x00,0xc0,0x03,0x00,0x30,0x00,0x00,0x03,0x00,0xc0,
- 0x03,0x00,0x30,0x00,0x00,0x03,0xc0,0xff,0xff,0x03,0xf0,0x00,0x00,0x03,0xc0,
- 0xff,0xff,0x03,0xf0,0x00,0x00,0x03,0x00,0xc0,0x03,0x00,0xf0,0x00,0x00,0x03,
- 0x00,0xc0,0x03,0x00,0xf0,0x00,0x00,0x03,0xc0,0xff,0xff,0x03,0xf0,0x00,0x00,
- 0x03,0xc0,0xff,0xff,0x03,0xf0,0x00,0xc0,0x00,0xc0,0xc3,0xc3,0x03,0xc0,0x00,
- 0xc0,0x00,0xc0,0xc3,0xc3,0x03,0xc0,0x00,0xc0,0x00,0xc0,0xff,0xff,0x03,0xc0,
- 0x03,0xc0,0x00,0xc0,0xff,0xff,0x03,0xc0,0x03,0xc0,0x00,0xc0,0xc3,0xc3,0x03,
- 0xc0,0x03,0xc0,0x00,0xc0,0xc3,0xc3,0x03,0xc0,0x03,0xc0,0x00,0xc0,0xff,0xff,
- 0x03,0xc0,0x03,0xc0,0x00,0xc0,0xff,0xff,0x03,0xc0,0x03,0x30,0x00,0x00,0xc0,
- 0x03,0x00,0x00,0x03,0x30,0x00,0x00,0xc0,0x03,0x00,0x00,0x03,0x30,0x00,0xf0,
- 0xff,0xff,0x0f,0x00,0x0f,0x30,0x00,0xf0,0xff,0xff,0x0f,0x00,0x0f,0x30,0x00,
- 0x00,0xc0,0x03,0x00,0x00,0x0f,0x30,0x00,0x00,0xc0,0x03,0x00,0x00,0x0f,0x30,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,
- 0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f};
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/eastern_bitmaps/lance_m.xbm b/xshogi/eastern_bitmaps/lance_m.xbm
index b03f104..8a61a1a 100644
--- a/xshogi/eastern_bitmaps/lance_m.xbm
+++ b/xshogi/eastern_bitmaps/lance_m.xbm
@@ -1,6 +1,6 @@
 #define lance_m_width 49
 #define lance_m_height 49
-static char lance_m_bits[] = {
+static unsigned char lance_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,
  0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,
diff --git a/xshogi/eastern_bitmaps/none.xbm b/xshogi/eastern_bitmaps/none.xbm
index eea3d21..b151d7a 100644
--- a/xshogi/eastern_bitmaps/none.xbm
+++ b/xshogi/eastern_bitmaps/none.xbm
@@ -1,6 +1,6 @@
 #define none_width 32
 #define none_height 32
-static char none_bits[] = {
+static unsigned char none_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/none_l.xbm b/xshogi/eastern_bitmaps/none_l.xbm
index ed7c5dc..27efd8e 100644
--- a/xshogi/eastern_bitmaps/none_l.xbm
+++ b/xshogi/eastern_bitmaps/none_l.xbm
@@ -1,6 +1,6 @@
 #define none_l_width 64
 #define none_l_height 64
-static char none_l_bits[] = {
+static unsigned char none_l_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/none_m.xbm b/xshogi/eastern_bitmaps/none_m.xbm
index 23cf310..94b3f0a 100644
--- a/xshogi/eastern_bitmaps/none_m.xbm
+++ b/xshogi/eastern_bitmaps/none_m.xbm
@@ -1,6 +1,6 @@
 #define none_m_width 49
 #define none_m_height 49
-static char none_m_bits[] = {
+static unsigned char none_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,
  0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/pawn.xbm b/xshogi/eastern_bitmaps/pawn.xbm
index 9d1fde9..90037a4 100644
--- a/xshogi/eastern_bitmaps/pawn.xbm
+++ b/xshogi/eastern_bitmaps/pawn.xbm
@@ -1,6 +1,6 @@
 #define pawn_width 32
 #define pawn_height 32
-static char pawn_bits[] = {
+static unsigned char pawn_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x01,
  0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,0x00,0x00,0x03,0x60,0x00,0x80,0x00,
  0x80,0x00,0x80,0x00,0x80,0x01,0x80,0xc0,0x80,0x01,0x40,0xd8,0x03,0x01,0x40,
diff --git a/xshogi/eastern_bitmaps/pawnP.xbm b/xshogi/eastern_bitmaps/pawnP.xbm
index 81c4b6f..f3341ff 100644
--- a/xshogi/eastern_bitmaps/pawnP.xbm
+++ b/xshogi/eastern_bitmaps/pawnP.xbm
@@ -1,6 +1,6 @@
 #define pawnP_width 32
 #define pawnP_height 32
-static char pawnP_bits[] = {
+static unsigned char pawnP_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x01,
  0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,0x00,0x00,0x03,0x60,0x00,0x80,0x00,
  0x80,0x00,0x80,0x00,0x80,0x01,0x80,0x00,0x80,0x01,0x40,0x00,0x00,0x01,0x40,
diff --git a/xshogi/eastern_bitmaps/pawnPR.xbm b/xshogi/eastern_bitmaps/pawnPR.xbm
index b539017..6663675 100644
--- a/xshogi/eastern_bitmaps/pawnPR.xbm
+++ b/xshogi/eastern_bitmaps/pawnPR.xbm
@@ -1,6 +1,6 @@
 #define pawnPR_width 32
 #define pawnPR_height 32
-static char pawnPR_bits[] = {
+static unsigned char pawnPR_bits[] = {
  0xfc,0xff,0xff,0x1f,0x04,0x00,0x00,0x30,0x04,0x00,0x00,0x30,0x04,0x00,0x00,
  0x30,0x04,0x00,0x00,0x30,0x08,0x00,0x00,0x18,0x08,0x00,0x00,0x18,0x08,0xf8,
  0x03,0x18,0x08,0xf8,0x07,0x18,0x10,0x00,0x06,0x0c,0x10,0x00,0x06,0x0c,0x10,
diff --git a/xshogi/eastern_bitmaps/pawnPR_l.xbm b/xshogi/eastern_bitmaps/pawnPR_l.xbm
index 5f4c26f..8dfd44e 100644
--- a/xshogi/eastern_bitmaps/pawnPR_l.xbm
+++ b/xshogi/eastern_bitmaps/pawnPR_l.xbm
@@ -1,38 +1,46 @@
 #define pawnPR_l_width 64
 #define pawnPR_l_height 64
-static char pawnPR_l_bits[] = {
- 0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xf0,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x0c,0xc0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xc0,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0c,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x03,0xc0,
- 0x03,0x00,0x00,0x00,0x00,0x00,0x03,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x03,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x03,0xc0,0x03,0x00,0xff,0x3f,0x00,0x00,
- 0x03,0xc0,0x03,0x00,0xff,0x3f,0x00,0x00,0x03,0x00,0x03,0x00,0xff,0xff,0x00,
- 0x00,0x03,0x00,0x03,0x00,0xff,0xff,0x00,0x00,0x03,0x00,0x0f,0x00,0x00,0xf0,
- 0x00,0xc0,0x00,0x00,0x0f,0x00,0x00,0xf0,0x00,0xc0,0x00,0x00,0x0f,0x00,0x00,
- 0xf0,0x00,0xc0,0x00,0x00,0x0f,0x00,0x00,0xf0,0x00,0xc0,0x00,0x00,0x0f,0x00,
- 0x00,0x3c,0x00,0xc0,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0xc0,0x00,0x00,0x0c,
- 0x00,0xc0,0x0f,0x00,0xc0,0x00,0x00,0x0c,0x00,0xc0,0x0f,0x00,0xc0,0x00,0x00,
- 0x3c,0x00,0x3c,0x0f,0x00,0x30,0x00,0x00,0x3c,0x00,0x3c,0x0f,0x00,0x30,0x00,
- 0x00,0x3c,0x00,0x00,0x0f,0x00,0x30,0x00,0x00,0x3c,0x00,0x00,0x0f,0x00,0x30,
- 0x00,0x00,0x3c,0x00,0x00,0x0f,0x00,0x30,0x00,0x00,0x3c,0x00,0x00,0x0f,0x00,
- 0x30,0x00,0x00,0x30,0x00,0x00,0x0f,0x00,0x30,0x00,0x00,0x30,0x00,0x00,0x0f,
- 0x00,0x30,0x00,0x00,0xf0,0x00,0x00,0x0f,0x00,0x0c,0x00,0x00,0xf0,0x00,0x00,
- 0x0f,0x00,0x0c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x0c,0x00,0x00,0xf0,0x00,
- 0x00,0x00,0x00,0x0c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x0c,0x00,0x00,0xf0,
- 0x00,0x00,0x00,0x00,0x0c,0x00,0x00,0xc0,0x00,0x00,0x00,0x00,0x0c,0x00,0x00,
- 0xc0,0x00,0x00,0x00,0x00,0x0c,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x03,0x00,
- 0x00,0xc0,0x03,0x00,0x00,0x00,0x03,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x03,
- 0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x03,0x00,0x00,0x00,0x03,0x00,0x00,0x00,
- 0x03,0x00,0x00,0x00,0x03,0x00,0x00,0x00,0x03,0x00,0x00,0x00,0x3c,0x00,0x00,
- 0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0xc0,0x03,
- 0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0x00,
- 0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,
- 0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char pawnPR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x20, 0x04, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x20, 0x04, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0xc0,
+  0x0f, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0xf0, 0x1f, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0xf0, 0x1f, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x60,
+  0x38, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0x30, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0x00, 0x30, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00,
+  0x18, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0x1c, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0x00, 0x3e, 0x00, 0x20, 0x00, 0x80, 0x10, 0x00, 0x80,
+  0x7f, 0x00, 0x10, 0x00, 0x80, 0x10, 0x00, 0xe0, 0x77, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0xf0, 0xe1, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x78,
+  0xe0, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x18, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0x00, 0xe0, 0x01, 0x10, 0x00, 0x00, 0x11, 0x00, 0x00,
+  0xc0, 0x00, 0x10, 0x00, 0x00, 0x21, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00,
+  0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0x00,
+  0x00, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00,
+  0x00, 0x48, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00,
+  0x00, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x00,
+  0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00, 0xc0, 0x01, 0x00,
+  0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+  0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/pawnPR_m.xbm b/xshogi/eastern_bitmaps/pawnPR_m.xbm
index e761a94..7f276c2 100644
--- a/xshogi/eastern_bitmaps/pawnPR_m.xbm
+++ b/xshogi/eastern_bitmaps/pawnPR_m.xbm
@@ -1,6 +1,6 @@
 #define pawnPR_m_width 49
 #define pawnPR_m_height 49
-static char pawnPR_m_bits[] = {
+static unsigned char pawnPR_m_bits[] = {
  0xf8,0xff,0xff,0xff,0xff,0x0f,0xfe,0xf8,0xff,0xff,0xff,0xff,0x0f,0xfe,0xf8,
  0xff,0xff,0xff,0xff,0x1f,0xfe,0xf8,0xff,0xff,0xff,0xff,0x1f,0xfe,0x38,0x00,
  0x00,0x00,0x00,0x10,0xfe,0x38,0x00,0x00,0x00,0x00,0x10,0xfe,0x38,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/pawnP_l.xbm b/xshogi/eastern_bitmaps/pawnP_l.xbm
index 4f2d795..2352a99 100644
--- a/xshogi/eastern_bitmaps/pawnP_l.xbm
+++ b/xshogi/eastern_bitmaps/pawnP_l.xbm
@@ -1,38 +1,38 @@
 #define pawnP_l_width 64
 #define pawnP_l_height 64
-static char pawnP_l_bits[] = {
+static unsigned char pawnP_l_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x00,0x00,0xe0,0x01,0x00,0x00,0x64,0x00,0x00,0x00,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x00,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x00,0x00,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x12,0x00,0x00,0x00,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,
+ 0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x09,
+ 0x00,0x03,0x00,0x00,0x08,0x00,0x80,0x08,0x80,0x07,0x00,0x00,0x08,0x00,0x80,
+ 0x08,0x80,0x07,0x18,0x00,0x08,0x00,0x80,0x08,0x00,0x07,0x1e,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x87,0x0f,0x00,0x08,0x00,0x80,0x08,0x00,0xee,0x07,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0xfe,0x01,0x00,0x08,0x00,0x40,0x04,0x00,0x7c,0x00,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0x38,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x18,0x00,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0x0c,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x0c,
+ 0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x1c,0x06,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0xf8,0x0f,0x00,0x20,0x00,0x20,0x02,0x00,0xf8,0x0f,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0xf0,0x03,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,
- 0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,
- 0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x00,0x00,
- 0x00,0xc0,0x00,0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x03,
- 0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,
- 0x03,0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0x30,0x00,0x00,0x00,
- 0x00,0x03,0x00,0x00,0x30,0x00,0x00,0x00,0x00,0x03,0x00,0x00,0x30,0x00,0x00,
- 0x00,0x00,0x0f,0x00,0x00,0x30,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x30,0x00,
- 0x00,0x00,0x00,0x0f,0x00,0x00,0x30,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x30,
- 0x00,0xf0,0x00,0x00,0x0f,0x00,0x00,0x30,0x00,0xf0,0x00,0x00,0x0f,0x00,0x00,
- 0x0c,0x00,0xf0,0x00,0x00,0x0c,0x00,0x00,0x0c,0x00,0xf0,0x00,0x00,0x0c,0x00,
- 0x00,0x0c,0x00,0xf0,0x00,0x00,0x3c,0x00,0x00,0x0c,0x00,0xf0,0x00,0x00,0x3c,
- 0x00,0x00,0x0c,0x00,0xf0,0x00,0x00,0x3c,0x00,0x00,0x0c,0x00,0xf0,0x00,0x00,
- 0x3c,0x00,0x00,0x0c,0x00,0xf0,0x3c,0x00,0x3c,0x00,0x00,0x0c,0x00,0xf0,0x3c,
- 0x00,0x3c,0x00,0x00,0x03,0x00,0xf0,0x03,0x00,0x30,0x00,0x00,0x03,0x00,0xf0,
- 0x03,0x00,0x30,0x00,0x00,0x03,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x03,0x00,
- 0x3c,0x00,0x00,0xf0,0x00,0x00,0x03,0x00,0x0f,0x00,0x00,0xf0,0x00,0x00,0x03,
- 0x00,0x0f,0x00,0x00,0xf0,0x00,0x00,0x03,0x00,0x0f,0x00,0x00,0xf0,0x00,0x00,
- 0x03,0x00,0x0f,0x00,0x00,0xf0,0x00,0xc0,0x00,0x00,0xff,0xff,0x00,0xc0,0x00,
- 0xc0,0x00,0x00,0xff,0xff,0x00,0xc0,0x00,0xc0,0x00,0x00,0xfc,0xff,0x00,0xc0,
- 0x03,0xc0,0x00,0x00,0xfc,0xff,0x00,0xc0,0x03,0xc0,0x00,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0xc0,0x00,0x00,0x00,0x00,
- 0x00,0xc0,0x03,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0x30,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x03,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x03,0x30,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x0f,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x30,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0f,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x30,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,
- 0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f};
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/eastern_bitmaps/pawnP_m.xbm b/xshogi/eastern_bitmaps/pawnP_m.xbm
index 8623970..de29f4d 100644
--- a/xshogi/eastern_bitmaps/pawnP_m.xbm
+++ b/xshogi/eastern_bitmaps/pawnP_m.xbm
@@ -1,6 +1,6 @@
 #define pawnP_m_width 49
 #define pawnP_m_height 49
-static char pawnP_m_bits[] = {
+static unsigned char pawnP_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,
  0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,
diff --git a/xshogi/eastern_bitmaps/pawnR.xbm b/xshogi/eastern_bitmaps/pawnR.xbm
index dce3241..311527d 100644
--- a/xshogi/eastern_bitmaps/pawnR.xbm
+++ b/xshogi/eastern_bitmaps/pawnR.xbm
@@ -1,6 +1,6 @@
 #define pawnR_width 32
 #define pawnR_height 32
-static char pawnR_bits[] = {
+static unsigned char pawnR_bits[] = {
  0xfc,0xff,0xff,0x1f,0x04,0x00,0x00,0x30,0x04,0x00,0x00,0x30,0x04,0x04,0x04,
  0x30,0x04,0x08,0x02,0x30,0x08,0xfe,0x1f,0x18,0x08,0x30,0x06,0x18,0x08,0x30,
  0x06,0x18,0x08,0xf8,0x07,0x18,0x10,0x00,0x06,0x0c,0x10,0xf8,0x01,0x0c,0x10,
diff --git a/xshogi/eastern_bitmaps/pawnR_l.xbm b/xshogi/eastern_bitmaps/pawnR_l.xbm
index c84be74..12595fa 100644
--- a/xshogi/eastern_bitmaps/pawnR_l.xbm
+++ b/xshogi/eastern_bitmaps/pawnR_l.xbm
@@ -1,38 +1,46 @@
 #define pawnR_l_width 64
 #define pawnR_l_height 64
-static char pawnR_l_bits[] = {
- 0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x0c,0xf0,0x00,0x00,0x03,0x00,0x03,0x00,0x0c,0xf0,0x00,0x00,
- 0x03,0x00,0x03,0x00,0x0c,0xc0,0x00,0x00,0x0c,0xc0,0x00,0x00,0x0c,0xc0,0x00,
- 0x00,0x0c,0xc0,0x00,0x00,0x0c,0xc0,0x03,0xc0,0xff,0xff,0x3f,0x00,0x03,0xc0,
- 0x03,0xc0,0xff,0xff,0x3f,0x00,0x03,0xc0,0x03,0x00,0xf0,0xc0,0x03,0x00,0x03,
- 0xc0,0x03,0x00,0xf0,0xc0,0x03,0x00,0x03,0xc0,0x03,0x00,0xf0,0xc0,0x03,0x00,
- 0x03,0xc0,0x03,0x00,0xf0,0xc0,0x03,0x00,0x03,0x00,0x03,0x00,0xfc,0xff,0x03,
- 0x00,0x03,0x00,0x03,0x00,0xfc,0xff,0x03,0x00,0x03,0x00,0x0f,0x00,0x00,0xc0,
- 0x03,0xc0,0x00,0x00,0x0f,0x00,0x00,0xc0,0x03,0xc0,0x00,0x00,0x0f,0x00,0xfc,
- 0x3f,0x00,0xc0,0x00,0x00,0x0f,0x00,0xfc,0x3f,0x00,0xc0,0x00,0x00,0x0f,0x00,
- 0x00,0x00,0x00,0xc0,0x00,0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x00,0x00,0x0c,
- 0x00,0x00,0xfc,0x03,0xc0,0x00,0x00,0x0c,0x00,0x00,0xfc,0x03,0xc0,0x00,0x00,
- 0x3c,0x00,0xc0,0x0f,0x00,0x30,0x00,0x00,0x3c,0x00,0xc0,0x0f,0x00,0x30,0x00,
- 0x00,0x3c,0x00,0xf0,0x00,0x00,0x30,0x00,0x00,0x3c,0x00,0xf0,0x00,0x00,0x30,
- 0x00,0x00,0x3c,0x00,0x03,0x0c,0x0c,0x30,0x00,0x00,0x3c,0x00,0x03,0x0c,0x0c,
- 0x30,0x00,0x00,0x30,0x00,0x0c,0x0f,0x03,0x30,0x00,0x00,0x30,0x00,0x0c,0x0f,
- 0x03,0x30,0x00,0x00,0xf0,0x00,0x30,0xcf,0x00,0x0c,0x00,0x00,0xf0,0x00,0x30,
- 0xcf,0x00,0x0c,0x00,0x00,0xf0,0x00,0xff,0xff,0x0f,0x0c,0x00,0x00,0xf0,0x00,
- 0xff,0xff,0x0f,0x0c,0x00,0x00,0xf0,0x00,0x00,0xcf,0x03,0x0c,0x00,0x00,0xf0,
- 0x00,0x00,0xcf,0x03,0x0c,0x00,0x00,0xc0,0x00,0xf0,0xcf,0x03,0x0c,0x00,0x00,
- 0xc0,0x00,0xf0,0xcf,0x03,0x0c,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x03,0x00,
- 0x00,0xc0,0x03,0x00,0x0f,0x00,0x03,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x03,
- 0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x03,0x00,0x00,0x00,0x03,0x00,0x00,0x00,
- 0x03,0x00,0x00,0x00,0x03,0x00,0x00,0x00,0x03,0x00,0x00,0x00,0x3c,0x00,0x00,
- 0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0xc0,0x03,
- 0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0x00,
- 0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,
- 0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char pawnR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x06,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x0e, 0x80, 0x03, 0x80, 0x00,
+  0x20, 0x04, 0x00, 0x1e, 0xc0, 0x00, 0x40, 0x00, 0x20, 0x04, 0x00, 0x38,
+  0xf0, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x30, 0x70, 0x04, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x20, 0x00, 0x0f, 0x40, 0x00, 0x40, 0x04, 0x00, 0xc0,
+  0xff, 0x07, 0x40, 0x00, 0x40, 0x04, 0xc0, 0xff, 0xff, 0x01, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x7f, 0x30, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x60,
+  0x60, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0xe0, 0xff, 0x01, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0xf0, 0xef, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0xf8,
+  0x70, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0x30, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0x00, 0x18, 0x00, 0x20, 0x00, 0x80, 0x10, 0x00, 0x80,
+  0x00, 0x00, 0x10, 0x00, 0x80, 0x10, 0x00, 0x60, 0x00, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0x38, 0xe0, 0x01, 0x10, 0x00, 0x00, 0x11, 0x00, 0x1e,
+  0xfe, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0xcc, 0x1f, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0xf0, 0x03, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x38,
+  0x03, 0x00, 0x10, 0x00, 0x00, 0x21, 0x00, 0x0e, 0x03, 0x01, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0x07, 0xf3, 0x01, 0x08, 0x00, 0x00, 0x22, 0x00, 0x07,
+  0xff, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0xfe, 0x6f, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0xfc, 0x23, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0x00,
+  0xc1, 0x07, 0x08, 0x00, 0x00, 0x28, 0x00, 0x00, 0xff, 0x03, 0x08, 0x00,
+  0x00, 0x48, 0x00, 0xfe, 0x9f, 0x01, 0x04, 0x00, 0x00, 0x50, 0x00, 0xff,
+  0xc3, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00, 0x61, 0x00, 0x04, 0x00,
+  0x00, 0x60, 0x00, 0x78, 0x23, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x3c,
+  0x03, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x0c, 0x01, 0xc0, 0x01, 0x00,
+  0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+  0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/pawnR_m.xbm b/xshogi/eastern_bitmaps/pawnR_m.xbm
index 3c2a154..9c30b11 100644
--- a/xshogi/eastern_bitmaps/pawnR_m.xbm
+++ b/xshogi/eastern_bitmaps/pawnR_m.xbm
@@ -1,6 +1,6 @@
 #define pawnR_m_width 49
 #define pawnR_m_height 49
-static char pawnR_m_bits[] = {
+static unsigned char pawnR_m_bits[] = {
  0xf8,0xff,0xff,0xff,0xff,0x0f,0xfe,0xf8,0xff,0xff,0xff,0xff,0x0f,0xfe,0xf8,
  0xff,0xff,0xff,0xff,0x1f,0xfe,0xf8,0xff,0xff,0xff,0xff,0x1f,0xfe,0x38,0x00,
  0x00,0x00,0x00,0x10,0xfe,0x38,0x00,0x00,0x00,0x00,0x10,0xfe,0x38,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/pawn_l.xbm b/xshogi/eastern_bitmaps/pawn_l.xbm
index 5b96b67..19621f3 100644
--- a/xshogi/eastern_bitmaps/pawn_l.xbm
+++ b/xshogi/eastern_bitmaps/pawn_l.xbm
@@ -1,38 +1,38 @@
 #define pawn_l_width 64
 #define pawn_l_height 64
-static char pawn_l_bits[] = {
+static unsigned char pawn_l_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x80,0x30,0xe0,0x01,0x00,0x00,0x64,0x00,0xc0,0x3c,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0xc4,0x1e,0x00,0x02,0x00,0x00,0x22,0x00,0x86,0x00,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0xc3,0xff,0x00,0x02,0x00,0x00,0x22,0x80,0xf9,0x7f,0x00,
+ 0x02,0x00,0x00,0x12,0xc0,0xff,0x00,0x00,0x04,0x00,0x00,0x12,0xe0,0x83,0x00,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0xc4,0x3f,0x00,0x04,0x00,0x00,0x11,0x00,0xf6,
+ 0x7f,0x00,0x04,0x00,0x00,0x11,0x00,0xff,0xe0,0x00,0x04,0x00,0x00,0x11,0x80,
+ 0xcf,0xe0,0x00,0x04,0x00,0x00,0x11,0x80,0xc0,0x70,0x00,0x04,0x00,0x00,0x09,
+ 0x00,0xc0,0x1c,0x00,0x08,0x00,0x80,0x08,0x00,0xc0,0x0f,0x00,0x08,0x00,0x80,
+ 0x08,0x00,0xf8,0x33,0x00,0x08,0x00,0x80,0x08,0x00,0x7f,0x78,0x00,0x08,0x00,
+ 0x80,0x08,0x80,0x07,0x1c,0x00,0x08,0x00,0x80,0x08,0x00,0x00,0x06,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x00,0x01,0x00,0x08,0x00,0x40,0x04,0x00,0x18,0x00,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0x0c,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x0e,0x1f,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0xf7,0x0f,0x00,0x10,0x00,0x40,0x04,0x80,0xff,
+ 0x07,0x00,0x10,0x00,0x40,0x04,0x00,0x06,0x06,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0x0c,0xfe,0x00,0x20,0x00,0x20,0x02,0x80,0xff,0xff,0x03,0x20,0x00,0x20,0x02,
+ 0xe0,0xff,0x03,0x00,0x20,0x00,0x20,0x02,0xf0,0x00,0x04,0x00,0x20,0x00,0x20,
+ 0x02,0x20,0x0e,0x0c,0x00,0x20,0x00,0x20,0x02,0x00,0x0f,0x1c,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x03,0x78,0x00,0x20,0x00,0x10,0x01,0xc0,0x01,0x70,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x00,0x60,0x00,0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,
- 0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,
- 0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x00,0x00,
- 0x00,0xc0,0x00,0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x03,
- 0x00,0x00,0xc0,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0xc0,0x00,0xf0,0x00,0xc0,
- 0x03,0x00,0x00,0xc0,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x30,0xc0,0xf3,0x0f,
- 0x00,0x03,0x00,0x00,0x30,0xc0,0xf3,0x0f,0x00,0x03,0x00,0x00,0x30,0xc0,0xf3,
- 0x00,0x00,0x0f,0x00,0x00,0x30,0xc0,0xf3,0x00,0x00,0x0f,0x00,0x00,0x30,0xf0,
- 0xff,0xff,0x00,0x0f,0x00,0x00,0x30,0xf0,0xff,0xff,0x00,0x0f,0x00,0x00,0x30,
- 0x00,0xf3,0x0c,0x00,0x0f,0x00,0x00,0x30,0x00,0xf3,0x0c,0x00,0x0f,0x00,0x00,
- 0x0c,0xc0,0xf0,0x30,0x00,0x0c,0x00,0x00,0x0c,0xc0,0xf0,0x30,0x00,0x0c,0x00,
- 0x00,0x0c,0x30,0x30,0xc0,0x00,0x3c,0x00,0x00,0x0c,0x30,0x30,0xc0,0x00,0x3c,
- 0x00,0x00,0x0c,0x00,0x00,0x0f,0x00,0x3c,0x00,0x00,0x0c,0x00,0x00,0x0f,0x00,
- 0x3c,0x00,0x00,0x0c,0x00,0xf0,0x03,0x00,0x3c,0x00,0x00,0x0c,0x00,0xf0,0x03,
- 0x00,0x3c,0x00,0x00,0x03,0xc0,0x3f,0x00,0x00,0x30,0x00,0x00,0x03,0xc0,0x3f,
- 0x00,0x00,0x30,0x00,0x00,0x03,0x00,0x00,0x00,0x00,0xf0,0x00,0x00,0x03,0x00,
- 0x00,0x00,0x00,0xf0,0x00,0x00,0x03,0x00,0xfc,0x3f,0x00,0xf0,0x00,0x00,0x03,
- 0x00,0xfc,0x3f,0x00,0xf0,0x00,0x00,0x03,0xc0,0x03,0x00,0x00,0xf0,0x00,0x00,
- 0x03,0xc0,0x03,0x00,0x00,0xf0,0x00,0xc0,0x00,0xc0,0xff,0x3f,0x00,0xc0,0x00,
- 0xc0,0x00,0xc0,0xff,0x3f,0x00,0xc0,0x00,0xc0,0x00,0xc0,0x03,0x0f,0x00,0xc0,
- 0x03,0xc0,0x00,0xc0,0x03,0x0f,0x00,0xc0,0x03,0xc0,0x00,0xc0,0x03,0x0f,0x00,
- 0xc0,0x03,0xc0,0x00,0xc0,0x03,0x0f,0x00,0xc0,0x03,0xc0,0x00,0xfc,0xff,0xff,
- 0x03,0xc0,0x03,0xc0,0x00,0xfc,0xff,0xff,0x03,0xc0,0x03,0x30,0x00,0x00,0x03,
- 0x30,0x00,0x00,0x03,0x30,0x00,0x00,0x03,0x30,0x00,0x00,0x03,0x30,0x00,0xc0,
- 0x00,0xc0,0x00,0x00,0x0f,0x30,0x00,0xc0,0x00,0xc0,0x00,0x00,0x0f,0x30,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0f,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x30,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,
- 0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f};
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/eastern_bitmaps/pawn_m.xbm b/xshogi/eastern_bitmaps/pawn_m.xbm
index 5688e6f..4e434e8 100644
--- a/xshogi/eastern_bitmaps/pawn_m.xbm
+++ b/xshogi/eastern_bitmaps/pawn_m.xbm
@@ -1,6 +1,6 @@
 #define pawn_m_width 49
 #define pawn_m_height 49
-static char pawn_m_bits[] = {
+static unsigned char pawn_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,
  0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,
diff --git a/xshogi/eastern_bitmaps/rook.xbm b/xshogi/eastern_bitmaps/rook.xbm
index 0a1c9e6..e0a1c8b 100644
--- a/xshogi/eastern_bitmaps/rook.xbm
+++ b/xshogi/eastern_bitmaps/rook.xbm
@@ -1,6 +1,6 @@
 #define rook_width 32
 #define rook_height 32
-static char rook_bits[] = {
+static unsigned char rook_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,
  0x00,0x00,0x03,0x60,0x00,0xc0,0x00,0x80,0x01,0x20,0x00,0x00,0x02,0x20,0xfc,
  0x2f,0x06,0x20,0xc0,0x1c,0x06,0x20,0xdc,0x0c,0x06,0x10,0xd8,0x38,0x04,0x10,
diff --git a/xshogi/eastern_bitmaps/rookP.top.xbm b/xshogi/eastern_bitmaps/rookP.top.xbm
index e1376ac..eeed192 100644
--- a/xshogi/eastern_bitmaps/rookP.top.xbm
+++ b/xshogi/eastern_bitmaps/rookP.top.xbm
@@ -1,6 +1,6 @@
 #define rookP_width 32
 #define rookP_height 32
-static char rookP_bits[] = {
+static unsigned char rookP_bits[] = {
    0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
    0x00, 0x0c, 0x18, 0x00, 0x00, 0x03, 0x60, 0x00, 0xc0, 0x00, 0x80, 0x01,
    0x20, 0x00, 0x00, 0x02, 0x20, 0x00, 0x00, 0x06, 0x20, 0x00, 0x00, 0x06,
diff --git a/xshogi/eastern_bitmaps/rookP.xbm b/xshogi/eastern_bitmaps/rookP.xbm
index fb0025f..5daa511 100644
--- a/xshogi/eastern_bitmaps/rookP.xbm
+++ b/xshogi/eastern_bitmaps/rookP.xbm
@@ -1,6 +1,6 @@
 #define rookP_width 32
 #define rookP_height 32
-static char rookP_bits[] = {
+static unsigned char rookP_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,
  0x00,0x00,0x03,0x60,0x00,0xc0,0x00,0x80,0x01,0x20,0x00,0x00,0x02,0x20,0x08,
  0x03,0x06,0x20,0x7e,0x1f,0x06,0x20,0x34,0x03,0x06,0x10,0x7e,0x3f,0x04,0x10,
diff --git a/xshogi/eastern_bitmaps/rookPR.top.xbm b/xshogi/eastern_bitmaps/rookPR.top.xbm
index 768ba2a..2371dd2 100644
--- a/xshogi/eastern_bitmaps/rookPR.top.xbm
+++ b/xshogi/eastern_bitmaps/rookPR.top.xbm
@@ -2,7 +2,7 @@
 #define rookPR_height 32
 #define rookPR_x_hot -1
 #define rookPR_y_hot -1
-static char rookPR_bits[] = {
+static unsigned char rookPR_bits[] = {
    0xff, 0xff, 0xff, 0x7f, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0,
    0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x02, 0x7f, 0x66, 0xc0,
    0x02, 0xe3, 0x66, 0x60, 0x02, 0xfc, 0x66, 0x60, 0x02, 0xc0, 0x66, 0x60,
diff --git a/xshogi/eastern_bitmaps/rookPR.xbm b/xshogi/eastern_bitmaps/rookPR.xbm
index 0000b67..6773cba 100644
--- a/xshogi/eastern_bitmaps/rookPR.xbm
+++ b/xshogi/eastern_bitmaps/rookPR.xbm
@@ -1,6 +1,6 @@
 #define rookPR_width 32
 #define rookPR_height 32
-static char rookPR_bits[] = {
+static unsigned char rookPR_bits[] = {
  0xff,0xff,0xff,0x7f,0x01,0x00,0x00,0xc0,0x01,0x00,0x00,0xc0,0x01,0xfc,0x3f,
  0xc0,0x01,0x80,0x01,0xc0,0x02,0x80,0x01,0x60,0x02,0x80,0x01,0x60,0x02,0xf0,
  0x0f,0x60,0x02,0x80,0x01,0x60,0x04,0x80,0x01,0x30,0x04,0x80,0x01,0x30,0x04,
diff --git a/xshogi/eastern_bitmaps/rookPR_l.top.xbm b/xshogi/eastern_bitmaps/rookPR_l.top.xbm
index deeb2f8..41af79b 100644
--- a/xshogi/eastern_bitmaps/rookPR_l.top.xbm
+++ b/xshogi/eastern_bitmaps/rookPR_l.top.xbm
@@ -1,6 +1,6 @@
 #define rookPR_l_width 64
 #define rookPR_l_height 64
-static char rookPR_l_bits[] = {
+static unsigned char rookPR_l_bits[] = {
    0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0xff, 0xff, 0xff, 0xff,
    0xff, 0xff, 0xff, 0x3f, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
    0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00, 0x00, 0x00,
diff --git a/xshogi/eastern_bitmaps/rookPR_l.xbm b/xshogi/eastern_bitmaps/rookPR_l.xbm
index 9b81839..99feb1d 100644
--- a/xshogi/eastern_bitmaps/rookPR_l.xbm
+++ b/xshogi/eastern_bitmaps/rookPR_l.xbm
@@ -1,38 +1,46 @@
 #define rookPR_l_width 64
 #define rookPR_l_height 64
-static char rookPR_l_bits[] = {
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0xc0,0xff,0xff,0x3f,0x00,0xc0,0x0f,0x00,0xc0,
- 0xff,0xff,0x3f,0x00,0xc0,0x0c,0x00,0x00,0x00,0x0f,0x00,0x00,0xc0,0x0c,0x00,
- 0x00,0x00,0x0f,0x00,0x00,0xc0,0x3c,0x00,0x00,0x00,0x0f,0x00,0x00,0x30,0x3c,
- 0x00,0x00,0x00,0x0f,0x00,0x00,0x30,0x3c,0x00,0x00,0x00,0x0f,0x00,0x00,0x30,
- 0x3c,0x00,0x00,0x00,0x0f,0x00,0x00,0x30,0x3c,0x00,0x00,0xfc,0xff,0x03,0x00,
- 0x30,0x3c,0x00,0x00,0xfc,0xff,0x03,0x00,0x30,0x30,0x00,0x00,0x00,0x0f,0x00,
- 0x00,0x30,0x30,0x00,0x00,0x00,0x0f,0x00,0x00,0x30,0xf0,0x00,0x00,0x00,0x0f,
- 0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x0f,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,
- 0x0f,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x0f,0x00,0x00,0x0c,0xf0,0x00,0x00,
- 0xff,0xff,0x0f,0x00,0x0c,0xf0,0x00,0x00,0xff,0xff,0x0f,0x00,0x0c,0xc0,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0c,0xc0,0x00,0x00,0x00,0x00,0x00,0x00,0x0c,0xc0,
- 0x03,0xf0,0x3f,0x3c,0x30,0x00,0x03,0xc0,0x03,0xf0,0x3f,0x3c,0x30,0x00,0x03,
- 0xc0,0x03,0xf0,0xff,0xfc,0x3f,0x00,0x03,0xc0,0x03,0xf0,0xff,0xfc,0x3f,0x00,
- 0x03,0xc0,0x03,0x00,0xf0,0x3c,0x3c,0x00,0x03,0xc0,0x03,0x00,0xf0,0x3c,0x3c,
- 0x00,0x03,0x00,0x03,0xf0,0xff,0xfc,0x3f,0x00,0x03,0x00,0x03,0xf0,0xff,0xfc,
- 0x3f,0x00,0x03,0x00,0x0f,0x00,0xf0,0x3c,0x3c,0xc0,0x00,0x00,0x0f,0x00,0xf0,
- 0x3c,0x3c,0xc0,0x00,0x00,0x0f,0xf0,0xff,0xfc,0x3f,0xc0,0x00,0x00,0x0f,0xf0,
- 0xff,0xfc,0x3f,0xc0,0x00,0x00,0x0f,0xf0,0x00,0x00,0x00,0xc0,0x00,0x00,0x0f,
- 0xf0,0x00,0x00,0x00,0xc0,0x00,0x00,0x0c,0xf0,0xff,0xfc,0x3f,0xc0,0x00,0x00,
- 0x0c,0xf0,0xff,0xfc,0x3f,0xc0,0x00,0x00,0x3c,0x00,0xf0,0xf0,0x0c,0x30,0x00,
- 0x00,0x3c,0x00,0xf0,0xf0,0x0c,0x30,0x00,0x00,0x3c,0xc0,0xff,0xfc,0x3f,0x30,
- 0x00,0x00,0x3c,0xc0,0xff,0xfc,0x3f,0x30,0x00,0x00,0x3c,0x00,0xf0,0x00,0x03,
- 0x30,0x00,0x00,0x3c,0x00,0xf0,0x00,0x03,0x30,0x00,0x00,0x30,0x00,0x00,0x00,
- 0x00,0x30,0x00,0x00,0x30,0x00,0x00,0x00,0x00,0x30,0x00,0x00,0xc0,0x03,0x00,
- 0x00,0x00,0x0f,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x0f,0x00,0x00,0x00,0x3c,
- 0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char rookPR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0xe0, 0xff, 0xff, 0x1f, 0x00, 0x20, 0x44, 0x00, 0xf0, 0xff,
+  0xff, 0x07, 0x00, 0x20, 0x48, 0x00, 0xe0, 0xff, 0x3f, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0xc0,
+  0x39, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0xe0, 0x3f, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0xf0, 0x31, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0xf8,
+  0x31, 0x00, 0x00, 0x10, 0x88, 0x00, 0x00, 0xe8, 0x1f, 0x00, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0xf8, 0x0f, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xc0,
+  0x70, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xc0, 0x1f, 0x00, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0xc0, 0x07, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0xc0,
+  0x01, 0x00, 0x00, 0x08, 0x10, 0x01, 0xf0, 0x07, 0x30, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0xf8, 0x0f, 0x78, 0x00, 0x00, 0x08, 0x20, 0x01, 0x18, 0x18,
+  0xd8, 0x81, 0x00, 0x08, 0x20, 0x01, 0x1c, 0x30, 0x98, 0xe1, 0x00, 0x08,
+  0x20, 0x01, 0x1c, 0x30, 0x98, 0x71, 0x00, 0x04, 0x20, 0x01, 0x18, 0x30,
+  0xf8, 0x31, 0x00, 0x04, 0x20, 0x01, 0x08, 0x30, 0x3c, 0x38, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x37, 0x3f, 0x1c, 0x00, 0x04, 0x20, 0x02, 0x80, 0xf7,
+  0x1b, 0x0e, 0x00, 0x04, 0x40, 0x02, 0xe0, 0xf1, 0x11, 0x0f, 0x00, 0x04,
+  0x40, 0x02, 0xe0, 0xf8, 0x80, 0x03, 0x00, 0x02, 0x40, 0x02, 0x00, 0x7c,
+  0xc0, 0x0f, 0x00, 0x02, 0x40, 0x02, 0x00, 0x7e, 0xf0, 0x1f, 0x00, 0x02,
+  0x40, 0x02, 0x80, 0x6f, 0xf8, 0x09, 0x00, 0x02, 0x40, 0x04, 0xc0, 0x63,
+  0x7c, 0x06, 0x00, 0x02, 0x80, 0x04, 0xe0, 0x61, 0x3c, 0x07, 0x00, 0x02,
+  0x80, 0x04, 0x70, 0x60, 0x30, 0x03, 0x00, 0x01, 0x80, 0x04, 0x00, 0x70,
+  0xc0, 0x0f, 0x00, 0x01, 0x80, 0x04, 0x00, 0x70, 0xf8, 0x03, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x70, 0x3c, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x70,
+  0x40, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x70, 0xc0, 0x00, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0xf0, 0xc0, 0x00, 0x00, 0x01, 0x00, 0x09, 0x00, 0xe0,
+  0xc0, 0x01, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/rookPR_m.top.xbm b/xshogi/eastern_bitmaps/rookPR_m.top.xbm
index 04cd8a0..677b543 100644
--- a/xshogi/eastern_bitmaps/rookPR_m.top.xbm
+++ b/xshogi/eastern_bitmaps/rookPR_m.top.xbm
@@ -1,6 +1,6 @@
 #define rookPR_m_width 49
 #define rookPR_m_height 49
-static char rookPR_m_bits[] = {
+static unsigned char rookPR_m_bits[] = {
    0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff,
    0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0x00, 0x00,
    0x00, 0x00, 0x80, 0xff, 0x07, 0x00, 0x00, 0x00, 0x00, 0x80, 0xff, 0x07,
diff --git a/xshogi/eastern_bitmaps/rookPR_m.xbm b/xshogi/eastern_bitmaps/rookPR_m.xbm
index c2ef104..d716885 100644
--- a/xshogi/eastern_bitmaps/rookPR_m.xbm
+++ b/xshogi/eastern_bitmaps/rookPR_m.xbm
@@ -1,6 +1,6 @@
 #define rookPR_m_width 49
 #define rookPR_m_height 49
-static char rookPR_m_bits[] = {
+static unsigned char rookPR_m_bits[] = {
  0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,
  0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x00,
  0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/rookP_l.top.xbm b/xshogi/eastern_bitmaps/rookP_l.top.xbm
index 9697d6e..4f787b0 100644
--- a/xshogi/eastern_bitmaps/rookP_l.top.xbm
+++ b/xshogi/eastern_bitmaps/rookP_l.top.xbm
@@ -1,6 +1,6 @@
 #define rookP_l_width 64
 #define rookP_l_height 64
-static char rookP_l_bits[] = {
+static unsigned char rookP_l_bits[] = {
    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
    0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0f,
diff --git a/xshogi/eastern_bitmaps/rookP_l.xbm b/xshogi/eastern_bitmaps/rookP_l.xbm
index 3aab819..261cbac 100644
--- a/xshogi/eastern_bitmaps/rookP_l.xbm
+++ b/xshogi/eastern_bitmaps/rookP_l.xbm
@@ -1,38 +1,46 @@
 #define rookP_l_width 64
 #define rookP_l_height 64
-static char rookP_l_bits[] = {
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0xf0,0x00,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0x00,0x0f,
- 0x00,0x00,0x3c,0x00,0x00,0x00,0xf0,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0xf0,
- 0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0x0c,0x00,0x00,0x00,0x00,0x0c,0x00,0x00,
- 0x0c,0x00,0x00,0x00,0x00,0x0c,0x00,0x00,0x0c,0xc0,0x00,0x0f,0x00,0x3c,0x00,
- 0x00,0x0c,0xc0,0x00,0x0f,0x00,0x3c,0x00,0x00,0x0c,0xfc,0x3f,0xff,0x03,0x3c,
- 0x00,0x00,0x0c,0xfc,0x3f,0xff,0x03,0x3c,0x00,0x00,0x0c,0x30,0x0f,0x0f,0x00,
- 0x3c,0x00,0x00,0x0c,0x30,0x0f,0x0f,0x00,0x3c,0x00,0x00,0x03,0xfc,0x3f,0xff,
- 0x0f,0x30,0x00,0x00,0x03,0xfc,0x3f,0xff,0x0f,0x30,0x00,0x00,0x03,0x00,0x00,
- 0x00,0x0f,0xf0,0x00,0x00,0x03,0x00,0x00,0x00,0x0f,0xf0,0x00,0x00,0x03,0xfc,
- 0x3f,0xff,0x0f,0xf0,0x00,0x00,0x03,0xfc,0x3f,0xff,0x0f,0xf0,0x00,0x00,0x03,
- 0x3c,0x3c,0x0f,0x00,0xf0,0x00,0x00,0x03,0x3c,0x3c,0x0f,0x00,0xf0,0x00,0xc0,
- 0x00,0xfc,0x3f,0xff,0x0f,0xc0,0x00,0xc0,0x00,0xfc,0x3f,0xff,0x0f,0xc0,0x00,
- 0xc0,0x00,0x3c,0x3c,0x0f,0x00,0xc0,0x03,0xc0,0x00,0x3c,0x3c,0x0f,0x00,0xc0,
- 0x03,0xc0,0x00,0xfc,0x3f,0xff,0x0f,0xc0,0x03,0xc0,0x00,0xfc,0x3f,0xff,0x0f,
- 0xc0,0x03,0xc0,0x00,0x0c,0x3c,0xfc,0x0f,0xc0,0x03,0xc0,0x00,0x0c,0x3c,0xfc,
- 0x0f,0xc0,0x03,0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x03,0x30,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x03,0x30,0x00,0xf0,0xff,0xff,0x00,0x00,0x0f,0x30,0x00,0xf0,
- 0xff,0xff,0x00,0x00,0x0f,0x30,0x00,0x00,0xf0,0x00,0x00,0x00,0x0f,0x30,0x00,
- 0x00,0xf0,0x00,0x00,0x00,0x0f,0x30,0x00,0x00,0xf0,0x00,0x00,0x00,0x0f,0x30,
- 0x00,0x00,0xf0,0x00,0x00,0x00,0x0f,0x0c,0x00,0x00,0xf0,0x00,0x00,0x00,0x0c,
- 0x0c,0x00,0x00,0xf0,0x00,0x00,0x00,0x0c,0x0c,0x00,0xc0,0xff,0x3f,0x00,0x00,
- 0x3c,0x0c,0x00,0xc0,0xff,0x3f,0x00,0x00,0x3c,0x0c,0x00,0x00,0xf0,0x00,0x00,
- 0x00,0x3c,0x0c,0x00,0x00,0xf0,0x00,0x00,0x00,0x3c,0x0c,0x00,0x00,0xf0,0x00,
- 0x00,0x00,0x3c,0x0c,0x00,0x00,0xf0,0x00,0x00,0x00,0x3c,0x03,0x00,0x00,0xf0,
- 0x00,0x00,0x00,0x30,0x03,0x00,0x00,0xf0,0x00,0x00,0x00,0x30,0x03,0x00,0xfc,
- 0xff,0xff,0x03,0x00,0xf0,0x03,0x00,0xfc,0xff,0xff,0x03,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xfc,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff};
+static unsigned char rookP_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x11, 0x80, 0x03, 0x07, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0x00, 0x03, 0x0f, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x03,
+  0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x02, 0x0e, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x3c, 0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0xc0, 0x1f,
+  0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0xf0, 0x03, 0x0e, 0x00, 0x00, 0x01,
+  0x80, 0x08, 0xc0, 0x0c, 0x06, 0x0e, 0x00, 0x01, 0x80, 0x08, 0xe0, 0x3c,
+  0x86, 0x07, 0x00, 0x01, 0x80, 0x04, 0x60, 0x3e, 0xc6, 0x03, 0x00, 0x01,
+  0x80, 0x04, 0x90, 0x1f, 0xf6, 0x01, 0x00, 0x01, 0x80, 0x04, 0xf8, 0x0f,
+  0x7e, 0x00, 0x00, 0x01, 0x80, 0x04, 0xf0, 0x03, 0x3e, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0xc0, 0x01, 0x1f, 0x07, 0x00, 0x02, 0x40, 0x04, 0xf0, 0x88,
+  0x8f, 0x07, 0x00, 0x02, 0x40, 0x02, 0x70, 0xd8, 0xef, 0x01, 0x00, 0x02,
+  0x40, 0x02, 0x38, 0xfc, 0xec, 0x00, 0x00, 0x02, 0x40, 0x02, 0x1c, 0x3c,
+  0x0c, 0x10, 0x00, 0x02, 0x40, 0x02, 0x8c, 0x1f, 0x0c, 0x18, 0x00, 0x02,
+  0x40, 0x02, 0x8e, 0x19, 0x0c, 0x38, 0x00, 0x04, 0x20, 0x02, 0x87, 0x19,
+  0x0c, 0x38, 0x00, 0x04, 0x20, 0x02, 0x81, 0x1b, 0x18, 0x18, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0x1e, 0xf0, 0x1f, 0x00, 0x04, 0x20, 0x01, 0x00, 0x0c,
+  0xe0, 0x0f, 0x00, 0x04, 0x20, 0x01, 0x00, 0x80, 0x03, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0xe0, 0x03, 0x00, 0x00, 0x08, 0x20, 0x01, 0x00, 0xf8,
+  0x03, 0x00, 0x00, 0x08, 0x10, 0x01, 0x00, 0x0e, 0x03, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0xf0, 0x1f, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0xf8,
+  0x17, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0x8c, 0x1f, 0x00, 0x00, 0x08,
+  0x90, 0x00, 0x00, 0x8c, 0x0f, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xfc,
+  0x07, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0x9c, 0x03, 0x00, 0x00, 0x10,
+  0x88, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0xfc,
+  0xff, 0x07, 0x00, 0x10, 0x48, 0x00, 0xe0, 0xff, 0xff, 0x0f, 0x00, 0x10,
+  0x48, 0x00, 0xf8, 0xff, 0xff, 0x07, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/rookP_m.top.xbm b/xshogi/eastern_bitmaps/rookP_m.top.xbm
index 3add5dc..579560d 100644
--- a/xshogi/eastern_bitmaps/rookP_m.top.xbm
+++ b/xshogi/eastern_bitmaps/rookP_m.top.xbm
@@ -1,6 +1,6 @@
 #define rookP_m_width 49
 #define rookP_m_height 49
-static char rookP_m_bits[] = {
+static unsigned char rookP_m_bits[] = {
    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0x00, 0x00, 0x00, 0x00, 0x00,
    0x00, 0xfe, 0x00, 0x00, 0xc0, 0x07, 0x00, 0x00, 0xfe, 0x00, 0x00, 0xc0,
    0x07, 0x00, 0x00, 0xfe, 0x00, 0x00, 0x38, 0x38, 0x00, 0x00, 0xfe, 0x00,
diff --git a/xshogi/eastern_bitmaps/rookP_m.xbm b/xshogi/eastern_bitmaps/rookP_m.xbm
index 5164ffa..227a9d9 100644
--- a/xshogi/eastern_bitmaps/rookP_m.xbm
+++ b/xshogi/eastern_bitmaps/rookP_m.xbm
@@ -1,6 +1,6 @@
 #define rookP_m_width 49
 #define rookP_m_height 49
-static char rookP_m_bits[] = {
+static unsigned char rookP_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,
  0x38,0x38,0x00,0x00,0xfe,0x00,0x00,0x07,0xc0,0x01,0x00,0xfe,0x00,0x00,0x07,
diff --git a/xshogi/eastern_bitmaps/rookR.xbm b/xshogi/eastern_bitmaps/rookR.xbm
index f796629..f487634 100644
--- a/xshogi/eastern_bitmaps/rookR.xbm
+++ b/xshogi/eastern_bitmaps/rookR.xbm
@@ -1,6 +1,6 @@
 #define rookR_width 32
 #define rookR_height 32
-static char rookR_bits[] = {
+static unsigned char rookR_bits[] = {
  0xff,0xff,0xff,0x7f,0x01,0x00,0x00,0xc0,0x01,0x00,0x00,0xc0,0x01,0x80,0x01,
  0xc0,0x01,0xfe,0x7f,0xc0,0x02,0x80,0x01,0x60,0x02,0xf8,0x1f,0x60,0x02,0x98,
  0x19,0x60,0x02,0xf8,0x1f,0x60,0x04,0x98,0x19,0x30,0x04,0xf8,0x1f,0x30,0x04,
diff --git a/xshogi/eastern_bitmaps/rookR_l.xbm b/xshogi/eastern_bitmaps/rookR_l.xbm
index 3dac8da..d89ff5b 100644
--- a/xshogi/eastern_bitmaps/rookR_l.xbm
+++ b/xshogi/eastern_bitmaps/rookR_l.xbm
@@ -1,38 +1,46 @@
 #define rookR_l_width 64
 #define rookR_l_height 64
-static char rookR_l_bits[] = {
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x0f,0x00,0x00,0xc0,0x0f,0x00,0x00,
- 0x00,0x0f,0x00,0x00,0xc0,0x0c,0x00,0xf0,0xff,0xff,0xff,0x00,0xc0,0x0c,0x00,
- 0xf0,0xff,0xff,0xff,0x00,0xc0,0x3c,0x00,0x00,0x00,0x0f,0x00,0x00,0x30,0x3c,
- 0x00,0x00,0x00,0x0f,0x00,0x00,0x30,0x3c,0x00,0x00,0xff,0xff,0x0f,0x00,0x30,
- 0x3c,0x00,0x00,0xff,0xff,0x0f,0x00,0x30,0x3c,0x00,0x00,0x0f,0x0f,0x0f,0x00,
- 0x30,0x3c,0x00,0x00,0x0f,0x0f,0x0f,0x00,0x30,0x30,0x00,0x00,0xff,0xff,0x0f,
- 0x00,0x30,0x30,0x00,0x00,0xff,0xff,0x0f,0x00,0x30,0xf0,0x00,0x00,0x0f,0x0f,
- 0x0f,0x00,0x0c,0xf0,0x00,0x00,0x0f,0x0f,0x0f,0x00,0x0c,0xf0,0x00,0x00,0xff,
- 0xff,0x0f,0x00,0x0c,0xf0,0x00,0x00,0xff,0xff,0x0f,0x00,0x0c,0xf0,0x00,0x00,
- 0x00,0x0f,0x00,0x00,0x0c,0xf0,0x00,0x00,0x00,0x0f,0x00,0x00,0x0c,0xc0,0x00,
- 0xc0,0xff,0xff,0x3f,0x00,0x0c,0xc0,0x00,0xc0,0xff,0xff,0x3f,0x00,0x0c,0xc0,
- 0x03,0x00,0x00,0x0f,0x00,0x00,0x03,0xc0,0x03,0x00,0x00,0x0f,0x00,0x00,0x03,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x03,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,
- 0x03,0xc0,0x03,0xf0,0x03,0x0f,0x0c,0x00,0x03,0xc0,0x03,0xf0,0x03,0x0f,0x0c,
- 0x00,0x03,0x00,0x03,0x00,0x0f,0x0f,0x03,0x00,0x03,0x00,0x03,0x00,0x0f,0x0f,
- 0x03,0x00,0x03,0x00,0x0f,0xc0,0x0f,0xcf,0x03,0xc0,0x00,0x00,0x0f,0xc0,0x0f,
- 0xcf,0x03,0xc0,0x00,0x00,0x0f,0x30,0x0f,0xcf,0x03,0xc0,0x00,0x00,0x0f,0x30,
- 0x0f,0xcf,0x03,0xc0,0x00,0x00,0x0f,0x00,0xff,0xff,0x3f,0xc0,0x00,0x00,0x0f,
- 0x00,0xff,0xff,0x3f,0xc0,0x00,0x00,0x0c,0xf0,0x03,0xcf,0x03,0xc0,0x00,0x00,
- 0x0c,0xf0,0x03,0xcf,0x03,0xc0,0x00,0x00,0x3c,0x00,0x0f,0xcf,0x0f,0x30,0x00,
- 0x00,0x3c,0x00,0x0f,0xcf,0x0f,0x30,0x00,0x00,0x3c,0xc0,0x0f,0x0f,0x00,0x30,
- 0x00,0x00,0x3c,0xc0,0x0f,0x0f,0x00,0x30,0x00,0x00,0x3c,0x30,0xff,0xff,0x0f,
- 0x30,0x00,0x00,0x3c,0x30,0xff,0xff,0x0f,0x30,0x00,0x00,0x30,0x00,0x00,0x00,
- 0x00,0x30,0x00,0x00,0x30,0x00,0x00,0x00,0x00,0x30,0x00,0x00,0xc0,0x03,0x00,
- 0x00,0x00,0x0f,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x0f,0x00,0x00,0x00,0x3c,
- 0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char rookR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x03, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x03, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0xc0, 0xff, 0xff, 0x03, 0x00, 0x10, 0x48, 0x00, 0x80, 0xff,
+  0x3f, 0x07, 0x00, 0x10, 0x88, 0x00, 0x00, 0x00, 0x03, 0x04, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0xfc, 0x7f, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0x3c,
+  0x63, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0x06, 0xe3, 0x00, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0xfe, 0xff, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0x03,
+  0xc1, 0x01, 0x00, 0x08, 0x10, 0x01, 0x00, 0x07, 0xc1, 0x01, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0xff, 0x7f, 0x01, 0x00, 0x08, 0x20, 0x01, 0x00, 0x00,
+  0x03, 0x00, 0x00, 0x08, 0x20, 0x01, 0x00, 0xf8, 0x1f, 0x00, 0x00, 0x08,
+  0x20, 0x01, 0x00, 0xf0, 0x3f, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x00,
+  0x01, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04,
+  0x20, 0x02, 0xe0, 0x07, 0x00, 0x00, 0x00, 0x04, 0x20, 0x02, 0xf0, 0x0f,
+  0x0c, 0x0e, 0x00, 0x04, 0x40, 0x02, 0x10, 0x18, 0x1e, 0x03, 0x00, 0x04,
+  0x40, 0x02, 0x90, 0x31, 0xa6, 0x01, 0x00, 0x02, 0x40, 0x02, 0x30, 0x37,
+  0xc6, 0x00, 0x00, 0x02, 0x40, 0x02, 0x10, 0x3e, 0xc6, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x33, 0x46, 0x00, 0x00, 0x02, 0x40, 0x04, 0x80, 0x31,
+  0xf6, 0x0f, 0x00, 0x02, 0x80, 0x04, 0x00, 0x60, 0xff, 0x1d, 0x00, 0x02,
+  0x80, 0x04, 0xe0, 0xef, 0x6f, 0x00, 0x00, 0x01, 0x80, 0x04, 0xf0, 0xdf,
+  0x67, 0x08, 0x00, 0x01, 0x80, 0x04, 0x30, 0x18, 0xe6, 0x0f, 0x00, 0x01,
+  0x80, 0x04, 0xb0, 0x11, 0xe6, 0x07, 0x00, 0x01, 0x80, 0x08, 0xa0, 0x33,
+  0x06, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x36, 0x04, 0x00, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0x3c, 0xc0, 0x00, 0x00, 0x01, 0x00, 0x09, 0x00, 0xee,
+  0x7f, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0xe3, 0x0f, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0xe0, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/rookR_m.xbm b/xshogi/eastern_bitmaps/rookR_m.xbm
index 79ede62..cb94c6b 100644
--- a/xshogi/eastern_bitmaps/rookR_m.xbm
+++ b/xshogi/eastern_bitmaps/rookR_m.xbm
@@ -1,6 +1,6 @@
 #define rookR_m_width 49
 #define rookR_m_height 49
-static char rookR_m_bits[] = {
+static unsigned char rookR_m_bits[] = {
  0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,
  0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x00,
  0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/rook_l.xbm b/xshogi/eastern_bitmaps/rook_l.xbm
index f54819d..a968391 100644
--- a/xshogi/eastern_bitmaps/rook_l.xbm
+++ b/xshogi/eastern_bitmaps/rook_l.xbm
@@ -1,38 +1,46 @@
 #define rook_l_width 64
 #define rook_l_height 64
-static char rook_l_bits[] = {
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0xf0,0x00,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0x00,0x0f,
- 0x00,0x00,0x3c,0x00,0x00,0x00,0xf0,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0xf0,
- 0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0x0c,0x00,0x00,0x00,0x00,0x0c,0x00,0x00,
- 0x0c,0x00,0x00,0x00,0x00,0x0c,0x00,0x00,0x0c,0xf0,0xff,0xff,0x0c,0x3c,0x00,
- 0x00,0x0c,0xf0,0xff,0xff,0x0c,0x3c,0x00,0x00,0x0c,0x00,0xf0,0xf0,0x03,0x3c,
- 0x00,0x00,0x0c,0x00,0xf0,0xf0,0x03,0x3c,0x00,0x00,0x0c,0xf0,0xf3,0xf0,0x00,
- 0x3c,0x00,0x00,0x0c,0xf0,0xf3,0xf0,0x00,0x3c,0x00,0x00,0x03,0xc0,0xf3,0xc0,
- 0x0f,0x30,0x00,0x00,0x03,0xc0,0xf3,0xc0,0x0f,0x30,0x00,0x00,0x03,0xfc,0xff,
- 0xff,0x00,0xf0,0x00,0x00,0x03,0xfc,0xff,0xff,0x00,0xf0,0x00,0x00,0x03,0xc0,
- 0xf3,0xf0,0x0c,0xf0,0x00,0x00,0x03,0xc0,0xf3,0xf0,0x0c,0xf0,0x00,0x00,0x03,
- 0xc0,0xf3,0xf0,0x03,0xf0,0x00,0x00,0x03,0xc0,0xf3,0xf0,0x03,0xf0,0x00,0xc0,
- 0x00,0xc0,0xf0,0xf0,0x00,0xc0,0x00,0xc0,0x00,0xc0,0xf0,0xf0,0x00,0xc0,0x00,
- 0xc0,0x00,0x30,0xf0,0xc0,0x0f,0xc0,0x03,0xc0,0x00,0x30,0xf0,0xc0,0x0f,0xc0,
- 0x03,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0xc0,0x00,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0xc0,0x00,0x00,0xf0,0x00,0x00,0xc0,0x03,0xc0,0x00,0x00,0xf0,0x00,
- 0x00,0xc0,0x03,0x30,0x00,0xfc,0xff,0xff,0x03,0x00,0x03,0x30,0x00,0xfc,0xff,
- 0xff,0x03,0x00,0x03,0x30,0x00,0x00,0xf0,0x00,0x00,0x00,0x0f,0x30,0x00,0x00,
- 0xf0,0x00,0x00,0x00,0x0f,0x30,0x00,0xf0,0xff,0xff,0x00,0x00,0x0f,0x30,0x00,
- 0xf0,0xff,0xff,0x00,0x00,0x0f,0x30,0x00,0xf0,0xf0,0xf0,0x00,0x00,0x0f,0x30,
- 0x00,0xf0,0xf0,0xf0,0x00,0x00,0x0f,0x0c,0x00,0xf0,0xff,0xff,0x00,0x00,0x0c,
- 0x0c,0x00,0xf0,0xff,0xff,0x00,0x00,0x0c,0x0c,0x00,0xf0,0xf0,0xf0,0x00,0x00,
- 0x3c,0x0c,0x00,0xf0,0xf0,0xf0,0x00,0x00,0x3c,0x0c,0x00,0xf0,0xff,0xff,0x00,
- 0x00,0x3c,0x0c,0x00,0xf0,0xff,0xff,0x00,0x00,0x3c,0x0c,0x00,0x00,0xf0,0x00,
- 0x00,0x00,0x3c,0x0c,0x00,0x00,0xf0,0x00,0x00,0x00,0x3c,0x03,0x00,0xff,0xff,
- 0xff,0x0f,0x00,0x30,0x03,0x00,0xff,0xff,0xff,0x0f,0x00,0x30,0x03,0x00,0x00,
- 0xf0,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0xf0,0x00,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xfc,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff};
+static unsigned char rook_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x00, 0x07, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0xf0,
+  0xc7, 0x00, 0x80, 0x00, 0x00, 0x11, 0x00, 0xfe, 0x77, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0x00, 0x03, 0x3c, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x20,
+  0x6c, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x60, 0xcc, 0x05, 0x80, 0x00,
+  0x00, 0x09, 0xe0, 0x67, 0x88, 0x0d, 0x80, 0x00, 0x00, 0x09, 0xf0, 0x67,
+  0x18, 0x0c, 0x80, 0x00, 0x00, 0x09, 0x10, 0xe6, 0xfb, 0x0f, 0x00, 0x01,
+  0x80, 0x08, 0x00, 0xf6, 0xf7, 0x07, 0x00, 0x01, 0x80, 0x08, 0xb8, 0xff,
+  0x06, 0x00, 0x00, 0x01, 0x80, 0x04, 0xf0, 0x6f, 0x8c, 0x01, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x62, 0xcc, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0x63,
+  0x7c, 0x08, 0x00, 0x01, 0x80, 0x04, 0x00, 0x63, 0xec, 0x0c, 0x00, 0x01,
+  0x80, 0x04, 0x80, 0x65, 0x8c, 0x09, 0x00, 0x02, 0x40, 0x04, 0xc0, 0x78,
+  0x18, 0x08, 0x00, 0x02, 0x40, 0x02, 0x70, 0x30, 0xf0, 0x0f, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x00, 0xe0, 0x07, 0x00, 0x02, 0x40, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x80, 0x00, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0xfc, 0x0f, 0x00, 0x00, 0x04, 0x20, 0x02, 0x00, 0xf8,
+  0x1f, 0x00, 0x00, 0x04, 0x20, 0x02, 0x00, 0xc0, 0x00, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x80, 0xfe, 0xff, 0x00, 0x00, 0x04, 0x20, 0x01, 0x80, 0x83,
+  0xe0, 0x00, 0x00, 0x04, 0x20, 0x01, 0x80, 0x83, 0xc0, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0xff, 0x7f, 0x00, 0x00, 0x08, 0x20, 0x01, 0x00, 0xc7,
+  0x60, 0x00, 0x00, 0x08, 0x10, 0x01, 0x00, 0xc6, 0x3c, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0xfe, 0x3f, 0x00, 0x00, 0x08, 0x90, 0x00, 0x20, 0xc0,
+  0x00, 0x00, 0x00, 0x08, 0x90, 0x00, 0xe0, 0xfc, 0xff, 0x01, 0x00, 0x08,
+  0x90, 0x00, 0xc0, 0xff, 0xff, 0x03, 0x00, 0x10, 0x90, 0x00, 0x00, 0xc0,
+  0x00, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xc0, 0x00, 0x00, 0x00, 0x10,
+  0x88, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/rook_m.xbm b/xshogi/eastern_bitmaps/rook_m.xbm
index 3ca13ee..6edbeec 100644
--- a/xshogi/eastern_bitmaps/rook_m.xbm
+++ b/xshogi/eastern_bitmaps/rook_m.xbm
@@ -1,6 +1,6 @@
 #define rook_m_width 49
 #define rook_m_height 49
-static char rook_m_bits[] = {
+static unsigned char rook_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,
  0x38,0x38,0x00,0x00,0xfe,0x00,0x00,0x07,0xc0,0x01,0x00,0xfe,0x00,0x00,0x07,
diff --git a/xshogi/eastern_bitmaps/silver.xbm b/xshogi/eastern_bitmaps/silver.xbm
index dc9ec20..a4ac46b 100644
--- a/xshogi/eastern_bitmaps/silver.xbm
+++ b/xshogi/eastern_bitmaps/silver.xbm
@@ -1,6 +1,6 @@
 #define silver_width 32
 #define silver_height 32
-static char silver_bits[] = {
+static unsigned char silver_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,
  0x00,0x00,0x03,0x60,0x00,0xc0,0x00,0x80,0x01,0x20,0x18,0x00,0x02,0x20,0x34,
  0x3f,0x06,0x20,0x62,0x33,0x06,0x20,0x3d,0x3f,0x06,0x10,0x18,0x33,0x04,0x10,
diff --git a/xshogi/eastern_bitmaps/silverP.xbm b/xshogi/eastern_bitmaps/silverP.xbm
index f183b14..8201f23 100644
--- a/xshogi/eastern_bitmaps/silverP.xbm
+++ b/xshogi/eastern_bitmaps/silverP.xbm
@@ -1,6 +1,6 @@
 #define silverP_width 32
 #define silverP_height 32
-static char silverP_bits[] = {
+static unsigned char silverP_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,
  0x00,0x00,0x03,0x60,0x00,0xc0,0x00,0x88,0x01,0x20,0x80,0x01,0x02,0x20,0xfc,
  0x1f,0x06,0x20,0x8c,0x01,0x06,0x20,0x0c,0x03,0x06,0x10,0x7c,0x03,0x04,0x10,
diff --git a/xshogi/eastern_bitmaps/silverPR.xbm b/xshogi/eastern_bitmaps/silverPR.xbm
index 04ca2a4..5dd432c 100644
--- a/xshogi/eastern_bitmaps/silverPR.xbm
+++ b/xshogi/eastern_bitmaps/silverPR.xbm
@@ -1,6 +1,6 @@
 #define silverPR_width 32
 #define silverPR_height 32
-static char silverPR_bits[] = {
+static unsigned char silverPR_bits[] = {
  0xff,0xff,0xff,0x7f,0x01,0x00,0x00,0xc0,0x01,0x00,0x00,0xc0,0x01,0x63,0x3f,
  0xc0,0x01,0x76,0x0c,0xc0,0x02,0x6c,0x2d,0x60,0x02,0x6a,0x0c,0x60,0x02,0x60,
  0x3f,0x60,0x02,0x7e,0x0c,0x60,0x04,0x66,0x1e,0x30,0x04,0x7e,0x20,0x30,0x04,
diff --git a/xshogi/eastern_bitmaps/silverPR_l.xbm b/xshogi/eastern_bitmaps/silverPR_l.xbm
index 3e015f9..2570986 100644
--- a/xshogi/eastern_bitmaps/silverPR_l.xbm
+++ b/xshogi/eastern_bitmaps/silverPR_l.xbm
@@ -1,38 +1,46 @@
 #define silverPR_l_width 64
 #define silverPR_l_height 64
-static char silverPR_l_bits[] = {
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x3c,0xf0,0xfc,0x3f,0x00,0xc0,0x0f,0x00,0x3c,
- 0xf0,0xfc,0x3f,0x00,0xc0,0x0c,0x00,0xf0,0xfc,0xc0,0x03,0x00,0xc0,0x0c,0x00,
- 0xf0,0xfc,0xc0,0x03,0x00,0xc0,0x3c,0x00,0xc0,0xf3,0xcc,0x33,0x00,0x30,0x3c,
- 0x00,0xc0,0xf3,0xcc,0x33,0x00,0x30,0x3c,0x00,0x30,0xf3,0xc0,0x03,0x00,0x30,
- 0x3c,0x00,0x30,0xf3,0xc0,0x03,0x00,0x30,0x3c,0x00,0x00,0xf0,0xfc,0x3f,0x00,
- 0x30,0x3c,0x00,0x00,0xf0,0xfc,0x3f,0x00,0x30,0x30,0x00,0xf0,0xff,0xc0,0x03,
- 0x00,0x30,0x30,0x00,0xf0,0xff,0xc0,0x03,0x00,0x30,0xf0,0x00,0xf0,0xf0,0xf0,
- 0x0f,0x00,0x0c,0xf0,0x00,0xf0,0xf0,0xf0,0x0f,0x00,0x0c,0xf0,0x00,0xf0,0xff,
- 0x00,0x30,0x00,0x0c,0xf0,0x00,0xf0,0xff,0x00,0x30,0x00,0x0c,0xf0,0x00,0xf0,
- 0xf0,0x3c,0x0c,0x00,0x0c,0xf0,0x00,0xf0,0xf0,0x3c,0x0c,0x00,0x0c,0xc0,0x00,
- 0xf0,0xff,0xf0,0x03,0x00,0x0c,0xc0,0x00,0xf0,0xff,0xf0,0x03,0x00,0x0c,0xc0,
- 0x03,0x00,0x00,0xc0,0x00,0x00,0x03,0xc0,0x03,0x00,0x00,0xc0,0x00,0x00,0x03,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x03,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,
- 0x03,0xc0,0x03,0xc0,0xc0,0xfc,0x30,0x00,0x03,0xc0,0x03,0xc0,0xc0,0xfc,0x30,
- 0x00,0x03,0x00,0x03,0xf0,0x33,0x3c,0x0c,0x00,0x03,0x00,0x03,0xf0,0x33,0x3c,
- 0x0c,0x00,0x03,0x00,0x0f,0x00,0x0f,0x3c,0x0f,0xc0,0x00,0x00,0x0f,0x00,0x0f,
- 0x3c,0x0f,0xc0,0x00,0x00,0x0f,0x00,0x3f,0x3c,0x0f,0xc0,0x00,0x00,0x0f,0x00,
- 0x3f,0x3c,0x0f,0xc0,0x00,0x00,0x0f,0xc0,0x3c,0x3c,0x0f,0xc0,0x00,0x00,0x0f,
- 0xc0,0x3c,0x3c,0x0f,0xc0,0x00,0x00,0x0c,0x00,0xf0,0xfc,0x0f,0xc0,0x00,0x00,
- 0x0c,0x00,0xf0,0xfc,0x0f,0xc0,0x00,0x00,0x3c,0x00,0xf0,0x00,0x0f,0x30,0x00,
- 0x00,0x3c,0x00,0xf0,0x00,0x0f,0x30,0x00,0x00,0x3c,0x00,0xc0,0x03,0x0f,0x30,
- 0x00,0x00,0x3c,0x00,0xc0,0x03,0x0f,0x30,0x00,0x00,0x3c,0xc0,0xff,0xff,0x0f,
- 0x30,0x00,0x00,0x3c,0xc0,0xff,0xff,0x0f,0x30,0x00,0x00,0x30,0x00,0xc0,0x03,
- 0x00,0x30,0x00,0x00,0x30,0x00,0xc0,0x03,0x00,0x30,0x00,0x00,0xc0,0x03,0x03,
- 0x00,0x00,0x0f,0x00,0x00,0xc0,0x03,0x03,0x00,0x00,0x0f,0x00,0x00,0x00,0x3c,
- 0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char silverPR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x1c, 0x00, 0x20,
+  0x48, 0x00, 0xfc, 0xff, 0xff, 0x0f, 0x00, 0x20, 0x48, 0x00, 0xfc, 0xff,
+  0xff, 0x01, 0x00, 0x20, 0x48, 0x00, 0xf8, 0x83, 0x03, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x80,
+  0x01, 0x00, 0x00, 0x10, 0x88, 0x00, 0x00, 0x80, 0xc0, 0x01, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0x80, 0xff, 0x01, 0x00, 0x10, 0x90, 0x00, 0x80, 0xff,
+  0x7f, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xbf, 0x01, 0x00, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0x80,
+  0xfe, 0x01, 0x00, 0x08, 0x10, 0x01, 0x00, 0xf8, 0x7f, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0x9c, 0x00, 0x00, 0x00, 0x08, 0x20, 0x01, 0x1f, 0x80,
+  0x01, 0x78, 0x00, 0x08, 0x20, 0x01, 0x3e, 0x80, 0x7f, 0x0c, 0x00, 0x08,
+  0x20, 0x01, 0xfc, 0xf0, 0x0f, 0x07, 0x00, 0x04, 0x20, 0x01, 0xf0, 0x39,
+  0x80, 0x03, 0x00, 0x04, 0x20, 0x01, 0xc0, 0x03, 0xc0, 0x00, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x07, 0x60, 0x00, 0x00, 0x04, 0x20, 0x02, 0x00, 0x0e,
+  0x38, 0x00, 0x00, 0x04, 0x40, 0x02, 0x00, 0x18, 0x1c, 0x00, 0x00, 0x04,
+  0x40, 0x02, 0x00, 0x30, 0x0e, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x60,
+  0x07, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0xe0, 0x07, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x80, 0x03, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x02, 0x80, 0x04, 0x00, 0xc0, 0x03, 0x00, 0x00, 0x02,
+  0x80, 0x04, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xc0,
+  0x01, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/silverPR_m.xbm b/xshogi/eastern_bitmaps/silverPR_m.xbm
index 157ded8..919bc33 100644
--- a/xshogi/eastern_bitmaps/silverPR_m.xbm
+++ b/xshogi/eastern_bitmaps/silverPR_m.xbm
@@ -1,6 +1,6 @@
 #define silverPR_m_width 49
 #define silverPR_m_height 49
-static char silverPR_m_bits[] = {
+static unsigned char silverPR_m_bits[] = {
  0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,
  0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x00,
  0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/silverP_l.xbm b/xshogi/eastern_bitmaps/silverP_l.xbm
index 82c9ba1..ac0fb31 100644
--- a/xshogi/eastern_bitmaps/silverP_l.xbm
+++ b/xshogi/eastern_bitmaps/silverP_l.xbm
@@ -1,38 +1,46 @@
 #define silverP_l_width 64
 #define silverP_l_height 64
-static char silverP_l_bits[] = {
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0xf0,0x00,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0x00,0x0f,
- 0x00,0x00,0x3c,0x00,0x00,0x00,0xf0,0x00,0x00,0xc0,0xc0,0x03,0x00,0x00,0xf0,
- 0x00,0x00,0xc0,0xc0,0x03,0x00,0x00,0x0c,0x00,0xc0,0x03,0x00,0x0c,0x00,0x00,
- 0x0c,0x00,0xc0,0x03,0x00,0x0c,0x00,0x00,0x0c,0xf0,0xff,0xff,0x03,0x3c,0x00,
- 0x00,0x0c,0xf0,0xff,0xff,0x03,0x3c,0x00,0x00,0x0c,0xf0,0xc0,0x03,0x00,0x3c,
- 0x00,0x00,0x0c,0xf0,0xc0,0x03,0x00,0x3c,0x00,0x00,0x0c,0xf0,0x00,0x0f,0x00,
- 0x3c,0x00,0x00,0x0c,0xf0,0x00,0x0f,0x00,0x3c,0x00,0x00,0x03,0xf0,0x3f,0x0f,
- 0x00,0x30,0x00,0x00,0x03,0xf0,0x3f,0x0f,0x00,0x30,0x00,0x00,0x03,0xf0,0x3c,
- 0x3c,0x03,0xf0,0x00,0x00,0x03,0xf0,0x3c,0x3c,0x03,0xf0,0x00,0x00,0x03,0xf0,
- 0x3c,0xfc,0x00,0xf0,0x00,0x00,0x03,0xf0,0x3c,0xfc,0x00,0xf0,0x00,0x00,0x03,
- 0xf0,0x3c,0xf0,0x00,0xf0,0x00,0x00,0x03,0xf0,0x3c,0xf0,0x00,0xf0,0x00,0xc0,
- 0x00,0x30,0x3c,0xcc,0x0f,0xc0,0x00,0xc0,0x00,0x30,0x3c,0xcc,0x0f,0xc0,0x00,
- 0xc0,0x00,0x0c,0x3f,0x03,0x03,0xc0,0x03,0xc0,0x00,0x0c,0x3f,0x03,0x03,0xc0,
- 0x03,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0xc0,0x00,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0xc0,0x00,0x00,0x03,0x00,0x00,0xc0,0x03,0xc0,0x00,0x00,0x03,0x00,
- 0x00,0xc0,0x03,0x30,0x00,0xc0,0x0f,0xff,0x0f,0x00,0x03,0x30,0x00,0xc0,0x0f,
- 0xff,0x0f,0x00,0x03,0x30,0x00,0x30,0x3c,0x0f,0x0f,0x00,0x0f,0x30,0x00,0x30,
- 0x3c,0x0f,0x0f,0x00,0x0f,0x30,0x00,0x0c,0x00,0xff,0x0f,0x00,0x0f,0x30,0x00,
- 0x0c,0x00,0xff,0x0f,0x00,0x0f,0x30,0x00,0xf0,0x0f,0x0f,0x0f,0x00,0x0f,0x30,
- 0x00,0xf0,0x0f,0x0f,0x0f,0x00,0x0f,0x0c,0x00,0xc0,0x03,0xff,0x0f,0x00,0x0c,
- 0x0c,0x00,0xc0,0x03,0xff,0x0f,0x00,0x0c,0x0c,0x00,0xfc,0x3f,0x0f,0x00,0x00,
- 0x3c,0x0c,0x00,0xfc,0x3f,0x0f,0x00,0x00,0x3c,0x0c,0x00,0xc0,0x03,0xcf,0x0c,
- 0x00,0x3c,0x0c,0x00,0xc0,0x03,0xcf,0x0c,0x00,0x3c,0x0c,0x00,0xcc,0x33,0xcf,
- 0x03,0x00,0x3c,0x0c,0x00,0xcc,0x33,0xcf,0x03,0x00,0x3c,0x03,0x00,0xc0,0x03,
- 0x3f,0x0f,0x00,0x30,0x03,0x00,0xc0,0x03,0x3f,0x0f,0x00,0x30,0x03,0x00,0xfc,
- 0x3f,0x0f,0x3c,0x00,0xf0,0x03,0x00,0xfc,0x3f,0x0f,0x3c,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xfc,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff};
+static unsigned char silverP_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x80,
+  0x03, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x80, 0x03, 0x00, 0x00, 0x01,
+  0x80, 0x08, 0x00, 0x80, 0x03, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0xc0,
+  0x03, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xe0,
+  0x07, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xe0, 0x06, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x70, 0x0c, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x38,
+  0x18, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x1c, 0x70, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x06, 0xe0, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x03,
+  0xc0, 0x03, 0x00, 0x02, 0x40, 0x02, 0xc0, 0x01, 0x9c, 0x0f, 0x00, 0x02,
+  0x40, 0x02, 0xe0, 0xf0, 0x0f, 0x3f, 0x00, 0x04, 0x20, 0x02, 0x30, 0xfe,
+  0x01, 0x7c, 0x00, 0x04, 0x20, 0x02, 0x1e, 0x80, 0x01, 0xf8, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0x00, 0x39, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0xfe,
+  0x1f, 0x00, 0x00, 0x04, 0x20, 0x01, 0x80, 0x7f, 0x01, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0x00, 0x01, 0x00, 0x00, 0x08, 0x20, 0x01, 0x00, 0x80,
+  0xfd, 0x00, 0x00, 0x08, 0x10, 0x01, 0x00, 0xfe, 0xff, 0x01, 0x00, 0x08,
+  0x10, 0x01, 0x80, 0xff, 0x01, 0x00, 0x00, 0x08, 0x90, 0x00, 0x80, 0x03,
+  0x01, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x08,
+  0x90, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xc0,
+  0xc1, 0x1f, 0x00, 0x10, 0x90, 0x00, 0x80, 0xff, 0xff, 0x3f, 0x00, 0x10,
+  0x88, 0x00, 0xf0, 0xff, 0xff, 0x3f, 0x00, 0x10, 0x48, 0x00, 0x38, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/silverP_m.xbm b/xshogi/eastern_bitmaps/silverP_m.xbm
index 1a856e6..f58488a 100644
--- a/xshogi/eastern_bitmaps/silverP_m.xbm
+++ b/xshogi/eastern_bitmaps/silverP_m.xbm
@@ -1,6 +1,6 @@
 #define silverP_m_width 49
 #define silverP_m_height 49
-static char silverP_m_bits[] = {
+static unsigned char silverP_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,
  0x38,0x38,0x00,0x00,0xfe,0x00,0x00,0x07,0xc0,0x01,0x00,0xfe,0x00,0x00,0x07,
diff --git a/xshogi/eastern_bitmaps/silverR.xbm b/xshogi/eastern_bitmaps/silverR.xbm
index ae19b96..0035467 100644
--- a/xshogi/eastern_bitmaps/silverR.xbm
+++ b/xshogi/eastern_bitmaps/silverR.xbm
@@ -1,6 +1,6 @@
 #define silverR_width 32
 #define silverR_height 32
-static char silverR_bits[] = {
+static unsigned char silverR_bits[] = {
  0xff,0xff,0xff,0x7f,0x01,0x00,0x00,0xc0,0x01,0x00,0x00,0xc0,0x01,0x1c,0x4c,
  0xc0,0x01,0x8c,0x2c,0xc0,0x02,0x0c,0x2d,0x60,0x02,0x0c,0x2c,0x60,0x02,0xff,
  0x7d,0x60,0x02,0x00,0x0c,0x60,0x04,0x94,0x7c,0x30,0x04,0x22,0x2d,0x30,0x04,
diff --git a/xshogi/eastern_bitmaps/silverR_l.xbm b/xshogi/eastern_bitmaps/silverR_l.xbm
index 9ca6f10..a55ad95 100644
--- a/xshogi/eastern_bitmaps/silverR_l.xbm
+++ b/xshogi/eastern_bitmaps/silverR_l.xbm
@@ -1,38 +1,46 @@
 #define silverR_l_width 64
 #define silverR_l_height 64
-static char silverR_l_bits[] = {
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x3f,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,
- 0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x0f,0xc0,0xc3,0x00,0xc0,0x0f,0x00,0x00,
- 0x0f,0xc0,0xc3,0x00,0xc0,0x0c,0x00,0xc0,0xc3,0xc0,0xc3,0x00,0xc0,0x0c,0x00,
- 0xc0,0xc3,0xc0,0xc3,0x00,0xc0,0x3c,0x00,0xc0,0x03,0xc3,0x33,0x00,0x30,0x3c,
- 0x00,0xc0,0x03,0xc3,0x33,0x00,0x30,0x3c,0x00,0xc0,0x03,0xc0,0x33,0x00,0x30,
- 0x3c,0x00,0xc0,0x03,0xc0,0x33,0x00,0x30,0x3c,0x00,0xfc,0xff,0xcf,0xff,0x00,
- 0x30,0x3c,0x00,0xfc,0xff,0xcf,0xff,0x00,0x30,0x30,0x00,0xc0,0x03,0xc0,0x03,
- 0x00,0x30,0x30,0x00,0xc0,0x03,0xc0,0x03,0x00,0x30,0xf0,0x00,0x00,0x00,0xc3,
- 0xff,0x00,0x0c,0xf0,0x00,0x00,0x00,0xc3,0xff,0x00,0x0c,0xf0,0x00,0xc0,0x0c,
- 0xcf,0x33,0x00,0x0c,0xf0,0x00,0xc0,0x0c,0xcf,0x33,0x00,0x0c,0xf0,0x00,0xf0,
- 0x3c,0xcc,0x33,0x00,0x0c,0xf0,0x00,0xf0,0x3c,0xcc,0x33,0x00,0x0c,0xc0,0x00,
- 0x30,0xf0,0xcf,0x33,0x00,0x0c,0xc0,0x00,0x30,0xf0,0xcf,0x33,0x00,0x0c,0xc0,
- 0x03,0xf0,0x0f,0x00,0x00,0x00,0x03,0xc0,0x03,0xf0,0x0f,0x00,0x00,0x00,0x03,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x03,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,
- 0x03,0xc0,0x03,0xfc,0xfc,0xfc,0xff,0x00,0x03,0xc0,0x03,0xfc,0xfc,0xfc,0xff,
- 0x00,0x03,0x00,0x03,0xc0,0xf3,0xc0,0x03,0x00,0x03,0x00,0x03,0xc0,0xf3,0xc0,
- 0x03,0x00,0x03,0x00,0x0f,0x30,0xf3,0xcc,0x33,0xc0,0x00,0x00,0x0f,0x30,0xf3,
- 0xcc,0x33,0xc0,0x00,0x00,0x0f,0x00,0xf0,0xc0,0x03,0xc0,0x00,0x00,0x0f,0x00,
- 0xf0,0xc0,0x03,0xc0,0x00,0x00,0x0f,0xf0,0xff,0xfc,0x3f,0xc0,0x00,0x00,0x0f,
- 0xf0,0xff,0xfc,0x3f,0xc0,0x00,0x00,0x0c,0xf0,0xf0,0xc0,0x03,0xc0,0x00,0x00,
- 0x0c,0xf0,0xf0,0xc0,0x03,0xc0,0x00,0x00,0x3c,0xf0,0xff,0xf0,0xcf,0x30,0x00,
- 0x00,0x3c,0xf0,0xff,0xf0,0xcf,0x30,0x00,0x00,0x3c,0xf0,0xf0,0x3c,0x30,0x30,
- 0x00,0x00,0x3c,0xf0,0xf0,0x3c,0x30,0x30,0x00,0x00,0x3c,0xf0,0xff,0xf0,0x0c,
- 0x30,0x00,0x00,0x3c,0xf0,0xff,0xf0,0x0c,0x30,0x00,0x00,0x30,0x00,0x00,0xc0,
- 0x03,0x30,0x00,0x00,0x30,0x00,0x00,0xc0,0x03,0x30,0x00,0x00,0xc0,0x03,0x00,
- 0x00,0x00,0x0f,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x0f,0x00,0x00,0x00,0x3c,
- 0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x3c,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x0f,0x00,0x00,0x00,
- 0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,0x00,0x00,0x00,0x3c,0xf0,0x00,0x00,0x00,
- 0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x0f,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char silverR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x0f, 0x80, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x0b,
+  0xc0, 0x01, 0x00, 0x20, 0x48, 0x00, 0x00, 0xc3, 0xe0, 0x01, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0xe3, 0x60, 0x03, 0x00, 0x10, 0x48, 0x00, 0x00, 0x63,
+  0x60, 0x18, 0x00, 0x10, 0x88, 0x00, 0x00, 0x26, 0x60, 0x1c, 0x00, 0x10,
+  0x90, 0x00, 0xe0, 0xe7, 0x63, 0x0c, 0x00, 0x10, 0x90, 0x00, 0xf0, 0xff,
+  0x63, 0x0c, 0x00, 0x10, 0x90, 0x00, 0x00, 0x06, 0x60, 0x04, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0x60, 0x20, 0x1f, 0x00, 0x08, 0x90, 0x00, 0x00, 0x7c,
+  0xa0, 0x0f, 0x00, 0x08, 0x10, 0x01, 0x00, 0x1c, 0x29, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0x06, 0x7b, 0x04, 0x00, 0x08, 0x20, 0x01, 0x00, 0x66,
+  0xfb, 0x07, 0x00, 0x08, 0x20, 0x01, 0x00, 0x7e, 0xf0, 0x06, 0x00, 0x08,
+  0x20, 0x01, 0x00, 0x5c, 0x20, 0x03, 0x00, 0x04, 0x20, 0x01, 0x00, 0xc0,
+  0x61, 0x03, 0x00, 0x04, 0x20, 0x01, 0x00, 0xe0, 0x63, 0x01, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x78, 0x60, 0x01, 0x00, 0x04, 0x20, 0x02, 0x00, 0x18,
+  0x60, 0x00, 0x00, 0x04, 0x40, 0x02, 0x00, 0x08, 0x20, 0x00, 0x00, 0x04,
+  0x40, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x40, 0x02, 0xc0, 0x81,
+  0xf0, 0x0f, 0x00, 0x02, 0x40, 0x02, 0x80, 0xe3, 0xf8, 0x07, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0xf3, 0x4c, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0xd7,
+  0xe0, 0x07, 0x00, 0x02, 0x80, 0x04, 0x00, 0x47, 0x58, 0x00, 0x00, 0x02,
+  0x80, 0x04, 0xc0, 0x4c, 0xe0, 0x03, 0x00, 0x01, 0x80, 0x04, 0x60, 0x78,
+  0x58, 0x00, 0x00, 0x01, 0x80, 0x04, 0x60, 0x7c, 0xc0, 0x03, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x46, 0xf0, 0x01, 0x00, 0x01, 0x80, 0x08, 0x00, 0xf2,
+  0x00, 0x0c, 0x00, 0x01, 0x80, 0x08, 0x00, 0xde, 0x18, 0x06, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0xc2, 0x30, 0x03, 0x00, 0x01, 0x00, 0x09, 0x00, 0xfe,
+  0xe0, 0x01, 0x80, 0x00, 0x00, 0x09, 0x00, 0xdc, 0xc0, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x40, 0x40, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/silverR_m.xbm b/xshogi/eastern_bitmaps/silverR_m.xbm
index 47ffffb..d312a88 100644
--- a/xshogi/eastern_bitmaps/silverR_m.xbm
+++ b/xshogi/eastern_bitmaps/silverR_m.xbm
@@ -1,6 +1,6 @@
 #define silverR_m_width 49
 #define silverR_m_height 49
-static char silverR_m_bits[] = {
+static unsigned char silverR_m_bits[] = {
  0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,0xff,0xff,0xff,0xff,0x7f,0xfe,0xff,
  0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x00,
  0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,0x00,0x00,0x80,0xff,0x07,0x00,0x00,
diff --git a/xshogi/eastern_bitmaps/silver_l.xbm b/xshogi/eastern_bitmaps/silver_l.xbm
index 248e8d6..85062e6 100644
--- a/xshogi/eastern_bitmaps/silver_l.xbm
+++ b/xshogi/eastern_bitmaps/silver_l.xbm
@@ -1,38 +1,46 @@
 #define silver_l_width 64
 #define silver_l_height 64
-static char silver_l_bits[] = {
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,0x00,0x00,0x00,0x00,0x00,0x00,0x0f,0x3c,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0xf0,0x00,
- 0xc0,0x03,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,0x3c,0x00,0x00,0x00,0x00,0x0f,
- 0x00,0x00,0x3c,0x00,0x00,0x00,0xf0,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0xf0,
- 0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0x0c,0xc0,0x03,0x00,0x00,0x0c,0x00,0x00,
- 0x0c,0xc0,0x03,0x00,0x00,0x0c,0x00,0x00,0x0c,0x30,0x0f,0xff,0x0f,0x3c,0x00,
- 0x00,0x0c,0x30,0x0f,0xff,0x0f,0x3c,0x00,0x00,0x0c,0x0c,0x3c,0x0f,0x0f,0x3c,
- 0x00,0x00,0x0c,0x0c,0x3c,0x0f,0x0f,0x3c,0x00,0x00,0x0c,0xf3,0x0f,0xff,0x0f,
- 0x3c,0x00,0x00,0x0c,0xf3,0x0f,0xff,0x0f,0x3c,0x00,0x00,0x03,0xc0,0x03,0x0f,
- 0x0f,0x30,0x00,0x00,0x03,0xc0,0x03,0x0f,0x0f,0x30,0x00,0x00,0x03,0xfc,0x3f,
- 0xff,0x0f,0xf0,0x00,0x00,0x03,0xfc,0x3f,0xff,0x0f,0xf0,0x00,0x00,0x03,0xc0,
- 0x03,0x0f,0x00,0xf0,0x00,0x00,0x03,0xc0,0x03,0x0f,0x00,0xf0,0x00,0x00,0x03,
- 0xcc,0x33,0xcf,0x0c,0xf0,0x00,0x00,0x03,0xcc,0x33,0xcf,0x0c,0xf0,0x00,0xc0,
- 0x00,0xc0,0x03,0xcf,0x03,0xc0,0x00,0xc0,0x00,0xc0,0x03,0xcf,0x03,0xc0,0x00,
- 0xc0,0x00,0xff,0x3f,0x3f,0x3f,0xc0,0x03,0xc0,0x00,0xff,0x3f,0x3f,0x3f,0xc0,
- 0x03,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0xc0,0x00,0x00,0x00,0x00,0x00,
- 0xc0,0x03,0xc0,0x00,0x00,0x00,0xf0,0x0f,0xc0,0x03,0xc0,0x00,0x00,0x00,0xf0,
- 0x0f,0xc0,0x03,0x30,0x00,0xcc,0xf3,0x0f,0x0c,0x00,0x03,0x30,0x00,0xcc,0xf3,
- 0x0f,0x0c,0x00,0x03,0x30,0x00,0xcc,0x33,0x3c,0x0f,0x00,0x0f,0x30,0x00,0xcc,
- 0x33,0x3c,0x0f,0x00,0x0f,0x30,0x00,0xcc,0xf3,0x30,0x03,0x00,0x0f,0x30,0x00,
- 0xcc,0xf3,0x30,0x03,0x00,0x0f,0x30,0x00,0xff,0xc3,0x00,0x00,0x00,0x0f,0x30,
- 0x00,0xff,0xc3,0x00,0x00,0x00,0x0f,0x0c,0x00,0xc0,0x03,0xc0,0x03,0x00,0x0c,
- 0x0c,0x00,0xc0,0x03,0xc0,0x03,0x00,0x0c,0x0c,0x00,0xff,0xf3,0xff,0x3f,0x00,
- 0x3c,0x0c,0x00,0xff,0xf3,0xff,0x3f,0x00,0x3c,0x0c,0x00,0xcc,0x03,0xc0,0x03,
- 0x00,0x3c,0x0c,0x00,0xcc,0x03,0xc0,0x03,0x00,0x3c,0x0c,0x00,0xcc,0xc3,0xc0,
- 0x03,0x00,0x3c,0x0c,0x00,0xcc,0xc3,0xc0,0x03,0x00,0x3c,0x03,0x00,0xc3,0x03,
- 0xc3,0x03,0x00,0x30,0x03,0x00,0xc3,0x03,0xc3,0x03,0x00,0x30,0x03,0x00,0xc3,
- 0x03,0xf0,0x00,0x00,0xf0,0x03,0x00,0xc3,0x03,0xf0,0x00,0x00,0xf0,0x03,0x00,
- 0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xfc,0xff,0xff,0xff,0xff,0xff,0xff,0xff,0xfc,0xff,0xff,0xff,0xff,0xff,
- 0xff,0xff};
+static unsigned char silver_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x02, 0x02, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0x03,
+  0x3b, 0x00, 0x80, 0x00, 0x00, 0x11, 0x80, 0x07, 0x7f, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0xc0, 0x0c, 0x43, 0x00, 0x80, 0x00, 0x00, 0x09, 0x60, 0x18,
+  0x7b, 0x00, 0x80, 0x00, 0x00, 0x09, 0x30, 0x00, 0x4f, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x80, 0x0f, 0x62, 0x00, 0x80, 0x00, 0x00, 0x09, 0xc0, 0x03,
+  0x3e, 0x06, 0x80, 0x00, 0x00, 0x09, 0x00, 0x1a, 0x1e, 0x06, 0x00, 0x01,
+  0x80, 0x08, 0xc0, 0x07, 0x32, 0x03, 0x00, 0x01, 0x80, 0x08, 0x00, 0x1a,
+  0xe2, 0x00, 0x00, 0x01, 0x80, 0x04, 0xe0, 0x07, 0xeb, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x32, 0xcf, 0x00, 0x00, 0x01, 0x80, 0x04, 0xe0, 0x1f,
+  0xc7, 0x01, 0x00, 0x01, 0x80, 0x04, 0xf0, 0x0f, 0x81, 0x03, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x04,
+  0x10, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x06, 0x18, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x80, 0x06, 0x1e, 0x00, 0x00, 0x02, 0x40, 0x02, 0x80, 0xc6,
+  0x07, 0x00, 0x00, 0x02, 0x40, 0x02, 0xc0, 0x86, 0x03, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0xc0, 0x04, 0x3a, 0x00, 0x00, 0x04, 0x20, 0x02, 0x60, 0x0f,
+  0x7e, 0x00, 0x00, 0x04, 0x20, 0x02, 0xe0, 0xdf, 0x66, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x20, 0xde, 0x60, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x94,
+  0x38, 0x00, 0x00, 0x04, 0x20, 0x01, 0xf0, 0x05, 0x3e, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0xf8, 0x04, 0x06, 0x00, 0x00, 0x08, 0x20, 0x01, 0x20, 0x06,
+  0x60, 0x00, 0x00, 0x08, 0x10, 0x01, 0x30, 0xc6, 0xff, 0x0f, 0x00, 0x08,
+  0x10, 0x01, 0x30, 0xc6, 0xe7, 0x07, 0x00, 0x08, 0x90, 0x00, 0x38, 0x06,
+  0x64, 0x00, 0x00, 0x08, 0x90, 0x00, 0x18, 0x06, 0xc6, 0x00, 0x00, 0x08,
+  0x90, 0x00, 0xc0, 0x06, 0xc7, 0x00, 0x00, 0x10, 0x90, 0x00, 0x80, 0x07,
+  0xc3, 0x00, 0x00, 0x10, 0x90, 0x00, 0x80, 0x03, 0xd0, 0x00, 0x00, 0x10,
+  0x88, 0x00, 0x00, 0x01, 0xf0, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00,
+  0x60, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/silver_m.xbm b/xshogi/eastern_bitmaps/silver_m.xbm
index c5a347c..4c9d7e4 100644
--- a/xshogi/eastern_bitmaps/silver_m.xbm
+++ b/xshogi/eastern_bitmaps/silver_m.xbm
@@ -1,6 +1,6 @@
 #define silver_m_width 49
 #define silver_m_height 49
-static char silver_m_bits[] = {
+static unsigned char silver_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,
  0x38,0x38,0x00,0x00,0xfe,0x00,0x00,0x07,0xc0,0x01,0x00,0xfe,0x00,0x00,0x07,
diff --git a/xshogi/eastern_bitmaps/smallblank.xbm b/xshogi/eastern_bitmaps/smallblank.xbm
index af89266..db2114c 100644
--- a/xshogi/eastern_bitmaps/smallblank.xbm
+++ b/xshogi/eastern_bitmaps/smallblank.xbm
@@ -1,6 +1,6 @@
 #define smallblank_width 32
 #define smallblank_height 32
-static char smallblank_bits[] = {
+static unsigned char smallblank_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x01,
  0x00,0x00,0x30,0x06,0x00,0x00,0x0c,0x18,0x00,0x00,0x03,0x60,0x00,0x80,0x00,
  0x80,0x00,0x80,0x00,0x80,0x01,0x80,0x00,0x80,0x01,0x40,0x00,0x00,0x01,0x40,
diff --git a/xshogi/eastern_bitmaps/smallblankR.xbm b/xshogi/eastern_bitmaps/smallblankR.xbm
index 62a7767..4e83f4b 100644
--- a/xshogi/eastern_bitmaps/smallblankR.xbm
+++ b/xshogi/eastern_bitmaps/smallblankR.xbm
@@ -1,6 +1,6 @@
 #define smallblankR_width 32
 #define smallblankR_height 32
-static char smallblankR_bits[] = {
+static unsigned char smallblankR_bits[] = {
  0xfc,0xff,0xff,0x1f,0x04,0x00,0x00,0x30,0x04,0x00,0x00,0x30,0x04,0x00,0x00,
  0x30,0x04,0x00,0x00,0x30,0x08,0x00,0x00,0x18,0x08,0x00,0x00,0x18,0x08,0x00,
  0x00,0x18,0x08,0x00,0x00,0x18,0x10,0x00,0x00,0x0c,0x10,0x00,0x00,0x0c,0x10,
diff --git a/xshogi/eastern_bitmaps/smalllight.xbm b/xshogi/eastern_bitmaps/smalllight.xbm
index c37a1c0..dc72204 100644
--- a/xshogi/eastern_bitmaps/smalllight.xbm
+++ b/xshogi/eastern_bitmaps/smalllight.xbm
@@ -2,7 +2,7 @@
 #define smalllight_height 32
 #define smalllight_x_hot -1
 #define smalllight_y_hot -1
-static char smalllight_bits[] = {
+static unsigned char smalllight_bits[] = {
    0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
    0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x00, 0x00, 0x00, 0x0c, 0x00, 0x00,
    0x00, 0x03, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00,
diff --git a/xshogi/eastern_bitmaps/smallsolid.xbm b/xshogi/eastern_bitmaps/smallsolid.xbm
index da9b737..e789a54 100644
--- a/xshogi/eastern_bitmaps/smallsolid.xbm
+++ b/xshogi/eastern_bitmaps/smallsolid.xbm
@@ -1,6 +1,6 @@
 #define smallsolid_width 32
 #define smallsolid_height 32
-static char smallsolid_bits[] = {
+static unsigned char smallsolid_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x01,
  0x00,0x00,0xf0,0x07,0x00,0x00,0xfc,0x1f,0x00,0x00,0xff,0x7f,0x00,0x80,0xff,
  0xff,0x00,0x80,0xff,0xff,0x01,0x80,0xff,0xff,0x01,0xc0,0xff,0xff,0x01,0xc0,
diff --git a/xshogi/eastern_bitmaps/smallsolidR.xbm b/xshogi/eastern_bitmaps/smallsolidR.xbm
index 65d74ef..91ab460 100644
--- a/xshogi/eastern_bitmaps/smallsolidR.xbm
+++ b/xshogi/eastern_bitmaps/smallsolidR.xbm
@@ -1,6 +1,6 @@
 #define smallsolidR_width 32
 #define smallsolidR_height 32
-static char smallsolidR_bits[] = {
+static unsigned char smallsolidR_bits[] = {
  0xfc,0xff,0xff,0x1f,0xfc,0xff,0xff,0x3f,0xfc,0xff,0xff,0x3f,0xfc,0xff,0xff,
  0x3f,0xfc,0xff,0xff,0x3f,0xf8,0xff,0xff,0x1f,0xf8,0xff,0xff,0x1f,0xf8,0xff,
  0xff,0x1f,0xf8,0xff,0xff,0x1f,0xf0,0xff,0xff,0x0f,0xf0,0xff,0xff,0x0f,0xf0,
diff --git a/xshogi/eastern_bitmaps/smallsolidR_l.xbm b/xshogi/eastern_bitmaps/smallsolidR_l.xbm
index 7241cee..d1e862d 100644
--- a/xshogi/eastern_bitmaps/smallsolidR_l.xbm
+++ b/xshogi/eastern_bitmaps/smallsolidR_l.xbm
@@ -1,38 +1,46 @@
 #define smallsolidR_l_width 64
 #define smallsolidR_l_height 64
-static char smallsolidR_l_bits[] = {
- 0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,
- 0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,
- 0xff,0xff,0xff,0xff,0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,
- 0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,
- 0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0x00,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,
- 0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,
- 0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xfc,
- 0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,
- 0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,
- 0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,
- 0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,
- 0x3f,0x00,0x00,0xf0,0xff,0xff,0xff,0xff,0x0f,0x00,0x00,0xf0,0xff,0xff,0xff,
- 0xff,0x0f,0x00,0x00,0xf0,0xff,0xff,0xff,0xff,0x0f,0x00,0x00,0xf0,0xff,0xff,
- 0xff,0xff,0x0f,0x00,0x00,0xf0,0xff,0xff,0xff,0xff,0x0f,0x00,0x00,0xf0,0xff,
- 0xff,0xff,0xff,0x0f,0x00,0x00,0xf0,0xff,0xff,0xff,0xff,0x0f,0x00,0x00,0xf0,
- 0xff,0xff,0xff,0xff,0x0f,0x00,0x00,0xc0,0xff,0xff,0xff,0xff,0x03,0x00,0x00,
- 0xc0,0xff,0xff,0xff,0xff,0x03,0x00,0x00,0xc0,0xff,0xff,0xff,0xff,0x03,0x00,
- 0x00,0xc0,0xff,0xff,0xff,0xff,0x03,0x00,0x00,0xc0,0xff,0xff,0xff,0xff,0x03,
- 0x00,0x00,0xc0,0xff,0xff,0xff,0xff,0x03,0x00,0x00,0x00,0xff,0xff,0xff,0xff,
- 0x00,0x00,0x00,0x00,0xff,0xff,0xff,0xff,0x00,0x00,0x00,0x00,0xf0,0xff,0xff,
- 0x3f,0x00,0x00,0x00,0x00,0xf0,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0xff,
- 0xff,0x03,0x00,0x00,0x00,0x00,0x00,0xff,0xff,0x03,0x00,0x00,0x00,0x00,0x00,
- 0xf0,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x3f,0x00,0x00,0x00,0x00,0x00,
- 0x00,0xc0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xc0,0x03,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00};
+static unsigned char smallsolidR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0xf8, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x7f, 0x00, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x7f, 0x00, 0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00,
+  0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00, 0xc0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x7f, 0x00, 0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00,
+  0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00, 0xc0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x3f, 0x00, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x80, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x3f, 0x00, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x80, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x1f, 0x00, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0x00,
+  0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0x00, 0x00, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x1f, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0x00,
+  0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0x00, 0x00, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x1f, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00,
+  0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00, 0x00, 0xfe, 0xff, 0xff,
+  0xff, 0xff, 0x0f, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00,
+  0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00, 0x00, 0xfc, 0xff, 0xff,
+  0xff, 0xff, 0x0f, 0x00, 0x00, 0xf8, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00,
+  0x00, 0xf8, 0xff, 0xff, 0xff, 0xff, 0x07, 0x00, 0x00, 0xf0, 0xff, 0xff,
+  0xff, 0xff, 0x07, 0x00, 0x00, 0xf0, 0xff, 0xff, 0xff, 0xff, 0x07, 0x00,
+  0x00, 0xe0, 0xff, 0xff, 0xff, 0xff, 0x07, 0x00, 0x00, 0xc0, 0xff, 0xff,
+  0xff, 0xff, 0x07, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00,
+  0x00, 0x00, 0xf8, 0xff, 0xff, 0x3f, 0x00, 0x00, 0x00, 0x00, 0xc0, 0xff,
+  0xff, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0xf0, 0x1f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/eastern_bitmaps/smallsolidR_m.xbm b/xshogi/eastern_bitmaps/smallsolidR_m.xbm
index 80a0fb8..3c70b8a 100644
--- a/xshogi/eastern_bitmaps/smallsolidR_m.xbm
+++ b/xshogi/eastern_bitmaps/smallsolidR_m.xbm
@@ -1,6 +1,6 @@
 #define smallsolidR_m_width 49
 #define smallsolidR_m_height 49
-static char smallsolidR_m_bits[] = {
+static unsigned char smallsolidR_m_bits[] = {
  0xf0,0xff,0xff,0xff,0xff,0x1f,0xfe,0xf0,0xff,0xff,0xff,0xff,0x1f,0xfe,0xf0,
  0xff,0xff,0xff,0xff,0x3f,0xfe,0xf0,0xff,0xff,0xff,0xff,0x3f,0xfe,0xf0,0xff,
  0xff,0xff,0xff,0x3f,0xfe,0xf0,0xff,0xff,0xff,0xff,0x3f,0xfe,0xf0,0xff,0xff,
diff --git a/xshogi/eastern_bitmaps/smallsolid_l.xbm b/xshogi/eastern_bitmaps/smallsolid_l.xbm
index 0fe37a6..a0d07c0 100644
--- a/xshogi/eastern_bitmaps/smallsolid_l.xbm
+++ b/xshogi/eastern_bitmaps/smallsolid_l.xbm
@@ -1,38 +1,38 @@
 #define smallsolid_l_width 64
 #define smallsolid_l_height 64
-static char smallsolid_l_bits[] = {
+static unsigned char smallsolid_l_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0xff,0x0f,0x00,0x00,0x00,0x00,0x00,0xf0,0xff,
+ 0x7f,0x00,0x00,0x00,0x00,0x00,0xff,0xff,0xff,0x03,0x00,0x00,0x00,0xf0,0xff,
+ 0xff,0xff,0x1f,0x00,0x00,0x00,0xf8,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0xfc,
+ 0xff,0xff,0xff,0xff,0x00,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x01,0x00,0x00,
+ 0xfc,0xff,0xff,0xff,0xff,0x01,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x03,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0x03,0x00,0x00,0xfe,0xff,0xff,0xff,0xff,0x03,
+ 0x00,0x00,0xfe,0xff,0xff,0xff,0xff,0x03,0x00,0x00,0xfe,0xff,0xff,0xff,0xff,
+ 0x03,0x00,0x00,0xfe,0xff,0xff,0xff,0xff,0x07,0x00,0x00,0xfe,0xff,0xff,0xff,
+ 0xff,0x07,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0x07,0x00,0x00,0xff,0xff,0xff,
+ 0xff,0xff,0x07,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0x07,0x00,0x00,0xff,0xff,
+ 0xff,0xff,0xff,0x07,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0x07,0x00,0x00,0xff,
+ 0xff,0xff,0xff,0xff,0x0f,0x00,0x80,0xff,0xff,0xff,0xff,0xff,0x0f,0x00,0x80,
+ 0xff,0xff,0xff,0xff,0xff,0x0f,0x00,0x80,0xff,0xff,0xff,0xff,0xff,0x0f,0x00,
+ 0x80,0xff,0xff,0xff,0xff,0xff,0x0f,0x00,0x80,0xff,0xff,0xff,0xff,0xff,0x0f,
+ 0x00,0x80,0xff,0xff,0xff,0xff,0xff,0x0f,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,
+ 0x1f,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,0x1f,0x00,0xc0,0xff,0xff,0xff,0xff,
+ 0xff,0x1f,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,0x1f,0x00,0xc0,0xff,0xff,0xff,
+ 0xff,0xff,0x1f,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,0x1f,0x00,0xe0,0xff,0xff,
+ 0xff,0xff,0xff,0x3f,0x00,0xe0,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0xe0,0xff,
+ 0xff,0xff,0xff,0xff,0x3f,0x00,0xe0,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0xe0,
+ 0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0xe0,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,
+ 0xf0,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0xf0,0xff,0xff,0xff,0xff,0xff,0x7f,
+ 0x00,0xf0,0xff,0xff,0xff,0xff,0xff,0x7f,0x00,0xf0,0xff,0xff,0xff,0xff,0xff,
+ 0x7f,0x00,0xf0,0xff,0xff,0xff,0xff,0xff,0x7f,0x00,0xe0,0xff,0xff,0xff,0xff,
+ 0xff,0x7f,0x00,0xe0,0xff,0xff,0xff,0xff,0xff,0x7f,0x00,0xe0,0xff,0xff,0xff,
+ 0xff,0xff,0x7f,0x00,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0xc0,0xff,0xff,
+ 0xff,0xff,0xff,0xff,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,
- 0x03,0x00,0x00,0x00,0x00,0x00,0x00,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
- 0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0xf0,0xff,0xff,0x03,0x00,0x00,0x00,0x00,
- 0xf0,0xff,0xff,0x03,0x00,0x00,0x00,0x00,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,
- 0x00,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0xc0,0xff,0xff,0xff,0xff,0x00,0x00,
- 0x00,0xc0,0xff,0xff,0xff,0xff,0x00,0x00,0x00,0xc0,0xff,0xff,0xff,0xff,0x03,
- 0x00,0x00,0xc0,0xff,0xff,0xff,0xff,0x03,0x00,0x00,0xc0,0xff,0xff,0xff,0xff,
- 0x03,0x00,0x00,0xc0,0xff,0xff,0xff,0xff,0x03,0x00,0x00,0xf0,0xff,0xff,0xff,
- 0xff,0x03,0x00,0x00,0xf0,0xff,0xff,0xff,0xff,0x03,0x00,0x00,0xf0,0xff,0xff,
- 0xff,0xff,0x0f,0x00,0x00,0xf0,0xff,0xff,0xff,0xff,0x0f,0x00,0x00,0xf0,0xff,
- 0xff,0xff,0xff,0x0f,0x00,0x00,0xf0,0xff,0xff,0xff,0xff,0x0f,0x00,0x00,0xf0,
- 0xff,0xff,0xff,0xff,0x0f,0x00,0x00,0xf0,0xff,0xff,0xff,0xff,0x0f,0x00,0x00,
- 0xfc,0xff,0xff,0xff,0xff,0x0f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x0f,0x00,
- 0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,
- 0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,
- 0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xfc,0xff,0xff,0xff,
- 0xff,0x3f,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0xff,0xff,0xff,
- 0xff,0xff,0x3f,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,
- 0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,
- 0xff,0xff,0xff,0xff,0xff,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x00,
- 0xff,0xff,0xff,0xff,0xff,0xff,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x00,
- 0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,
- 0xff,0xff,0x03,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xf0,0xff,0xff,0xff,
- 0xff,0xff,0xff,0x03,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x03,0xf0,0xff,0xff,
- 0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,
- 0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,
- 0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,
- 0xf0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xf0,0xff,0xff,0xff,0xff,0xff,0xff,
- 0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x0f,0xc0,0xff,0xff,0xff,0xff,0xff,
- 0xff,0x0f};
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/eastern_bitmaps/smallsolid_m.xbm b/xshogi/eastern_bitmaps/smallsolid_m.xbm
index e81fc0e..af0c41d 100644
--- a/xshogi/eastern_bitmaps/smallsolid_m.xbm
+++ b/xshogi/eastern_bitmaps/smallsolid_m.xbm
@@ -1,6 +1,6 @@
 #define smallsolid_m_width 49
 #define smallsolid_m_height 49
-static char smallsolid_m_bits[] = {
+static unsigned char smallsolid_m_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,
  0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0x00,0x00,0x00,0x00,0xfe,0x00,0x00,
  0x00,0x00,0x00,0x00,0xfe,0x00,0x00,0xc0,0x07,0x00,0x00,0xfe,0x00,0x00,0xc0,
diff --git a/xshogi/new_eastern_bitmaps/bigsolidR_l.xbm b/xshogi/new_eastern_bitmaps/bigsolidR_l.xbm
new file mode 100644
index 0000000..805f712
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/bigsolidR_l.xbm
@@ -0,0 +1,46 @@
+#define bigsolidR_l_width 64
+#define bigsolidR_l_height 64
+static unsigned char bigsolidR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0xfe, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x1f, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0xfc, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x7f, 0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f,
+  0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0xfc, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x7f, 0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f,
+  0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0xfc, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x3f, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0xf8, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x3f, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0xf8, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x1f, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x1f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x0f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x0f, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f,
+  0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x07, 0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03,
+  0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x03, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01,
+  0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0x00, 0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0xf8, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0x00, 0xf0, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00,
+  0x00, 0xe0, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00, 0x00, 0x80, 0xff, 0xff,
+  0xff, 0xff, 0x00, 0x00, 0x00, 0x00, 0xf8, 0xff, 0xff, 0x0f, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0xff, 0xff, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfc,
+  0x1f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/bigsolid_l.xbm b/xshogi/new_eastern_bitmaps/bigsolid_l.xbm
new file mode 100644
index 0000000..43c4554
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/bigsolid_l.xbm
@@ -0,0 +1,46 @@
+#define bigsolid_l_width 64
+#define bigsolid_l_height 64
+static unsigned char bigsolid_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0xfe, 0x3f, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0xff,
+  0xff, 0x03, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0x3f, 0x00, 0x00,
+  0x00, 0xe0, 0xff, 0xff, 0xff, 0xff, 0x03, 0x00, 0x00, 0xfc, 0xff, 0xff,
+  0xff, 0xff, 0x1f, 0x00, 0x00, 0xfc, 0xff, 0xff, 0xff, 0xff, 0x1f, 0x00,
+  0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00, 0x00, 0xfe, 0xff, 0xff,
+  0xff, 0xff, 0x7f, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00,
+  0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00, 0x00, 0xfe, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03,
+  0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x03, 0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x03,
+  0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x07, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x0f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x0f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x1f, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0xf8, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x1f, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0xf8, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x3f, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0xfc, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x3f, 0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0xfc, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0xfc, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x7f, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x7f, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/bishopPR_l.xbm b/xshogi/new_eastern_bitmaps/bishopPR_l.xbm
new file mode 100644
index 0000000..6071589
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/bishopPR_l.xbm
@@ -0,0 +1,46 @@
+#define bishopPR_l_width 64
+#define bishopPR_l_height 64
+static unsigned char bishopPR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0xc0,
+  0x3f, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0xf0, 0xff, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0xf0, 0x83, 0x03, 0x00, 0x20, 0x44, 0x00, 0x00, 0x38,
+  0x18, 0x07, 0x00, 0x20, 0x48, 0x00, 0x00, 0x1c, 0x38, 0x07, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x0c, 0xf8, 0x03, 0x00, 0x20, 0x48, 0x00, 0x00, 0x0c,
+  0xf0, 0x03, 0x00, 0x20, 0x48, 0x00, 0x00, 0xf8, 0x0f, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0xf8, 0x06, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00,
+  0x1f, 0x00, 0x00, 0x10, 0x88, 0x00, 0x00, 0xc0, 0x0f, 0x00, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0xc0, 0xe1, 0x03, 0x00, 0x10, 0x90, 0x00, 0x00, 0xfe,
+  0xff, 0x03, 0x00, 0x10, 0x90, 0x00, 0x00, 0xfc, 0xbf, 0x03, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0x0c,
+  0x00, 0x00, 0x00, 0x08, 0x10, 0x01, 0x80, 0x0f, 0x30, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0xf0, 0x01, 0x78, 0x00, 0x00, 0x08, 0x20, 0x01, 0x78, 0x00,
+  0xd8, 0x81, 0x00, 0x08, 0x20, 0x01, 0x3c, 0x30, 0x98, 0xe1, 0x00, 0x08,
+  0x20, 0x01, 0x1c, 0x7e, 0x98, 0x71, 0x00, 0x04, 0x20, 0x01, 0xfc, 0x37,
+  0xf8, 0x31, 0x00, 0x04, 0x20, 0x01, 0xf8, 0x30, 0x3c, 0x38, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x16, 0x3f, 0x1c, 0x00, 0x04, 0x20, 0x02, 0x80, 0xf3,
+  0x1b, 0x0e, 0x00, 0x04, 0x40, 0x02, 0xe0, 0xe1, 0x19, 0x0f, 0x00, 0x04,
+  0x40, 0x02, 0xe0, 0xf0, 0xb0, 0x03, 0x00, 0x02, 0x40, 0x02, 0x00, 0x7c,
+  0xc0, 0x01, 0x00, 0x02, 0x40, 0x02, 0x00, 0x7e, 0xf0, 0x1f, 0x00, 0x02,
+  0x40, 0x02, 0x80, 0x6f, 0xf8, 0x7f, 0x00, 0x02, 0x40, 0x04, 0xc0, 0x63,
+  0xfc, 0x03, 0x00, 0x02, 0x80, 0x04, 0xe0, 0x61, 0x3e, 0x00, 0x00, 0x02,
+  0x80, 0x04, 0x70, 0x60, 0x80, 0x03, 0x00, 0x01, 0x80, 0x04, 0x00, 0x70,
+  0xf0, 0x03, 0x00, 0x01, 0x80, 0x04, 0x00, 0x70, 0x70, 0x03, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x70, 0x00, 0x03, 0x00, 0x01, 0x80, 0x08, 0x00, 0x70,
+  0xc0, 0x1f, 0x00, 0x01, 0x80, 0x08, 0x00, 0x70, 0xf0, 0x0f, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0xf0, 0x30, 0x03, 0x00, 0x01, 0x00, 0x09, 0x00, 0xe0,
+  0x00, 0x03, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00, 0x00, 0x06, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/bishopP_l.xbm b/xshogi/new_eastern_bitmaps/bishopP_l.xbm
new file mode 100644
index 0000000..3d4ea2c
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/bishopP_l.xbm
@@ -0,0 +1,46 @@
+#define bishopP_l_width 64
+#define bishopP_l_height 64
+static unsigned char bishopP_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00, 0x00, 0x12, 0x60, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x11, 0xc0, 0x00, 0x07, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0xc0, 0x0c, 0x0f, 0x00, 0x80, 0x00, 0x00, 0x09, 0xf0, 0x0f,
+  0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0xf8, 0x03, 0x0e, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0xc0, 0x00, 0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0xc0, 0x0e,
+  0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0xc0, 0x0f, 0x0e, 0x00, 0x00, 0x01,
+  0x80, 0x08, 0xc0, 0x01, 0x06, 0x0e, 0x00, 0x01, 0x80, 0x08, 0x00, 0x7c,
+  0x86, 0x07, 0x00, 0x01, 0x80, 0x04, 0xc0, 0x3f, 0xc6, 0x03, 0x00, 0x01,
+  0x80, 0x04, 0xfe, 0x1f, 0xf6, 0x01, 0x00, 0x01, 0x80, 0x04, 0xf8, 0x0f,
+  0x7e, 0x00, 0x00, 0x01, 0x80, 0x04, 0x80, 0x03, 0x3e, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0xc0, 0x0d, 0x0f, 0x07, 0x00, 0x02, 0x40, 0x04, 0xf0, 0x98,
+  0x87, 0x07, 0x00, 0x02, 0x40, 0x02, 0x70, 0xd8, 0xcf, 0x01, 0x00, 0x02,
+  0x40, 0x02, 0x38, 0xfc, 0x68, 0x00, 0x00, 0x02, 0x40, 0x02, 0x1c, 0x3c,
+  0x0c, 0x1f, 0x00, 0x02, 0x40, 0x02, 0x8c, 0x1f, 0xec, 0x3f, 0x00, 0x02,
+  0x40, 0x02, 0x8e, 0x19, 0x7e, 0x38, 0x00, 0x04, 0x20, 0x02, 0x87, 0x19,
+  0x0c, 0x3c, 0x00, 0x04, 0x20, 0x02, 0x81, 0x1b, 0x00, 0x1e, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0x1e, 0x80, 0x0f, 0x00, 0x04, 0x20, 0x01, 0x00, 0x0c,
+  0xf0, 0x01, 0x00, 0x04, 0x20, 0x01, 0x00, 0x00, 0x30, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x20, 0x01, 0xc0, 0xfd,
+  0x3f, 0x00, 0x00, 0x08, 0x10, 0x01, 0xc0, 0xff, 0x7f, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0xc0, 0x87, 0x03, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0xf0,
+  0x03, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0xf8, 0x00, 0x00, 0x00, 0x08,
+  0x90, 0x00, 0x00, 0x60, 0x1f, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xf0,
+  0x1f, 0x00, 0x00, 0x10, 0x90, 0x00, 0xc0, 0x0f, 0x30, 0x00, 0x00, 0x10,
+  0x88, 0x00, 0xc0, 0x1f, 0x30, 0x00, 0x00, 0x10, 0x48, 0x00, 0xe0, 0x1c,
+  0x38, 0x00, 0x00, 0x10, 0x48, 0x00, 0xe0, 0x18, 0x1c, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0xc0, 0xc1, 0x0f, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0xff,
+  0x0f, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0xfc, 0x03, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/bishopR_l.xbm b/xshogi/new_eastern_bitmaps/bishopR_l.xbm
new file mode 100644
index 0000000..a8f0f96
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/bishopR_l.xbm
@@ -0,0 +1,46 @@
+#define bishopR_l_width 64
+#define bishopR_l_height 64
+static unsigned char bishopR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0xc0, 0x00, 0x80, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0xe0, 0x03, 0x80, 0x01, 0x00, 0x20, 0x48, 0x00, 0x60, 0x07,
+  0x80, 0x01, 0x00, 0x20, 0x48, 0x00, 0x60, 0x0e, 0x80, 0x01, 0x00, 0x20,
+  0x48, 0x00, 0x60, 0x18, 0x80, 0x01, 0x00, 0x10, 0x48, 0x00, 0x60, 0x30,
+  0x80, 0x19, 0x00, 0x10, 0x88, 0x00, 0x60, 0x00, 0x80, 0x0f, 0x00, 0x10,
+  0x90, 0x00, 0x40, 0x00, 0x00, 0x07, 0x00, 0x10, 0x90, 0x00, 0x40, 0xf0,
+  0x81, 0x03, 0x00, 0x10, 0x90, 0x00, 0xe0, 0xff, 0xc1, 0x01, 0x00, 0x10,
+  0x90, 0x00, 0xf0, 0x1f, 0xe0, 0x18, 0x00, 0x08, 0x90, 0x00, 0x00, 0x00,
+  0x78, 0x0c, 0x00, 0x08, 0x10, 0x01, 0x80, 0xff, 0x78, 0x07, 0x00, 0x08,
+  0x10, 0x01, 0x80, 0x7f, 0xa0, 0x03, 0x00, 0x08, 0x20, 0x01, 0x00, 0x00,
+  0xc0, 0x01, 0x00, 0x08, 0x20, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x08,
+  0x20, 0x01, 0x00, 0x00, 0xc0, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x0c,
+  0x00, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x1c, 0x00, 0x00, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x04, 0x00, 0x00, 0x00, 0x04, 0x20, 0x02, 0x00, 0x0c,
+  0xf8, 0x01, 0x00, 0x04, 0x40, 0x02, 0x00, 0xfc, 0xbf, 0x01, 0x00, 0x04,
+  0x40, 0x02, 0x00, 0xfc, 0x87, 0x01, 0x00, 0x02, 0x40, 0x02, 0x00, 0x0c,
+  0xf6, 0x01, 0x00, 0x02, 0x40, 0x02, 0x00, 0xdc, 0xff, 0x01, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0xfc, 0x87, 0x01, 0x00, 0x02, 0x40, 0x04, 0x00, 0x0c,
+  0xc6, 0x01, 0x00, 0x02, 0x80, 0x04, 0x00, 0x8c, 0xff, 0x00, 0x00, 0x02,
+  0x80, 0x04, 0x00, 0xf8, 0xff, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0x00, 0x04, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x00, 0x07, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x80,
+  0x63, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0xc0, 0x71, 0x00, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0xc0, 0x3f, 0x00, 0x00, 0x01, 0x00, 0x09, 0x00, 0xc0,
+  0x1b, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00, 0x08, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/bishop_l.xbm b/xshogi/new_eastern_bitmaps/bishop_l.xbm
new file mode 100644
index 0000000..07e0189
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/bishop_l.xbm
@@ -0,0 +1,46 @@
+#define bishop_l_width 64
+#define bishop_l_height 64
+static unsigned char bishop_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0x10,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x11, 0x00, 0xd8, 0x03, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0x00, 0xfc, 0x03, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x8e,
+  0x03, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0xc6, 0x01, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0xe0, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x20,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x80, 0x08, 0x00, 0xff, 0x1f, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0xff,
+  0x31, 0x00, 0x00, 0x01, 0x80, 0x04, 0x80, 0x63, 0x30, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x80, 0xe1, 0x3f, 0x00, 0x00, 0x01, 0x80, 0x04, 0x80, 0xff,
+  0x3b, 0x00, 0x00, 0x01, 0x80, 0x04, 0x80, 0x6f, 0x30, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x80, 0xe1, 0x3f, 0x00, 0x00, 0x02, 0x40, 0x04, 0x80, 0xfd,
+  0x3f, 0x00, 0x00, 0x02, 0x40, 0x02, 0x80, 0x1f, 0x30, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x00, 0x20, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x00,
+  0x38, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x00, 0x30, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x03, 0x00, 0x00, 0x00, 0x04, 0x20, 0x02, 0x80, 0x03,
+  0x00, 0x00, 0x00, 0x04, 0x20, 0x02, 0x80, 0x03, 0x00, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0xc0, 0x05, 0xfe, 0x01, 0x00, 0x04, 0x20, 0x01, 0xe0, 0x1e,
+  0xff, 0x01, 0x00, 0x04, 0x20, 0x01, 0x30, 0x1e, 0x00, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x18, 0x07, 0xf8, 0x0f, 0x00, 0x08, 0x20, 0x01, 0x80, 0x83,
+  0xff, 0x07, 0x00, 0x08, 0x10, 0x01, 0xc0, 0x81, 0x0f, 0x02, 0x00, 0x08,
+  0x10, 0x01, 0xe0, 0x00, 0x00, 0x02, 0x00, 0x08, 0x90, 0x00, 0xf0, 0x01,
+  0x00, 0x06, 0x00, 0x08, 0x90, 0x00, 0x98, 0x01, 0x0c, 0x06, 0x00, 0x08,
+  0x90, 0x00, 0x80, 0x01, 0x18, 0x06, 0x00, 0x10, 0x90, 0x00, 0x80, 0x01,
+  0x70, 0x06, 0x00, 0x10, 0x90, 0x00, 0x80, 0x01, 0xe0, 0x06, 0x00, 0x10,
+  0x88, 0x00, 0x80, 0x01, 0xc0, 0x07, 0x00, 0x10, 0x48, 0x00, 0x00, 0x01,
+  0x00, 0x03, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/goldR_l.xbm b/xshogi/new_eastern_bitmaps/goldR_l.xbm
new file mode 100644
index 0000000..3e9048e
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/goldR_l.xbm
@@ -0,0 +1,46 @@
+#define goldR_l_width 64
+#define goldR_l_height 64
+static unsigned char goldR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x0f, 0x80, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x0b,
+  0xc0, 0x01, 0x00, 0x20, 0x48, 0x00, 0x00, 0xc3, 0xe0, 0x01, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0xe3, 0x60, 0x03, 0x00, 0x10, 0x48, 0x00, 0x00, 0x63,
+  0x60, 0x18, 0x00, 0x10, 0x88, 0x00, 0x00, 0x26, 0x60, 0x1c, 0x00, 0x10,
+  0x90, 0x00, 0xe0, 0xe7, 0x63, 0x0c, 0x00, 0x10, 0x90, 0x00, 0xf0, 0xff,
+  0x63, 0x0c, 0x00, 0x10, 0x90, 0x00, 0x00, 0x06, 0x60, 0x04, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0x60, 0x20, 0x1f, 0x00, 0x08, 0x90, 0x00, 0x00, 0x7c,
+  0xa0, 0x0f, 0x00, 0x08, 0x10, 0x01, 0x00, 0x1c, 0x21, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0x06, 0x63, 0x0c, 0x00, 0x08, 0x20, 0x01, 0x00, 0x66,
+  0xe3, 0x1f, 0x00, 0x08, 0x20, 0x01, 0x00, 0x7e, 0xe0, 0x06, 0x00, 0x08,
+  0x20, 0x01, 0x00, 0x5c, 0x20, 0x03, 0x00, 0x04, 0x20, 0x01, 0x00, 0xc0,
+  0x61, 0x03, 0x00, 0x04, 0x20, 0x01, 0x00, 0xe0, 0x63, 0x01, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x78, 0x60, 0x01, 0x00, 0x04, 0x20, 0x02, 0x00, 0x18,
+  0x60, 0x00, 0x00, 0x04, 0x40, 0x02, 0x00, 0x08, 0x20, 0x00, 0x00, 0x04,
+  0x40, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0xfc,
+  0xff, 0x01, 0x00, 0x02, 0x40, 0x02, 0x00, 0xfe, 0xff, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x00, 0x03, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x38,
+  0x3b, 0x00, 0x00, 0x02, 0x80, 0x04, 0x00, 0x1c, 0x73, 0x00, 0x00, 0x02,
+  0x80, 0x04, 0x00, 0x0c, 0x63, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xe0,
+  0x1f, 0x00, 0x00, 0x01, 0x80, 0x04, 0x80, 0xfb, 0x1f, 0x0e, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x07, 0x83, 0x07, 0x00, 0x01, 0x80, 0x08, 0x00, 0xdc,
+  0xcf, 0x03, 0x00, 0x01, 0x80, 0x08, 0x00, 0x98, 0xe7, 0x00, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0x70, 0x70, 0x00, 0x00, 0x01, 0x00, 0x09, 0x00, 0x60,
+  0x38, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0xc0, 0x1c, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0xc0, 0x07, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x03, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/gold_l.xbm b/xshogi/new_eastern_bitmaps/gold_l.xbm
new file mode 100644
index 0000000..2f93718
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/gold_l.xbm
@@ -0,0 +1,46 @@
+#define gold_l_width 64
+#define gold_l_height 64
+static unsigned char gold_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0xc0, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0xe0, 0x03, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0x38,
+  0x03, 0x00, 0x80, 0x00, 0x00, 0x11, 0x00, 0x1c, 0x06, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0x00, 0x0e, 0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0xe7,
+  0x19, 0x00, 0x80, 0x00, 0x00, 0x09, 0xc0, 0xf3, 0x3b, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0xe0, 0xc1, 0xe0, 0x00, 0x80, 0x00, 0x00, 0x09, 0x70, 0xf8,
+  0xdf, 0x01, 0x80, 0x00, 0x00, 0x09, 0x00, 0xf8, 0x07, 0x00, 0x00, 0x01,
+  0x80, 0x08, 0x00, 0xc6, 0x30, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0xce,
+  0x38, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xdc, 0x1c, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0xc0, 0x00, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xff,
+  0x7f, 0x00, 0x00, 0x01, 0x80, 0x04, 0x80, 0xff, 0x3f, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x04,
+  0x10, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x06, 0x18, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x80, 0x06, 0x1e, 0x00, 0x00, 0x02, 0x40, 0x02, 0x80, 0xc6,
+  0x07, 0x00, 0x00, 0x02, 0x40, 0x02, 0xc0, 0x86, 0x03, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0xc0, 0x04, 0x3a, 0x00, 0x00, 0x04, 0x20, 0x02, 0x60, 0x07,
+  0x7e, 0x00, 0x00, 0x04, 0x20, 0x02, 0xf8, 0xc7, 0x66, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x30, 0xc6, 0x60, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x84,
+  0x38, 0x00, 0x00, 0x04, 0x20, 0x01, 0xf0, 0x05, 0x3e, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0xf8, 0x04, 0x06, 0x00, 0x00, 0x08, 0x20, 0x01, 0x20, 0x06,
+  0x60, 0x00, 0x00, 0x08, 0x10, 0x01, 0x30, 0xc6, 0xff, 0x0f, 0x00, 0x08,
+  0x10, 0x01, 0x30, 0xc6, 0xe7, 0x07, 0x00, 0x08, 0x90, 0x00, 0x38, 0x06,
+  0x64, 0x00, 0x00, 0x08, 0x90, 0x00, 0x18, 0x06, 0xc6, 0x00, 0x00, 0x08,
+  0x90, 0x00, 0xc0, 0x06, 0xc7, 0x00, 0x00, 0x10, 0x90, 0x00, 0x80, 0x07,
+  0xc3, 0x00, 0x00, 0x10, 0x90, 0x00, 0x80, 0x03, 0xd0, 0x00, 0x00, 0x10,
+  0x88, 0x00, 0x00, 0x01, 0xf0, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00,
+  0x60, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/kingR_l.xbm b/xshogi/new_eastern_bitmaps/kingR_l.xbm
new file mode 100644
index 0000000..3da731a
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/kingR_l.xbm
@@ -0,0 +1,46 @@
+#define kingR_l_width 64
+#define kingR_l_height 64
+static unsigned char kingR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x0f, 0x80, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x0b,
+  0xc0, 0x01, 0x00, 0x20, 0x48, 0x00, 0x00, 0xc3, 0xe0, 0x01, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0xe3, 0x60, 0x03, 0x00, 0x10, 0x48, 0x00, 0x00, 0x63,
+  0x60, 0x18, 0x00, 0x10, 0x88, 0x00, 0x00, 0x26, 0x60, 0x1c, 0x00, 0x10,
+  0x90, 0x00, 0xe0, 0xe7, 0x63, 0x0c, 0x00, 0x10, 0x90, 0x00, 0xf0, 0xff,
+  0x63, 0x0c, 0x00, 0x10, 0x90, 0x00, 0x00, 0x06, 0x60, 0x04, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0x60, 0x20, 0x1f, 0x00, 0x08, 0x90, 0x00, 0x00, 0x7c,
+  0xa0, 0x0f, 0x00, 0x08, 0x10, 0x01, 0x00, 0x1c, 0x21, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0x06, 0x23, 0x0c, 0x00, 0x08, 0x20, 0x01, 0x00, 0x66,
+  0xe3, 0x1f, 0x00, 0x08, 0x20, 0x01, 0x00, 0x7e, 0xe0, 0x06, 0x00, 0x08,
+  0x20, 0x01, 0x00, 0x5c, 0x20, 0x03, 0x00, 0x04, 0x20, 0x01, 0x00, 0xc0,
+  0x61, 0x03, 0x00, 0x04, 0x20, 0x01, 0x00, 0xe0, 0x63, 0x01, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x78, 0x60, 0x01, 0x00, 0x04, 0x20, 0x02, 0x00, 0x18,
+  0x60, 0x00, 0x00, 0x04, 0x40, 0x02, 0x00, 0x08, 0x20, 0x00, 0x00, 0x04,
+  0x40, 0x02, 0x00, 0x00, 0xc0, 0x00, 0x00, 0x02, 0x40, 0x02, 0x80, 0xff,
+  0xff, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0xfe, 0x1f, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x80, 0x01, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x80,
+  0x01, 0x00, 0x00, 0x02, 0x80, 0x04, 0x00, 0x80, 0x01, 0x00, 0x00, 0x02,
+  0x80, 0x04, 0x00, 0xe0, 0x3f, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xf8,
+  0x0f, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0x9c, 0x01, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x80, 0x01, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x80,
+  0x01, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x80, 0xe3, 0x00, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0xfe, 0x7f, 0x00, 0x00, 0x01, 0x00, 0x09, 0x00, 0xff,
+  0x1f, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x02, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/king_l.xbm b/xshogi/new_eastern_bitmaps/king_l.xbm
new file mode 100644
index 0000000..b849c75
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/king_l.xbm
@@ -0,0 +1,46 @@
+#define king_l_width 64
+#define king_l_height 64
+static unsigned char king_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0x00,
+  0x40, 0x00, 0x80, 0x00, 0x00, 0x11, 0x00, 0xf8, 0xff, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0x00, 0xfe, 0x7f, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0xc7,
+  0x01, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x80, 0x01, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x80, 0x01, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x80,
+  0x39, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0xf0, 0x1f, 0x00, 0x00, 0x01,
+  0x80, 0x08, 0x00, 0xfc, 0x07, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x80,
+  0x01, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0x80, 0x01, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x80, 0x01, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xf8,
+  0x7f, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xff, 0xff, 0x01, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x03, 0x00, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x04,
+  0x10, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x06, 0x18, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x80, 0x06, 0x1e, 0x00, 0x00, 0x02, 0x40, 0x02, 0x80, 0xc6,
+  0x07, 0x00, 0x00, 0x02, 0x40, 0x02, 0xc0, 0x86, 0x03, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0xc0, 0x04, 0x3a, 0x00, 0x00, 0x04, 0x20, 0x02, 0x60, 0x07,
+  0x7e, 0x00, 0x00, 0x04, 0x20, 0x02, 0xf8, 0xc7, 0x66, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x30, 0xc4, 0x60, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x84,
+  0x38, 0x00, 0x00, 0x04, 0x20, 0x01, 0xf0, 0x05, 0x3e, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0xf8, 0x04, 0x06, 0x00, 0x00, 0x08, 0x20, 0x01, 0x20, 0x06,
+  0x60, 0x00, 0x00, 0x08, 0x10, 0x01, 0x30, 0xc6, 0xff, 0x0f, 0x00, 0x08,
+  0x10, 0x01, 0x30, 0xc6, 0xe7, 0x07, 0x00, 0x08, 0x90, 0x00, 0x38, 0x06,
+  0x64, 0x00, 0x00, 0x08, 0x90, 0x00, 0x18, 0x06, 0xc6, 0x00, 0x00, 0x08,
+  0x90, 0x00, 0xc0, 0x06, 0xc7, 0x00, 0x00, 0x10, 0x90, 0x00, 0x80, 0x07,
+  0xc3, 0x00, 0x00, 0x10, 0x90, 0x00, 0x80, 0x03, 0xd0, 0x00, 0x00, 0x10,
+  0x88, 0x00, 0x00, 0x01, 0xf0, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00,
+  0x60, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/knightPR_l.xbm b/xshogi/new_eastern_bitmaps/knightPR_l.xbm
new file mode 100644
index 0000000..af6c836
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/knightPR_l.xbm
@@ -0,0 +1,46 @@
+#define knightPR_l_width 64
+#define knightPR_l_height 64
+static unsigned char knightPR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0xf0, 0x03, 0x00, 0x80, 0x00,
+  0x20, 0x02, 0x00, 0xf8, 0x0f, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x0c, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x0c, 0x00, 0x80, 0x00,
+  0x20, 0x04, 0x00, 0x00, 0x1e, 0x00, 0x40, 0x00, 0x20, 0x04, 0x00, 0x00,
+  0x7e, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0xe7, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x80, 0xc3, 0x01, 0x40, 0x00, 0x40, 0x04, 0x00, 0xc0,
+  0xe1, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0xe0, 0x7f, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0xe0, 0x07, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x70,
+  0x00, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x18, 0x3c, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0xf8, 0x0f, 0x00, 0x20, 0x00, 0x80, 0x08, 0x1f, 0xf8,
+  0x00, 0x78, 0x20, 0x00, 0x80, 0x08, 0x3e, 0x00, 0x00, 0x0c, 0x20, 0x00,
+  0x80, 0x08, 0xfc, 0x80, 0x07, 0x07, 0x20, 0x00, 0x80, 0x10, 0xf0, 0xe1,
+  0x83, 0x03, 0x10, 0x00, 0x80, 0x10, 0xc0, 0xe3, 0xc0, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0x07, 0x60, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x0e,
+  0x38, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x18, 0x1c, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0x30, 0x0e, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x60,
+  0x07, 0x00, 0x10, 0x00, 0x00, 0x21, 0x00, 0xe0, 0x07, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0x80, 0x03, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x80,
+  0x03, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0xc0, 0x03, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0xc0, 0x01, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0xc0,
+  0x01, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0xc0, 0x01, 0x00, 0x08, 0x00,
+  0x00, 0x48, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00,
+  0x00, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x00,
+  0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00, 0xc0, 0x01, 0x00,
+  0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+  0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/knightP_l.xbm b/xshogi/new_eastern_bitmaps/knightP_l.xbm
new file mode 100644
index 0000000..dff95b3
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/knightP_l.xbm
@@ -0,0 +1,38 @@
+#define knightP_l_width 64
+#define knightP_l_height 64
+static char knightP_l_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x00,0x00,0xe0,0x01,0x00,0x00,0x64,0x00,0x00,0x00,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x00,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x00,0x00,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0x80,0x03,0x00,0x04,0x00,0x00,0x12,0x00,0x80,0x03,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0x80,0x03,0x00,0x04,0x00,0x00,0x11,0x00,0xc0,
+ 0x03,0x00,0x04,0x00,0x00,0x11,0x00,0xc0,0x01,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0xc0,0x01,0x00,0x04,0x00,0x00,0x11,0x00,0xe0,0x07,0x00,0x04,0x00,0x00,0x09,
+ 0x00,0xe0,0x06,0x00,0x08,0x00,0x80,0x08,0x00,0x70,0x0c,0x00,0x08,0x00,0x80,
+ 0x08,0x00,0x38,0x18,0x00,0x08,0x00,0x80,0x08,0x00,0x1c,0x70,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x06,0xe0,0x00,0x08,0x00,0x80,0x08,0x00,0x03,0xc7,0x03,0x08,
+ 0x00,0x80,0x08,0xc0,0xc1,0x87,0x0f,0x08,0x00,0x40,0x04,0xe0,0xe0,0x01,0x3f,
+ 0x10,0x00,0x40,0x04,0x30,0x00,0x00,0x7c,0x10,0x00,0x40,0x04,0x1e,0x00,0x1f,
+ 0xf8,0x10,0x00,0x40,0x04,0x00,0xf0,0x1f,0x00,0x10,0x00,0x40,0x04,0x00,0x3c,
+ 0x18,0x00,0x10,0x00,0x40,0x04,0x00,0x00,0x0e,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0xe0,0x07,0x00,0x20,0x00,0x20,0x02,0x00,0xfe,0x07,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x87,0x03,0x00,0x20,0x00,0x20,0x02,0x80,0xc3,0x01,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0xe7,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x7e,0x00,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x78,0x00,0x00,0x20,0x00,0x10,0x01,0x00,0x30,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x30,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0xf0,0x1f,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0xc0,0x0f,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_eastern_bitmaps/knightR_l.xbm b/xshogi/new_eastern_bitmaps/knightR_l.xbm
new file mode 100644
index 0000000..20cb8e6
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/knightR_l.xbm
@@ -0,0 +1,46 @@
+#define knightR_l_width 64
+#define knightR_l_height 64
+static unsigned char knightR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x1e,
+  0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x1f, 0x00, 0x00, 0x80, 0x00,
+  0x10, 0x02, 0x00, 0x1f, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x80, 0x31,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0xc0, 0x31, 0x00, 0x00, 0x80, 0x00,
+  0x20, 0x02, 0xc0, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x60, 0x38,
+  0xe7, 0x0e, 0x80, 0x00, 0x20, 0x02, 0x70, 0x38, 0xe7, 0x0e, 0x80, 0x00,
+  0x20, 0x04, 0x30, 0x70, 0xc6, 0x0c, 0x40, 0x00, 0x20, 0x04, 0x30, 0x60,
+  0x8c, 0x08, 0x40, 0x00, 0x40, 0x04, 0x70, 0x00, 0x00, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0xf0, 0x7f, 0x00, 0x00, 0x40, 0x00, 0x40, 0x04, 0xe0, 0xff,
+  0x7f, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0xfc, 0x6f, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x00, 0x63, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0xf0,
+  0x7f, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0x63, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0xf0, 0x7f, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00,
+  0x63, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0xe0, 0x7f, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0xf0, 0x5f, 0x00, 0x20, 0x00, 0x80, 0x10, 0x00, 0x00,
+  0x00, 0x00, 0x10, 0x00, 0x80, 0x10, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0x00, 0x40, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x00,
+  0x62, 0x00, 0x10, 0x00, 0x00, 0x11, 0xe0, 0xff, 0xe3, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0xe0, 0xff, 0xe1, 0x04, 0x10, 0x00, 0x00, 0x11, 0x40, 0x1c,
+  0x60, 0x06, 0x10, 0x00, 0x00, 0x21, 0x00, 0x98, 0x61, 0x07, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0xff, 0xe0, 0x03, 0x08, 0x00, 0x00, 0x22, 0x80, 0x3f,
+  0xe0, 0x01, 0x08, 0x00, 0x00, 0x22, 0x00, 0xd8, 0xe1, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0xff, 0xe0, 0x00, 0x08, 0x00, 0x00, 0x24, 0x80, 0x3f,
+  0x60, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0x98, 0x61, 0x0e, 0x08, 0x00,
+  0x00, 0x48, 0x00, 0xfe, 0xf8, 0x07, 0x04, 0x00, 0x00, 0x50, 0x00, 0xff,
+  0xf0, 0x03, 0x04, 0x00, 0x00, 0x50, 0x00, 0x18, 0x60, 0x00, 0x04, 0x00,
+  0x00, 0x60, 0x00, 0x18, 0x60, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x18,
+  0x20, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x08, 0x00, 0xc0, 0x01, 0x00,
+  0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+  0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/knight_l.xbm b/xshogi/new_eastern_bitmaps/knight_l.xbm
new file mode 100644
index 0000000..a1e9920
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/knight_l.xbm
@@ -0,0 +1,38 @@
+#define knight_l_width 64
+#define knight_l_height 64
+static char knight_l_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x00,0x10,0xe0,0x01,0x00,0x00,0x64,0x00,0x04,0x18,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x06,0x18,0x00,0x02,0x00,0x00,0x22,0x00,0x06,0x18,0x00,0x02,
+ 0x00,0x00,0x22,0xc0,0x0f,0xff,0x00,0x02,0x00,0x00,0x22,0xe0,0x1f,0x7f,0x00,
+ 0x02,0x00,0x00,0x12,0x70,0x86,0x19,0x00,0x04,0x00,0x00,0x12,0x00,0x06,0xfc,
+ 0x01,0x04,0x00,0x00,0x11,0x00,0x07,0xff,0x00,0x04,0x00,0x00,0x11,0x00,0x87,
+ 0x1b,0x00,0x04,0x00,0x00,0x11,0x80,0x07,0xfc,0x01,0x04,0x00,0x00,0x11,0xc0,
+ 0x07,0xff,0x00,0x04,0x00,0x00,0x11,0xe0,0x86,0x19,0x00,0x04,0x00,0x00,0x09,
+ 0x60,0x06,0x38,0x02,0x08,0x00,0x80,0x08,0x20,0x87,0xff,0x07,0x08,0x00,0x80,
+ 0x08,0x00,0xc7,0xff,0x07,0x08,0x00,0x80,0x08,0x00,0x46,0x00,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x02,0x00,0x00,0x08,0x00,0x80,0x08,0x00,0x00,0x00,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x00,0x00,0x00,0x08,0x00,0x40,0x04,0x00,0xfa,0x0f,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0xfe,0x07,0x00,0x10,0x00,0x40,0x04,0x00,0xc6,0x00,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0xfe,0x0f,0x00,0x10,0x00,0x40,0x04,0x00,0xc6,
+ 0x00,0x00,0x10,0x00,0x40,0x04,0x00,0xfe,0x0f,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0xc6,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0xf6,0x3f,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0xfe,0xff,0x07,0x20,0x00,0x20,0x02,0x00,0x00,0xfe,0x0f,0x20,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x0e,0x20,0x00,0x20,0x02,0x10,0x31,0x06,0x0c,0x20,0x00,
+ 0x10,0x02,0x30,0x63,0x0e,0x0c,0x20,0x00,0x10,0x01,0x70,0xe7,0x1c,0x0e,0x40,
+ 0x00,0x10,0x01,0x70,0xe7,0x1c,0x06,0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x03,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x8c,0x03,0x40,0x00,0x20,0x01,0x00,0x00,0x8c,
+ 0x01,0x40,0x00,0x20,0x01,0x00,0x00,0xf8,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0xf8,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x78,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_eastern_bitmaps/lancePR_l.xbm b/xshogi/new_eastern_bitmaps/lancePR_l.xbm
new file mode 100644
index 0000000..36bc4d4
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/lancePR_l.xbm
@@ -0,0 +1,46 @@
+#define lancePR_l_width 64
+#define lancePR_l_height 64
+static unsigned char lancePR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0xc0,
+  0x0f, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0xf0, 0x1f, 0x00, 0x80, 0x00,
+  0x20, 0x04, 0x00, 0xf0, 0x1f, 0x00, 0x40, 0x00, 0x20, 0x04, 0x00, 0x60,
+  0x38, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x30, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x00, 0x30, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00,
+  0x18, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x1c, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x00, 0x3e, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x80,
+  0x7f, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0xe0, 0xff, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0xe0, 0xe7, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00,
+  0xe7, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0xe3, 0x01, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0x3f, 0xe3, 0x01, 0x20, 0x00, 0x80, 0x10, 0x80, 0x1f,
+  0xc3, 0x00, 0x10, 0x00, 0x80, 0x10, 0xc0, 0x07, 0x03, 0x1c, 0x10, 0x00,
+  0x00, 0x11, 0xc0, 0x03, 0x03, 0x1e, 0x10, 0x00, 0x00, 0x11, 0xc0, 0xff,
+  0xbf, 0x1f, 0x10, 0x00, 0x00, 0x11, 0x80, 0xff, 0x7f, 0x0f, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0x1f, 0x03, 0x07, 0x10, 0x00, 0x00, 0x11, 0x00, 0x00,
+  0xbb, 0x03, 0x10, 0x00, 0x00, 0x21, 0x00, 0xe0, 0x1f, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0xf0, 0x1f, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00,
+  0x0e, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x80, 0x07, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0x80, 0x07, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0x80,
+  0x03, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0x80, 0x01, 0x00, 0x08, 0x00,
+  0x00, 0x48, 0x00, 0x80, 0x07, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00,
+  0x06, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x00,
+  0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00, 0xc0, 0x01, 0x00,
+  0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+  0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/lanceP_l.xbm b/xshogi/new_eastern_bitmaps/lanceP_l.xbm
new file mode 100644
index 0000000..83fe38b
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/lanceP_l.xbm
@@ -0,0 +1,38 @@
+#define lanceP_l_width 64
+#define lanceP_l_height 64
+static char lanceP_l_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x00,0x00,0xe0,0x01,0x00,0x00,0x64,0x00,0x00,0x00,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x00,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x60,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0xe0,0x01,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0x80,0x01,0x00,0x04,0x00,0x00,0x12,0x00,0xc0,0x01,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0xe0,0x01,0x00,0x04,0x00,0x00,0x11,0x00,0xe0,
+ 0x01,0x00,0x04,0x00,0x00,0x11,0x00,0x70,0x00,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0xf8,0x0f,0x00,0x04,0x00,0x00,0x11,0x00,0xf8,0x07,0x00,0x04,0x00,0x00,0x09,
+ 0xc0,0xdd,0x00,0x00,0x08,0x00,0x80,0x08,0xe0,0xc0,0xf8,0x00,0x08,0x00,0x80,
+ 0x08,0xf0,0xfe,0xff,0x01,0x08,0x00,0x80,0x08,0xf8,0xfd,0xff,0x03,0x08,0x00,
+ 0x80,0x08,0x78,0xc0,0xc0,0x03,0x08,0x00,0x80,0x08,0x38,0xc0,0xe0,0x03,0x08,
+ 0x00,0x80,0x08,0x00,0xc3,0xf8,0x01,0x08,0x00,0x40,0x04,0x80,0xc7,0xfc,0x00,
+ 0x10,0x00,0x40,0x04,0x80,0xc7,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0xe7,0x00,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0xe7,0x07,0x00,0x10,0x00,0x40,0x04,0x00,0xff,
+ 0x07,0x00,0x10,0x00,0x40,0x04,0x00,0xfe,0x01,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0x7c,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x38,0x00,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x18,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x0c,0x00,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0x0c,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x1c,0x06,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0xf8,0x0f,0x00,0x20,0x00,0x10,0x01,0x00,0xf8,0x0f,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0xf0,0x03,0x00,0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_eastern_bitmaps/lanceR_l.xbm b/xshogi/new_eastern_bitmaps/lanceR_l.xbm
new file mode 100644
index 0000000..9fcb0c8
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/lanceR_l.xbm
@@ -0,0 +1,46 @@
+#define lanceR_l_width 64
+#define lanceR_l_height 64
+static unsigned char lanceR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x20, 0x02, 0x00, 0x00, 0x01, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x01, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x01, 0x00, 0x80, 0x00,
+  0x20, 0x04, 0xc0, 0xff, 0xff, 0x03, 0x40, 0x00, 0x20, 0x04, 0x80, 0xff,
+  0x3f, 0x07, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x01, 0x04, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0xfc, 0x7f, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x3c,
+  0x61, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x06, 0xe1, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0xff, 0xff, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x03,
+  0xc1, 0x01, 0x20, 0x00, 0x80, 0x08, 0x00, 0x07, 0xc1, 0x01, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0xff, 0x7f, 0x01, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00,
+  0x03, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0xf8, 0x1f, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0x00, 0x3f, 0x00, 0x20, 0x00, 0x80, 0x10, 0x00, 0x00,
+  0x01, 0x00, 0x10, 0x00, 0x80, 0x10, 0x00, 0x00, 0x00, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0xe0, 0x07, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x20,
+  0x0c, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0xf0, 0x08, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0xf8, 0x1f, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x18,
+  0x18, 0x00, 0x10, 0x00, 0x00, 0x21, 0x00, 0xf0, 0x1f, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x0c,
+  0x33, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x1c, 0x19, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0xb8, 0x1d, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0x80,
+  0x01, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0xf0, 0x1f, 0x00, 0x08, 0x00,
+  0x00, 0x48, 0x00, 0x30, 0x39, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00,
+  0x01, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00, 0x06, 0x00, 0x04, 0x00,
+  0x00, 0x60, 0x00, 0x80, 0x03, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0xc0,
+  0x01, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0xc0, 0x00, 0xc0, 0x01, 0x00,
+  0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+  0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/lance_l.xbm b/xshogi/new_eastern_bitmaps/lance_l.xbm
new file mode 100644
index 0000000..1fca5be
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/lance_l.xbm
@@ -0,0 +1,38 @@
+#define lance_l_width 64
+#define lance_l_height 64
+static char lance_l_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x00,0x03,0xe0,0x01,0x00,0x00,0x64,0x00,0x80,0x03,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0xc0,0x01,0x00,0x02,0x00,0x00,0x22,0x00,0x60,0x00,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x80,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x9c,0x0c,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0xf8,0x0f,0x00,0x04,0x00,0x00,0x12,0x00,0x80,0x01,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0xb8,0x1d,0x00,0x04,0x00,0x00,0x11,0x00,0x98,
+ 0x38,0x00,0x04,0x00,0x00,0x11,0x00,0xcc,0x30,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0xf8,0x0f,0x00,0x04,0x00,0x00,0x09,
+ 0x00,0x18,0x18,0x00,0x08,0x00,0x80,0x08,0x00,0xf8,0x1f,0x00,0x08,0x00,0x80,
+ 0x08,0x00,0x10,0x0f,0x00,0x08,0x00,0x80,0x08,0x00,0x30,0x04,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0xe0,0x07,0x00,0x08,0x00,0x80,0x08,0x00,0x00,0x00,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x40,0x04,0x00,0xfc,0x00,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0xf8,0x1f,0x00,0x10,0x00,0x40,0x04,0x00,0xc0,0x00,
+ 0x00,0x10,0x00,0x40,0x04,0x80,0xfe,0xff,0x00,0x10,0x00,0x40,0x04,0x80,0x83,
+ 0xe0,0x00,0x10,0x00,0x40,0x04,0x80,0x83,0xc0,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0xff,0xff,0x00,0x20,0x00,0x20,0x02,0x00,0x87,0x60,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x86,0x3c,0x00,0x20,0x00,0x20,0x02,0x00,0xfe,0x3f,0x00,0x20,0x00,0x20,
+ 0x02,0x20,0x80,0x00,0x00,0x20,0x00,0x20,0x02,0xe0,0xfc,0xff,0x01,0x20,0x00,
+ 0x10,0x02,0xc0,0xff,0xff,0x03,0x20,0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0x80,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_eastern_bitmaps/none_l.xbm b/xshogi/new_eastern_bitmaps/none_l.xbm
new file mode 100644
index 0000000..ed7c5dc
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/none_l.xbm
@@ -0,0 +1,38 @@
+#define none_l_width 64
+#define none_l_height 64
+static char none_l_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_eastern_bitmaps/pawnPR_l.xbm b/xshogi/new_eastern_bitmaps/pawnPR_l.xbm
new file mode 100644
index 0000000..8dfd44e
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/pawnPR_l.xbm
@@ -0,0 +1,46 @@
+#define pawnPR_l_width 64
+#define pawnPR_l_height 64
+static unsigned char pawnPR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x20, 0x04, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x20, 0x04, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0xc0,
+  0x0f, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0xf0, 0x1f, 0x00, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0xf0, 0x1f, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x60,
+  0x38, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0x30, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0x00, 0x30, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00,
+  0x18, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0x1c, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0x00, 0x3e, 0x00, 0x20, 0x00, 0x80, 0x10, 0x00, 0x80,
+  0x7f, 0x00, 0x10, 0x00, 0x80, 0x10, 0x00, 0xe0, 0x77, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0xf0, 0xe1, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x78,
+  0xe0, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x18, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0x00, 0xe0, 0x01, 0x10, 0x00, 0x00, 0x11, 0x00, 0x00,
+  0xc0, 0x00, 0x10, 0x00, 0x00, 0x21, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00,
+  0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0x00,
+  0x00, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00,
+  0x00, 0x48, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00,
+  0x00, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x00,
+  0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00, 0xc0, 0x01, 0x00,
+  0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+  0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/pawnP_l.xbm b/xshogi/new_eastern_bitmaps/pawnP_l.xbm
new file mode 100644
index 0000000..3e7afd0
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/pawnP_l.xbm
@@ -0,0 +1,38 @@
+#define pawnP_l_width 64
+#define pawnP_l_height 64
+static char pawnP_l_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x00,0x00,0xe0,0x01,0x00,0x00,0x64,0x00,0x00,0x00,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x00,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x00,0x00,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x12,0x00,0x00,0x00,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,
+ 0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x09,
+ 0x00,0x03,0x00,0x00,0x08,0x00,0x80,0x08,0x80,0x07,0x00,0x00,0x08,0x00,0x80,
+ 0x08,0x80,0x07,0x18,0x00,0x08,0x00,0x80,0x08,0x00,0x07,0x1e,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x87,0x0f,0x00,0x08,0x00,0x80,0x08,0x00,0xee,0x07,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0xfe,0x01,0x00,0x08,0x00,0x40,0x04,0x00,0x7c,0x00,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0x38,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x18,0x00,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0x0c,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x0c,
+ 0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x1c,0x06,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0xf8,0x0f,0x00,0x20,0x00,0x20,0x02,0x00,0xf8,0x0f,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0xf0,0x03,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_eastern_bitmaps/pawnR_l.xbm b/xshogi/new_eastern_bitmaps/pawnR_l.xbm
new file mode 100644
index 0000000..12595fa
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/pawnR_l.xbm
@@ -0,0 +1,46 @@
+#define pawnR_l_width 64
+#define pawnR_l_height 64
+static unsigned char pawnR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x06,
+  0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x0e, 0x80, 0x03, 0x80, 0x00,
+  0x20, 0x04, 0x00, 0x1e, 0xc0, 0x00, 0x40, 0x00, 0x20, 0x04, 0x00, 0x38,
+  0xf0, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x30, 0x70, 0x04, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x20, 0x00, 0x0f, 0x40, 0x00, 0x40, 0x04, 0x00, 0xc0,
+  0xff, 0x07, 0x40, 0x00, 0x40, 0x04, 0xc0, 0xff, 0xff, 0x01, 0x40, 0x00,
+  0x40, 0x04, 0x00, 0x7f, 0x30, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x60,
+  0x60, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0xe0, 0xff, 0x01, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0xf0, 0xef, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0xf8,
+  0x70, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0x30, 0x00, 0x20, 0x00,
+  0x80, 0x08, 0x00, 0x00, 0x18, 0x00, 0x20, 0x00, 0x80, 0x10, 0x00, 0x80,
+  0x00, 0x00, 0x10, 0x00, 0x80, 0x10, 0x00, 0x60, 0x00, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0x38, 0xe0, 0x01, 0x10, 0x00, 0x00, 0x11, 0x00, 0x1e,
+  0xfe, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0xcc, 0x1f, 0x00, 0x10, 0x00,
+  0x00, 0x11, 0x00, 0xf0, 0x03, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x38,
+  0x03, 0x00, 0x10, 0x00, 0x00, 0x21, 0x00, 0x0e, 0x03, 0x01, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0x07, 0xf3, 0x01, 0x08, 0x00, 0x00, 0x22, 0x00, 0x07,
+  0xff, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0xfe, 0x6f, 0x00, 0x08, 0x00,
+  0x00, 0x22, 0x00, 0xfc, 0x23, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0x00,
+  0xc1, 0x07, 0x08, 0x00, 0x00, 0x28, 0x00, 0x00, 0xff, 0x03, 0x08, 0x00,
+  0x00, 0x48, 0x00, 0xfe, 0x9f, 0x01, 0x04, 0x00, 0x00, 0x50, 0x00, 0xff,
+  0xc3, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x00, 0x61, 0x00, 0x04, 0x00,
+  0x00, 0x60, 0x00, 0x78, 0x23, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x3c,
+  0x03, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x0c, 0x01, 0xc0, 0x01, 0x00,
+  0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+  0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/pawn_l.xbm b/xshogi/new_eastern_bitmaps/pawn_l.xbm
new file mode 100644
index 0000000..3ad87b7
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/pawn_l.xbm
@@ -0,0 +1,38 @@
+#define pawn_l_width 64
+#define pawn_l_height 64
+static char pawn_l_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x80,0x30,0xe0,0x01,0x00,0x00,0x64,0x00,0xc0,0x3c,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0xc4,0x1e,0x00,0x02,0x00,0x00,0x22,0x00,0x86,0x00,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0xc3,0xff,0x00,0x02,0x00,0x00,0x22,0x80,0xf9,0x7f,0x00,
+ 0x02,0x00,0x00,0x12,0xc0,0xff,0x00,0x00,0x04,0x00,0x00,0x12,0xe0,0x83,0x00,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0xc4,0x3f,0x00,0x04,0x00,0x00,0x11,0x00,0xf6,
+ 0x7f,0x00,0x04,0x00,0x00,0x11,0x00,0xff,0xe0,0x00,0x04,0x00,0x00,0x11,0x80,
+ 0xcf,0xe0,0x00,0x04,0x00,0x00,0x11,0x80,0xc0,0x70,0x00,0x04,0x00,0x00,0x09,
+ 0x00,0xc0,0x1c,0x00,0x08,0x00,0x80,0x08,0x00,0xc0,0x0f,0x00,0x08,0x00,0x80,
+ 0x08,0x00,0xf8,0x33,0x00,0x08,0x00,0x80,0x08,0x00,0x7f,0x78,0x00,0x08,0x00,
+ 0x80,0x08,0x80,0x07,0x1c,0x00,0x08,0x00,0x80,0x08,0x00,0x00,0x06,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x00,0x01,0x00,0x08,0x00,0x40,0x04,0x00,0x18,0x00,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0x0c,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x0e,0x1f,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0xf7,0x0f,0x00,0x10,0x00,0x40,0x04,0x80,0xff,
+ 0x07,0x00,0x10,0x00,0x40,0x04,0x00,0x06,0x06,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0x0c,0xfe,0x00,0x20,0x00,0x20,0x02,0x80,0xff,0xff,0x03,0x20,0x00,0x20,0x02,
+ 0xe0,0xff,0x03,0x00,0x20,0x00,0x20,0x02,0xf0,0x00,0x04,0x00,0x20,0x00,0x20,
+ 0x02,0x20,0x0e,0x0c,0x00,0x20,0x00,0x20,0x02,0x00,0x0f,0x1c,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x03,0x78,0x00,0x20,0x00,0x10,0x01,0xc0,0x01,0x70,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x00,0x60,0x00,0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_eastern_bitmaps/rookPR_l.xbm b/xshogi/new_eastern_bitmaps/rookPR_l.xbm
new file mode 100644
index 0000000..99feb1d
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/rookPR_l.xbm
@@ -0,0 +1,46 @@
+#define rookPR_l_width 64
+#define rookPR_l_height 64
+static unsigned char rookPR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0xe0, 0xff, 0xff, 0x1f, 0x00, 0x20, 0x44, 0x00, 0xf0, 0xff,
+  0xff, 0x07, 0x00, 0x20, 0x48, 0x00, 0xe0, 0xff, 0x3f, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0xc0,
+  0x39, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0xe0, 0x3f, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0xf0, 0x31, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0xf8,
+  0x31, 0x00, 0x00, 0x10, 0x88, 0x00, 0x00, 0xe8, 0x1f, 0x00, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0xf8, 0x0f, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xc0,
+  0x70, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xc0, 0x1f, 0x00, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0xc0, 0x07, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0xc0,
+  0x01, 0x00, 0x00, 0x08, 0x10, 0x01, 0xf0, 0x07, 0x30, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0xf8, 0x0f, 0x78, 0x00, 0x00, 0x08, 0x20, 0x01, 0x18, 0x18,
+  0xd8, 0x81, 0x00, 0x08, 0x20, 0x01, 0x1c, 0x30, 0x98, 0xe1, 0x00, 0x08,
+  0x20, 0x01, 0x1c, 0x30, 0x98, 0x71, 0x00, 0x04, 0x20, 0x01, 0x18, 0x30,
+  0xf8, 0x31, 0x00, 0x04, 0x20, 0x01, 0x08, 0x30, 0x3c, 0x38, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x37, 0x3f, 0x1c, 0x00, 0x04, 0x20, 0x02, 0x80, 0xf7,
+  0x1b, 0x0e, 0x00, 0x04, 0x40, 0x02, 0xe0, 0xf1, 0x11, 0x0f, 0x00, 0x04,
+  0x40, 0x02, 0xe0, 0xf8, 0x80, 0x03, 0x00, 0x02, 0x40, 0x02, 0x00, 0x7c,
+  0xc0, 0x0f, 0x00, 0x02, 0x40, 0x02, 0x00, 0x7e, 0xf0, 0x1f, 0x00, 0x02,
+  0x40, 0x02, 0x80, 0x6f, 0xf8, 0x09, 0x00, 0x02, 0x40, 0x04, 0xc0, 0x63,
+  0x7c, 0x06, 0x00, 0x02, 0x80, 0x04, 0xe0, 0x61, 0x3c, 0x07, 0x00, 0x02,
+  0x80, 0x04, 0x70, 0x60, 0x30, 0x03, 0x00, 0x01, 0x80, 0x04, 0x00, 0x70,
+  0xc0, 0x0f, 0x00, 0x01, 0x80, 0x04, 0x00, 0x70, 0xf8, 0x03, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x70, 0x3c, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x70,
+  0x40, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x70, 0xc0, 0x00, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0xf0, 0xc0, 0x00, 0x00, 0x01, 0x00, 0x09, 0x00, 0xe0,
+  0xc0, 0x01, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/rookP_l.xbm b/xshogi/new_eastern_bitmaps/rookP_l.xbm
new file mode 100644
index 0000000..261cbac
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/rookP_l.xbm
@@ -0,0 +1,46 @@
+#define rookP_l_width 64
+#define rookP_l_height 64
+static unsigned char rookP_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x11, 0x80, 0x03, 0x07, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0x00, 0x03, 0x0f, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x03,
+  0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x02, 0x0e, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x3c, 0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0xc0, 0x1f,
+  0x0e, 0x00, 0x80, 0x00, 0x00, 0x09, 0xf0, 0x03, 0x0e, 0x00, 0x00, 0x01,
+  0x80, 0x08, 0xc0, 0x0c, 0x06, 0x0e, 0x00, 0x01, 0x80, 0x08, 0xe0, 0x3c,
+  0x86, 0x07, 0x00, 0x01, 0x80, 0x04, 0x60, 0x3e, 0xc6, 0x03, 0x00, 0x01,
+  0x80, 0x04, 0x90, 0x1f, 0xf6, 0x01, 0x00, 0x01, 0x80, 0x04, 0xf8, 0x0f,
+  0x7e, 0x00, 0x00, 0x01, 0x80, 0x04, 0xf0, 0x03, 0x3e, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0xc0, 0x01, 0x1f, 0x07, 0x00, 0x02, 0x40, 0x04, 0xf0, 0x88,
+  0x8f, 0x07, 0x00, 0x02, 0x40, 0x02, 0x70, 0xd8, 0xef, 0x01, 0x00, 0x02,
+  0x40, 0x02, 0x38, 0xfc, 0xec, 0x00, 0x00, 0x02, 0x40, 0x02, 0x1c, 0x3c,
+  0x0c, 0x10, 0x00, 0x02, 0x40, 0x02, 0x8c, 0x1f, 0x0c, 0x18, 0x00, 0x02,
+  0x40, 0x02, 0x8e, 0x19, 0x0c, 0x38, 0x00, 0x04, 0x20, 0x02, 0x87, 0x19,
+  0x0c, 0x38, 0x00, 0x04, 0x20, 0x02, 0x81, 0x1b, 0x18, 0x18, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0x1e, 0xf0, 0x1f, 0x00, 0x04, 0x20, 0x01, 0x00, 0x0c,
+  0xe0, 0x0f, 0x00, 0x04, 0x20, 0x01, 0x00, 0x80, 0x03, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0xe0, 0x03, 0x00, 0x00, 0x08, 0x20, 0x01, 0x00, 0xf8,
+  0x03, 0x00, 0x00, 0x08, 0x10, 0x01, 0x00, 0x0e, 0x03, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0xf0, 0x1f, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0xf8,
+  0x17, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0x8c, 0x1f, 0x00, 0x00, 0x08,
+  0x90, 0x00, 0x00, 0x8c, 0x0f, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xfc,
+  0x07, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0x9c, 0x03, 0x00, 0x00, 0x10,
+  0x88, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0xfc,
+  0xff, 0x07, 0x00, 0x10, 0x48, 0x00, 0xe0, 0xff, 0xff, 0x0f, 0x00, 0x10,
+  0x48, 0x00, 0xf8, 0xff, 0xff, 0x07, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/rookR_l.xbm b/xshogi/new_eastern_bitmaps/rookR_l.xbm
new file mode 100644
index 0000000..d89ff5b
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/rookR_l.xbm
@@ -0,0 +1,46 @@
+#define rookR_l_width 64
+#define rookR_l_height 64
+static unsigned char rookR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x03, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x03, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0xc0, 0xff, 0xff, 0x03, 0x00, 0x10, 0x48, 0x00, 0x80, 0xff,
+  0x3f, 0x07, 0x00, 0x10, 0x88, 0x00, 0x00, 0x00, 0x03, 0x04, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0xfc, 0x7f, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0x3c,
+  0x63, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0x06, 0xe3, 0x00, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0xfe, 0xff, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0x03,
+  0xc1, 0x01, 0x00, 0x08, 0x10, 0x01, 0x00, 0x07, 0xc1, 0x01, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0xff, 0x7f, 0x01, 0x00, 0x08, 0x20, 0x01, 0x00, 0x00,
+  0x03, 0x00, 0x00, 0x08, 0x20, 0x01, 0x00, 0xf8, 0x1f, 0x00, 0x00, 0x08,
+  0x20, 0x01, 0x00, 0xf0, 0x3f, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x00,
+  0x01, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04,
+  0x20, 0x02, 0xe0, 0x07, 0x00, 0x00, 0x00, 0x04, 0x20, 0x02, 0xf0, 0x0f,
+  0x0c, 0x0e, 0x00, 0x04, 0x40, 0x02, 0x10, 0x18, 0x1e, 0x03, 0x00, 0x04,
+  0x40, 0x02, 0x90, 0x31, 0xa6, 0x01, 0x00, 0x02, 0x40, 0x02, 0x30, 0x37,
+  0xc6, 0x00, 0x00, 0x02, 0x40, 0x02, 0x10, 0x3e, 0xc6, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x33, 0x46, 0x00, 0x00, 0x02, 0x40, 0x04, 0x80, 0x31,
+  0xf6, 0x0f, 0x00, 0x02, 0x80, 0x04, 0x00, 0x60, 0xff, 0x1d, 0x00, 0x02,
+  0x80, 0x04, 0xe0, 0xef, 0x6f, 0x00, 0x00, 0x01, 0x80, 0x04, 0xf0, 0xdf,
+  0x67, 0x08, 0x00, 0x01, 0x80, 0x04, 0x30, 0x18, 0xe6, 0x0f, 0x00, 0x01,
+  0x80, 0x04, 0xb0, 0x11, 0xe6, 0x07, 0x00, 0x01, 0x80, 0x08, 0xa0, 0x33,
+  0x06, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x36, 0x04, 0x00, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0x3c, 0xc0, 0x00, 0x00, 0x01, 0x00, 0x09, 0x00, 0xee,
+  0x7f, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0xe3, 0x0f, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0xe0, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/rook_l.xbm b/xshogi/new_eastern_bitmaps/rook_l.xbm
new file mode 100644
index 0000000..a968391
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/rook_l.xbm
@@ -0,0 +1,46 @@
+#define rook_l_width 64
+#define rook_l_height 64
+static unsigned char rook_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x00, 0x07, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0xf0,
+  0xc7, 0x00, 0x80, 0x00, 0x00, 0x11, 0x00, 0xfe, 0x77, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0x00, 0x03, 0x3c, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x20,
+  0x6c, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x60, 0xcc, 0x05, 0x80, 0x00,
+  0x00, 0x09, 0xe0, 0x67, 0x88, 0x0d, 0x80, 0x00, 0x00, 0x09, 0xf0, 0x67,
+  0x18, 0x0c, 0x80, 0x00, 0x00, 0x09, 0x10, 0xe6, 0xfb, 0x0f, 0x00, 0x01,
+  0x80, 0x08, 0x00, 0xf6, 0xf7, 0x07, 0x00, 0x01, 0x80, 0x08, 0xb8, 0xff,
+  0x06, 0x00, 0x00, 0x01, 0x80, 0x04, 0xf0, 0x6f, 0x8c, 0x01, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x62, 0xcc, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0x63,
+  0x7c, 0x08, 0x00, 0x01, 0x80, 0x04, 0x00, 0x63, 0xec, 0x0c, 0x00, 0x01,
+  0x80, 0x04, 0x80, 0x65, 0x8c, 0x09, 0x00, 0x02, 0x40, 0x04, 0xc0, 0x78,
+  0x18, 0x08, 0x00, 0x02, 0x40, 0x02, 0x70, 0x30, 0xf0, 0x0f, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x00, 0xe0, 0x07, 0x00, 0x02, 0x40, 0x02, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x80, 0x00, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0xfc, 0x0f, 0x00, 0x00, 0x04, 0x20, 0x02, 0x00, 0xf8,
+  0x1f, 0x00, 0x00, 0x04, 0x20, 0x02, 0x00, 0xc0, 0x00, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x80, 0xfe, 0xff, 0x00, 0x00, 0x04, 0x20, 0x01, 0x80, 0x83,
+  0xe0, 0x00, 0x00, 0x04, 0x20, 0x01, 0x80, 0x83, 0xc0, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0xff, 0x7f, 0x00, 0x00, 0x08, 0x20, 0x01, 0x00, 0xc7,
+  0x60, 0x00, 0x00, 0x08, 0x10, 0x01, 0x00, 0xc6, 0x3c, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0xfe, 0x3f, 0x00, 0x00, 0x08, 0x90, 0x00, 0x20, 0xc0,
+  0x00, 0x00, 0x00, 0x08, 0x90, 0x00, 0xe0, 0xfc, 0xff, 0x01, 0x00, 0x08,
+  0x90, 0x00, 0xc0, 0xff, 0xff, 0x03, 0x00, 0x10, 0x90, 0x00, 0x00, 0xc0,
+  0x00, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xc0, 0x00, 0x00, 0x00, 0x10,
+  0x88, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/silverPR_l.xbm b/xshogi/new_eastern_bitmaps/silverPR_l.xbm
new file mode 100644
index 0000000..2570986
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/silverPR_l.xbm
@@ -0,0 +1,46 @@
+#define silverPR_l_width 64
+#define silverPR_l_height 64
+static unsigned char silverPR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x1c, 0x00, 0x20,
+  0x48, 0x00, 0xfc, 0xff, 0xff, 0x0f, 0x00, 0x20, 0x48, 0x00, 0xfc, 0xff,
+  0xff, 0x01, 0x00, 0x20, 0x48, 0x00, 0xf8, 0x83, 0x03, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x80,
+  0x01, 0x00, 0x00, 0x10, 0x88, 0x00, 0x00, 0x80, 0xc0, 0x01, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0x80, 0xff, 0x01, 0x00, 0x10, 0x90, 0x00, 0x80, 0xff,
+  0x7f, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xbf, 0x01, 0x00, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0x80, 0x00, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0x80,
+  0xfe, 0x01, 0x00, 0x08, 0x10, 0x01, 0x00, 0xf8, 0x7f, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0x9c, 0x00, 0x00, 0x00, 0x08, 0x20, 0x01, 0x1f, 0x80,
+  0x01, 0x78, 0x00, 0x08, 0x20, 0x01, 0x3e, 0x80, 0x7f, 0x0c, 0x00, 0x08,
+  0x20, 0x01, 0xfc, 0xf0, 0x0f, 0x07, 0x00, 0x04, 0x20, 0x01, 0xf0, 0x39,
+  0x80, 0x03, 0x00, 0x04, 0x20, 0x01, 0xc0, 0x03, 0xc0, 0x00, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x07, 0x60, 0x00, 0x00, 0x04, 0x20, 0x02, 0x00, 0x0e,
+  0x38, 0x00, 0x00, 0x04, 0x40, 0x02, 0x00, 0x18, 0x1c, 0x00, 0x00, 0x04,
+  0x40, 0x02, 0x00, 0x30, 0x0e, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x60,
+  0x07, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0xe0, 0x07, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x80, 0x03, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x02, 0x80, 0x04, 0x00, 0xc0, 0x03, 0x00, 0x00, 0x02,
+  0x80, 0x04, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xc0,
+  0x01, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/silverP_l.xbm b/xshogi/new_eastern_bitmaps/silverP_l.xbm
new file mode 100644
index 0000000..ac0fb31
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/silverP_l.xbm
@@ -0,0 +1,46 @@
+#define silverP_l_width 64
+#define silverP_l_height 64
+static unsigned char silverP_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x80,
+  0x03, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x80, 0x03, 0x00, 0x00, 0x01,
+  0x80, 0x08, 0x00, 0x80, 0x03, 0x00, 0x00, 0x01, 0x80, 0x08, 0x00, 0xc0,
+  0x03, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xe0,
+  0x07, 0x00, 0x00, 0x01, 0x80, 0x04, 0x00, 0xe0, 0x06, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x70, 0x0c, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x38,
+  0x18, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x1c, 0x70, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0x06, 0xe0, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x03,
+  0xc0, 0x03, 0x00, 0x02, 0x40, 0x02, 0xc0, 0x01, 0x9c, 0x0f, 0x00, 0x02,
+  0x40, 0x02, 0xe0, 0xf0, 0x0f, 0x3f, 0x00, 0x04, 0x20, 0x02, 0x30, 0xfe,
+  0x01, 0x7c, 0x00, 0x04, 0x20, 0x02, 0x1e, 0x80, 0x01, 0xf8, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0x00, 0x39, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0xfe,
+  0x1f, 0x00, 0x00, 0x04, 0x20, 0x01, 0x80, 0x7f, 0x01, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x00, 0x00, 0x01, 0x00, 0x00, 0x08, 0x20, 0x01, 0x00, 0x80,
+  0xfd, 0x00, 0x00, 0x08, 0x10, 0x01, 0x00, 0xfe, 0xff, 0x01, 0x00, 0x08,
+  0x10, 0x01, 0x80, 0xff, 0x01, 0x00, 0x00, 0x08, 0x90, 0x00, 0x80, 0x03,
+  0x01, 0x00, 0x00, 0x08, 0x90, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x08,
+  0x90, 0x00, 0x00, 0x80, 0x01, 0x00, 0x00, 0x10, 0x90, 0x00, 0x00, 0xc0,
+  0xc1, 0x1f, 0x00, 0x10, 0x90, 0x00, 0x80, 0xff, 0xff, 0x3f, 0x00, 0x10,
+  0x88, 0x00, 0xf0, 0xff, 0xff, 0x3f, 0x00, 0x10, 0x48, 0x00, 0x38, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/silverR_l.xbm b/xshogi/new_eastern_bitmaps/silverR_l.xbm
new file mode 100644
index 0000000..a55ad95
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/silverR_l.xbm
@@ -0,0 +1,46 @@
+#define silverR_l_width 64
+#define silverR_l_height 64
+static unsigned char silverR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x07,
+  0x06, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x08, 0x0a, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x10, 0x12, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0xe4, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x06, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x0f, 0x80, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x0b,
+  0xc0, 0x01, 0x00, 0x20, 0x48, 0x00, 0x00, 0xc3, 0xe0, 0x01, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0xe3, 0x60, 0x03, 0x00, 0x10, 0x48, 0x00, 0x00, 0x63,
+  0x60, 0x18, 0x00, 0x10, 0x88, 0x00, 0x00, 0x26, 0x60, 0x1c, 0x00, 0x10,
+  0x90, 0x00, 0xe0, 0xe7, 0x63, 0x0c, 0x00, 0x10, 0x90, 0x00, 0xf0, 0xff,
+  0x63, 0x0c, 0x00, 0x10, 0x90, 0x00, 0x00, 0x06, 0x60, 0x04, 0x00, 0x10,
+  0x90, 0x00, 0x00, 0x60, 0x20, 0x1f, 0x00, 0x08, 0x90, 0x00, 0x00, 0x7c,
+  0xa0, 0x0f, 0x00, 0x08, 0x10, 0x01, 0x00, 0x1c, 0x29, 0x00, 0x00, 0x08,
+  0x10, 0x01, 0x00, 0x06, 0x7b, 0x04, 0x00, 0x08, 0x20, 0x01, 0x00, 0x66,
+  0xfb, 0x07, 0x00, 0x08, 0x20, 0x01, 0x00, 0x7e, 0xf0, 0x06, 0x00, 0x08,
+  0x20, 0x01, 0x00, 0x5c, 0x20, 0x03, 0x00, 0x04, 0x20, 0x01, 0x00, 0xc0,
+  0x61, 0x03, 0x00, 0x04, 0x20, 0x01, 0x00, 0xe0, 0x63, 0x01, 0x00, 0x04,
+  0x20, 0x02, 0x00, 0x78, 0x60, 0x01, 0x00, 0x04, 0x20, 0x02, 0x00, 0x18,
+  0x60, 0x00, 0x00, 0x04, 0x40, 0x02, 0x00, 0x08, 0x20, 0x00, 0x00, 0x04,
+  0x40, 0x02, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x40, 0x02, 0xc0, 0x81,
+  0xf0, 0x0f, 0x00, 0x02, 0x40, 0x02, 0x80, 0xe3, 0xf8, 0x07, 0x00, 0x02,
+  0x40, 0x02, 0x00, 0xf3, 0x4c, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0xd7,
+  0xe0, 0x07, 0x00, 0x02, 0x80, 0x04, 0x00, 0x47, 0x58, 0x00, 0x00, 0x02,
+  0x80, 0x04, 0xc0, 0x4c, 0xe0, 0x03, 0x00, 0x01, 0x80, 0x04, 0x60, 0x78,
+  0x58, 0x00, 0x00, 0x01, 0x80, 0x04, 0x60, 0x7c, 0xc0, 0x03, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x46, 0xf0, 0x01, 0x00, 0x01, 0x80, 0x08, 0x00, 0xf2,
+  0x00, 0x0c, 0x00, 0x01, 0x80, 0x08, 0x00, 0xde, 0x18, 0x06, 0x00, 0x01,
+  0x00, 0x09, 0x00, 0xc2, 0x30, 0x03, 0x00, 0x01, 0x00, 0x09, 0x00, 0xfe,
+  0xe0, 0x01, 0x80, 0x00, 0x00, 0x09, 0x00, 0xdc, 0xc0, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x00, 0x40, 0x40, 0x00, 0x80, 0x00, 0x00, 0x09, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+  0x00, 0x14, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x00, 0x18, 0x00, 0x00,
+  0x00, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x00, 0x00, 0x00, 0x70, 0x00,
+  0x00, 0x60, 0x00, 0x00, 0x00, 0x00, 0x0f, 0x00, 0x00, 0x80, 0x07, 0x00,
+  0x00, 0xf0, 0x00, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x0e, 0x00, 0x00,
+  0x00, 0x00, 0xc0, 0x03, 0xe0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x3c,
+  0x1e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/silver_l.xbm b/xshogi/new_eastern_bitmaps/silver_l.xbm
new file mode 100644
index 0000000..85062e6
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/silver_l.xbm
@@ -0,0 +1,46 @@
+#define silver_l_width 64
+#define silver_l_height 64
+static unsigned char silver_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x03, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x8e, 0x3c, 0x00, 0x00, 0x00, 0x00, 0x00, 0xe0, 0x81,
+  0xc0, 0x03, 0x00, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x01, 0x3c, 0x00, 0x00,
+  0x00, 0xe0, 0x01, 0xc0, 0x01, 0xc0, 0x03, 0x00, 0x00, 0x1c, 0x00, 0x3c,
+  0x1e, 0x00, 0x1c, 0x00, 0x00, 0x04, 0xc0, 0x03, 0xe0, 0x01, 0x10, 0x00,
+  0x00, 0x06, 0x38, 0x00, 0x00, 0x0e, 0x60, 0x00, 0x00, 0x8a, 0x07, 0x00,
+  0x00, 0xf0, 0x40, 0x00, 0x00, 0x7a, 0x00, 0x00, 0x00, 0x00, 0x4f, 0x00,
+  0x00, 0x12, 0x00, 0x02, 0x02, 0x00, 0x70, 0x00, 0x00, 0x12, 0x00, 0x03,
+  0x3b, 0x00, 0x80, 0x00, 0x00, 0x11, 0x80, 0x07, 0x7f, 0x00, 0x80, 0x00,
+  0x00, 0x11, 0xc0, 0x0c, 0x43, 0x00, 0x80, 0x00, 0x00, 0x09, 0x60, 0x18,
+  0x7b, 0x00, 0x80, 0x00, 0x00, 0x09, 0x30, 0x00, 0x4f, 0x00, 0x80, 0x00,
+  0x00, 0x09, 0x80, 0x0f, 0x62, 0x00, 0x80, 0x00, 0x00, 0x09, 0xc0, 0x03,
+  0x3e, 0x06, 0x80, 0x00, 0x00, 0x09, 0x00, 0x1a, 0x1e, 0x06, 0x00, 0x01,
+  0x80, 0x08, 0xc0, 0x07, 0x32, 0x03, 0x00, 0x01, 0x80, 0x08, 0x00, 0x1a,
+  0xe2, 0x00, 0x00, 0x01, 0x80, 0x04, 0xe0, 0x07, 0xeb, 0x00, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x32, 0xcf, 0x00, 0x00, 0x01, 0x80, 0x04, 0xe0, 0x1f,
+  0xc7, 0x01, 0x00, 0x01, 0x80, 0x04, 0xf0, 0x0f, 0x81, 0x03, 0x00, 0x01,
+  0x80, 0x04, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0x40, 0x04, 0x00, 0x04,
+  0x10, 0x00, 0x00, 0x02, 0x40, 0x02, 0x00, 0x06, 0x18, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0x80, 0x06, 0x1e, 0x00, 0x00, 0x02, 0x40, 0x02, 0x80, 0xc6,
+  0x07, 0x00, 0x00, 0x02, 0x40, 0x02, 0xc0, 0x86, 0x03, 0x00, 0x00, 0x02,
+  0x40, 0x02, 0xc0, 0x04, 0x3a, 0x00, 0x00, 0x04, 0x20, 0x02, 0x60, 0x0f,
+  0x7e, 0x00, 0x00, 0x04, 0x20, 0x02, 0xe0, 0xdf, 0x66, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0x20, 0xde, 0x60, 0x00, 0x00, 0x04, 0x20, 0x01, 0x00, 0x94,
+  0x38, 0x00, 0x00, 0x04, 0x20, 0x01, 0xf0, 0x05, 0x3e, 0x00, 0x00, 0x04,
+  0x20, 0x01, 0xf8, 0x04, 0x06, 0x00, 0x00, 0x08, 0x20, 0x01, 0x20, 0x06,
+  0x60, 0x00, 0x00, 0x08, 0x10, 0x01, 0x30, 0xc6, 0xff, 0x0f, 0x00, 0x08,
+  0x10, 0x01, 0x30, 0xc6, 0xe7, 0x07, 0x00, 0x08, 0x90, 0x00, 0x38, 0x06,
+  0x64, 0x00, 0x00, 0x08, 0x90, 0x00, 0x18, 0x06, 0xc6, 0x00, 0x00, 0x08,
+  0x90, 0x00, 0xc0, 0x06, 0xc7, 0x00, 0x00, 0x10, 0x90, 0x00, 0x80, 0x07,
+  0xc3, 0x00, 0x00, 0x10, 0x90, 0x00, 0x80, 0x03, 0xd0, 0x00, 0x00, 0x10,
+  0x88, 0x00, 0x00, 0x01, 0xf0, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00,
+  0x60, 0x00, 0x00, 0x10, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20, 0x44, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x20, 0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x20,
+  0x24, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x24, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x40, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40,
+  0x30, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x40, 0x30, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x60, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/smallsolidR_l.xbm b/xshogi/new_eastern_bitmaps/smallsolidR_l.xbm
new file mode 100644
index 0000000..d1e862d
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/smallsolidR_l.xbm
@@ -0,0 +1,46 @@
+#define smallsolidR_l_width 64
+#define smallsolidR_l_height 64
+static unsigned char smallsolidR_l_bits[] = {
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0xf8, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x7f, 0x00, 0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0xf0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x01, 0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0xf0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0xff, 0x00, 0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x00,
+  0xe0, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00, 0xe0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x7f, 0x00, 0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00,
+  0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00, 0xc0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x7f, 0x00, 0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00,
+  0xc0, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00, 0xc0, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x3f, 0x00, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x80, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x3f, 0x00, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00,
+  0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x80, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x1f, 0x00, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0x00,
+  0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0x00, 0x00, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x1f, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0x00,
+  0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1f, 0x00, 0x00, 0xff, 0xff, 0xff,
+  0xff, 0xff, 0x1f, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00,
+  0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00, 0x00, 0xfe, 0xff, 0xff,
+  0xff, 0xff, 0x0f, 0x00, 0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00,
+  0x00, 0xfe, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00, 0x00, 0xfc, 0xff, 0xff,
+  0xff, 0xff, 0x0f, 0x00, 0x00, 0xf8, 0xff, 0xff, 0xff, 0xff, 0x0f, 0x00,
+  0x00, 0xf8, 0xff, 0xff, 0xff, 0xff, 0x07, 0x00, 0x00, 0xf0, 0xff, 0xff,
+  0xff, 0xff, 0x07, 0x00, 0x00, 0xf0, 0xff, 0xff, 0xff, 0xff, 0x07, 0x00,
+  0x00, 0xe0, 0xff, 0xff, 0xff, 0xff, 0x07, 0x00, 0x00, 0xc0, 0xff, 0xff,
+  0xff, 0xff, 0x07, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00,
+  0x00, 0x00, 0xf8, 0xff, 0xff, 0x3f, 0x00, 0x00, 0x00, 0x00, 0xc0, 0xff,
+  0xff, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0xfe, 0xff, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0xf0, 0x1f, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+  0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+  0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, };
diff --git a/xshogi/new_eastern_bitmaps/smallsolid_l.xbm b/xshogi/new_eastern_bitmaps/smallsolid_l.xbm
new file mode 100644
index 0000000..9479e92
--- /dev/null
+++ b/xshogi/new_eastern_bitmaps/smallsolid_l.xbm
@@ -0,0 +1,38 @@
+#define smallsolid_l_width 64
+#define smallsolid_l_height 64
+static char smallsolid_l_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0xff,0x0f,0x00,0x00,0x00,0x00,0x00,0xf0,0xff,
+ 0x7f,0x00,0x00,0x00,0x00,0x00,0xff,0xff,0xff,0x03,0x00,0x00,0x00,0xf0,0xff,
+ 0xff,0xff,0x1f,0x00,0x00,0x00,0xf8,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0xfc,
+ 0xff,0xff,0xff,0xff,0x00,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x01,0x00,0x00,
+ 0xfc,0xff,0xff,0xff,0xff,0x01,0x00,0x00,0xfc,0xff,0xff,0xff,0xff,0x03,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0x03,0x00,0x00,0xfe,0xff,0xff,0xff,0xff,0x03,
+ 0x00,0x00,0xfe,0xff,0xff,0xff,0xff,0x03,0x00,0x00,0xfe,0xff,0xff,0xff,0xff,
+ 0x03,0x00,0x00,0xfe,0xff,0xff,0xff,0xff,0x07,0x00,0x00,0xfe,0xff,0xff,0xff,
+ 0xff,0x07,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0x07,0x00,0x00,0xff,0xff,0xff,
+ 0xff,0xff,0x07,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0x07,0x00,0x00,0xff,0xff,
+ 0xff,0xff,0xff,0x07,0x00,0x00,0xff,0xff,0xff,0xff,0xff,0x07,0x00,0x00,0xff,
+ 0xff,0xff,0xff,0xff,0x0f,0x00,0x80,0xff,0xff,0xff,0xff,0xff,0x0f,0x00,0x80,
+ 0xff,0xff,0xff,0xff,0xff,0x0f,0x00,0x80,0xff,0xff,0xff,0xff,0xff,0x0f,0x00,
+ 0x80,0xff,0xff,0xff,0xff,0xff,0x0f,0x00,0x80,0xff,0xff,0xff,0xff,0xff,0x0f,
+ 0x00,0x80,0xff,0xff,0xff,0xff,0xff,0x0f,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,
+ 0x1f,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,0x1f,0x00,0xc0,0xff,0xff,0xff,0xff,
+ 0xff,0x1f,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,0x1f,0x00,0xc0,0xff,0xff,0xff,
+ 0xff,0xff,0x1f,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,0x1f,0x00,0xe0,0xff,0xff,
+ 0xff,0xff,0xff,0x3f,0x00,0xe0,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0xe0,0xff,
+ 0xff,0xff,0xff,0xff,0x3f,0x00,0xe0,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0xe0,
+ 0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0xe0,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,
+ 0xf0,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0xf0,0xff,0xff,0xff,0xff,0xff,0x7f,
+ 0x00,0xf0,0xff,0xff,0xff,0xff,0xff,0x7f,0x00,0xf0,0xff,0xff,0xff,0xff,0xff,
+ 0x7f,0x00,0xf0,0xff,0xff,0xff,0xff,0xff,0x7f,0x00,0xe0,0xff,0xff,0xff,0xff,
+ 0xff,0x7f,0x00,0xe0,0xff,0xff,0xff,0xff,0xff,0x7f,0x00,0xe0,0xff,0xff,0xff,
+ 0xff,0xff,0x7f,0x00,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0xc0,0xff,0xff,
+ 0xff,0xff,0xff,0xff,0x00,0xc0,0xff,0xff,0xff,0xff,0xff,0xff,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/bishopPRW.xbm b/xshogi/new_western_bitmaps/bishopPRW.xbm
new file mode 100644
index 0000000..04c3af0
--- /dev/null
+++ b/xshogi/new_western_bitmaps/bishopPRW.xbm
@@ -0,0 +1,38 @@
+#define bishopPRW_width 64
+#define bishopPRW_height 64
+static char bishopPRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0xf0,0x00,0x01,0x1e,0x00,0x20,
+ 0x48,0x00,0x30,0x00,0x01,0x18,0x00,0x20,0x48,0x00,0x50,0x00,0x01,0x14,0x00,
+ 0x20,0x48,0x00,0x90,0x00,0x01,0x12,0x00,0x20,0x48,0x00,0x00,0x01,0x01,0x01,
+ 0x00,0x10,0x48,0x00,0x00,0x02,0x81,0x00,0x00,0x10,0x88,0x00,0x00,0x04,0x41,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x08,0x21,0x00,0x00,0x10,0x90,0x00,0x00,0x10,
+ 0x11,0x00,0x00,0x10,0x90,0x00,0x00,0x20,0x09,0x00,0x00,0x10,0x90,0x00,0x00,
+ 0x40,0x05,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x03,0x00,0x00,0x08,0x10,0x01,
+ 0xf0,0xff,0xff,0x1f,0x00,0x08,0x10,0x01,0x00,0x80,0x03,0x00,0x00,0x08,0x20,
+ 0x01,0x00,0x40,0x05,0x00,0x00,0x08,0x20,0x01,0x00,0x20,0x09,0x00,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x11,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x21,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x41,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x81,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x01,0x01,0x00,0x04,0x40,0x02,0x90,0x00,0x01,
+ 0x12,0x00,0x04,0x40,0x02,0x50,0x00,0x01,0x14,0x00,0x02,0x40,0x02,0x30,0x00,
+ 0x01,0x18,0x00,0x02,0x40,0x02,0xf0,0x00,0x01,0x1e,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0xc0,0x07,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x20,0x08,0x00,0x00,0x01,0x80,0x04,0x00,0x90,0x17,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x48,0x24,0x00,0x00,0x01,0x80,0x08,0x00,0x48,0x24,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x88,0x27,0x00,0x00,0x01,0x00,0x09,0x00,0x48,0x24,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x48,0x24,0x00,0x80,0x00,0x00,0x09,0x00,0x90,0x17,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x08,0x00,0x80,0x00,0x00,0x09,0x00,0xc0,
+ 0x07,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/bishopPW.xbm b/xshogi/new_western_bitmaps/bishopPW.xbm
new file mode 100644
index 0000000..0759d37
--- /dev/null
+++ b/xshogi/new_western_bitmaps/bishopPW.xbm
@@ -0,0 +1,38 @@
+#define bishopPW_width 64
+#define bishopPW_height 64
+static char bishopPW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0xe0,0x03,0x00,0x4f,0x00,0x00,0x12,0x00,0x10,0x04,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xe8,0x09,0x00,0x80,0x00,0x00,0x11,0x00,0x24,0x12,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x24,0x12,0x00,0x80,0x00,0x00,0x09,0x00,0xe4,0x11,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x24,0x12,0x00,0x80,0x00,0x00,0x09,0x00,0x24,0x12,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0xe8,0x09,0x00,0x80,0x00,0x00,0x09,0x00,0x10,0x04,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0xe0,0x03,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x78,0x80,0x00,0x0f,0x00,0x01,0x80,0x04,
+ 0x18,0x80,0x00,0x0c,0x00,0x01,0x80,0x04,0x28,0x80,0x00,0x0a,0x00,0x02,0x40,
+ 0x04,0x48,0x80,0x00,0x09,0x00,0x02,0x40,0x02,0x80,0x80,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x81,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x82,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x84,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x88,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x90,0x04,0x00,0x00,0x04,0x20,0x02,0x00,0xa0,0x02,
+ 0x00,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0xf8,0xff,
+ 0xff,0x0f,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0x00,
+ 0xa0,0x02,0x00,0x00,0x08,0x20,0x01,0x00,0x90,0x04,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x88,0x08,0x00,0x00,0x08,0x10,0x01,0x00,0x84,0x10,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x82,0x20,0x00,0x00,0x08,0x90,0x00,0x00,0x81,0x40,0x00,0x00,0x08,
+ 0x90,0x00,0x80,0x80,0x80,0x00,0x00,0x10,0x90,0x00,0x48,0x80,0x00,0x09,0x00,
+ 0x10,0x90,0x00,0x28,0x80,0x00,0x0a,0x00,0x10,0x88,0x00,0x18,0x80,0x00,0x0c,
+ 0x00,0x10,0x48,0x00,0x78,0x80,0x00,0x0f,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/bishopRW.xbm b/xshogi/new_western_bitmaps/bishopRW.xbm
new file mode 100644
index 0000000..2713023
--- /dev/null
+++ b/xshogi/new_western_bitmaps/bishopRW.xbm
@@ -0,0 +1,38 @@
+#define bishopRW_width 64
+#define bishopRW_height 64
+static char bishopRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0xf0,0x00,0x00,0x1e,0x00,0x20,
+ 0x48,0x00,0x30,0x00,0x00,0x18,0x00,0x20,0x48,0x00,0x50,0x00,0x00,0x14,0x00,
+ 0x20,0x48,0x00,0x90,0x00,0x00,0x12,0x00,0x20,0x48,0x00,0x00,0x01,0x00,0x01,
+ 0x00,0x10,0x48,0x00,0x00,0x02,0x80,0x00,0x00,0x10,0x88,0x00,0x00,0x04,0x40,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x08,0x20,0x00,0x00,0x10,0x90,0x00,0x00,0x10,
+ 0x10,0x00,0x00,0x10,0x90,0x00,0x00,0x20,0x08,0x00,0x00,0x10,0x90,0x00,0x00,
+ 0x40,0x04,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x02,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x00,0x01,0x00,0x00,0x08,0x10,0x01,0x00,0x80,0x02,0x00,0x00,0x08,0x20,
+ 0x01,0x00,0x40,0x04,0x00,0x00,0x08,0x20,0x01,0x00,0x20,0x08,0x00,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x10,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x20,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x40,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x80,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x00,0x01,0x00,0x04,0x40,0x02,0x90,0x00,0x00,
+ 0x12,0x00,0x04,0x40,0x02,0x50,0x00,0x00,0x14,0x00,0x02,0x40,0x02,0x30,0x00,
+ 0x00,0x18,0x00,0x02,0x40,0x02,0xf0,0x00,0x00,0x1e,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x80,0x07,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x40,0x04,0x00,0x00,0x01,0x80,0x08,0x00,0x40,0x04,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x80,0x07,0x00,0x00,0x01,0x00,0x09,0x00,0x40,0x04,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x09,0x00,0x80,0x07,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x00,
+ 0x00,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/bishopW.xbm b/xshogi/new_western_bitmaps/bishopW.xbm
new file mode 100644
index 0000000..88b1f51
--- /dev/null
+++ b/xshogi/new_western_bitmaps/bishopW.xbm
@@ -0,0 +1,38 @@
+#define bishopW_width 64
+#define bishopW_height 64
+static char bishopW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0x00,0x00,0x00,0x4f,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xe0,0x01,0x00,0x80,0x00,0x00,0x11,0x00,0x20,0x02,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0xe0,0x01,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x02,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0xe0,0x01,0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x78,0x00,0x00,0x0f,0x00,0x01,0x80,0x04,
+ 0x18,0x00,0x00,0x0c,0x00,0x01,0x80,0x04,0x28,0x00,0x00,0x0a,0x00,0x02,0x40,
+ 0x04,0x48,0x00,0x00,0x09,0x00,0x02,0x40,0x02,0x80,0x00,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x01,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x02,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x04,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x08,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x10,0x04,0x00,0x00,0x04,0x20,0x02,0x00,0x20,0x02,
+ 0x00,0x00,0x04,0x20,0x01,0x00,0x40,0x01,0x00,0x00,0x04,0x20,0x01,0x00,0x80,
+ 0x00,0x00,0x00,0x04,0x20,0x01,0x00,0x40,0x01,0x00,0x00,0x04,0x20,0x01,0x00,
+ 0x20,0x02,0x00,0x00,0x08,0x20,0x01,0x00,0x10,0x04,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x08,0x08,0x00,0x00,0x08,0x10,0x01,0x00,0x04,0x10,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x02,0x20,0x00,0x00,0x08,0x90,0x00,0x00,0x01,0x40,0x00,0x00,0x08,
+ 0x90,0x00,0x80,0x00,0x80,0x00,0x00,0x10,0x90,0x00,0x48,0x00,0x00,0x09,0x00,
+ 0x10,0x90,0x00,0x28,0x00,0x00,0x0a,0x00,0x10,0x88,0x00,0x18,0x00,0x00,0x0c,
+ 0x00,0x10,0x48,0x00,0x78,0x00,0x00,0x0f,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/goldRW.xbm b/xshogi/new_western_bitmaps/goldRW.xbm
new file mode 100644
index 0000000..a7b9000
--- /dev/null
+++ b/xshogi/new_western_bitmaps/goldRW.xbm
@@ -0,0 +1,38 @@
+#define goldRW_width 64
+#define goldRW_height 64
+static char goldRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,
+ 0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,
+ 0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,
+ 0x00,0x10,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x88,0x00,0x00,0x00,0x01,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x90,0x00,0x00,0x00,
+ 0x01,0x00,0x00,0x10,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x90,0x00,0x00,
+ 0x00,0x01,0x00,0x00,0x08,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x08,0x10,0x01,
+ 0xf0,0xff,0xff,0x1f,0x00,0x08,0x10,0x01,0x00,0x80,0x03,0x00,0x00,0x08,0x20,
+ 0x01,0x00,0x40,0x05,0x00,0x00,0x08,0x20,0x01,0x00,0x20,0x09,0x00,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x11,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x21,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x41,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x81,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x01,0x01,0x00,0x04,0x40,0x02,0x80,0x00,0x01,
+ 0x02,0x00,0x04,0x40,0x02,0x40,0x00,0x01,0x04,0x00,0x02,0x40,0x02,0x20,0x00,
+ 0x01,0x08,0x00,0x02,0x40,0x02,0x10,0x00,0x01,0x10,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,0xc0,0x03,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x40,0x04,0x00,0x00,0x01,0x80,0x08,0x00,0x40,0x04,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0xc0,0x05,0x00,0x00,0x01,0x00,0x09,0x00,0x00,0x04,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x00,0x04,0x00,0x80,0x00,0x00,0x09,0x00,0xc0,0x03,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x00,
+ 0x00,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/goldW.xbm b/xshogi/new_western_bitmaps/goldW.xbm
new file mode 100644
index 0000000..94b21e8
--- /dev/null
+++ b/xshogi/new_western_bitmaps/goldW.xbm
@@ -0,0 +1,38 @@
+#define goldW_width 64
+#define goldW_height 64
+static char goldW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0x00,0x00,0x00,0x4f,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xc0,0x03,0x00,0x80,0x00,0x00,0x11,0x00,0x20,0x00,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x20,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0xa0,0x03,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x02,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0xc0,0x03,0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x08,0x80,0x00,0x08,0x00,0x01,0x80,0x04,
+ 0x10,0x80,0x00,0x04,0x00,0x01,0x80,0x04,0x20,0x80,0x00,0x02,0x00,0x02,0x40,
+ 0x04,0x40,0x80,0x00,0x01,0x00,0x02,0x40,0x02,0x80,0x80,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x81,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x82,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x84,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x88,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x90,0x04,0x00,0x00,0x04,0x20,0x02,0x00,0xa0,0x02,
+ 0x00,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0xf8,0xff,
+ 0xff,0x0f,0x00,0x04,0x20,0x01,0x00,0x80,0x00,0x00,0x00,0x04,0x20,0x01,0x00,
+ 0x80,0x00,0x00,0x00,0x08,0x20,0x01,0x00,0x80,0x00,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x80,0x00,0x00,0x00,0x08,0x10,0x01,0x00,0x80,0x00,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x80,0x00,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x08,
+ 0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x90,0x00,0x00,0x80,0x00,0x00,0x00,
+ 0x10,0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x88,0x00,0x00,0x80,0x00,0x00,
+ 0x00,0x10,0x48,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/kingRW.xbm b/xshogi/new_western_bitmaps/kingRW.xbm
new file mode 100644
index 0000000..6e10dba
--- /dev/null
+++ b/xshogi/new_western_bitmaps/kingRW.xbm
@@ -0,0 +1,38 @@
+#define kingRW_width 64
+#define kingRW_height 64
+static char kingRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x10,0x00,0x01,0x10,0x00,0x20,
+ 0x48,0x00,0x20,0x00,0x01,0x08,0x00,0x20,0x48,0x00,0x40,0x00,0x01,0x04,0x00,
+ 0x20,0x48,0x00,0x80,0x00,0x01,0x02,0x00,0x20,0x48,0x00,0x00,0x01,0x01,0x01,
+ 0x00,0x10,0x48,0x00,0x00,0x02,0x81,0x00,0x00,0x10,0x88,0x00,0x00,0x04,0x41,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x08,0x21,0x00,0x00,0x10,0x90,0x00,0x00,0x10,
+ 0x11,0x00,0x00,0x10,0x90,0x00,0x00,0x20,0x09,0x00,0x00,0x10,0x90,0x00,0x00,
+ 0x40,0x05,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x03,0x00,0x00,0x08,0x10,0x01,
+ 0xf0,0xff,0xff,0x1f,0x00,0x08,0x10,0x01,0x00,0x80,0x03,0x00,0x00,0x08,0x20,
+ 0x01,0x00,0x40,0x05,0x00,0x00,0x08,0x20,0x01,0x00,0x20,0x09,0x00,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x11,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x21,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x41,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x81,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x01,0x01,0x00,0x04,0x40,0x02,0x80,0x00,0x01,
+ 0x02,0x00,0x04,0x40,0x02,0x40,0x00,0x01,0x04,0x00,0x02,0x40,0x02,0x20,0x00,
+ 0x01,0x08,0x00,0x02,0x40,0x02,0x10,0x00,0x01,0x10,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x40,0x04,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x80,0x04,0x00,0x00,0x01,0x80,0x08,0x00,0x00,0x05,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x00,0x06,0x00,0x00,0x01,0x00,0x09,0x00,0x00,0x05,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x80,0x04,0x00,0x80,0x00,0x00,0x09,0x00,0x40,0x04,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x00,
+ 0x00,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/kingW.xbm b/xshogi/new_western_bitmaps/kingW.xbm
new file mode 100644
index 0000000..e26cb7f
--- /dev/null
+++ b/xshogi/new_western_bitmaps/kingW.xbm
@@ -0,0 +1,38 @@
+#define kingW_width 64
+#define kingW_height 64
+static char kingW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0x00,0x00,0x00,0x4f,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x11,0x00,0x20,0x01,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0xa0,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x60,0x00,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0xa0,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x01,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x08,0x80,0x00,0x08,0x00,0x01,0x80,0x04,
+ 0x10,0x80,0x00,0x04,0x00,0x01,0x80,0x04,0x20,0x80,0x00,0x02,0x00,0x02,0x40,
+ 0x04,0x40,0x80,0x00,0x01,0x00,0x02,0x40,0x02,0x80,0x80,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x81,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x82,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x84,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x88,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x90,0x04,0x00,0x00,0x04,0x20,0x02,0x00,0xa0,0x02,
+ 0x00,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0xf8,0xff,
+ 0xff,0x0f,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0x00,
+ 0xa0,0x02,0x00,0x00,0x08,0x20,0x01,0x00,0x90,0x04,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x88,0x08,0x00,0x00,0x08,0x10,0x01,0x00,0x84,0x10,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x82,0x20,0x00,0x00,0x08,0x90,0x00,0x00,0x81,0x40,0x00,0x00,0x08,
+ 0x90,0x00,0x80,0x80,0x80,0x00,0x00,0x10,0x90,0x00,0x40,0x80,0x00,0x01,0x00,
+ 0x10,0x90,0x00,0x20,0x80,0x00,0x02,0x00,0x10,0x88,0x00,0x10,0x80,0x00,0x04,
+ 0x00,0x10,0x48,0x00,0x08,0x80,0x00,0x08,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/knightPRW.xbm b/xshogi/new_western_bitmaps/knightPRW.xbm
new file mode 100644
index 0000000..2c242ec
--- /dev/null
+++ b/xshogi/new_western_bitmaps/knightPRW.xbm
@@ -0,0 +1,46 @@
+#define knightPRW_width 64
+#define knightPRW_height 64
+static unsigned char knightPRW_bits[] = {
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+   0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+   0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+   0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x01, 0x00, 0x80, 0x00,
+   0x20, 0x02, 0x00, 0x00, 0x01, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+   0x01, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x01, 0x00, 0x80, 0x00,
+   0x20, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00, 0x20, 0x04, 0x00, 0x00,
+   0x01, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00,
+   0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00,
+   0x01, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00,
+   0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x00,
+   0x01, 0x00, 0x20, 0x00, 0x80, 0x08, 0xf0, 0xff, 0xff, 0x1f, 0x20, 0x00,
+   0x80, 0x08, 0x00, 0x80, 0x03, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x40,
+   0x05, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x20, 0x09, 0x00, 0x20, 0x00,
+   0x80, 0x08, 0x00, 0x10, 0x11, 0x00, 0x20, 0x00, 0x80, 0x10, 0x00, 0x08,
+   0x21, 0x00, 0x10, 0x00, 0x80, 0x10, 0x00, 0x04, 0x41, 0x00, 0x10, 0x00,
+   0x00, 0x11, 0x00, 0x02, 0x81, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x01,
+   0x01, 0x01, 0x10, 0x00, 0x00, 0x11, 0x80, 0x00, 0x01, 0x02, 0x10, 0x00,
+   0x00, 0x11, 0x40, 0x00, 0x01, 0x04, 0x10, 0x00, 0x00, 0x11, 0x20, 0x00,
+   0x01, 0x08, 0x10, 0x00, 0x00, 0x21, 0x10, 0x00, 0x01, 0x10, 0x08, 0x00,
+   0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00,
+   0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00,
+   0x00, 0x22, 0x00, 0xc0, 0x07, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0x20,
+   0x08, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0x50, 0x14, 0x00, 0x08, 0x00,
+   0x00, 0x48, 0x00, 0xc8, 0x24, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0xc8,
+   0x25, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x48, 0x25, 0x00, 0x04, 0x00,
+   0x00, 0x60, 0x00, 0x48, 0x27, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x48,
+   0x26, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x50, 0x14, 0xc0, 0x01, 0x00,
+   0x00, 0x00, 0x38, 0x20, 0x08, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0xc1,
+   0x07, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+   0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 };
diff --git a/xshogi/new_western_bitmaps/knightPW.xbm b/xshogi/new_western_bitmaps/knightPW.xbm
new file mode 100644
index 0000000..2b5a607
--- /dev/null
+++ b/xshogi/new_western_bitmaps/knightPW.xbm
@@ -0,0 +1,46 @@
+#define knightPW_width 64
+#define knightPW_height 64
+static unsigned char knightPW_bits[] = {
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x01, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x4f, 0x0e, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x80,
+   0x70, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0f, 0xc0, 0x81, 0x03, 0x00, 0x00,
+   0x00, 0xf0, 0x00, 0x38, 0x0e, 0x1c, 0x00, 0x00, 0x00, 0x08, 0x00, 0x07,
+   0x70, 0x60, 0x00, 0x00, 0x00, 0x0c, 0xe0, 0xe0, 0x83, 0x83, 0x00, 0x00,
+   0x00, 0x14, 0x1c, 0x10, 0x04, 0x1c, 0x01, 0x00, 0x00, 0x94, 0x03, 0x28,
+   0x0a, 0xe0, 0x01, 0x00, 0x00, 0x64, 0x00, 0x64, 0x12, 0x00, 0x03, 0x00,
+   0x00, 0x22, 0x00, 0xe4, 0x12, 0x00, 0x02, 0x00, 0x00, 0x22, 0x00, 0xa4,
+   0x12, 0x00, 0x02, 0x00, 0x00, 0x22, 0x00, 0xa4, 0x13, 0x00, 0x02, 0x00,
+   0x00, 0x22, 0x00, 0x24, 0x13, 0x00, 0x02, 0x00, 0x00, 0x12, 0x00, 0x28,
+   0x0a, 0x00, 0x04, 0x00, 0x00, 0x12, 0x00, 0x10, 0x04, 0x00, 0x04, 0x00,
+   0x00, 0x11, 0x00, 0xe0, 0x03, 0x00, 0x04, 0x00, 0x00, 0x11, 0x00, 0x00,
+   0x00, 0x00, 0x04, 0x00, 0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00,
+   0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x11, 0x08, 0x80,
+   0x00, 0x08, 0x04, 0x00, 0x00, 0x09, 0x10, 0x80, 0x00, 0x04, 0x08, 0x00,
+   0x80, 0x08, 0x20, 0x80, 0x00, 0x02, 0x08, 0x00, 0x80, 0x08, 0x40, 0x80,
+   0x00, 0x01, 0x08, 0x00, 0x80, 0x08, 0x80, 0x80, 0x80, 0x00, 0x08, 0x00,
+   0x80, 0x08, 0x00, 0x81, 0x40, 0x00, 0x08, 0x00, 0x80, 0x08, 0x00, 0x82,
+   0x20, 0x00, 0x08, 0x00, 0x80, 0x08, 0x00, 0x84, 0x10, 0x00, 0x08, 0x00,
+   0x40, 0x04, 0x00, 0x88, 0x08, 0x00, 0x10, 0x00, 0x40, 0x04, 0x00, 0x90,
+   0x04, 0x00, 0x10, 0x00, 0x40, 0x04, 0x00, 0xa0, 0x02, 0x00, 0x10, 0x00,
+   0x40, 0x04, 0x00, 0xc0, 0x01, 0x00, 0x10, 0x00, 0x40, 0x04, 0xf8, 0xff,
+   0xff, 0x0f, 0x10, 0x00, 0x40, 0x04, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00,
+   0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80,
+   0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00,
+   0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80,
+   0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00,
+   0x10, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x10, 0x01, 0x00, 0x80,
+   0x00, 0x00, 0x40, 0x00, 0x10, 0x01, 0x00, 0x80, 0x00, 0x00, 0x40, 0x00,
+   0x10, 0x01, 0x00, 0x80, 0x00, 0x00, 0x40, 0x00, 0x10, 0x01, 0x00, 0x80,
+   0x00, 0x00, 0x40, 0x00, 0x20, 0x01, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00,
+   0x20, 0x01, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x20, 0x01, 0x00, 0x00,
+   0x00, 0x00, 0x40, 0x00, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0xc0, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0xc0, 0x00, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 };
diff --git a/xshogi/new_western_bitmaps/knightRW.xbm b/xshogi/new_western_bitmaps/knightRW.xbm
new file mode 100644
index 0000000..7d95e5a
--- /dev/null
+++ b/xshogi/new_western_bitmaps/knightRW.xbm
@@ -0,0 +1,46 @@
+#define knightRW_width 64
+#define knightRW_height 64
+static unsigned char knightRW_bits[] = {
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+   0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+   0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+   0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+   0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x01, 0x00, 0x80, 0x00,
+   0x20, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00, 0x20, 0x04, 0x00, 0x00,
+   0x01, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00,
+   0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00,
+   0x01, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00,
+   0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x00,
+   0x01, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0x01, 0x00, 0x20, 0x00,
+   0x80, 0x08, 0x00, 0x00, 0x01, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00,
+   0x01, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0x01, 0x00, 0x20, 0x00,
+   0x80, 0x08, 0x00, 0x00, 0x01, 0x00, 0x20, 0x00, 0x80, 0x10, 0x00, 0x00,
+   0x01, 0x00, 0x10, 0x00, 0x80, 0x10, 0x00, 0x80, 0x02, 0x00, 0x10, 0x00,
+   0x00, 0x11, 0x00, 0x80, 0x02, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x40,
+   0x04, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x20, 0x08, 0x00, 0x10, 0x00,
+   0x00, 0x11, 0x00, 0x10, 0x10, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x0f,
+   0xe0, 0x00, 0x10, 0x00, 0x00, 0x21, 0xf0, 0x00, 0x00, 0x0f, 0x08, 0x00,
+   0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00,
+   0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00,
+   0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0x00,
+   0x00, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0x40, 0x04, 0x00, 0x08, 0x00,
+   0x00, 0x48, 0x00, 0xc0, 0x04, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0xc0,
+   0x05, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x40, 0x05, 0x00, 0x04, 0x00,
+   0x00, 0x60, 0x00, 0x40, 0x07, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x40,
+   0x06, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x40, 0x04, 0xc0, 0x01, 0x00,
+   0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+   0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+   0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 };
diff --git a/xshogi/new_western_bitmaps/knightW.xbm b/xshogi/new_western_bitmaps/knightW.xbm
new file mode 100644
index 0000000..cbec507
--- /dev/null
+++ b/xshogi/new_western_bitmaps/knightW.xbm
@@ -0,0 +1,46 @@
+#define knightW_width 64
+#define knightW_height 64
+static unsigned char knightW_bits[] = {
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x01, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x4f, 0x0e, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x80,
+   0x70, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0f, 0xc0, 0x81, 0x03, 0x00, 0x00,
+   0x00, 0xf0, 0x00, 0x38, 0x0e, 0x1c, 0x00, 0x00, 0x00, 0x08, 0x00, 0x07,
+   0x70, 0x60, 0x00, 0x00, 0x00, 0x0c, 0xe0, 0x00, 0x80, 0x83, 0x00, 0x00,
+   0x00, 0x14, 0x1c, 0x00, 0x00, 0x1c, 0x01, 0x00, 0x00, 0x94, 0x03, 0x20,
+   0x02, 0xe0, 0x01, 0x00, 0x00, 0x64, 0x00, 0x60, 0x02, 0x00, 0x03, 0x00,
+   0x00, 0x22, 0x00, 0xe0, 0x02, 0x00, 0x02, 0x00, 0x00, 0x22, 0x00, 0xa0,
+   0x02, 0x00, 0x02, 0x00, 0x00, 0x22, 0x00, 0xa0, 0x03, 0x00, 0x02, 0x00,
+   0x00, 0x22, 0x00, 0x20, 0x03, 0x00, 0x02, 0x00, 0x00, 0x12, 0x00, 0x20,
+   0x02, 0x00, 0x04, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00,
+   0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x11, 0x00, 0x00,
+   0x00, 0x00, 0x04, 0x00, 0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00,
+   0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x11, 0xf0, 0x00,
+   0x00, 0x0f, 0x04, 0x00, 0x00, 0x09, 0x00, 0x07, 0xf0, 0x00, 0x08, 0x00,
+   0x80, 0x08, 0x00, 0x08, 0x08, 0x00, 0x08, 0x00, 0x80, 0x08, 0x00, 0x10,
+   0x04, 0x00, 0x08, 0x00, 0x80, 0x08, 0x00, 0x20, 0x02, 0x00, 0x08, 0x00,
+   0x80, 0x08, 0x00, 0x40, 0x01, 0x00, 0x08, 0x00, 0x80, 0x08, 0x00, 0x40,
+   0x01, 0x00, 0x08, 0x00, 0x80, 0x08, 0x00, 0x80, 0x00, 0x00, 0x08, 0x00,
+   0x40, 0x04, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x40, 0x04, 0x00, 0x80,
+   0x00, 0x00, 0x10, 0x00, 0x40, 0x04, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00,
+   0x40, 0x04, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x40, 0x04, 0x00, 0x80,
+   0x00, 0x00, 0x10, 0x00, 0x40, 0x04, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00,
+   0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80,
+   0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00,
+   0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80,
+   0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00,
+   0x10, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x10, 0x01, 0x00, 0x80,
+   0x00, 0x00, 0x40, 0x00, 0x10, 0x01, 0x00, 0x80, 0x00, 0x00, 0x40, 0x00,
+   0x10, 0x01, 0x00, 0x80, 0x00, 0x00, 0x40, 0x00, 0x10, 0x01, 0x00, 0x80,
+   0x00, 0x00, 0x40, 0x00, 0x20, 0x01, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00,
+   0x20, 0x01, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x20, 0x01, 0x00, 0x00,
+   0x00, 0x00, 0x40, 0x00, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0xc0, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0xc0, 0x00, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 };
diff --git a/xshogi/new_western_bitmaps/lancePRW.xbm b/xshogi/new_western_bitmaps/lancePRW.xbm
new file mode 100644
index 0000000..c485d91
--- /dev/null
+++ b/xshogi/new_western_bitmaps/lancePRW.xbm
@@ -0,0 +1,38 @@
+#define lancePRW_width 64
+#define lancePRW_height 64
+static char lancePRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf8,0xff,0xff,0xff,0xff,0xff,
+ 0x3f,0x00,0x18,0x00,0x00,0x00,0x00,0x00,0x40,0x00,0x28,0x00,0x00,0x00,0x00,
+ 0x00,0x80,0x00,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x01,0x90,0xff,0xff,0xff,
+ 0xff,0xff,0xff,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x02,
+ 0x00,0x00,0x00,0x00,0x80,0x00,0x10,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x01,0x00,0x80,0x00,
+ 0x20,0x02,0x00,0x00,0x01,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x01,0x00,0x80,
+ 0x00,0x20,0x02,0x00,0x00,0x01,0x00,0x80,0x00,0x20,0x04,0x00,0x00,0x01,0x00,
+ 0x40,0x00,0x20,0x04,0x00,0x00,0x01,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x01,
+ 0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x01,0x00,0x40,0x00,0x40,0x04,0x00,0x00,
+ 0x01,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x01,0x00,0x40,0x00,0x40,0x04,0x00,
+ 0x00,0x01,0x00,0x40,0x00,0x40,0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x08,
+ 0xf0,0xff,0xff,0x1f,0x20,0x00,0x80,0x08,0x00,0x80,0x03,0x00,0x20,0x00,0x80,
+ 0x08,0x00,0x40,0x05,0x00,0x20,0x00,0x80,0x08,0x00,0x20,0x09,0x00,0x20,0x00,
+ 0x80,0x08,0x00,0x10,0x11,0x00,0x20,0x00,0x80,0x10,0x00,0x08,0x21,0x00,0x10,
+ 0x00,0x80,0x10,0x00,0x04,0x41,0x00,0x10,0x00,0x00,0x11,0x00,0x02,0x81,0x00,
+ 0x10,0x00,0x00,0x11,0x00,0x01,0x01,0x01,0x10,0x00,0x00,0x11,0x80,0x00,0x01,
+ 0x02,0x10,0x00,0x00,0x11,0x40,0x00,0x01,0x04,0x10,0x00,0x00,0x11,0x20,0x00,
+ 0x01,0x08,0x10,0x00,0x00,0x21,0x10,0x00,0x01,0x10,0x08,0x00,0x00,0x22,0x00,
+ 0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,
+ 0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0xc0,0x07,0x00,0x08,0x00,0x00,
+ 0x24,0x00,0x20,0x08,0x00,0x08,0x00,0x00,0x28,0x00,0xd0,0x17,0x00,0x08,0x00,
+ 0x00,0x48,0x00,0x08,0x24,0x00,0x04,0x00,0x00,0x50,0x00,0x08,0x24,0x00,0x04,
+ 0x00,0x00,0x50,0x00,0x08,0x24,0x00,0x04,0x00,0x00,0x60,0x00,0x08,0x24,0x00,
+ 0x04,0x00,0x00,0xc0,0x00,0x08,0x24,0x00,0x06,0x00,0x00,0x00,0x07,0x10,0x14,
+ 0xc0,0x01,0x00,0x00,0x00,0x38,0x20,0x08,0x38,0x00,0x00,0x00,0x00,0xc0,0xc1,
+ 0x07,0x07,0x00,0x00,0x00,0x00,0x00,0x0e,0xe0,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x70,0x1c,0x00,0x00,0x00,0x00,0x00,0x00,0x80,0x03,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/lancePW.xbm b/xshogi/new_western_bitmaps/lancePW.xbm
new file mode 100644
index 0000000..8583612
--- /dev/null
+++ b/xshogi/new_western_bitmaps/lancePW.xbm
@@ -0,0 +1,38 @@
+#define lancePW_width 64
+#define lancePW_height 64
+static char lancePW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0xe0,0x83,0x83,0x00,0x00,0x00,0x14,0x1c,0x10,0x04,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x28,0x08,0xe0,0x01,0x00,0x00,0x64,0x00,0x24,0x10,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x24,0x10,0x00,0x02,0x00,0x00,0x22,0x00,0x24,0x10,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x24,0x10,0x00,0x02,0x00,0x00,0x22,0x00,0x24,0x10,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0xe8,0x0b,0x00,0x04,0x00,0x00,0x12,0x00,0x10,0x04,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0xe0,0x03,0x00,0x04,0x00,0x00,0x11,0x00,0x00,
+ 0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x08,0x80,0x00,0x08,0x04,0x00,0x00,0x09,
+ 0x10,0x80,0x00,0x04,0x08,0x00,0x80,0x08,0x20,0x80,0x00,0x02,0x08,0x00,0x80,
+ 0x08,0x40,0x80,0x00,0x01,0x08,0x00,0x80,0x08,0x80,0x80,0x80,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x81,0x40,0x00,0x08,0x00,0x80,0x08,0x00,0x82,0x20,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x84,0x10,0x00,0x08,0x00,0x40,0x04,0x00,0x88,0x08,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0x90,0x04,0x00,0x10,0x00,0x40,0x04,0x00,0xa0,0x02,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0xc0,0x01,0x00,0x10,0x00,0x40,0x04,0xf8,0xff,
+ 0xff,0x0f,0x10,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0x80,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x80,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0x80,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/lanceRW.xbm b/xshogi/new_western_bitmaps/lanceRW.xbm
new file mode 100644
index 0000000..f4cb354
--- /dev/null
+++ b/xshogi/new_western_bitmaps/lanceRW.xbm
@@ -0,0 +1,38 @@
+#define lanceRW_width 64
+#define lanceRW_height 64
+static char lanceRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf8,0xff,0xff,0xff,0xff,0xff,
+ 0x3f,0x00,0x18,0x00,0x00,0x00,0x00,0x00,0x40,0x00,0x28,0x00,0x00,0x00,0x00,
+ 0x00,0x80,0x00,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x01,0x90,0xff,0xff,0xff,
+ 0xff,0xff,0xff,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x02,
+ 0x00,0x00,0x00,0x00,0x80,0x00,0x10,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x80,0x00,
+ 0x20,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x80,
+ 0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x04,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x20,0x04,0x00,0x00,0x00,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x00,0x00,0x40,0x00,0x40,0x04,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x00,0x00,0x40,0x00,0x40,0x04,0x00,
+ 0x00,0x00,0x00,0x40,0x00,0x40,0x08,0x00,0x00,0x00,0x00,0x20,0x00,0x80,0x08,
+ 0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,
+ 0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x08,0x00,0x00,0x01,0x00,0x20,0x00,
+ 0x80,0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x10,0x00,0x00,0x01,0x00,0x10,
+ 0x00,0x80,0x10,0x00,0x00,0x01,0x00,0x10,0x00,0x00,0x11,0x00,0x00,0x01,0x00,
+ 0x10,0x00,0x00,0x11,0x00,0x00,0x01,0x00,0x10,0x00,0x00,0x11,0x00,0x20,0x09,
+ 0x00,0x10,0x00,0x00,0x11,0x00,0xc0,0x07,0x00,0x10,0x00,0x00,0x11,0x00,0x80,
+ 0x03,0x00,0x10,0x00,0x00,0x21,0x00,0x00,0x01,0x00,0x08,0x00,0x00,0x22,0x00,
+ 0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,
+ 0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x08,0x00,0x00,
+ 0x24,0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x28,0x00,0xc0,0x07,0x00,0x08,0x00,
+ 0x00,0x48,0x00,0x00,0x04,0x00,0x04,0x00,0x00,0x50,0x00,0x00,0x04,0x00,0x04,
+ 0x00,0x00,0x50,0x00,0x00,0x04,0x00,0x04,0x00,0x00,0x60,0x00,0x00,0x04,0x00,
+ 0x04,0x00,0x00,0xc0,0x00,0x00,0x04,0x00,0x06,0x00,0x00,0x00,0x07,0x00,0x04,
+ 0xc0,0x01,0x00,0x00,0x00,0x38,0x00,0x00,0x38,0x00,0x00,0x00,0x00,0xc0,0x01,
+ 0x00,0x07,0x00,0x00,0x00,0x00,0x00,0x0e,0xe0,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x70,0x1c,0x00,0x00,0x00,0x00,0x00,0x00,0x80,0x03,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/lanceW.xbm b/xshogi/new_western_bitmaps/lanceW.xbm
new file mode 100644
index 0000000..41e0d73
--- /dev/null
+++ b/xshogi/new_western_bitmaps/lanceW.xbm
@@ -0,0 +1,38 @@
+#define lanceW_width 64
+#define lanceW_height 64
+static char lanceW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x20,0x00,0xe0,0x01,0x00,0x00,0x64,0x00,0x20,0x00,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x20,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x20,0x00,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x20,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x20,0x00,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0xe0,0x03,0x00,0x04,0x00,0x00,0x12,0x00,0x00,0x00,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,
+ 0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x80,0x00,0x00,0x04,0x00,0x00,0x09,
+ 0x00,0xc0,0x01,0x00,0x08,0x00,0x80,0x08,0x00,0xe0,0x03,0x00,0x08,0x00,0x80,
+ 0x08,0x00,0x90,0x04,0x00,0x08,0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x40,0x04,0x00,0x80,0x00,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x80,0x00,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x80,
+ 0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x00,0x00,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/noneW.xbm b/xshogi/new_western_bitmaps/noneW.xbm
new file mode 100644
index 0000000..d7658e6
--- /dev/null
+++ b/xshogi/new_western_bitmaps/noneW.xbm
@@ -0,0 +1,38 @@
+#define noneW_width 64
+#define noneW_height 64
+static char noneW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/pawnPRW.xbm b/xshogi/new_western_bitmaps/pawnPRW.xbm
new file mode 100644
index 0000000..073c122
--- /dev/null
+++ b/xshogi/new_western_bitmaps/pawnPRW.xbm
@@ -0,0 +1,38 @@
+#define pawnPRW_width 64
+#define pawnPRW_height 64
+static char pawnPRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf8,0xff,0xff,0xff,0xff,0xff,
+ 0x3f,0x00,0x18,0x00,0x00,0x00,0x00,0x00,0x40,0x00,0x28,0x00,0x00,0x00,0x00,
+ 0x00,0x80,0x00,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x01,0x90,0xff,0xff,0xff,
+ 0xff,0xff,0xff,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x02,
+ 0x00,0x00,0x00,0x00,0x80,0x00,0x10,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x01,0x00,0x80,0x00,
+ 0x20,0x02,0x00,0x00,0x01,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x01,0x00,0x80,
+ 0x00,0x20,0x02,0x00,0x00,0x01,0x00,0x80,0x00,0x20,0x04,0x00,0x00,0x01,0x00,
+ 0x40,0x00,0x20,0x04,0x00,0x00,0x01,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x01,
+ 0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x01,0x00,0x40,0x00,0x40,0x04,0x00,0x00,
+ 0x01,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x01,0x00,0x40,0x00,0x40,0x04,0x00,
+ 0x00,0x01,0x00,0x40,0x00,0x40,0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x08,
+ 0xf0,0xff,0xff,0x1f,0x20,0x00,0x80,0x08,0x00,0x80,0x03,0x00,0x20,0x00,0x80,
+ 0x08,0x00,0x40,0x05,0x00,0x20,0x00,0x80,0x08,0x00,0x20,0x09,0x00,0x20,0x00,
+ 0x80,0x08,0x00,0x10,0x11,0x00,0x20,0x00,0x80,0x10,0x00,0x08,0x21,0x00,0x10,
+ 0x00,0x80,0x10,0x00,0x04,0x41,0x00,0x10,0x00,0x00,0x11,0x00,0x02,0x81,0x00,
+ 0x10,0x00,0x00,0x11,0x00,0x01,0x01,0x01,0x10,0x00,0x00,0x11,0x80,0x00,0x01,
+ 0x02,0x10,0x00,0x00,0x11,0x40,0x00,0x01,0x04,0x10,0x00,0x00,0x11,0x20,0x00,
+ 0x01,0x08,0x10,0x00,0x00,0x21,0x10,0x00,0x01,0x10,0x08,0x00,0x00,0x22,0x00,
+ 0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,
+ 0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0xc0,0x07,0x00,0x08,0x00,0x00,
+ 0x24,0x00,0x20,0x08,0x00,0x08,0x00,0x00,0x28,0x00,0x10,0x14,0x00,0x08,0x00,
+ 0x00,0x48,0x00,0x08,0x24,0x00,0x04,0x00,0x00,0x50,0x00,0x08,0x24,0x00,0x04,
+ 0x00,0x00,0x50,0x00,0x88,0x27,0x00,0x04,0x00,0x00,0x60,0x00,0x48,0x24,0x00,
+ 0x04,0x00,0x00,0xc0,0x00,0x48,0x24,0x00,0x06,0x00,0x00,0x00,0x07,0x90,0x17,
+ 0xc0,0x01,0x00,0x00,0x00,0x38,0x20,0x08,0x38,0x00,0x00,0x00,0x00,0xc0,0xc1,
+ 0x07,0x07,0x00,0x00,0x00,0x00,0x00,0x0e,0xe0,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x70,0x1c,0x00,0x00,0x00,0x00,0x00,0x00,0x80,0x03,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/pawnPW.xbm b/xshogi/new_western_bitmaps/pawnPW.xbm
new file mode 100644
index 0000000..b5bfc85
--- /dev/null
+++ b/xshogi/new_western_bitmaps/pawnPW.xbm
@@ -0,0 +1,38 @@
+#define pawnPW_width 64
+#define pawnPW_height 64
+static char pawnPW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0xe0,0x83,0x83,0x00,0x00,0x00,0x14,0x1c,0x10,0x04,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0xe8,0x09,0xe0,0x01,0x00,0x00,0x64,0x00,0x24,0x12,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x24,0x12,0x00,0x02,0x00,0x00,0x22,0x00,0xe4,0x11,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x24,0x10,0x00,0x02,0x00,0x00,0x22,0x00,0x24,0x10,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0x28,0x08,0x00,0x04,0x00,0x00,0x12,0x00,0x10,0x04,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0xe0,0x03,0x00,0x04,0x00,0x00,0x11,0x00,0x00,
+ 0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x08,0x80,0x00,0x08,0x04,0x00,0x00,0x09,
+ 0x10,0x80,0x00,0x04,0x08,0x00,0x80,0x08,0x20,0x80,0x00,0x02,0x08,0x00,0x80,
+ 0x08,0x40,0x80,0x00,0x01,0x08,0x00,0x80,0x08,0x80,0x80,0x80,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x81,0x40,0x00,0x08,0x00,0x80,0x08,0x00,0x82,0x20,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x84,0x10,0x00,0x08,0x00,0x40,0x04,0x00,0x88,0x08,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0x90,0x04,0x00,0x10,0x00,0x40,0x04,0x00,0xa0,0x02,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0xc0,0x01,0x00,0x10,0x00,0x40,0x04,0xf8,0xff,
+ 0xff,0x0f,0x10,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0x80,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x80,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0x80,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/pawnRW.xbm b/xshogi/new_western_bitmaps/pawnRW.xbm
new file mode 100644
index 0000000..9982e12
--- /dev/null
+++ b/xshogi/new_western_bitmaps/pawnRW.xbm
@@ -0,0 +1,38 @@
+#define pawnRW_width 64
+#define pawnRW_height 64
+static char pawnRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf8,0xff,0xff,0xff,0xff,0xff,
+ 0x3f,0x00,0x18,0x00,0x00,0x00,0x00,0x00,0x40,0x00,0x28,0x00,0x00,0x00,0x00,
+ 0x00,0x80,0x00,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x01,0x90,0xff,0xff,0xff,
+ 0xff,0xff,0xff,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x02,
+ 0x00,0x00,0x00,0x00,0x80,0x00,0x10,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x80,0x00,
+ 0x20,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x80,
+ 0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x04,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x20,0x04,0x00,0x00,0x00,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x00,0x00,0x40,0x00,0x40,0x04,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x00,0x00,0x40,0x00,0x40,0x04,0x00,
+ 0x00,0x00,0x00,0x40,0x00,0x40,0x08,0x00,0x00,0x00,0x00,0x20,0x00,0x80,0x08,
+ 0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,
+ 0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x08,0x00,0x00,0x01,0x00,0x20,0x00,
+ 0x80,0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x10,0x00,0x00,0x01,0x00,0x10,
+ 0x00,0x80,0x10,0x00,0x00,0x01,0x00,0x10,0x00,0x00,0x11,0x00,0x00,0x01,0x00,
+ 0x10,0x00,0x00,0x11,0x00,0x00,0x01,0x00,0x10,0x00,0x00,0x11,0x00,0x00,0x01,
+ 0x00,0x10,0x00,0x00,0x11,0x00,0x00,0x01,0x00,0x10,0x00,0x00,0x11,0x00,0x00,
+ 0x01,0x00,0x10,0x00,0x00,0x21,0x00,0x00,0x01,0x00,0x08,0x00,0x00,0x22,0x00,
+ 0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,
+ 0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x08,0x00,0x00,
+ 0x24,0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x28,0x00,0x00,0x04,0x00,0x08,0x00,
+ 0x00,0x48,0x00,0x00,0x04,0x00,0x04,0x00,0x00,0x50,0x00,0x00,0x04,0x00,0x04,
+ 0x00,0x00,0x50,0x00,0x80,0x07,0x00,0x04,0x00,0x00,0x60,0x00,0x40,0x04,0x00,
+ 0x04,0x00,0x00,0xc0,0x00,0x40,0x04,0x00,0x06,0x00,0x00,0x00,0x07,0x80,0x07,
+ 0xc0,0x01,0x00,0x00,0x00,0x38,0x00,0x00,0x38,0x00,0x00,0x00,0x00,0xc0,0x01,
+ 0x00,0x07,0x00,0x00,0x00,0x00,0x00,0x0e,0xe0,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x70,0x1c,0x00,0x00,0x00,0x00,0x00,0x00,0x80,0x03,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/pawnW.xbm b/xshogi/new_western_bitmaps/pawnW.xbm
new file mode 100644
index 0000000..f5796c7
--- /dev/null
+++ b/xshogi/new_western_bitmaps/pawnW.xbm
@@ -0,0 +1,38 @@
+#define pawnW_width 64
+#define pawnW_height 64
+static char pawnW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0xe0,0x01,0xe0,0x01,0x00,0x00,0x64,0x00,0x20,0x02,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x20,0x02,0x00,0x02,0x00,0x00,0x22,0x00,0xe0,0x01,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x20,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x20,0x00,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0x20,0x00,0x00,0x04,0x00,0x00,0x12,0x00,0x00,0x00,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,
+ 0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x80,0x00,0x00,0x04,0x00,0x00,0x09,
+ 0x00,0x80,0x00,0x00,0x08,0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x80,
+ 0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x40,0x04,0x00,0x80,0x00,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x80,0x00,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x80,
+ 0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x00,0x00,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/rookPRW.xbm b/xshogi/new_western_bitmaps/rookPRW.xbm
new file mode 100644
index 0000000..018c0a7
--- /dev/null
+++ b/xshogi/new_western_bitmaps/rookPRW.xbm
@@ -0,0 +1,38 @@
+#define rookPRW_width 64
+#define rookPRW_height 64
+static char rookPRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x10,0x00,0x01,0x10,0x00,0x20,
+ 0x48,0x00,0x20,0x80,0x03,0x08,0x00,0x20,0x48,0x00,0x40,0xc0,0x07,0x04,0x00,
+ 0x20,0x48,0x00,0x80,0x20,0x09,0x02,0x00,0x20,0x48,0x00,0x00,0x01,0x01,0x01,
+ 0x00,0x10,0x48,0x00,0x00,0x02,0x81,0x00,0x00,0x10,0x88,0x00,0x00,0x04,0x41,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x08,0x21,0x00,0x00,0x10,0x90,0x00,0x00,0x10,
+ 0x11,0x00,0x00,0x10,0x90,0x00,0x80,0x20,0x09,0x02,0x00,0x10,0x90,0x00,0x40,
+ 0x40,0x05,0x04,0x00,0x08,0x90,0x00,0x60,0x80,0x03,0x0c,0x00,0x08,0x10,0x01,
+ 0xf0,0xff,0xff,0x1f,0x00,0x08,0x10,0x01,0x60,0x80,0x03,0x0c,0x00,0x08,0x20,
+ 0x01,0x40,0x40,0x05,0x04,0x00,0x08,0x20,0x01,0x80,0x20,0x09,0x02,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x11,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x21,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x41,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x81,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x01,0x01,0x00,0x04,0x40,0x02,0x80,0x20,0x09,
+ 0x02,0x00,0x04,0x40,0x02,0x40,0xc0,0x07,0x04,0x00,0x02,0x40,0x02,0x20,0x80,
+ 0x03,0x08,0x00,0x02,0x40,0x02,0x10,0x00,0x01,0x10,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0xc0,0x07,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x20,0x08,0x00,0x00,0x01,0x80,0x04,0x00,0x50,0x14,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x48,0x24,0x00,0x00,0x01,0x80,0x08,0x00,0x88,0x24,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x88,0x27,0x00,0x00,0x01,0x00,0x09,0x00,0x48,0x24,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x48,0x24,0x00,0x80,0x00,0x00,0x09,0x00,0x90,0x17,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x08,0x00,0x80,0x00,0x00,0x09,0x00,0xc0,
+ 0x07,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/rookPW.xbm b/xshogi/new_western_bitmaps/rookPW.xbm
new file mode 100644
index 0000000..b042466
--- /dev/null
+++ b/xshogi/new_western_bitmaps/rookPW.xbm
@@ -0,0 +1,38 @@
+#define rookPW_width 64
+#define rookPW_height 64
+static char rookPW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0xe0,0x03,0x00,0x4f,0x00,0x00,0x12,0x00,0x10,0x04,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xe8,0x09,0x00,0x80,0x00,0x00,0x11,0x00,0x24,0x12,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x24,0x12,0x00,0x80,0x00,0x00,0x09,0x00,0xe4,0x11,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x24,0x11,0x00,0x80,0x00,0x00,0x09,0x00,0x24,0x12,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0x28,0x0a,0x00,0x80,0x00,0x00,0x09,0x00,0x10,0x04,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0xe0,0x03,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x08,0x80,0x00,0x08,0x00,0x01,0x80,0x04,
+ 0x10,0xc0,0x01,0x04,0x00,0x01,0x80,0x04,0x20,0xe0,0x03,0x02,0x00,0x02,0x40,
+ 0x04,0x40,0x90,0x04,0x01,0x00,0x02,0x40,0x02,0x80,0x80,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x81,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x82,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x84,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x88,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x40,0x90,0x04,0x01,0x00,0x04,0x20,0x02,0x20,0xa0,0x02,
+ 0x02,0x00,0x04,0x20,0x01,0x30,0xc0,0x01,0x06,0x00,0x04,0x20,0x01,0xf8,0xff,
+ 0xff,0x0f,0x00,0x04,0x20,0x01,0x30,0xc0,0x01,0x06,0x00,0x04,0x20,0x01,0x20,
+ 0xa0,0x02,0x02,0x00,0x08,0x20,0x01,0x40,0x90,0x04,0x01,0x00,0x08,0x10,0x01,
+ 0x00,0x88,0x08,0x00,0x00,0x08,0x10,0x01,0x00,0x84,0x10,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x82,0x20,0x00,0x00,0x08,0x90,0x00,0x00,0x81,0x40,0x00,0x00,0x08,
+ 0x90,0x00,0x80,0x80,0x80,0x00,0x00,0x10,0x90,0x00,0x40,0x90,0x04,0x01,0x00,
+ 0x10,0x90,0x00,0x20,0xe0,0x03,0x02,0x00,0x10,0x88,0x00,0x10,0xc0,0x01,0x04,
+ 0x00,0x10,0x48,0x00,0x08,0x80,0x00,0x08,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/rookRW.xbm b/xshogi/new_western_bitmaps/rookRW.xbm
new file mode 100644
index 0000000..0063e60
--- /dev/null
+++ b/xshogi/new_western_bitmaps/rookRW.xbm
@@ -0,0 +1,38 @@
+#define rookRW_width 64
+#define rookRW_height 64
+static char rookRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,
+ 0x48,0x00,0x00,0x80,0x03,0x00,0x00,0x20,0x48,0x00,0x00,0xc0,0x07,0x00,0x00,
+ 0x20,0x48,0x00,0x00,0x20,0x09,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,
+ 0x00,0x10,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x88,0x00,0x00,0x00,0x01,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x90,0x00,0x00,0x00,
+ 0x01,0x00,0x00,0x10,0x90,0x00,0x80,0x00,0x01,0x02,0x00,0x10,0x90,0x00,0x40,
+ 0x00,0x01,0x04,0x00,0x08,0x90,0x00,0x60,0x00,0x01,0x0c,0x00,0x08,0x10,0x01,
+ 0xf0,0xff,0xff,0x1f,0x00,0x08,0x10,0x01,0x60,0x00,0x01,0x0c,0x00,0x08,0x20,
+ 0x01,0x40,0x00,0x01,0x04,0x00,0x08,0x20,0x01,0x80,0x00,0x01,0x02,0x00,0x08,
+ 0x20,0x01,0x00,0x00,0x01,0x00,0x00,0x04,0x20,0x01,0x00,0x00,0x01,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x00,0x01,0x00,0x00,0x04,0x20,0x02,0x00,0x00,0x01,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x00,0x01,0x00,0x00,0x04,0x40,0x02,0x00,0x20,0x09,
+ 0x00,0x00,0x04,0x40,0x02,0x00,0xc0,0x07,0x00,0x00,0x02,0x40,0x02,0x00,0x80,
+ 0x03,0x00,0x00,0x02,0x40,0x02,0x00,0x00,0x01,0x00,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x40,0x04,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x40,0x04,0x00,0x00,0x01,0x80,0x08,0x00,0x80,0x04,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x80,0x07,0x00,0x00,0x01,0x00,0x09,0x00,0x40,0x04,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x09,0x00,0x80,0x07,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x00,
+ 0x00,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/rookW.xbm b/xshogi/new_western_bitmaps/rookW.xbm
new file mode 100644
index 0000000..33d4b96
--- /dev/null
+++ b/xshogi/new_western_bitmaps/rookW.xbm
@@ -0,0 +1,38 @@
+#define rookW_width 64
+#define rookW_height 64
+static char rookW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0x00,0x00,0x00,0x4f,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xe0,0x01,0x00,0x80,0x00,0x00,0x11,0x00,0x20,0x02,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0xe0,0x01,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x20,0x01,0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x02,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x80,0x00,0x00,0x00,0x01,0x80,0x04,
+ 0x00,0xc0,0x01,0x00,0x00,0x01,0x80,0x04,0x00,0xe0,0x03,0x00,0x00,0x02,0x40,
+ 0x04,0x00,0x90,0x04,0x00,0x00,0x02,0x40,0x02,0x00,0x80,0x00,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x80,0x00,0x00,0x00,0x02,0x40,0x02,0x00,0x80,0x00,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x80,0x00,0x00,0x00,0x02,0x40,0x02,0x00,0x80,0x00,0x00,
+ 0x00,0x04,0x20,0x02,0x40,0x80,0x00,0x01,0x00,0x04,0x20,0x02,0x20,0x80,0x00,
+ 0x02,0x00,0x04,0x20,0x01,0x30,0x80,0x00,0x06,0x00,0x04,0x20,0x01,0xf8,0xff,
+ 0xff,0x0f,0x00,0x04,0x20,0x01,0x30,0x80,0x00,0x06,0x00,0x04,0x20,0x01,0x20,
+ 0x80,0x00,0x02,0x00,0x08,0x20,0x01,0x40,0x80,0x00,0x01,0x00,0x08,0x10,0x01,
+ 0x00,0x80,0x00,0x00,0x00,0x08,0x10,0x01,0x00,0x80,0x00,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x80,0x00,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x08,
+ 0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x90,0x00,0x00,0x90,0x04,0x00,0x00,
+ 0x10,0x90,0x00,0x00,0xe0,0x03,0x00,0x00,0x10,0x88,0x00,0x00,0xc0,0x01,0x00,
+ 0x00,0x10,0x48,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/silverPRW.xbm b/xshogi/new_western_bitmaps/silverPRW.xbm
new file mode 100644
index 0000000..ba25ca0
--- /dev/null
+++ b/xshogi/new_western_bitmaps/silverPRW.xbm
@@ -0,0 +1,38 @@
+#define silverPRW_width 64
+#define silverPRW_height 64
+static char silverPRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,
+ 0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,
+ 0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,
+ 0x00,0x10,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x88,0x00,0x00,0x00,0x01,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x90,0x00,0x00,0x00,
+ 0x01,0x00,0x00,0x10,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x90,0x00,0x00,
+ 0x00,0x01,0x00,0x00,0x08,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x08,0x10,0x01,
+ 0xf0,0xff,0xff,0x1f,0x00,0x08,0x10,0x01,0x00,0x80,0x03,0x00,0x00,0x08,0x20,
+ 0x01,0x00,0x40,0x05,0x00,0x00,0x08,0x20,0x01,0x00,0x20,0x09,0x00,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x11,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x21,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x41,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x81,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x01,0x01,0x00,0x04,0x40,0x02,0x80,0x00,0x01,
+ 0x02,0x00,0x04,0x40,0x02,0x40,0x00,0x01,0x04,0x00,0x02,0x40,0x02,0x20,0x00,
+ 0x01,0x08,0x00,0x02,0x40,0x02,0x10,0x00,0x01,0x10,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0xc0,0x07,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x20,0x08,0x00,0x00,0x01,0x80,0x04,0x00,0x90,0x17,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x48,0x20,0x00,0x00,0x01,0x80,0x08,0x00,0x48,0x20,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x88,0x23,0x00,0x00,0x01,0x00,0x09,0x00,0x08,0x24,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x08,0x24,0x00,0x80,0x00,0x00,0x09,0x00,0xd0,0x13,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x08,0x00,0x80,0x00,0x00,0x09,0x00,0xc0,
+ 0x07,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/silverPW.xbm b/xshogi/new_western_bitmaps/silverPW.xbm
new file mode 100644
index 0000000..e17c335
--- /dev/null
+++ b/xshogi/new_western_bitmaps/silverPW.xbm
@@ -0,0 +1,38 @@
+#define silverPW_width 64
+#define silverPW_height 64
+static char silverPW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0xe0,0x03,0x00,0x4f,0x00,0x00,0x12,0x00,0x10,0x04,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xc8,0x0b,0x00,0x80,0x00,0x00,0x11,0x00,0x24,0x10,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x24,0x10,0x00,0x80,0x00,0x00,0x09,0x00,0xc4,0x11,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x04,0x12,0x00,0x80,0x00,0x00,0x09,0x00,0x04,0x12,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0xe8,0x09,0x00,0x80,0x00,0x00,0x09,0x00,0x10,0x04,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0xe0,0x03,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x08,0x80,0x00,0x08,0x00,0x01,0x80,0x04,
+ 0x10,0x80,0x00,0x04,0x00,0x01,0x80,0x04,0x20,0x80,0x00,0x02,0x00,0x02,0x40,
+ 0x04,0x40,0x80,0x00,0x01,0x00,0x02,0x40,0x02,0x80,0x80,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x81,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x82,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x84,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x88,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x90,0x04,0x00,0x00,0x04,0x20,0x02,0x00,0xa0,0x02,
+ 0x00,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0xf8,0xff,
+ 0xff,0x0f,0x00,0x04,0x20,0x01,0x00,0x80,0x00,0x00,0x00,0x04,0x20,0x01,0x00,
+ 0x80,0x00,0x00,0x00,0x08,0x20,0x01,0x00,0x80,0x00,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x80,0x00,0x00,0x00,0x08,0x10,0x01,0x00,0x80,0x00,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x80,0x00,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x08,
+ 0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x90,0x00,0x00,0x80,0x00,0x00,0x00,
+ 0x10,0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x88,0x00,0x00,0x80,0x00,0x00,
+ 0x00,0x10,0x48,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/silverRW.xbm b/xshogi/new_western_bitmaps/silverRW.xbm
new file mode 100644
index 0000000..1e32112
--- /dev/null
+++ b/xshogi/new_western_bitmaps/silverRW.xbm
@@ -0,0 +1,38 @@
+#define silverRW_width 64
+#define silverRW_height 64
+static char silverRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x10,0x00,0x00,0x10,0x00,0x20,
+ 0x48,0x00,0x20,0x00,0x00,0x08,0x00,0x20,0x48,0x00,0x40,0x00,0x00,0x04,0x00,
+ 0x20,0x48,0x00,0x80,0x00,0x00,0x02,0x00,0x20,0x48,0x00,0x00,0x01,0x00,0x01,
+ 0x00,0x10,0x48,0x00,0x00,0x02,0x80,0x00,0x00,0x10,0x88,0x00,0x00,0x04,0x40,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x08,0x20,0x00,0x00,0x10,0x90,0x00,0x00,0x10,
+ 0x10,0x00,0x00,0x10,0x90,0x00,0x00,0x20,0x08,0x00,0x00,0x10,0x90,0x00,0x00,
+ 0x40,0x04,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x02,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x00,0x01,0x00,0x00,0x08,0x10,0x01,0x00,0x80,0x03,0x00,0x00,0x08,0x20,
+ 0x01,0x00,0x40,0x05,0x00,0x00,0x08,0x20,0x01,0x00,0x20,0x09,0x00,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x11,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x21,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x41,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x81,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x01,0x01,0x00,0x04,0x40,0x02,0x80,0x00,0x01,
+ 0x02,0x00,0x04,0x40,0x02,0x40,0x00,0x01,0x04,0x00,0x02,0x40,0x02,0x20,0x00,
+ 0x01,0x08,0x00,0x02,0x40,0x02,0x10,0x00,0x01,0x10,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x80,0x07,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x40,0x00,0x00,0x00,0x01,0x80,0x08,0x00,0x40,0x00,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x80,0x03,0x00,0x00,0x01,0x00,0x09,0x00,0x00,0x04,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x00,0x04,0x00,0x80,0x00,0x00,0x09,0x00,0xc0,0x03,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x00,
+ 0x00,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/new_western_bitmaps/silverW.xbm b/xshogi/new_western_bitmaps/silverW.xbm
new file mode 100644
index 0000000..a6642d0
--- /dev/null
+++ b/xshogi/new_western_bitmaps/silverW.xbm
@@ -0,0 +1,38 @@
+#define silverW_width 64
+#define silverW_height 64
+static char silverW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0x00,0x00,0x00,0x4f,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xc0,0x03,0x00,0x80,0x00,0x00,0x11,0x00,0x20,0x00,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x20,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0xc0,0x01,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x00,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x02,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0xe0,0x01,0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x08,0x80,0x00,0x08,0x00,0x01,0x80,0x04,
+ 0x10,0x80,0x00,0x04,0x00,0x01,0x80,0x04,0x20,0x80,0x00,0x02,0x00,0x02,0x40,
+ 0x04,0x40,0x80,0x00,0x01,0x00,0x02,0x40,0x02,0x80,0x80,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x81,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x82,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x84,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x88,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x90,0x04,0x00,0x00,0x04,0x20,0x02,0x00,0xa0,0x02,
+ 0x00,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0x00,0x80,
+ 0x00,0x00,0x00,0x04,0x20,0x01,0x00,0x40,0x01,0x00,0x00,0x04,0x20,0x01,0x00,
+ 0x20,0x02,0x00,0x00,0x08,0x20,0x01,0x00,0x10,0x04,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x08,0x08,0x00,0x00,0x08,0x10,0x01,0x00,0x04,0x10,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x02,0x20,0x00,0x00,0x08,0x90,0x00,0x00,0x01,0x40,0x00,0x00,0x08,
+ 0x90,0x00,0x80,0x00,0x80,0x00,0x00,0x10,0x90,0x00,0x40,0x00,0x00,0x01,0x00,
+ 0x10,0x90,0x00,0x20,0x00,0x00,0x02,0x00,0x10,0x88,0x00,0x10,0x00,0x00,0x04,
+ 0x00,0x10,0x48,0x00,0x08,0x00,0x00,0x08,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/parser.y b/xshogi/parser.y
index 33f8212..0d2784b 100644
--- a/xshogi/parser.y
+++ b/xshogi/parser.y
@@ -15,7 +15,7 @@
  * Modified implementation of ISS mode for XShogi:  Matthias Mutz
  * Current maintainer:                              Michael C. Vanier
  *
- * XShogi borrows its piece bitmaps from CRANES Shogi.
+ * XShogi borrows some of its piece bitmaps from CRANES Shogi.
  *
  * Copyright 1991 by Digital Equipment Corporation, Maynard, Massachusetts.
  * Enhancements Copyright 1992 Free Software Foundation, Inc.
@@ -92,7 +92,8 @@ extern void MakeMove(ShogiMove *move_type, int from_x, int from_y,
 %}
 
 %start goal
-%token PROMOTE DROPS PIECE SQUARE NUMBER COMMENT COLON
+%token PROMOTE DROPS PIECE SQUARE NUMBER COMMENT COLON 
+%token BLACK_WINS WHITE_WINS DRAW
       
 %union { int val; char* string; }
 
@@ -170,12 +171,28 @@ extern void MakeMove(ShogiMove *move_type, int from_x, int from_y,
         strcpy(moveList[currentMove], currentMoveString);
         MakeMove(&move_type, from_x, from_y, to_x, to_y);
     }
+  | BLACK_WINS 
+    { 
+		loaded_game_finished = 1;
+		DisplayMessage("Black wins", False);
+	}
+  | WHITE_WINS 
+    { 
+		loaded_game_finished = 1;
+		DisplayMessage("White wins", False);
+	}
+  | DRAW
+    { 
+		loaded_game_finished = 1;
+		DisplayMessage("Draw", False);
+	}
  ;         
 
  promotion:
    | PROMOTE 
-    { move_type = (BlackOnMove(currentMove) ? BlackPromotion : WhitePromotion); 
-      strcat(currentMoveString,"+"); }
+     { move_type = (BlackOnMove(currentMove) 
+					? BlackPromotion : WhitePromotion); 
+       strcat(currentMoveString,"+"); }
  ;
 
 %%
diff --git a/xshogi/scanner.l b/xshogi/scanner.l
index 3dcf8dc..ff3cb1f 100644
--- a/xshogi/scanner.l
+++ b/xshogi/scanner.l
@@ -14,7 +14,7 @@
  * Modified implementation of ISS mode for XShogi:  Matthias Mutz
  * Current maintainer:                              Michael C. Vanier
  *
- * XShogi borrows its piece bitmaps from CRANES Shogi.
+ * XShogi borrows some of its piece bitmaps from CRANES Shogi.
  *
  * Copyright 1991 by Digital Equipment Corporation, Maynard, Massachusetts.
  * Enhancements Copyright 1992 Free Software Foundation, Inc.
@@ -72,15 +72,19 @@ COMMENT ["#"]([^\n])*
 
 %%
 
-"\n"      { lines++; cols = 1; }
+"White wins" { return WHITE_WINS; }
+"Black wins" { return BLACK_WINS; }
+"Draw"       { return DRAW;       }
+
+"\n"      { lines++; cols = 1;       }
 "+"       { cols++;  return PROMOTE; }
-"*"       { cols++;  return DROPS; }
-"'"       { cols++;  return DROPS; }
-"."       { cols++;  return COLON; }
-{PIECE}   { yylval.string = yytext; cols += strlen(yytext); return PIECE;  }
-{SQUARE}  { yylval.string = yytext; cols += strlen(yytext); return SQUARE; }
-{NUMBER}  { yylval.string = yytext; cols += strlen(yytext); return NUMBER; }
-{COMMENT} { yylval.string = yytext; lines++; cols = 1; return COMMENT; }
+"*"       { cols++;  return DROPS;   }
+"'"       { cols++;  return DROPS;   }
+"."       { cols++;  return COLON;   }
+{PIECE}   { yylval.string = yytext; cols += strlen(yytext); return PIECE;   }
+{SQUARE}  { yylval.string = yytext; cols += strlen(yytext); return SQUARE;  }
+{NUMBER}  { yylval.string = yytext; cols += strlen(yytext); return NUMBER;  }
+{COMMENT} { yylval.string = yytext; lines++; cols = 1;      return COMMENT; }
 .         { cols++; }
 
 %%
diff --git a/xshogi/sysdeps.h b/xshogi/sysdeps.h
index 9864c45..cd410f2 100644
--- a/xshogi/sysdeps.h
+++ b/xshogi/sysdeps.h
@@ -13,7 +13,7 @@
  * Modified implementation of ISS mode for XShogi:  Matthias Mutz
  * Current maintainer:                              Michael C. Vanier
  *
- * XShogi borrows its piece bitmaps from CRANES Shogi.
+ * XShogi borrows some of its piece bitmaps from CRANES Shogi.
  *
  * Copyright 1991 by Digital Equipment Corporation, Maynard, Massachusetts.
  * Enhancements Copyright 1992 Free Software Foundation, Inc.
@@ -64,12 +64,7 @@
 #ifndef _SYSDEPS_H_
 #define _SYSDEPS_H_
 
-#if defined(LINUX)
-/* Avoid multiple definitions of wide char type.  */
-#define X_WCHAR /* This should work, but doesn't. */
-#define __EMX__ /* This is an outrageous hack!    */
-#endif
-
+#include 
 #include 
 #include 
 #include 
@@ -79,6 +74,16 @@
 #include 
 #include 
 
+/*
+ * Stuff that isn't reliably included (on Linux, anyway).
+ */
+
+extern FILE *fdopen(int fd, const char *modes);
+extern int   fileno(FILE *stream);
+extern int   kill(pid_t pid, int sig);
+extern int   strcasecmp(const char *s1, const char *s2);
+extern int   gethostname(char *name, size_t len);
+
 
 /*
  * Check for POSIX-compatible wait().
diff --git a/xshogi/western_bitmaps/TRANS.TBL b/xshogi/western_bitmaps/TRANS.TBL
deleted file mode 100644
index c416a3e..0000000
--- a/xshogi/western_bitmaps/TRANS.TBL
+++ /dev/null
@@ -1,29 +0,0 @@
-F BISHOPPR.XBM;1                    	bishopPRW.xbm
-F BISHOPPW.XBM;1                    	bishopPW.xbm
-F BISHOPRW.XBM;1                    	bishopRW.xbm
-F BISHOPW.XBM;1                     	bishopW.xbm
-F GOLDRW.XBM;1                      	goldRW.xbm
-F GOLDW.XBM;1                       	goldW.xbm
-F KINGRW.XBM;1                      	kingRW.xbm
-F KINGW.XBM;1                       	kingW.xbm
-F KNIGHTPR.XBM;1                    	knightPRW.xbm
-F KNIGHTPW.XBM;1                    	knightPW.xbm
-F KNIGHTRW.XBM;1                    	knightRW.xbm
-F KNIGHTW.XBM;1                     	knightW.xbm
-F LANCEPRW.XBM;1                    	lancePRW.xbm
-F LANCEPW.XBM;1                     	lancePW.xbm
-F LANCERW.XBM;1                     	lanceRW.xbm
-F LANCEW.XBM;1                      	lanceW.xbm
-F NONEW.XBM;1                       	noneW.xbm
-F PAWNPRW.XBM;1                     	pawnPRW.xbm
-F PAWNPW.XBM;1                      	pawnPW.xbm
-F PAWNRW.XBM;1                      	pawnRW.xbm
-F PAWNW.XBM;1                       	pawnW.xbm
-F ROOKPRW.XBM;1                     	rookPRW.xbm
-F ROOKPW.XBM;1                      	rookPW.xbm
-F ROOKRW.XBM;1                      	rookRW.xbm
-F ROOKW.XBM;1                       	rookW.xbm
-F SILVERPR.XBM;1                    	silverPRW.xbm
-F SILVERPW.XBM;1                    	silverPW.xbm
-F SILVERRW.XBM;1                    	silverRW.xbm
-F SILVERW.XBM;1                     	silverW.xbm
diff --git a/xshogi/western_bitmaps/bishopPRW.xbm b/xshogi/western_bitmaps/bishopPRW.xbm
index c9fa0e4..6ef647c 100644
--- a/xshogi/western_bitmaps/bishopPRW.xbm
+++ b/xshogi/western_bitmaps/bishopPRW.xbm
@@ -1,14 +1,38 @@
-#define bishopPRW_width 32
-#define bishopPRW_height 32
-static char bishopPRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0xf9, 0xff, 0xff, 0xcf, 0xf9, 0x00, 0x80, 0xcf, 0x79, 0xf0, 0x07, 0x4f,
-   0x32, 0xfc, 0x1f, 0x66, 0x12, 0x0e, 0x38, 0x64, 0x12, 0x06, 0x30, 0x64,
-   0x12, 0xc4, 0x11, 0x24, 0x24, 0x44, 0x11, 0x32, 0x24, 0x44, 0x11, 0x32,
-   0x24, 0x44, 0x11, 0x32, 0x24, 0x64, 0x13, 0x12, 0x48, 0x28, 0x0a, 0x19,
-   0x48, 0x28, 0x0a, 0x19, 0x48, 0x68, 0x0b, 0x19, 0x48, 0x48, 0x09, 0x09,
-   0x90, 0xc8, 0x89, 0x0c, 0x90, 0x10, 0x84, 0x0c, 0x90, 0x10, 0x84, 0x0c,
-   0x90, 0x10, 0x84, 0x04, 0x20, 0x11, 0x44, 0x06, 0x20, 0x21, 0x42, 0x06,
-   0x20, 0x21, 0x42, 0x06, 0x20, 0x46, 0x31, 0x02, 0xc0, 0x58, 0x8d, 0x01,
-   0x00, 0xa3, 0x62, 0x00, 0x00, 0xcc, 0x19, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define bishopPRW_width 64
+#define bishopPRW_height 64
+static unsigned char bishopPRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0xf0,0x00,0x01,0x1e,0x00,0x20,
+ 0x48,0x00,0x30,0x00,0x01,0x18,0x00,0x20,0x48,0x00,0x50,0x00,0x01,0x14,0x00,
+ 0x20,0x48,0x00,0x90,0x00,0x01,0x12,0x00,0x20,0x48,0x00,0x00,0x01,0x01,0x01,
+ 0x00,0x10,0x48,0x00,0x00,0x02,0x81,0x00,0x00,0x10,0x88,0x00,0x00,0x04,0x41,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x08,0x21,0x00,0x00,0x10,0x90,0x00,0x00,0x10,
+ 0x11,0x00,0x00,0x10,0x90,0x00,0x00,0x20,0x09,0x00,0x00,0x10,0x90,0x00,0x00,
+ 0x40,0x05,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x03,0x00,0x00,0x08,0x10,0x01,
+ 0xf0,0xff,0xff,0x1f,0x00,0x08,0x10,0x01,0x00,0x80,0x03,0x00,0x00,0x08,0x20,
+ 0x01,0x00,0x40,0x05,0x00,0x00,0x08,0x20,0x01,0x00,0x20,0x09,0x00,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x11,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x21,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x41,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x81,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x01,0x01,0x00,0x04,0x40,0x02,0x90,0x00,0x01,
+ 0x12,0x00,0x04,0x40,0x02,0x50,0x00,0x01,0x14,0x00,0x02,0x40,0x02,0x30,0x00,
+ 0x01,0x18,0x00,0x02,0x40,0x02,0xf0,0x00,0x01,0x1e,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0xc0,0x07,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x20,0x08,0x00,0x00,0x01,0x80,0x04,0x00,0x90,0x17,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x48,0x24,0x00,0x00,0x01,0x80,0x08,0x00,0x48,0x24,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x88,0x27,0x00,0x00,0x01,0x00,0x09,0x00,0x48,0x24,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x48,0x24,0x00,0x80,0x00,0x00,0x09,0x00,0x90,0x17,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x08,0x00,0x80,0x00,0x00,0x09,0x00,0xc0,
+ 0x07,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/bishopPW.xbm b/xshogi/western_bitmaps/bishopPW.xbm
index 8764c07..eae7b0d 100644
--- a/xshogi/western_bitmaps/bishopPW.xbm
+++ b/xshogi/western_bitmaps/bishopPW.xbm
@@ -1,14 +1,38 @@
-#define bishopPW_width 32
-#define bishopPW_height 32
-static char bishopPW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xcc, 0x19, 0x00, 0x00, 0xa3, 0x62, 0x00, 0xc0, 0x58, 0x8d, 0x01,
-   0x20, 0x46, 0x31, 0x02, 0x20, 0x21, 0x42, 0x06, 0x20, 0x21, 0x42, 0x06,
-   0x20, 0x11, 0x44, 0x06, 0x90, 0x10, 0x84, 0x04, 0x90, 0x10, 0x84, 0x0c,
-   0x90, 0x10, 0x84, 0x0c, 0x90, 0x08, 0x88, 0x0c, 0x48, 0xc8, 0x09, 0x09,
-   0x48, 0x48, 0x09, 0x19, 0x48, 0x68, 0x0b, 0x19, 0x48, 0x28, 0x0a, 0x19,
-   0x24, 0x64, 0x13, 0x12, 0x24, 0x44, 0x11, 0x32, 0x24, 0x44, 0x11, 0x32,
-   0x24, 0x44, 0x11, 0x32, 0x12, 0xc4, 0x11, 0x24, 0x12, 0x06, 0x30, 0x64,
-   0x12, 0x0e, 0x38, 0x64, 0x32, 0xfc, 0x1f, 0x66, 0x79, 0xf0, 0x07, 0x4f,
-   0xf9, 0x00, 0x80, 0xcf, 0xf9, 0xff, 0xff, 0xcf, 0x01, 0x00, 0x00, 0xc0,
-   0xff, 0xff, 0xff, 0xff, 0xfe, 0xff, 0xff, 0xff};
+#define bishopPW_width 64
+#define bishopPW_height 64
+static unsigned char bishopPW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0xe0,0x03,0x00,0x4f,0x00,0x00,0x12,0x00,0x10,0x04,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xe8,0x09,0x00,0x80,0x00,0x00,0x11,0x00,0x24,0x12,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x24,0x12,0x00,0x80,0x00,0x00,0x09,0x00,0xe4,0x11,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x24,0x12,0x00,0x80,0x00,0x00,0x09,0x00,0x24,0x12,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0xe8,0x09,0x00,0x80,0x00,0x00,0x09,0x00,0x10,0x04,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0xe0,0x03,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x78,0x80,0x00,0x0f,0x00,0x01,0x80,0x04,
+ 0x18,0x80,0x00,0x0c,0x00,0x01,0x80,0x04,0x28,0x80,0x00,0x0a,0x00,0x02,0x40,
+ 0x04,0x48,0x80,0x00,0x09,0x00,0x02,0x40,0x02,0x80,0x80,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x81,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x82,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x84,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x88,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x90,0x04,0x00,0x00,0x04,0x20,0x02,0x00,0xa0,0x02,
+ 0x00,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0xf8,0xff,
+ 0xff,0x0f,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0x00,
+ 0xa0,0x02,0x00,0x00,0x08,0x20,0x01,0x00,0x90,0x04,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x88,0x08,0x00,0x00,0x08,0x10,0x01,0x00,0x84,0x10,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x82,0x20,0x00,0x00,0x08,0x90,0x00,0x00,0x81,0x40,0x00,0x00,0x08,
+ 0x90,0x00,0x80,0x80,0x80,0x00,0x00,0x10,0x90,0x00,0x48,0x80,0x00,0x09,0x00,
+ 0x10,0x90,0x00,0x28,0x80,0x00,0x0a,0x00,0x10,0x88,0x00,0x18,0x80,0x00,0x0c,
+ 0x00,0x10,0x48,0x00,0x78,0x80,0x00,0x0f,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/bishopRW.xbm b/xshogi/western_bitmaps/bishopRW.xbm
index d90b6d0..9053da1 100644
--- a/xshogi/western_bitmaps/bishopRW.xbm
+++ b/xshogi/western_bitmaps/bishopRW.xbm
@@ -1,14 +1,38 @@
-#define bishopRW_width 32
-#define bishopRW_height 32
-static char bishopRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x01, 0xf0, 0x07, 0x40,
-   0x02, 0xfc, 0x1f, 0x60, 0x02, 0x0e, 0x38, 0x60, 0x02, 0x06, 0x30, 0x60,
-   0x02, 0xc4, 0x11, 0x20, 0x04, 0x44, 0x11, 0x30, 0x04, 0x44, 0x11, 0x30,
-   0x04, 0x44, 0x11, 0x30, 0x04, 0x64, 0x13, 0x10, 0x08, 0x28, 0x0a, 0x18,
-   0x08, 0x28, 0x0a, 0x18, 0x08, 0x68, 0x0b, 0x18, 0x08, 0x48, 0x09, 0x08,
-   0x10, 0xc8, 0x09, 0x0c, 0x10, 0x10, 0x04, 0x0c, 0x10, 0x10, 0x04, 0x0c,
-   0x10, 0x10, 0x04, 0x04, 0x20, 0x10, 0x04, 0x06, 0x20, 0x20, 0x02, 0x06,
-   0x20, 0x20, 0x02, 0x06, 0x20, 0x40, 0x01, 0x02, 0xc0, 0x40, 0x81, 0x01,
-   0x00, 0x83, 0x60, 0x00, 0x00, 0x0c, 0x18, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define bishopRW_width 64
+#define bishopRW_height 64
+static unsigned char bishopRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0xf0,0x00,0x00,0x1e,0x00,0x20,
+ 0x48,0x00,0x30,0x00,0x00,0x18,0x00,0x20,0x48,0x00,0x50,0x00,0x00,0x14,0x00,
+ 0x20,0x48,0x00,0x90,0x00,0x00,0x12,0x00,0x20,0x48,0x00,0x00,0x01,0x00,0x01,
+ 0x00,0x10,0x48,0x00,0x00,0x02,0x80,0x00,0x00,0x10,0x88,0x00,0x00,0x04,0x40,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x08,0x20,0x00,0x00,0x10,0x90,0x00,0x00,0x10,
+ 0x10,0x00,0x00,0x10,0x90,0x00,0x00,0x20,0x08,0x00,0x00,0x10,0x90,0x00,0x00,
+ 0x40,0x04,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x02,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x00,0x01,0x00,0x00,0x08,0x10,0x01,0x00,0x80,0x02,0x00,0x00,0x08,0x20,
+ 0x01,0x00,0x40,0x04,0x00,0x00,0x08,0x20,0x01,0x00,0x20,0x08,0x00,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x10,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x20,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x40,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x80,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x00,0x01,0x00,0x04,0x40,0x02,0x90,0x00,0x00,
+ 0x12,0x00,0x04,0x40,0x02,0x50,0x00,0x00,0x14,0x00,0x02,0x40,0x02,0x30,0x00,
+ 0x00,0x18,0x00,0x02,0x40,0x02,0xf0,0x00,0x00,0x1e,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x80,0x07,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x40,0x04,0x00,0x00,0x01,0x80,0x08,0x00,0x40,0x04,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x80,0x07,0x00,0x00,0x01,0x00,0x09,0x00,0x40,0x04,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x09,0x00,0x80,0x07,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x00,
+ 0x00,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/bishopW.xbm b/xshogi/western_bitmaps/bishopW.xbm
index 35c497e..1ec5f8c 100644
--- a/xshogi/western_bitmaps/bishopW.xbm
+++ b/xshogi/western_bitmaps/bishopW.xbm
@@ -1,14 +1,38 @@
-#define bishopW_width 32
-#define bishopW_height 32
-static char bishopW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0x0c, 0x18, 0x00, 0x00, 0x83, 0x60, 0x00, 0xc0, 0x40, 0x81, 0x01,
-   0x20, 0x40, 0x01, 0x02, 0x20, 0x20, 0x02, 0x06, 0x20, 0x20, 0x02, 0x06,
-   0x20, 0x10, 0x04, 0x06, 0x10, 0x10, 0x04, 0x04, 0x10, 0x10, 0x04, 0x0c,
-   0x10, 0x10, 0x04, 0x0c, 0x10, 0x08, 0x08, 0x0c, 0x08, 0xc8, 0x09, 0x08,
-   0x08, 0x48, 0x09, 0x18, 0x08, 0x68, 0x0b, 0x18, 0x08, 0x28, 0x0a, 0x18,
-   0x04, 0x64, 0x13, 0x10, 0x04, 0x44, 0x11, 0x30, 0x04, 0x44, 0x11, 0x30,
-   0x04, 0x44, 0x11, 0x30, 0x02, 0xc4, 0x11, 0x20, 0x02, 0x06, 0x30, 0x60,
-   0x02, 0x0e, 0x38, 0x60, 0x02, 0xfc, 0x1f, 0x60, 0x01, 0xf0, 0x07, 0x40,
-   0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0,
-   0xff, 0xff, 0xff, 0xff, 0xfe, 0xff, 0xff, 0xff};
+#define bishopW_width 64
+#define bishopW_height 64
+static unsigned char bishopW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0x00,0x00,0x00,0x4f,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xe0,0x01,0x00,0x80,0x00,0x00,0x11,0x00,0x20,0x02,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0xe0,0x01,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x02,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0xe0,0x01,0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x78,0x00,0x00,0x0f,0x00,0x01,0x80,0x04,
+ 0x18,0x00,0x00,0x0c,0x00,0x01,0x80,0x04,0x28,0x00,0x00,0x0a,0x00,0x02,0x40,
+ 0x04,0x48,0x00,0x00,0x09,0x00,0x02,0x40,0x02,0x80,0x00,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x01,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x02,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x04,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x08,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x10,0x04,0x00,0x00,0x04,0x20,0x02,0x00,0x20,0x02,
+ 0x00,0x00,0x04,0x20,0x01,0x00,0x40,0x01,0x00,0x00,0x04,0x20,0x01,0x00,0x80,
+ 0x00,0x00,0x00,0x04,0x20,0x01,0x00,0x40,0x01,0x00,0x00,0x04,0x20,0x01,0x00,
+ 0x20,0x02,0x00,0x00,0x08,0x20,0x01,0x00,0x10,0x04,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x08,0x08,0x00,0x00,0x08,0x10,0x01,0x00,0x04,0x10,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x02,0x20,0x00,0x00,0x08,0x90,0x00,0x00,0x01,0x40,0x00,0x00,0x08,
+ 0x90,0x00,0x80,0x00,0x80,0x00,0x00,0x10,0x90,0x00,0x48,0x00,0x00,0x09,0x00,
+ 0x10,0x90,0x00,0x28,0x00,0x00,0x0a,0x00,0x10,0x88,0x00,0x18,0x00,0x00,0x0c,
+ 0x00,0x10,0x48,0x00,0x78,0x00,0x00,0x0f,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/goldRW.xbm b/xshogi/western_bitmaps/goldRW.xbm
index b615b6c..f5d09fc 100644
--- a/xshogi/western_bitmaps/goldRW.xbm
+++ b/xshogi/western_bitmaps/goldRW.xbm
@@ -1,14 +1,38 @@
-#define goldRW_width 32
-#define goldRW_height 32
-static char goldRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x80, 0x00, 0x40,
-   0x02, 0x40, 0x01, 0x60, 0x02, 0x40, 0x01, 0x60, 0x02, 0x20, 0x02, 0x60,
-   0x02, 0x20, 0x02, 0x20, 0x04, 0x10, 0x04, 0x30, 0x04, 0x10, 0x04, 0x30,
-   0x04, 0xc8, 0x09, 0x30, 0x04, 0x28, 0x08, 0x10, 0x08, 0xa4, 0x13, 0x18,
-   0x08, 0x28, 0x09, 0x18, 0x08, 0xc8, 0x09, 0x18, 0x08, 0x10, 0x04, 0x08,
-   0x10, 0x10, 0x04, 0x0c, 0x10, 0x20, 0x02, 0x0c, 0x10, 0x20, 0x02, 0x0c,
-   0x10, 0x40, 0x01, 0x04, 0x20, 0x40, 0x01, 0x06, 0x20, 0x80, 0x00, 0x06,
-   0x20, 0x00, 0x00, 0x06, 0x20, 0x00, 0x00, 0x02, 0xc0, 0x00, 0x80, 0x01,
-   0x00, 0x03, 0x60, 0x00, 0x00, 0x0c, 0x18, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define goldRW_width 64
+#define goldRW_height 64
+static unsigned char goldRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,
+ 0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,
+ 0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,
+ 0x00,0x10,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x88,0x00,0x00,0x00,0x01,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x90,0x00,0x00,0x00,
+ 0x01,0x00,0x00,0x10,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x90,0x00,0x00,
+ 0x00,0x01,0x00,0x00,0x08,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x08,0x10,0x01,
+ 0xf0,0xff,0xff,0x1f,0x00,0x08,0x10,0x01,0x00,0x80,0x03,0x00,0x00,0x08,0x20,
+ 0x01,0x00,0x40,0x05,0x00,0x00,0x08,0x20,0x01,0x00,0x20,0x09,0x00,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x11,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x21,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x41,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x81,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x01,0x01,0x00,0x04,0x40,0x02,0x80,0x00,0x01,
+ 0x02,0x00,0x04,0x40,0x02,0x40,0x00,0x01,0x04,0x00,0x02,0x40,0x02,0x20,0x00,
+ 0x01,0x08,0x00,0x02,0x40,0x02,0x10,0x00,0x01,0x10,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,0xc0,0x03,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x40,0x04,0x00,0x00,0x01,0x80,0x08,0x00,0x40,0x04,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0xc0,0x05,0x00,0x00,0x01,0x00,0x09,0x00,0x00,0x04,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x00,0x04,0x00,0x80,0x00,0x00,0x09,0x00,0xc0,0x03,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x00,
+ 0x00,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/goldW.xbm b/xshogi/western_bitmaps/goldW.xbm
index 63b53ae..246be7a 100644
--- a/xshogi/western_bitmaps/goldW.xbm
+++ b/xshogi/western_bitmaps/goldW.xbm
@@ -1,14 +1,38 @@
-#define goldW_width 32
-#define goldW_height 32
-static char goldW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0x0c, 0x18, 0x00, 0x00, 0x03, 0x60, 0x00, 0xc0, 0x00, 0x80, 0x01,
-   0x20, 0x00, 0x00, 0x02, 0x20, 0x00, 0x00, 0x06, 0x20, 0x80, 0x00, 0x06,
-   0x20, 0x40, 0x01, 0x06, 0x10, 0x40, 0x01, 0x04, 0x10, 0x20, 0x02, 0x0c,
-   0x10, 0x20, 0x02, 0x0c, 0x10, 0x10, 0x04, 0x0c, 0x08, 0x10, 0x04, 0x08,
-   0x08, 0xc8, 0x09, 0x18, 0x08, 0x28, 0x08, 0x18, 0x08, 0xa4, 0x13, 0x18,
-   0x04, 0x28, 0x09, 0x10, 0x04, 0xc8, 0x09, 0x30, 0x04, 0x10, 0x04, 0x30,
-   0x04, 0x10, 0x04, 0x30, 0x02, 0x20, 0x02, 0x20, 0x02, 0x20, 0x02, 0x60,
-   0x02, 0x40, 0x01, 0x60, 0x02, 0x40, 0x01, 0x60, 0x01, 0x80, 0x00, 0x40,
-   0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0,
-   0xff, 0xff, 0xff, 0xff, 0xfe, 0xff, 0xff, 0xff};
+#define goldW_width 64
+#define goldW_height 64
+static unsigned char goldW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0x00,0x00,0x00,0x4f,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xc0,0x03,0x00,0x80,0x00,0x00,0x11,0x00,0x20,0x00,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x20,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0xa0,0x03,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x02,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0xc0,0x03,0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x08,0x80,0x00,0x08,0x00,0x01,0x80,0x04,
+ 0x10,0x80,0x00,0x04,0x00,0x01,0x80,0x04,0x20,0x80,0x00,0x02,0x00,0x02,0x40,
+ 0x04,0x40,0x80,0x00,0x01,0x00,0x02,0x40,0x02,0x80,0x80,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x81,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x82,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x84,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x88,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x90,0x04,0x00,0x00,0x04,0x20,0x02,0x00,0xa0,0x02,
+ 0x00,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0xf8,0xff,
+ 0xff,0x0f,0x00,0x04,0x20,0x01,0x00,0x80,0x00,0x00,0x00,0x04,0x20,0x01,0x00,
+ 0x80,0x00,0x00,0x00,0x08,0x20,0x01,0x00,0x80,0x00,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x80,0x00,0x00,0x00,0x08,0x10,0x01,0x00,0x80,0x00,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x80,0x00,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x08,
+ 0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x90,0x00,0x00,0x80,0x00,0x00,0x00,
+ 0x10,0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x88,0x00,0x00,0x80,0x00,0x00,
+ 0x00,0x10,0x48,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/kingRW.xbm b/xshogi/western_bitmaps/kingRW.xbm
index e87ddbe..67745ec 100644
--- a/xshogi/western_bitmaps/kingRW.xbm
+++ b/xshogi/western_bitmaps/kingRW.xbm
@@ -1,14 +1,38 @@
-#define kingRW_width 32
-#define kingRW_height 32
-static char kingRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x01, 0xff, 0x7f, 0x40,
-   0x02, 0x01, 0x40, 0x60, 0x82, 0x40, 0x82, 0x60, 0x82, 0x40, 0x81, 0x60,
-   0x82, 0xc0, 0x80, 0x20, 0x84, 0x40, 0x81, 0x30, 0x84, 0x40, 0x82, 0x30,
-   0x84, 0x40, 0x82, 0x30, 0x84, 0x08, 0x88, 0x10, 0x08, 0x15, 0x54, 0x18,
-   0x08, 0x15, 0x54, 0x18, 0x08, 0x15, 0x54, 0x18, 0x08, 0x22, 0x22, 0x08,
-   0x10, 0x22, 0x22, 0x0c, 0x10, 0x40, 0x01, 0x0c, 0x10, 0x80, 0x00, 0x0c,
-   0x10, 0xc0, 0x01, 0x04, 0x20, 0x60, 0x03, 0x06, 0x20, 0xe0, 0x03, 0x06,
-   0x20, 0xc0, 0x01, 0x06, 0x20, 0x00, 0x00, 0x02, 0xc0, 0x00, 0x80, 0x01,
-   0x00, 0x03, 0x60, 0x00, 0x00, 0x0c, 0x18, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define kingRW_width 64
+#define kingRW_height 64
+static unsigned char kingRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x10,0x00,0x01,0x10,0x00,0x20,
+ 0x48,0x00,0x20,0x00,0x01,0x08,0x00,0x20,0x48,0x00,0x40,0x00,0x01,0x04,0x00,
+ 0x20,0x48,0x00,0x80,0x00,0x01,0x02,0x00,0x20,0x48,0x00,0x00,0x01,0x01,0x01,
+ 0x00,0x10,0x48,0x00,0x00,0x02,0x81,0x00,0x00,0x10,0x88,0x00,0x00,0x04,0x41,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x08,0x21,0x00,0x00,0x10,0x90,0x00,0x00,0x10,
+ 0x11,0x00,0x00,0x10,0x90,0x00,0x00,0x20,0x09,0x00,0x00,0x10,0x90,0x00,0x00,
+ 0x40,0x05,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x03,0x00,0x00,0x08,0x10,0x01,
+ 0xf0,0xff,0xff,0x1f,0x00,0x08,0x10,0x01,0x00,0x80,0x03,0x00,0x00,0x08,0x20,
+ 0x01,0x00,0x40,0x05,0x00,0x00,0x08,0x20,0x01,0x00,0x20,0x09,0x00,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x11,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x21,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x41,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x81,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x01,0x01,0x00,0x04,0x40,0x02,0x80,0x00,0x01,
+ 0x02,0x00,0x04,0x40,0x02,0x40,0x00,0x01,0x04,0x00,0x02,0x40,0x02,0x20,0x00,
+ 0x01,0x08,0x00,0x02,0x40,0x02,0x10,0x00,0x01,0x10,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x40,0x04,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x80,0x04,0x00,0x00,0x01,0x80,0x08,0x00,0x00,0x05,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x00,0x06,0x00,0x00,0x01,0x00,0x09,0x00,0x00,0x05,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x80,0x04,0x00,0x80,0x00,0x00,0x09,0x00,0x40,0x04,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x00,
+ 0x00,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/kingW.xbm b/xshogi/western_bitmaps/kingW.xbm
index 88762de..79b1493 100644
--- a/xshogi/western_bitmaps/kingW.xbm
+++ b/xshogi/western_bitmaps/kingW.xbm
@@ -1,14 +1,38 @@
-#define kingW_width 32
-#define kingW_height 32
-static char kingW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0x0c, 0x18, 0x00, 0x00, 0x03, 0x60, 0x00, 0xc0, 0x00, 0x80, 0x01,
-   0x20, 0x00, 0x00, 0x02, 0x20, 0xc0, 0x01, 0x06, 0x20, 0xe0, 0x03, 0x06,
-   0x20, 0x60, 0x03, 0x06, 0x10, 0xc0, 0x01, 0x04, 0x10, 0x80, 0x00, 0x0c,
-   0x10, 0x40, 0x01, 0x0c, 0x10, 0x22, 0x22, 0x0c, 0x08, 0x22, 0x22, 0x08,
-   0x08, 0x15, 0x54, 0x18, 0x08, 0x15, 0x54, 0x18, 0x08, 0x15, 0x54, 0x18,
-   0x84, 0x08, 0x88, 0x10, 0x84, 0x40, 0x82, 0x30, 0x84, 0x40, 0x81, 0x30,
-   0x84, 0xc0, 0x80, 0x30, 0x82, 0x40, 0x81, 0x20, 0x82, 0x40, 0x82, 0x60,
-   0x82, 0x40, 0x82, 0x60, 0x02, 0x01, 0x40, 0x60, 0x01, 0xff, 0x7f, 0x40,
-   0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0,
-   0xff, 0xff, 0xff, 0xff, 0xfe, 0xff, 0xff, 0xff};
+#define kingW_width 64
+#define kingW_height 64
+static unsigned char kingW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0x00,0x00,0x00,0x4f,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x11,0x00,0x20,0x01,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0xa0,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x60,0x00,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0xa0,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x01,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x08,0x80,0x00,0x08,0x00,0x01,0x80,0x04,
+ 0x10,0x80,0x00,0x04,0x00,0x01,0x80,0x04,0x20,0x80,0x00,0x02,0x00,0x02,0x40,
+ 0x04,0x40,0x80,0x00,0x01,0x00,0x02,0x40,0x02,0x80,0x80,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x81,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x82,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x84,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x88,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x90,0x04,0x00,0x00,0x04,0x20,0x02,0x00,0xa0,0x02,
+ 0x00,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0xf8,0xff,
+ 0xff,0x0f,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0x00,
+ 0xa0,0x02,0x00,0x00,0x08,0x20,0x01,0x00,0x90,0x04,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x88,0x08,0x00,0x00,0x08,0x10,0x01,0x00,0x84,0x10,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x82,0x20,0x00,0x00,0x08,0x90,0x00,0x00,0x81,0x40,0x00,0x00,0x08,
+ 0x90,0x00,0x80,0x80,0x80,0x00,0x00,0x10,0x90,0x00,0x40,0x80,0x00,0x01,0x00,
+ 0x10,0x90,0x00,0x20,0x80,0x00,0x02,0x00,0x10,0x88,0x00,0x10,0x80,0x00,0x04,
+ 0x00,0x10,0x48,0x00,0x08,0x80,0x00,0x08,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/knightPRW.xbm b/xshogi/western_bitmaps/knightPRW.xbm
index a4f585e..2c242ec 100644
--- a/xshogi/western_bitmaps/knightPRW.xbm
+++ b/xshogi/western_bitmaps/knightPRW.xbm
@@ -1,14 +1,46 @@
-#define knightPRW_width 32
-#define knightPRW_height 32
-static char knightPRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0xf9, 0xff, 0xff, 0xcf, 0x09, 0x00, 0x00, 0xc8, 0xe9, 0xff, 0x00, 0x48,
-   0xf2, 0x7f, 0x00, 0x64, 0xf2, 0x3f, 0x1c, 0x64, 0xf2, 0x3f, 0x3f, 0x64,
-   0xf2, 0x9f, 0x3f, 0x24, 0xe4, 0xdf, 0x2f, 0x32, 0xe4, 0xff, 0x1f, 0x32,
-   0xe4, 0xff, 0x0f, 0x32, 0xe4, 0xff, 0x07, 0x12, 0xc8, 0xff, 0x07, 0x19,
-   0xc8, 0xff, 0x03, 0x19, 0x48, 0x9f, 0x03, 0x19, 0x48, 0xff, 0x01, 0x09,
-   0x90, 0xfe, 0x81, 0x0c, 0x90, 0xfc, 0x81, 0x0c, 0x90, 0xf8, 0x80, 0x0c,
-   0x90, 0x70, 0x80, 0x04, 0x20, 0x61, 0x40, 0x06, 0x20, 0xc1, 0x40, 0x06,
-   0x20, 0x01, 0x40, 0x06, 0x20, 0x06, 0x30, 0x02, 0xc0, 0x18, 0x8c, 0x01,
-   0x00, 0x23, 0x62, 0x00, 0x00, 0xcc, 0x19, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define knightPRW_width 64
+#define knightPRW_height 64
+static unsigned char knightPRW_bits[] = {
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+   0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+   0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+   0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x01, 0x00, 0x80, 0x00,
+   0x20, 0x02, 0x00, 0x00, 0x01, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+   0x01, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x01, 0x00, 0x80, 0x00,
+   0x20, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00, 0x20, 0x04, 0x00, 0x00,
+   0x01, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00,
+   0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00,
+   0x01, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00,
+   0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x00,
+   0x01, 0x00, 0x20, 0x00, 0x80, 0x08, 0xf0, 0xff, 0xff, 0x1f, 0x20, 0x00,
+   0x80, 0x08, 0x00, 0x80, 0x03, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x40,
+   0x05, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x20, 0x09, 0x00, 0x20, 0x00,
+   0x80, 0x08, 0x00, 0x10, 0x11, 0x00, 0x20, 0x00, 0x80, 0x10, 0x00, 0x08,
+   0x21, 0x00, 0x10, 0x00, 0x80, 0x10, 0x00, 0x04, 0x41, 0x00, 0x10, 0x00,
+   0x00, 0x11, 0x00, 0x02, 0x81, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x01,
+   0x01, 0x01, 0x10, 0x00, 0x00, 0x11, 0x80, 0x00, 0x01, 0x02, 0x10, 0x00,
+   0x00, 0x11, 0x40, 0x00, 0x01, 0x04, 0x10, 0x00, 0x00, 0x11, 0x20, 0x00,
+   0x01, 0x08, 0x10, 0x00, 0x00, 0x21, 0x10, 0x00, 0x01, 0x10, 0x08, 0x00,
+   0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00,
+   0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00,
+   0x00, 0x22, 0x00, 0xc0, 0x07, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0x20,
+   0x08, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0x50, 0x14, 0x00, 0x08, 0x00,
+   0x00, 0x48, 0x00, 0xc8, 0x24, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0xc8,
+   0x25, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x48, 0x25, 0x00, 0x04, 0x00,
+   0x00, 0x60, 0x00, 0x48, 0x27, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x48,
+   0x26, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x50, 0x14, 0xc0, 0x01, 0x00,
+   0x00, 0x00, 0x38, 0x20, 0x08, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0xc1,
+   0x07, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+   0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 };
diff --git a/xshogi/western_bitmaps/knightPW.xbm b/xshogi/western_bitmaps/knightPW.xbm
index 7f10cb3..2b5a607 100644
--- a/xshogi/western_bitmaps/knightPW.xbm
+++ b/xshogi/western_bitmaps/knightPW.xbm
@@ -1,14 +1,46 @@
-#define knightPW_width 32
-#define knightPW_height 32
-static char knightPW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00, 0x00, 0x8c, 0x18, 0x00,
-   0x00, 0x63, 0x63, 0x00, 0x80, 0x18, 0x8c, 0x00, 0x80, 0x04, 0x90, 0x01,
-   0x80, 0x04, 0x90, 0x01, 0x40, 0xc2, 0x20, 0x01, 0x40, 0x82, 0x21, 0x03,
-   0x40, 0x82, 0x23, 0x03, 0x40, 0xc2, 0x27, 0x03, 0x20, 0xc1, 0x4f, 0x02,
-   0x20, 0xe1, 0x5f, 0x06, 0x20, 0x31, 0x5f, 0x06, 0x20, 0xf1, 0x7f, 0x06,
-   0x90, 0xf8, 0xff, 0x04, 0x90, 0xf8, 0xff, 0x0c, 0x90, 0xfc, 0xff, 0x0c,
-   0x90, 0xfa, 0xfe, 0x0c, 0x48, 0x7e, 0xfe, 0x09, 0x48, 0x1c, 0xfe, 0x19,
-   0x48, 0x00, 0xff, 0x19, 0x48, 0x80, 0xff, 0x19, 0x24, 0x00, 0x00, 0x12,
-   0xe4, 0xff, 0xff, 0x33, 0x04, 0x00, 0x00, 0x30, 0x04, 0x00, 0x00, 0x30,
-   0xfc, 0xff, 0xff, 0x3f, 0xf8, 0xff, 0xff, 0x3f};
+#define knightPW_width 64
+#define knightPW_height 64
+static unsigned char knightPW_bits[] = {
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x01, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x4f, 0x0e, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x80,
+   0x70, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0f, 0xc0, 0x81, 0x03, 0x00, 0x00,
+   0x00, 0xf0, 0x00, 0x38, 0x0e, 0x1c, 0x00, 0x00, 0x00, 0x08, 0x00, 0x07,
+   0x70, 0x60, 0x00, 0x00, 0x00, 0x0c, 0xe0, 0xe0, 0x83, 0x83, 0x00, 0x00,
+   0x00, 0x14, 0x1c, 0x10, 0x04, 0x1c, 0x01, 0x00, 0x00, 0x94, 0x03, 0x28,
+   0x0a, 0xe0, 0x01, 0x00, 0x00, 0x64, 0x00, 0x64, 0x12, 0x00, 0x03, 0x00,
+   0x00, 0x22, 0x00, 0xe4, 0x12, 0x00, 0x02, 0x00, 0x00, 0x22, 0x00, 0xa4,
+   0x12, 0x00, 0x02, 0x00, 0x00, 0x22, 0x00, 0xa4, 0x13, 0x00, 0x02, 0x00,
+   0x00, 0x22, 0x00, 0x24, 0x13, 0x00, 0x02, 0x00, 0x00, 0x12, 0x00, 0x28,
+   0x0a, 0x00, 0x04, 0x00, 0x00, 0x12, 0x00, 0x10, 0x04, 0x00, 0x04, 0x00,
+   0x00, 0x11, 0x00, 0xe0, 0x03, 0x00, 0x04, 0x00, 0x00, 0x11, 0x00, 0x00,
+   0x00, 0x00, 0x04, 0x00, 0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00,
+   0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x11, 0x08, 0x80,
+   0x00, 0x08, 0x04, 0x00, 0x00, 0x09, 0x10, 0x80, 0x00, 0x04, 0x08, 0x00,
+   0x80, 0x08, 0x20, 0x80, 0x00, 0x02, 0x08, 0x00, 0x80, 0x08, 0x40, 0x80,
+   0x00, 0x01, 0x08, 0x00, 0x80, 0x08, 0x80, 0x80, 0x80, 0x00, 0x08, 0x00,
+   0x80, 0x08, 0x00, 0x81, 0x40, 0x00, 0x08, 0x00, 0x80, 0x08, 0x00, 0x82,
+   0x20, 0x00, 0x08, 0x00, 0x80, 0x08, 0x00, 0x84, 0x10, 0x00, 0x08, 0x00,
+   0x40, 0x04, 0x00, 0x88, 0x08, 0x00, 0x10, 0x00, 0x40, 0x04, 0x00, 0x90,
+   0x04, 0x00, 0x10, 0x00, 0x40, 0x04, 0x00, 0xa0, 0x02, 0x00, 0x10, 0x00,
+   0x40, 0x04, 0x00, 0xc0, 0x01, 0x00, 0x10, 0x00, 0x40, 0x04, 0xf8, 0xff,
+   0xff, 0x0f, 0x10, 0x00, 0x40, 0x04, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00,
+   0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80,
+   0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00,
+   0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80,
+   0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00,
+   0x10, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x10, 0x01, 0x00, 0x80,
+   0x00, 0x00, 0x40, 0x00, 0x10, 0x01, 0x00, 0x80, 0x00, 0x00, 0x40, 0x00,
+   0x10, 0x01, 0x00, 0x80, 0x00, 0x00, 0x40, 0x00, 0x10, 0x01, 0x00, 0x80,
+   0x00, 0x00, 0x40, 0x00, 0x20, 0x01, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00,
+   0x20, 0x01, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x20, 0x01, 0x00, 0x00,
+   0x00, 0x00, 0x40, 0x00, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0xc0, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0xc0, 0x00, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 };
diff --git a/xshogi/western_bitmaps/knightRW.xbm b/xshogi/western_bitmaps/knightRW.xbm
index d4da3ff..7d95e5a 100644
--- a/xshogi/western_bitmaps/knightRW.xbm
+++ b/xshogi/western_bitmaps/knightRW.xbm
@@ -1,14 +1,46 @@
-#define knightRW_width 32
-#define knightRW_height 32
-static char knightRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0xf1, 0xff, 0x00, 0x40,
-   0xf2, 0x7f, 0x00, 0x60, 0xf2, 0x3f, 0x1c, 0x60, 0xf2, 0x3f, 0x3f, 0x60,
-   0xf2, 0x9f, 0x3f, 0x20, 0xe4, 0xdf, 0x2f, 0x30, 0xe4, 0xff, 0x1f, 0x30,
-   0xc4, 0xff, 0x0f, 0x30, 0xc4, 0xff, 0x07, 0x10, 0xc8, 0xff, 0x07, 0x18,
-   0x88, 0xff, 0x03, 0x18, 0x08, 0x9f, 0x03, 0x18, 0x08, 0xff, 0x01, 0x08,
-   0x10, 0xfe, 0x01, 0x0c, 0x10, 0xfc, 0x01, 0x0c, 0x10, 0xf8, 0x00, 0x0c,
-   0x10, 0x70, 0x00, 0x04, 0x20, 0x60, 0x00, 0x06, 0x20, 0xc0, 0x00, 0x06,
-   0x20, 0x00, 0x00, 0x06, 0x20, 0x00, 0x00, 0x02, 0xc0, 0x00, 0x80, 0x01,
-   0x00, 0x03, 0x60, 0x00, 0x00, 0x0c, 0x18, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define knightRW_width 64
+#define knightRW_height 64
+static unsigned char knightRW_bits[] = {
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0xf8, 0xff, 0xff, 0xff, 0xff, 0xff, 0x3f, 0x00, 0x18, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x40, 0x00, 0x28, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0x48, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x90, 0xff, 0xff, 0xff,
+   0xff, 0xff, 0xff, 0x01, 0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01,
+   0x10, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x10, 0x01, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x01, 0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0x10, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+   0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0x20, 0x02, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00,
+   0x00, 0x00, 0x80, 0x00, 0x20, 0x02, 0x00, 0x00, 0x01, 0x00, 0x80, 0x00,
+   0x20, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00, 0x20, 0x04, 0x00, 0x00,
+   0x01, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00,
+   0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00,
+   0x01, 0x00, 0x40, 0x00, 0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00,
+   0x40, 0x04, 0x00, 0x00, 0x01, 0x00, 0x40, 0x00, 0x40, 0x08, 0x00, 0x00,
+   0x01, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0x01, 0x00, 0x20, 0x00,
+   0x80, 0x08, 0x00, 0x00, 0x01, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00,
+   0x01, 0x00, 0x20, 0x00, 0x80, 0x08, 0x00, 0x00, 0x01, 0x00, 0x20, 0x00,
+   0x80, 0x08, 0x00, 0x00, 0x01, 0x00, 0x20, 0x00, 0x80, 0x10, 0x00, 0x00,
+   0x01, 0x00, 0x10, 0x00, 0x80, 0x10, 0x00, 0x80, 0x02, 0x00, 0x10, 0x00,
+   0x00, 0x11, 0x00, 0x80, 0x02, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x40,
+   0x04, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x20, 0x08, 0x00, 0x10, 0x00,
+   0x00, 0x11, 0x00, 0x10, 0x10, 0x00, 0x10, 0x00, 0x00, 0x11, 0x00, 0x0f,
+   0xe0, 0x00, 0x10, 0x00, 0x00, 0x21, 0xf0, 0x00, 0x00, 0x0f, 0x08, 0x00,
+   0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00,
+   0x00, 0x00, 0x08, 0x00, 0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00,
+   0x00, 0x22, 0x00, 0x00, 0x00, 0x00, 0x08, 0x00, 0x00, 0x24, 0x00, 0x00,
+   0x00, 0x00, 0x08, 0x00, 0x00, 0x28, 0x00, 0x40, 0x04, 0x00, 0x08, 0x00,
+   0x00, 0x48, 0x00, 0xc0, 0x04, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0xc0,
+   0x05, 0x00, 0x04, 0x00, 0x00, 0x50, 0x00, 0x40, 0x05, 0x00, 0x04, 0x00,
+   0x00, 0x60, 0x00, 0x40, 0x07, 0x00, 0x04, 0x00, 0x00, 0xc0, 0x00, 0x40,
+   0x06, 0x00, 0x06, 0x00, 0x00, 0x00, 0x07, 0x40, 0x04, 0xc0, 0x01, 0x00,
+   0x00, 0x00, 0x38, 0x00, 0x00, 0x38, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01,
+   0x00, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0e, 0xe0, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x70, 0x1c, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80,
+   0x03, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 };
diff --git a/xshogi/western_bitmaps/knightW.xbm b/xshogi/western_bitmaps/knightW.xbm
index c0b1718..cbec507 100644
--- a/xshogi/western_bitmaps/knightW.xbm
+++ b/xshogi/western_bitmaps/knightW.xbm
@@ -1,14 +1,46 @@
-#define knightW_width 32
-#define knightW_height 32
-static char knightW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00, 0x00, 0x0c, 0x18, 0x00,
-   0x00, 0x03, 0x60, 0x00, 0x80, 0x00, 0x80, 0x00, 0x80, 0x00, 0x80, 0x01,
-   0x80, 0x00, 0x80, 0x01, 0x40, 0xc0, 0x00, 0x01, 0x40, 0x80, 0x01, 0x03,
-   0x40, 0x80, 0x03, 0x03, 0x40, 0xc0, 0x07, 0x03, 0x20, 0xc0, 0x0f, 0x02,
-   0x20, 0xe0, 0x1f, 0x06, 0x20, 0x30, 0x1f, 0x06, 0x20, 0xf0, 0x3f, 0x06,
-   0x10, 0xf8, 0x7f, 0x04, 0x10, 0xf8, 0x7f, 0x0c, 0x10, 0xfc, 0x7f, 0x0c,
-   0x10, 0xfa, 0x7e, 0x0c, 0x08, 0x7e, 0x7e, 0x08, 0x08, 0x1c, 0x7e, 0x18,
-   0x08, 0x00, 0x7f, 0x18, 0x08, 0x80, 0x7f, 0x18, 0x04, 0x00, 0x00, 0x10,
-   0x04, 0x00, 0x00, 0x30, 0x04, 0x00, 0x00, 0x30, 0x04, 0x00, 0x00, 0x30,
-   0xfc, 0xff, 0xff, 0x3f, 0xf8, 0xff, 0xff, 0x3f};
+#define knightW_width 64
+#define knightW_height 64
+static unsigned char knightW_bits[] = {
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x01, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x4f, 0x0e, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf0, 0x80,
+   0x70, 0x00, 0x00, 0x00, 0x00, 0x00, 0x0f, 0xc0, 0x81, 0x03, 0x00, 0x00,
+   0x00, 0xf0, 0x00, 0x38, 0x0e, 0x1c, 0x00, 0x00, 0x00, 0x08, 0x00, 0x07,
+   0x70, 0x60, 0x00, 0x00, 0x00, 0x0c, 0xe0, 0x00, 0x80, 0x83, 0x00, 0x00,
+   0x00, 0x14, 0x1c, 0x00, 0x00, 0x1c, 0x01, 0x00, 0x00, 0x94, 0x03, 0x20,
+   0x02, 0xe0, 0x01, 0x00, 0x00, 0x64, 0x00, 0x60, 0x02, 0x00, 0x03, 0x00,
+   0x00, 0x22, 0x00, 0xe0, 0x02, 0x00, 0x02, 0x00, 0x00, 0x22, 0x00, 0xa0,
+   0x02, 0x00, 0x02, 0x00, 0x00, 0x22, 0x00, 0xa0, 0x03, 0x00, 0x02, 0x00,
+   0x00, 0x22, 0x00, 0x20, 0x03, 0x00, 0x02, 0x00, 0x00, 0x12, 0x00, 0x20,
+   0x02, 0x00, 0x04, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00,
+   0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x11, 0x00, 0x00,
+   0x00, 0x00, 0x04, 0x00, 0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00,
+   0x00, 0x11, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00, 0x11, 0xf0, 0x00,
+   0x00, 0x0f, 0x04, 0x00, 0x00, 0x09, 0x00, 0x07, 0xf0, 0x00, 0x08, 0x00,
+   0x80, 0x08, 0x00, 0x08, 0x08, 0x00, 0x08, 0x00, 0x80, 0x08, 0x00, 0x10,
+   0x04, 0x00, 0x08, 0x00, 0x80, 0x08, 0x00, 0x20, 0x02, 0x00, 0x08, 0x00,
+   0x80, 0x08, 0x00, 0x40, 0x01, 0x00, 0x08, 0x00, 0x80, 0x08, 0x00, 0x40,
+   0x01, 0x00, 0x08, 0x00, 0x80, 0x08, 0x00, 0x80, 0x00, 0x00, 0x08, 0x00,
+   0x40, 0x04, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x40, 0x04, 0x00, 0x80,
+   0x00, 0x00, 0x10, 0x00, 0x40, 0x04, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00,
+   0x40, 0x04, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00, 0x40, 0x04, 0x00, 0x80,
+   0x00, 0x00, 0x10, 0x00, 0x40, 0x04, 0x00, 0x80, 0x00, 0x00, 0x10, 0x00,
+   0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80,
+   0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00,
+   0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80,
+   0x00, 0x00, 0x20, 0x00, 0x20, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00,
+   0x10, 0x02, 0x00, 0x80, 0x00, 0x00, 0x20, 0x00, 0x10, 0x01, 0x00, 0x80,
+   0x00, 0x00, 0x40, 0x00, 0x10, 0x01, 0x00, 0x80, 0x00, 0x00, 0x40, 0x00,
+   0x10, 0x01, 0x00, 0x80, 0x00, 0x00, 0x40, 0x00, 0x10, 0x01, 0x00, 0x80,
+   0x00, 0x00, 0x40, 0x00, 0x20, 0x01, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00,
+   0x20, 0x01, 0x00, 0x00, 0x00, 0x00, 0x40, 0x00, 0x20, 0x01, 0x00, 0x00,
+   0x00, 0x00, 0x40, 0x00, 0xa0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00,
+   0xc0, 0x00, 0x00, 0x00, 0x00, 0x00, 0x80, 0x00, 0xc0, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0xc0, 0x00, 0x80, 0xff, 0xff, 0xff, 0xff, 0xff, 0x7f, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+   0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 };
diff --git a/xshogi/western_bitmaps/lancePRW.xbm b/xshogi/western_bitmaps/lancePRW.xbm
index b423e25..034ba69 100644
--- a/xshogi/western_bitmaps/lancePRW.xbm
+++ b/xshogi/western_bitmaps/lancePRW.xbm
@@ -1,14 +1,38 @@
-#define lancePRW_width 32
-#define lancePRW_height 32
-static char lancePRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0xf9, 0xff, 0xff, 0xcf, 0xf9, 0x00, 0x80, 0xcf, 0x79, 0x00, 0x00, 0x4f,
-   0x32, 0x00, 0x62, 0x66, 0x12, 0x00, 0x75, 0x64, 0x12, 0x80, 0x38, 0x64,
-   0x12, 0x80, 0x10, 0x24, 0x24, 0x40, 0x24, 0x32, 0x24, 0x20, 0x42, 0x32,
-   0x24, 0x10, 0x21, 0x32, 0x24, 0x88, 0x18, 0x12, 0x48, 0x48, 0x04, 0x19,
-   0x48, 0x24, 0x02, 0x19, 0x48, 0x12, 0x01, 0x19, 0x48, 0xc2, 0x00, 0x09,
-   0x90, 0x26, 0x80, 0x0c, 0x90, 0x9e, 0x80, 0x0c, 0x90, 0x80, 0x80, 0x0c,
-   0x90, 0x80, 0x80, 0x04, 0x20, 0x81, 0x40, 0x06, 0x20, 0x81, 0x43, 0x06,
-   0x20, 0x01, 0x40, 0x06, 0x20, 0x06, 0x30, 0x02, 0xc0, 0x18, 0x8c, 0x01,
-   0x00, 0x23, 0x62, 0x00, 0x00, 0xcc, 0x19, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define lancePRW_width 64
+#define lancePRW_height 64
+static unsigned char lancePRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf8,0xff,0xff,0xff,0xff,0xff,
+ 0x3f,0x00,0x18,0x00,0x00,0x00,0x00,0x00,0x40,0x00,0x28,0x00,0x00,0x00,0x00,
+ 0x00,0x80,0x00,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x01,0x90,0xff,0xff,0xff,
+ 0xff,0xff,0xff,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x02,
+ 0x00,0x00,0x00,0x00,0x80,0x00,0x10,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x01,0x00,0x80,0x00,
+ 0x20,0x02,0x00,0x00,0x01,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x01,0x00,0x80,
+ 0x00,0x20,0x02,0x00,0x00,0x01,0x00,0x80,0x00,0x20,0x04,0x00,0x00,0x01,0x00,
+ 0x40,0x00,0x20,0x04,0x00,0x00,0x01,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x01,
+ 0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x01,0x00,0x40,0x00,0x40,0x04,0x00,0x00,
+ 0x01,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x01,0x00,0x40,0x00,0x40,0x04,0x00,
+ 0x00,0x01,0x00,0x40,0x00,0x40,0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x08,
+ 0xf0,0xff,0xff,0x1f,0x20,0x00,0x80,0x08,0x00,0x80,0x03,0x00,0x20,0x00,0x80,
+ 0x08,0x00,0x40,0x05,0x00,0x20,0x00,0x80,0x08,0x00,0x20,0x09,0x00,0x20,0x00,
+ 0x80,0x08,0x00,0x10,0x11,0x00,0x20,0x00,0x80,0x10,0x00,0x08,0x21,0x00,0x10,
+ 0x00,0x80,0x10,0x00,0x04,0x41,0x00,0x10,0x00,0x00,0x11,0x00,0x02,0x81,0x00,
+ 0x10,0x00,0x00,0x11,0x00,0x01,0x01,0x01,0x10,0x00,0x00,0x11,0x80,0x00,0x01,
+ 0x02,0x10,0x00,0x00,0x11,0x40,0x00,0x01,0x04,0x10,0x00,0x00,0x11,0x20,0x00,
+ 0x01,0x08,0x10,0x00,0x00,0x21,0x10,0x00,0x01,0x10,0x08,0x00,0x00,0x22,0x00,
+ 0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,
+ 0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0xc0,0x07,0x00,0x08,0x00,0x00,
+ 0x24,0x00,0x20,0x08,0x00,0x08,0x00,0x00,0x28,0x00,0xd0,0x17,0x00,0x08,0x00,
+ 0x00,0x48,0x00,0x08,0x24,0x00,0x04,0x00,0x00,0x50,0x00,0x08,0x24,0x00,0x04,
+ 0x00,0x00,0x50,0x00,0x08,0x24,0x00,0x04,0x00,0x00,0x60,0x00,0x08,0x24,0x00,
+ 0x04,0x00,0x00,0xc0,0x00,0x08,0x24,0x00,0x06,0x00,0x00,0x00,0x07,0x10,0x14,
+ 0xc0,0x01,0x00,0x00,0x00,0x38,0x20,0x08,0x38,0x00,0x00,0x00,0x00,0xc0,0xc1,
+ 0x07,0x07,0x00,0x00,0x00,0x00,0x00,0x0e,0xe0,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x70,0x1c,0x00,0x00,0x00,0x00,0x00,0x00,0x80,0x03,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/lancePW.xbm b/xshogi/western_bitmaps/lancePW.xbm
index 5bc230e..7ddaf49 100644
--- a/xshogi/western_bitmaps/lancePW.xbm
+++ b/xshogi/western_bitmaps/lancePW.xbm
@@ -1,14 +1,38 @@
-#define lancePW_width 32
-#define lancePW_height 32
-static char lancePW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xcc, 0x19, 0x00, 0x00, 0x23, 0x62, 0x00, 0xc0, 0x18, 0x8c, 0x01,
-   0x20, 0x06, 0x30, 0x02, 0x20, 0x01, 0x40, 0x06, 0x20, 0x05, 0x40, 0x06,
-   0x20, 0x05, 0x40, 0x06, 0x90, 0x04, 0x80, 0x04, 0x90, 0x04, 0x80, 0x0c,
-   0x90, 0x04, 0xbc, 0x0c, 0x90, 0x3c, 0xb2, 0x0c, 0x48, 0x80, 0x21, 0x09,
-   0x48, 0x40, 0x24, 0x19, 0x48, 0x20, 0x12, 0x19, 0x48, 0x10, 0x09, 0x19,
-   0x24, 0x8c, 0x08, 0x12, 0x24, 0x42, 0x04, 0x32, 0x24, 0x21, 0x02, 0x32,
-   0x24, 0x12, 0x01, 0x32, 0x12, 0x84, 0x00, 0x24, 0x12, 0x8e, 0x00, 0x64,
-   0x12, 0x57, 0x00, 0x64, 0x32, 0x23, 0x00, 0x66, 0x79, 0x00, 0x00, 0x4f,
-   0xf9, 0x00, 0x80, 0xcf, 0xf9, 0xff, 0xff, 0xcf, 0x01, 0x00, 0x00, 0xc0,
-   0xff, 0xff, 0xff, 0xff, 0xfe, 0xff, 0xff, 0xff};
+#define lancePW_width 64
+#define lancePW_height 64
+static unsigned char lancePW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0xe0,0x83,0x83,0x00,0x00,0x00,0x14,0x1c,0x10,0x04,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x28,0x08,0xe0,0x01,0x00,0x00,0x64,0x00,0x24,0x10,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x24,0x10,0x00,0x02,0x00,0x00,0x22,0x00,0x24,0x10,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x24,0x10,0x00,0x02,0x00,0x00,0x22,0x00,0x24,0x10,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0xe8,0x0b,0x00,0x04,0x00,0x00,0x12,0x00,0x10,0x04,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0xe0,0x03,0x00,0x04,0x00,0x00,0x11,0x00,0x00,
+ 0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x08,0x80,0x00,0x08,0x04,0x00,0x00,0x09,
+ 0x10,0x80,0x00,0x04,0x08,0x00,0x80,0x08,0x20,0x80,0x00,0x02,0x08,0x00,0x80,
+ 0x08,0x40,0x80,0x00,0x01,0x08,0x00,0x80,0x08,0x80,0x80,0x80,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x81,0x40,0x00,0x08,0x00,0x80,0x08,0x00,0x82,0x20,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x84,0x10,0x00,0x08,0x00,0x40,0x04,0x00,0x88,0x08,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0x90,0x04,0x00,0x10,0x00,0x40,0x04,0x00,0xa0,0x02,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0xc0,0x01,0x00,0x10,0x00,0x40,0x04,0xf8,0xff,
+ 0xff,0x0f,0x10,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0x80,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x80,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0x80,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/lanceRW.xbm b/xshogi/western_bitmaps/lanceRW.xbm
index 26e5de8..8990d4a 100644
--- a/xshogi/western_bitmaps/lanceRW.xbm
+++ b/xshogi/western_bitmaps/lanceRW.xbm
@@ -1,14 +1,38 @@
-#define lanceRW_width 32
-#define lanceRW_height 32
-static char lanceRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x40,
-   0x02, 0x00, 0x62, 0x60, 0x02, 0x00, 0x75, 0x60, 0x02, 0x80, 0x38, 0x60,
-   0x02, 0x80, 0x10, 0x20, 0x04, 0x40, 0x24, 0x30, 0x04, 0x20, 0x42, 0x30,
-   0x04, 0x10, 0x21, 0x30, 0x04, 0x88, 0x18, 0x10, 0x08, 0x48, 0x04, 0x18,
-   0x08, 0x24, 0x02, 0x18, 0x08, 0x12, 0x01, 0x18, 0x08, 0xc9, 0x00, 0x08,
-   0x10, 0x25, 0x00, 0x0c, 0x90, 0x10, 0x00, 0x0c, 0x90, 0x8d, 0x00, 0x0c,
-   0x90, 0x83, 0x00, 0x04, 0x20, 0x80, 0x00, 0x06, 0x20, 0x80, 0x00, 0x06,
-   0x20, 0x80, 0x00, 0x06, 0x20, 0x80, 0x07, 0x02, 0xc0, 0x00, 0x80, 0x01,
-   0x00, 0x03, 0x60, 0x00, 0x00, 0x0c, 0x18, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define lanceRW_width 64
+#define lanceRW_height 64
+static unsigned char lanceRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf8,0xff,0xff,0xff,0xff,0xff,
+ 0x3f,0x00,0x18,0x00,0x00,0x00,0x00,0x00,0x40,0x00,0x28,0x00,0x00,0x00,0x00,
+ 0x00,0x80,0x00,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x01,0x90,0xff,0xff,0xff,
+ 0xff,0xff,0xff,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x02,
+ 0x00,0x00,0x00,0x00,0x80,0x00,0x10,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x80,0x00,
+ 0x20,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x80,
+ 0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x04,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x20,0x04,0x00,0x00,0x00,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x00,0x00,0x40,0x00,0x40,0x04,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x00,0x00,0x40,0x00,0x40,0x04,0x00,
+ 0x00,0x00,0x00,0x40,0x00,0x40,0x08,0x00,0x00,0x00,0x00,0x20,0x00,0x80,0x08,
+ 0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,
+ 0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x08,0x00,0x00,0x01,0x00,0x20,0x00,
+ 0x80,0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x10,0x00,0x00,0x01,0x00,0x10,
+ 0x00,0x80,0x10,0x00,0x00,0x01,0x00,0x10,0x00,0x00,0x11,0x00,0x00,0x01,0x00,
+ 0x10,0x00,0x00,0x11,0x00,0x00,0x01,0x00,0x10,0x00,0x00,0x11,0x00,0x20,0x09,
+ 0x00,0x10,0x00,0x00,0x11,0x00,0xc0,0x07,0x00,0x10,0x00,0x00,0x11,0x00,0x80,
+ 0x03,0x00,0x10,0x00,0x00,0x21,0x00,0x00,0x01,0x00,0x08,0x00,0x00,0x22,0x00,
+ 0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,
+ 0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x08,0x00,0x00,
+ 0x24,0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x28,0x00,0xc0,0x07,0x00,0x08,0x00,
+ 0x00,0x48,0x00,0x00,0x04,0x00,0x04,0x00,0x00,0x50,0x00,0x00,0x04,0x00,0x04,
+ 0x00,0x00,0x50,0x00,0x00,0x04,0x00,0x04,0x00,0x00,0x60,0x00,0x00,0x04,0x00,
+ 0x04,0x00,0x00,0xc0,0x00,0x00,0x04,0x00,0x06,0x00,0x00,0x00,0x07,0x00,0x04,
+ 0xc0,0x01,0x00,0x00,0x00,0x38,0x00,0x00,0x38,0x00,0x00,0x00,0x00,0xc0,0x01,
+ 0x00,0x07,0x00,0x00,0x00,0x00,0x00,0x0e,0xe0,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x70,0x1c,0x00,0x00,0x00,0x00,0x00,0x00,0x80,0x03,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/lanceW.xbm b/xshogi/western_bitmaps/lanceW.xbm
index 943d4b8..6c66996 100644
--- a/xshogi/western_bitmaps/lanceW.xbm
+++ b/xshogi/western_bitmaps/lanceW.xbm
@@ -1,14 +1,38 @@
-#define lanceW_width 32
-#define lanceW_height 32
-static char lanceW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0x0c, 0x18, 0x00, 0x00, 0x03, 0x60, 0x00, 0xc0, 0x00, 0x80, 0x01,
-   0x20, 0x00, 0x00, 0x02, 0x20, 0x02, 0x00, 0x06, 0x20, 0x02, 0x00, 0x06,
-   0x20, 0x02, 0x00, 0x06, 0x10, 0x02, 0x00, 0x04, 0x10, 0x02, 0x70, 0x0c,
-   0x10, 0x1e, 0x4c, 0x0c, 0x10, 0x00, 0x42, 0x0c, 0x08, 0x80, 0x29, 0x08,
-   0x08, 0x40, 0x24, 0x18, 0x08, 0x20, 0x12, 0x18, 0x08, 0x10, 0x09, 0x18,
-   0x04, 0x8c, 0x08, 0x10, 0x04, 0x42, 0x04, 0x30, 0x04, 0x21, 0x02, 0x30,
-   0x04, 0x12, 0x01, 0x30, 0x02, 0x84, 0x00, 0x20, 0x02, 0x8f, 0x00, 0x60,
-   0x82, 0x57, 0x00, 0x60, 0xc2, 0x27, 0x00, 0x60, 0xe1, 0x03, 0x00, 0x40,
-   0xc1, 0x01, 0x00, 0xc0, 0x81, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0,
-   0xff, 0xff, 0xff, 0xff, 0xfe, 0xff, 0xff, 0xff};
+#define lanceW_width 64
+#define lanceW_height 64
+static unsigned char lanceW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0x20,0x00,0xe0,0x01,0x00,0x00,0x64,0x00,0x20,0x00,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x20,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x20,0x00,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x20,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x20,0x00,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0xe0,0x03,0x00,0x04,0x00,0x00,0x12,0x00,0x00,0x00,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,
+ 0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x80,0x00,0x00,0x04,0x00,0x00,0x09,
+ 0x00,0xc0,0x01,0x00,0x08,0x00,0x80,0x08,0x00,0xe0,0x03,0x00,0x08,0x00,0x80,
+ 0x08,0x00,0x90,0x04,0x00,0x08,0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x40,0x04,0x00,0x80,0x00,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x80,0x00,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x80,
+ 0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x00,0x00,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/noneW.xbm b/xshogi/western_bitmaps/noneW.xbm
index a1928f1..caff7bf 100644
--- a/xshogi/western_bitmaps/noneW.xbm
+++ b/xshogi/western_bitmaps/noneW.xbm
@@ -1,6 +1,6 @@
-#define noneW_width 32
-#define noneW_height 32
-static char noneW_bits[] = {
+#define noneW_width 64
+#define noneW_height 64
+static unsigned char noneW_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
@@ -9,4 +9,30 @@ static char noneW_bits[] = {
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
  0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
- 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00};
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/pawnPRW.xbm b/xshogi/western_bitmaps/pawnPRW.xbm
index 387c76d..1b55ad0 100644
--- a/xshogi/western_bitmaps/pawnPRW.xbm
+++ b/xshogi/western_bitmaps/pawnPRW.xbm
@@ -1,14 +1,38 @@
-#define pawnPRW_width 32
-#define pawnPRW_height 32
-static char pawnPRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0xf9, 0xff, 0xff, 0xcf, 0xf9, 0x00, 0x80, 0xcf, 0x79, 0x00, 0x00, 0x4f,
-   0x32, 0x00, 0x00, 0x66, 0x12, 0xf8, 0x0f, 0x64, 0x12, 0x10, 0x04, 0x64,
-   0x12, 0x20, 0x02, 0x24, 0x24, 0x40, 0x01, 0x32, 0x24, 0x40, 0x01, 0x32,
-   0x24, 0x40, 0x01, 0x32, 0x24, 0x40, 0x01, 0x12, 0x48, 0x40, 0x01, 0x19,
-   0x48, 0x40, 0x01, 0x19, 0x48, 0x40, 0x01, 0x19, 0x48, 0x40, 0x01, 0x09,
-   0x90, 0x40, 0x81, 0x0c, 0x90, 0x20, 0x82, 0x0c, 0x90, 0x10, 0x84, 0x0c,
-   0x90, 0x10, 0x84, 0x04, 0x20, 0x11, 0x44, 0x06, 0x20, 0x21, 0x42, 0x06,
-   0x20, 0xc1, 0x41, 0x06, 0x20, 0x06, 0x30, 0x02, 0xc0, 0x18, 0x8c, 0x01,
-   0x00, 0x23, 0x62, 0x00, 0x00, 0xcc, 0x19, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define pawnPRW_width 64
+#define pawnPRW_height 64
+static unsigned char pawnPRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf8,0xff,0xff,0xff,0xff,0xff,
+ 0x3f,0x00,0x18,0x00,0x00,0x00,0x00,0x00,0x40,0x00,0x28,0x00,0x00,0x00,0x00,
+ 0x00,0x80,0x00,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x01,0x90,0xff,0xff,0xff,
+ 0xff,0xff,0xff,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x02,
+ 0x00,0x00,0x00,0x00,0x80,0x00,0x10,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x01,0x00,0x80,0x00,
+ 0x20,0x02,0x00,0x00,0x01,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x01,0x00,0x80,
+ 0x00,0x20,0x02,0x00,0x00,0x01,0x00,0x80,0x00,0x20,0x04,0x00,0x00,0x01,0x00,
+ 0x40,0x00,0x20,0x04,0x00,0x00,0x01,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x01,
+ 0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x01,0x00,0x40,0x00,0x40,0x04,0x00,0x00,
+ 0x01,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x01,0x00,0x40,0x00,0x40,0x04,0x00,
+ 0x00,0x01,0x00,0x40,0x00,0x40,0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x08,
+ 0xf0,0xff,0xff,0x1f,0x20,0x00,0x80,0x08,0x00,0x80,0x03,0x00,0x20,0x00,0x80,
+ 0x08,0x00,0x40,0x05,0x00,0x20,0x00,0x80,0x08,0x00,0x20,0x09,0x00,0x20,0x00,
+ 0x80,0x08,0x00,0x10,0x11,0x00,0x20,0x00,0x80,0x10,0x00,0x08,0x21,0x00,0x10,
+ 0x00,0x80,0x10,0x00,0x04,0x41,0x00,0x10,0x00,0x00,0x11,0x00,0x02,0x81,0x00,
+ 0x10,0x00,0x00,0x11,0x00,0x01,0x01,0x01,0x10,0x00,0x00,0x11,0x80,0x00,0x01,
+ 0x02,0x10,0x00,0x00,0x11,0x40,0x00,0x01,0x04,0x10,0x00,0x00,0x11,0x20,0x00,
+ 0x01,0x08,0x10,0x00,0x00,0x21,0x10,0x00,0x01,0x10,0x08,0x00,0x00,0x22,0x00,
+ 0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,
+ 0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0xc0,0x07,0x00,0x08,0x00,0x00,
+ 0x24,0x00,0x20,0x08,0x00,0x08,0x00,0x00,0x28,0x00,0x10,0x14,0x00,0x08,0x00,
+ 0x00,0x48,0x00,0x08,0x24,0x00,0x04,0x00,0x00,0x50,0x00,0x08,0x24,0x00,0x04,
+ 0x00,0x00,0x50,0x00,0x88,0x27,0x00,0x04,0x00,0x00,0x60,0x00,0x48,0x24,0x00,
+ 0x04,0x00,0x00,0xc0,0x00,0x48,0x24,0x00,0x06,0x00,0x00,0x00,0x07,0x90,0x17,
+ 0xc0,0x01,0x00,0x00,0x00,0x38,0x20,0x08,0x38,0x00,0x00,0x00,0x00,0xc0,0xc1,
+ 0x07,0x07,0x00,0x00,0x00,0x00,0x00,0x0e,0xe0,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x70,0x1c,0x00,0x00,0x00,0x00,0x00,0x00,0x80,0x03,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/pawnPW.xbm b/xshogi/western_bitmaps/pawnPW.xbm
index 793d882..346d896 100644
--- a/xshogi/western_bitmaps/pawnPW.xbm
+++ b/xshogi/western_bitmaps/pawnPW.xbm
@@ -1,14 +1,38 @@
-#define pawnPW_width 32
-#define pawnPW_height 32
-static char pawnPW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xcc, 0x19, 0x00, 0x00, 0x23, 0x62, 0x00, 0xc0, 0x18, 0x8c, 0x01,
-   0x20, 0x06, 0x30, 0x02, 0x20, 0xc1, 0x41, 0x06, 0x20, 0x21, 0x42, 0x06,
-   0x20, 0x11, 0x44, 0x06, 0x90, 0x10, 0x84, 0x04, 0x90, 0x10, 0x84, 0x0c,
-   0x90, 0x20, 0x82, 0x0c, 0x90, 0x40, 0x81, 0x0c, 0x48, 0x40, 0x01, 0x09,
-   0x48, 0x40, 0x01, 0x19, 0x48, 0x40, 0x01, 0x19, 0x48, 0x40, 0x01, 0x19,
-   0x24, 0x40, 0x01, 0x12, 0x24, 0x40, 0x01, 0x32, 0x24, 0x40, 0x01, 0x32,
-   0x24, 0x40, 0x01, 0x32, 0x12, 0x20, 0x02, 0x24, 0x12, 0x10, 0x04, 0x64,
-   0x12, 0xf8, 0x0f, 0x64, 0x32, 0x00, 0x00, 0x66, 0x79, 0x00, 0x00, 0x4f,
-   0xf9, 0x00, 0x80, 0xcf, 0xf9, 0xff, 0xff, 0xcf, 0x01, 0x00, 0x00, 0xc0,
-   0xff, 0xff, 0xff, 0xff, 0xfe, 0xff, 0xff, 0xff};
+#define pawnPW_width 64
+#define pawnPW_height 64
+static unsigned char pawnPW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0xe0,0x83,0x83,0x00,0x00,0x00,0x14,0x1c,0x10,0x04,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0xe8,0x09,0xe0,0x01,0x00,0x00,0x64,0x00,0x24,0x12,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x24,0x12,0x00,0x02,0x00,0x00,0x22,0x00,0xe4,0x11,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x24,0x10,0x00,0x02,0x00,0x00,0x22,0x00,0x24,0x10,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0x28,0x08,0x00,0x04,0x00,0x00,0x12,0x00,0x10,0x04,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0xe0,0x03,0x00,0x04,0x00,0x00,0x11,0x00,0x00,
+ 0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x08,0x80,0x00,0x08,0x04,0x00,0x00,0x09,
+ 0x10,0x80,0x00,0x04,0x08,0x00,0x80,0x08,0x20,0x80,0x00,0x02,0x08,0x00,0x80,
+ 0x08,0x40,0x80,0x00,0x01,0x08,0x00,0x80,0x08,0x80,0x80,0x80,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x81,0x40,0x00,0x08,0x00,0x80,0x08,0x00,0x82,0x20,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x84,0x10,0x00,0x08,0x00,0x40,0x04,0x00,0x88,0x08,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0x90,0x04,0x00,0x10,0x00,0x40,0x04,0x00,0xa0,0x02,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0xc0,0x01,0x00,0x10,0x00,0x40,0x04,0xf8,0xff,
+ 0xff,0x0f,0x10,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0x80,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x80,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x80,0x00,0x00,0x20,0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0x80,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x80,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/pawnRW.xbm b/xshogi/western_bitmaps/pawnRW.xbm
index cdd973f..2218492 100644
--- a/xshogi/western_bitmaps/pawnRW.xbm
+++ b/xshogi/western_bitmaps/pawnRW.xbm
@@ -1,14 +1,38 @@
-#define pawnRW_width 32
-#define pawnRW_height 32
-static char pawnRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x40,
-   0x02, 0x00, 0x00, 0x60, 0x02, 0xf8, 0x0f, 0x60, 0x02, 0x10, 0x04, 0x60,
-   0x02, 0x20, 0x02, 0x20, 0x04, 0x40, 0x01, 0x30, 0x04, 0x40, 0x01, 0x30,
-   0x04, 0x40, 0x01, 0x30, 0x04, 0x40, 0x01, 0x10, 0x08, 0x40, 0x01, 0x18,
-   0x08, 0x40, 0x01, 0x18, 0x08, 0x40, 0x01, 0x18, 0x08, 0x40, 0x01, 0x08,
-   0x10, 0x40, 0x01, 0x0c, 0x10, 0x80, 0x00, 0x0c, 0x10, 0x80, 0x00, 0x0c,
-   0x10, 0x80, 0x00, 0x04, 0x20, 0x80, 0x00, 0x06, 0x20, 0x80, 0x00, 0x06,
-   0x20, 0x80, 0x00, 0x06, 0x20, 0x80, 0x00, 0x02, 0xc0, 0x00, 0x80, 0x01,
-   0x00, 0x03, 0x60, 0x00, 0x00, 0x0c, 0x18, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define pawnRW_width 64
+#define pawnRW_height 64
+static unsigned char pawnRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf8,0xff,0xff,0xff,0xff,0xff,
+ 0x3f,0x00,0x18,0x00,0x00,0x00,0x00,0x00,0x40,0x00,0x28,0x00,0x00,0x00,0x00,
+ 0x00,0x80,0x00,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x01,0x90,0xff,0xff,0xff,
+ 0xff,0xff,0xff,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x10,0x01,0x00,0x00,0x00,0x00,0x00,0x01,0x10,0x02,
+ 0x00,0x00,0x00,0x00,0x80,0x00,0x10,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x80,0x00,
+ 0x20,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x80,
+ 0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x80,0x00,0x20,0x04,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x20,0x04,0x00,0x00,0x00,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x00,0x00,0x40,0x00,0x40,0x04,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0x40,0x04,0x00,0x00,0x00,0x00,0x40,0x00,0x40,0x04,0x00,
+ 0x00,0x00,0x00,0x40,0x00,0x40,0x08,0x00,0x00,0x00,0x00,0x20,0x00,0x80,0x08,
+ 0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,
+ 0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x08,0x00,0x00,0x01,0x00,0x20,0x00,
+ 0x80,0x08,0x00,0x00,0x01,0x00,0x20,0x00,0x80,0x10,0x00,0x00,0x01,0x00,0x10,
+ 0x00,0x80,0x10,0x00,0x00,0x01,0x00,0x10,0x00,0x00,0x11,0x00,0x00,0x01,0x00,
+ 0x10,0x00,0x00,0x11,0x00,0x00,0x01,0x00,0x10,0x00,0x00,0x11,0x00,0x00,0x01,
+ 0x00,0x10,0x00,0x00,0x11,0x00,0x00,0x01,0x00,0x10,0x00,0x00,0x11,0x00,0x00,
+ 0x01,0x00,0x10,0x00,0x00,0x21,0x00,0x00,0x01,0x00,0x08,0x00,0x00,0x22,0x00,
+ 0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,
+ 0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x22,0x00,0x00,0x00,0x00,0x08,0x00,0x00,
+ 0x24,0x00,0x00,0x00,0x00,0x08,0x00,0x00,0x28,0x00,0x00,0x04,0x00,0x08,0x00,
+ 0x00,0x48,0x00,0x00,0x04,0x00,0x04,0x00,0x00,0x50,0x00,0x00,0x04,0x00,0x04,
+ 0x00,0x00,0x50,0x00,0x80,0x07,0x00,0x04,0x00,0x00,0x60,0x00,0x40,0x04,0x00,
+ 0x04,0x00,0x00,0xc0,0x00,0x40,0x04,0x00,0x06,0x00,0x00,0x00,0x07,0x80,0x07,
+ 0xc0,0x01,0x00,0x00,0x00,0x38,0x00,0x00,0x38,0x00,0x00,0x00,0x00,0xc0,0x01,
+ 0x00,0x07,0x00,0x00,0x00,0x00,0x00,0x0e,0xe0,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x70,0x1c,0x00,0x00,0x00,0x00,0x00,0x00,0x80,0x03,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/pawnW.xbm b/xshogi/western_bitmaps/pawnW.xbm
index 2d4ade0..84f1998 100644
--- a/xshogi/western_bitmaps/pawnW.xbm
+++ b/xshogi/western_bitmaps/pawnW.xbm
@@ -1,14 +1,38 @@
-#define pawnW_width 32
-#define pawnW_height 32
-static char pawnW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0x0c, 0x18, 0x00, 0x00, 0x03, 0x60, 0x00, 0xc0, 0x00, 0x80, 0x01,
-   0x20, 0x00, 0x00, 0x02, 0x20, 0x80, 0x00, 0x06, 0x20, 0x80, 0x00, 0x06,
-   0x20, 0x80, 0x00, 0x06, 0x10, 0x80, 0x00, 0x04, 0x10, 0x80, 0x00, 0x0c,
-   0x10, 0x80, 0x00, 0x0c, 0x10, 0x40, 0x01, 0x0c, 0x08, 0x40, 0x01, 0x08,
-   0x08, 0x40, 0x01, 0x18, 0x08, 0x40, 0x01, 0x18, 0x08, 0x40, 0x01, 0x18,
-   0x04, 0x40, 0x01, 0x10, 0x04, 0x40, 0x01, 0x30, 0x04, 0x40, 0x01, 0x30,
-   0x04, 0x40, 0x01, 0x30, 0x02, 0x20, 0x02, 0x20, 0x02, 0x10, 0x04, 0x60,
-   0x02, 0xf8, 0x0f, 0x60, 0x02, 0x00, 0x00, 0x60, 0x01, 0x00, 0x00, 0x40,
-   0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0,
-   0xff, 0xff, 0xff, 0xff, 0xfe, 0xff, 0xff, 0xff};
+#define pawnW_width 64
+#define pawnW_height 64
+static unsigned char pawnW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0xf0,0x01,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x4f,0x0e,0x00,0x00,0x00,0x00,0x00,0xf0,0x80,
+ 0x70,0x00,0x00,0x00,0x00,0x00,0x0f,0xc0,0x81,0x03,0x00,0x00,0x00,0xf0,0x00,
+ 0x38,0x0e,0x1c,0x00,0x00,0x00,0x08,0x00,0x07,0x70,0x60,0x00,0x00,0x00,0x0c,
+ 0xe0,0x00,0x80,0x83,0x00,0x00,0x00,0x14,0x1c,0x00,0x00,0x1c,0x01,0x00,0x00,
+ 0x94,0x03,0xe0,0x01,0xe0,0x01,0x00,0x00,0x64,0x00,0x20,0x02,0x00,0x03,0x00,
+ 0x00,0x22,0x00,0x20,0x02,0x00,0x02,0x00,0x00,0x22,0x00,0xe0,0x01,0x00,0x02,
+ 0x00,0x00,0x22,0x00,0x20,0x00,0x00,0x02,0x00,0x00,0x22,0x00,0x20,0x00,0x00,
+ 0x02,0x00,0x00,0x12,0x00,0x20,0x00,0x00,0x04,0x00,0x00,0x12,0x00,0x00,0x00,
+ 0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,
+ 0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,
+ 0x00,0x00,0x00,0x04,0x00,0x00,0x11,0x00,0x80,0x00,0x00,0x04,0x00,0x00,0x09,
+ 0x00,0x80,0x00,0x00,0x08,0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x80,
+ 0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,
+ 0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,
+ 0x00,0x80,0x08,0x00,0x80,0x00,0x00,0x08,0x00,0x40,0x04,0x00,0x80,0x00,0x00,
+ 0x10,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x80,0x00,
+ 0x00,0x10,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x80,
+ 0x00,0x00,0x10,0x00,0x40,0x04,0x00,0x00,0x00,0x00,0x10,0x00,0x20,0x02,0x00,
+ 0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,
+ 0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,
+ 0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x20,0x02,0x00,0x00,0x00,0x00,0x20,0x00,
+ 0x10,0x02,0x00,0x00,0x00,0x00,0x20,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,
+ 0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,
+ 0x40,0x00,0x10,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,
+ 0x00,0x40,0x00,0x20,0x01,0x00,0x00,0x00,0x00,0x40,0x00,0x20,0x01,0x00,0x00,
+ 0x00,0x00,0x40,0x00,0xa0,0x00,0x00,0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0xc0,0x00,0x00,0x00,0x00,0x00,0xc0,0x00,0x80,0xff,
+ 0xff,0xff,0xff,0xff,0x7f,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/rookPRW.xbm b/xshogi/western_bitmaps/rookPRW.xbm
index d1f7e83..a6b6362 100644
--- a/xshogi/western_bitmaps/rookPRW.xbm
+++ b/xshogi/western_bitmaps/rookPRW.xbm
@@ -1,14 +1,38 @@
-#define rookPRW_width 32
-#define rookPRW_height 32
-static char rookPRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0xf9, 0xff, 0xff, 0xcf, 0xf9, 0x00, 0x80, 0xcf, 0x79, 0xf0, 0x07, 0x4f,
-   0x32, 0x0c, 0x18, 0x66, 0x12, 0x08, 0x08, 0x64, 0x12, 0xe8, 0x09, 0x64,
-   0x12, 0x28, 0x0a, 0x24, 0x24, 0x28, 0x0a, 0x32, 0x24, 0xec, 0x19, 0x32,
-   0x24, 0x24, 0x11, 0x32, 0x24, 0x24, 0x12, 0x12, 0x48, 0x24, 0x12, 0x19,
-   0x48, 0x04, 0x10, 0x19, 0x48, 0x04, 0x10, 0x19, 0x48, 0x74, 0x17, 0x09,
-   0x90, 0x54, 0x95, 0x0c, 0x90, 0x54, 0x95, 0x0c, 0x90, 0x5c, 0x9d, 0x0c,
-   0x90, 0x40, 0x81, 0x04, 0x20, 0x41, 0x41, 0x06, 0x20, 0xc1, 0x41, 0x06,
-   0x20, 0x01, 0x40, 0x06, 0x20, 0x06, 0x30, 0x02, 0xc0, 0x18, 0x8c, 0x01,
-   0x00, 0x23, 0x62, 0x00, 0x00, 0xcc, 0x19, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define rookPRW_width 64
+#define rookPRW_height 64
+static unsigned char rookPRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x10,0x00,0x01,0x10,0x00,0x20,
+ 0x48,0x00,0x20,0x80,0x03,0x08,0x00,0x20,0x48,0x00,0x40,0xc0,0x07,0x04,0x00,
+ 0x20,0x48,0x00,0x80,0x20,0x09,0x02,0x00,0x20,0x48,0x00,0x00,0x01,0x01,0x01,
+ 0x00,0x10,0x48,0x00,0x00,0x02,0x81,0x00,0x00,0x10,0x88,0x00,0x00,0x04,0x41,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x08,0x21,0x00,0x00,0x10,0x90,0x00,0x00,0x10,
+ 0x11,0x00,0x00,0x10,0x90,0x00,0x80,0x20,0x09,0x02,0x00,0x10,0x90,0x00,0x40,
+ 0x40,0x05,0x04,0x00,0x08,0x90,0x00,0x60,0x80,0x03,0x0c,0x00,0x08,0x10,0x01,
+ 0xf0,0xff,0xff,0x1f,0x00,0x08,0x10,0x01,0x60,0x80,0x03,0x0c,0x00,0x08,0x20,
+ 0x01,0x40,0x40,0x05,0x04,0x00,0x08,0x20,0x01,0x80,0x20,0x09,0x02,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x11,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x21,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x41,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x81,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x01,0x01,0x00,0x04,0x40,0x02,0x80,0x20,0x09,
+ 0x02,0x00,0x04,0x40,0x02,0x40,0xc0,0x07,0x04,0x00,0x02,0x40,0x02,0x20,0x80,
+ 0x03,0x08,0x00,0x02,0x40,0x02,0x10,0x00,0x01,0x10,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0xc0,0x07,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x20,0x08,0x00,0x00,0x01,0x80,0x04,0x00,0x50,0x14,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x48,0x24,0x00,0x00,0x01,0x80,0x08,0x00,0x88,0x24,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x88,0x27,0x00,0x00,0x01,0x00,0x09,0x00,0x48,0x24,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x48,0x24,0x00,0x80,0x00,0x00,0x09,0x00,0x90,0x17,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x08,0x00,0x80,0x00,0x00,0x09,0x00,0xc0,
+ 0x07,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/rookPW.xbm b/xshogi/western_bitmaps/rookPW.xbm
index 88ed871..cde0442 100644
--- a/xshogi/western_bitmaps/rookPW.xbm
+++ b/xshogi/western_bitmaps/rookPW.xbm
@@ -1,14 +1,38 @@
-#define rookPW_width 32
-#define rookPW_height 32
-static char rookPW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xcc, 0x19, 0x00, 0x00, 0x23, 0x62, 0x00, 0xc0, 0x18, 0x8c, 0x01,
-   0x20, 0x06, 0x30, 0x02, 0x20, 0x01, 0x40, 0x06, 0x20, 0xc1, 0x41, 0x06,
-   0x20, 0x41, 0x41, 0x06, 0x90, 0x40, 0x81, 0x04, 0x90, 0x4e, 0xb9, 0x0c,
-   0x90, 0x4a, 0xa9, 0x0c, 0x90, 0x4a, 0xa9, 0x0c, 0x48, 0x7a, 0x2f, 0x09,
-   0x48, 0x02, 0x20, 0x19, 0x48, 0x02, 0x20, 0x19, 0x48, 0xe2, 0x21, 0x19,
-   0x24, 0x22, 0x22, 0x12, 0x24, 0x22, 0x22, 0x32, 0x24, 0xe6, 0x31, 0x32,
-   0x24, 0x24, 0x11, 0x32, 0x12, 0x24, 0x12, 0x24, 0x12, 0x24, 0x12, 0x64,
-   0x12, 0x04, 0x10, 0x64, 0x32, 0x06, 0x30, 0x66, 0x79, 0xf8, 0x0f, 0x4f,
-   0xf9, 0x00, 0x80, 0xcf, 0xf9, 0xff, 0xff, 0xcf, 0x01, 0x00, 0x00, 0xc0,
-   0xff, 0xff, 0xff, 0xff, 0xfe, 0xff, 0xff, 0xff};
+#define rookPW_width 64
+#define rookPW_height 64
+static unsigned char rookPW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0xe0,0x03,0x00,0x4f,0x00,0x00,0x12,0x00,0x10,0x04,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xe8,0x09,0x00,0x80,0x00,0x00,0x11,0x00,0x24,0x12,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x24,0x12,0x00,0x80,0x00,0x00,0x09,0x00,0xe4,0x11,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x24,0x11,0x00,0x80,0x00,0x00,0x09,0x00,0x24,0x12,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0x28,0x0a,0x00,0x80,0x00,0x00,0x09,0x00,0x10,0x04,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0xe0,0x03,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x08,0x80,0x00,0x08,0x00,0x01,0x80,0x04,
+ 0x10,0xc0,0x01,0x04,0x00,0x01,0x80,0x04,0x20,0xe0,0x03,0x02,0x00,0x02,0x40,
+ 0x04,0x40,0x90,0x04,0x01,0x00,0x02,0x40,0x02,0x80,0x80,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x81,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x82,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x84,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x88,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x40,0x90,0x04,0x01,0x00,0x04,0x20,0x02,0x20,0xa0,0x02,
+ 0x02,0x00,0x04,0x20,0x01,0x30,0xc0,0x01,0x06,0x00,0x04,0x20,0x01,0xf8,0xff,
+ 0xff,0x0f,0x00,0x04,0x20,0x01,0x30,0xc0,0x01,0x06,0x00,0x04,0x20,0x01,0x20,
+ 0xa0,0x02,0x02,0x00,0x08,0x20,0x01,0x40,0x90,0x04,0x01,0x00,0x08,0x10,0x01,
+ 0x00,0x88,0x08,0x00,0x00,0x08,0x10,0x01,0x00,0x84,0x10,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x82,0x20,0x00,0x00,0x08,0x90,0x00,0x00,0x81,0x40,0x00,0x00,0x08,
+ 0x90,0x00,0x80,0x80,0x80,0x00,0x00,0x10,0x90,0x00,0x40,0x90,0x04,0x01,0x00,
+ 0x10,0x90,0x00,0x20,0xe0,0x03,0x02,0x00,0x10,0x88,0x00,0x10,0xc0,0x01,0x04,
+ 0x00,0x10,0x48,0x00,0x08,0x80,0x00,0x08,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/rookRW.xbm b/xshogi/western_bitmaps/rookRW.xbm
index 34d30a1..f5715de 100644
--- a/xshogi/western_bitmaps/rookRW.xbm
+++ b/xshogi/western_bitmaps/rookRW.xbm
@@ -1,14 +1,38 @@
-#define rookRW_width 32
-#define rookRW_height 32
-static char rookRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0x01, 0xfe, 0x3f, 0xc0, 0x01, 0x01, 0x40, 0xc0, 0x01, 0x02, 0x20, 0x40,
-   0x02, 0x0c, 0x18, 0x60, 0x02, 0x08, 0x08, 0x60, 0x02, 0xe8, 0x09, 0x60,
-   0x02, 0x28, 0x0a, 0x20, 0x04, 0x28, 0x0a, 0x30, 0x04, 0xec, 0x19, 0x30,
-   0x04, 0x24, 0x11, 0x30, 0x04, 0x24, 0x12, 0x10, 0x08, 0x24, 0x12, 0x18,
-   0x08, 0x04, 0x10, 0x18, 0x08, 0x04, 0x10, 0x18, 0x08, 0x74, 0x17, 0x08,
-   0x10, 0x54, 0x15, 0x0c, 0x10, 0x54, 0x15, 0x0c, 0x10, 0x5c, 0x1d, 0x0c,
-   0x10, 0x40, 0x01, 0x04, 0x20, 0x40, 0x01, 0x06, 0x20, 0xc0, 0x01, 0x06,
-   0x20, 0x00, 0x00, 0x06, 0x20, 0x00, 0x00, 0x02, 0xc0, 0x00, 0x80, 0x01,
-   0x00, 0x03, 0x60, 0x00, 0x00, 0x0c, 0x18, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define rookRW_width 64
+#define rookRW_height 64
+static unsigned char rookRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,
+ 0x48,0x00,0x00,0x80,0x03,0x00,0x00,0x20,0x48,0x00,0x00,0xc0,0x07,0x00,0x00,
+ 0x20,0x48,0x00,0x00,0x20,0x09,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,
+ 0x00,0x10,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x88,0x00,0x00,0x00,0x01,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x90,0x00,0x00,0x00,
+ 0x01,0x00,0x00,0x10,0x90,0x00,0x80,0x00,0x01,0x02,0x00,0x10,0x90,0x00,0x40,
+ 0x00,0x01,0x04,0x00,0x08,0x90,0x00,0x60,0x00,0x01,0x0c,0x00,0x08,0x10,0x01,
+ 0xf0,0xff,0xff,0x1f,0x00,0x08,0x10,0x01,0x60,0x00,0x01,0x0c,0x00,0x08,0x20,
+ 0x01,0x40,0x00,0x01,0x04,0x00,0x08,0x20,0x01,0x80,0x00,0x01,0x02,0x00,0x08,
+ 0x20,0x01,0x00,0x00,0x01,0x00,0x00,0x04,0x20,0x01,0x00,0x00,0x01,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x00,0x01,0x00,0x00,0x04,0x20,0x02,0x00,0x00,0x01,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x00,0x01,0x00,0x00,0x04,0x40,0x02,0x00,0x20,0x09,
+ 0x00,0x00,0x04,0x40,0x02,0x00,0xc0,0x07,0x00,0x00,0x02,0x40,0x02,0x00,0x80,
+ 0x03,0x00,0x00,0x02,0x40,0x02,0x00,0x00,0x01,0x00,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x40,0x04,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x40,0x04,0x00,0x00,0x01,0x80,0x08,0x00,0x80,0x04,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x80,0x07,0x00,0x00,0x01,0x00,0x09,0x00,0x40,0x04,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x40,0x04,0x00,0x80,0x00,0x00,0x09,0x00,0x80,0x07,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x00,
+ 0x00,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/rookW.xbm b/xshogi/western_bitmaps/rookW.xbm
index 1d5b617..4b4e3ae 100644
--- a/xshogi/western_bitmaps/rookW.xbm
+++ b/xshogi/western_bitmaps/rookW.xbm
@@ -1,14 +1,38 @@
-#define rookW_width 32
-#define rookW_height 32
-static char rookW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0x0c, 0x18, 0x00, 0x00, 0x03, 0x60, 0x00, 0xc0, 0x00, 0x80, 0x01,
-   0x20, 0x00, 0x00, 0x02, 0x20, 0x00, 0x00, 0x06, 0x20, 0xc0, 0x01, 0x06,
-   0x20, 0x40, 0x01, 0x06, 0x10, 0x40, 0x01, 0x04, 0x10, 0x4e, 0x39, 0x0c,
-   0x10, 0x4a, 0x29, 0x0c, 0x10, 0x4a, 0x29, 0x0c, 0x08, 0x7a, 0x2f, 0x08,
-   0x08, 0x02, 0x20, 0x18, 0x08, 0x02, 0x20, 0x18, 0x08, 0xe2, 0x21, 0x18,
-   0x04, 0x22, 0x22, 0x10, 0x04, 0x22, 0x22, 0x30, 0x04, 0xe6, 0x31, 0x30,
-   0x04, 0x24, 0x11, 0x30, 0x02, 0x24, 0x12, 0x20, 0x02, 0x24, 0x12, 0x60,
-   0x02, 0x04, 0x10, 0x60, 0x02, 0x06, 0x30, 0x60, 0x01, 0x02, 0x20, 0x40,
-   0x01, 0xfc, 0x1f, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0,
-   0xff, 0xff, 0xff, 0xff, 0xfe, 0xff, 0xff, 0xff};
+#define rookW_width 64
+#define rookW_height 64
+static unsigned char rookW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0x00,0x00,0x00,0x4f,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xe0,0x01,0x00,0x80,0x00,0x00,0x11,0x00,0x20,0x02,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0xe0,0x01,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x20,0x01,0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x02,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0x20,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x80,0x00,0x00,0x00,0x01,0x80,0x04,
+ 0x00,0xc0,0x01,0x00,0x00,0x01,0x80,0x04,0x00,0xe0,0x03,0x00,0x00,0x02,0x40,
+ 0x04,0x00,0x90,0x04,0x00,0x00,0x02,0x40,0x02,0x00,0x80,0x00,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x80,0x00,0x00,0x00,0x02,0x40,0x02,0x00,0x80,0x00,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x80,0x00,0x00,0x00,0x02,0x40,0x02,0x00,0x80,0x00,0x00,
+ 0x00,0x04,0x20,0x02,0x40,0x80,0x00,0x01,0x00,0x04,0x20,0x02,0x20,0x80,0x00,
+ 0x02,0x00,0x04,0x20,0x01,0x30,0x80,0x00,0x06,0x00,0x04,0x20,0x01,0xf8,0xff,
+ 0xff,0x0f,0x00,0x04,0x20,0x01,0x30,0x80,0x00,0x06,0x00,0x04,0x20,0x01,0x20,
+ 0x80,0x00,0x02,0x00,0x08,0x20,0x01,0x40,0x80,0x00,0x01,0x00,0x08,0x10,0x01,
+ 0x00,0x80,0x00,0x00,0x00,0x08,0x10,0x01,0x00,0x80,0x00,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x80,0x00,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x08,
+ 0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x90,0x00,0x00,0x90,0x04,0x00,0x00,
+ 0x10,0x90,0x00,0x00,0xe0,0x03,0x00,0x00,0x10,0x88,0x00,0x00,0xc0,0x01,0x00,
+ 0x00,0x10,0x48,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/silverPRW.xbm b/xshogi/western_bitmaps/silverPRW.xbm
index 93efd8c..d0926ab 100644
--- a/xshogi/western_bitmaps/silverPRW.xbm
+++ b/xshogi/western_bitmaps/silverPRW.xbm
@@ -1,14 +1,38 @@
-#define silverPRW_width 32
-#define silverPRW_height 32
-static char silverPRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0xf9, 0xff, 0xff, 0xcf, 0xf9, 0x00, 0x80, 0xcf, 0x79, 0x1c, 0x1c, 0x4f,
-   0x32, 0x22, 0x22, 0x66, 0x12, 0x41, 0x41, 0x64, 0x12, 0xe2, 0x23, 0x64,
-   0x12, 0xbc, 0x1e, 0x24, 0x24, 0x56, 0x35, 0x32, 0x24, 0xab, 0x6a, 0x32,
-   0x24, 0x56, 0x35, 0x32, 0x24, 0xbc, 0x1e, 0x12, 0x48, 0xe2, 0x23, 0x19,
-   0x48, 0x41, 0x41, 0x19, 0x48, 0x22, 0x22, 0x19, 0x48, 0x1c, 0x1c, 0x09,
-   0x90, 0xc0, 0x81, 0x0c, 0x90, 0x20, 0x82, 0x0c, 0x90, 0x20, 0x80, 0x0c,
-   0x90, 0xc0, 0x81, 0x04, 0x20, 0x01, 0x42, 0x06, 0x20, 0x21, 0x42, 0x06,
-   0x20, 0xc1, 0x41, 0x06, 0x20, 0x06, 0x30, 0x02, 0xc0, 0x18, 0x8c, 0x01,
-   0x00, 0x23, 0x62, 0x00, 0x00, 0xcc, 0x19, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define silverPRW_width 64
+#define silverPRW_height 64
+static unsigned char silverPRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,
+ 0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,
+ 0x20,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x01,0x00,
+ 0x00,0x10,0x48,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x88,0x00,0x00,0x00,0x01,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x90,0x00,0x00,0x00,
+ 0x01,0x00,0x00,0x10,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x10,0x90,0x00,0x00,
+ 0x00,0x01,0x00,0x00,0x08,0x90,0x00,0x00,0x00,0x01,0x00,0x00,0x08,0x10,0x01,
+ 0xf0,0xff,0xff,0x1f,0x00,0x08,0x10,0x01,0x00,0x80,0x03,0x00,0x00,0x08,0x20,
+ 0x01,0x00,0x40,0x05,0x00,0x00,0x08,0x20,0x01,0x00,0x20,0x09,0x00,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x11,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x21,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x41,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x81,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x01,0x01,0x00,0x04,0x40,0x02,0x80,0x00,0x01,
+ 0x02,0x00,0x04,0x40,0x02,0x40,0x00,0x01,0x04,0x00,0x02,0x40,0x02,0x20,0x00,
+ 0x01,0x08,0x00,0x02,0x40,0x02,0x10,0x00,0x01,0x10,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0xc0,0x07,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x20,0x08,0x00,0x00,0x01,0x80,0x04,0x00,0x90,0x17,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x48,0x20,0x00,0x00,0x01,0x80,0x08,0x00,0x48,0x20,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x88,0x23,0x00,0x00,0x01,0x00,0x09,0x00,0x08,0x24,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x08,0x24,0x00,0x80,0x00,0x00,0x09,0x00,0xd0,0x13,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x20,0x08,0x00,0x80,0x00,0x00,0x09,0x00,0xc0,
+ 0x07,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/silverPW.xbm b/xshogi/western_bitmaps/silverPW.xbm
index 8dd52df..fa85df2 100644
--- a/xshogi/western_bitmaps/silverPW.xbm
+++ b/xshogi/western_bitmaps/silverPW.xbm
@@ -1,14 +1,38 @@
-#define silverPW_width 32
-#define silverPW_height 32
-static char silverPW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xcc, 0x19, 0x00, 0x00, 0x23, 0x62, 0x00, 0xc0, 0x18, 0x8c, 0x01,
-   0x20, 0xc6, 0x31, 0x02, 0x20, 0x21, 0x42, 0x06, 0x20, 0x21, 0x40, 0x06,
-   0x20, 0xc1, 0x41, 0x06, 0x90, 0x00, 0x82, 0x04, 0x90, 0x20, 0x82, 0x0c,
-   0x90, 0xc0, 0x81, 0x0c, 0x90, 0x00, 0x80, 0x0c, 0x48, 0x1c, 0x1c, 0x09,
-   0x48, 0x22, 0x22, 0x19, 0x48, 0x41, 0x41, 0x19, 0x48, 0xe2, 0x23, 0x19,
-   0x24, 0xbc, 0x1e, 0x12, 0x24, 0x56, 0x35, 0x32, 0x24, 0xab, 0x6a, 0x32,
-   0x24, 0x56, 0x35, 0x32, 0x12, 0xbc, 0x1e, 0x24, 0x12, 0xe2, 0x23, 0x64,
-   0x12, 0x41, 0x41, 0x64, 0x32, 0x22, 0x22, 0x66, 0x79, 0x1c, 0x1c, 0x4f,
-   0xf9, 0x00, 0x80, 0xcf, 0xf9, 0xff, 0xff, 0xcf, 0x01, 0x00, 0x00, 0xc0,
-   0xff, 0xff, 0xff, 0xff, 0xfe, 0xff, 0xff, 0xff};
+#define silverPW_width 64
+#define silverPW_height 64
+static unsigned char silverPW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0xe0,0x03,0x00,0x4f,0x00,0x00,0x12,0x00,0x10,0x04,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xc8,0x0b,0x00,0x80,0x00,0x00,0x11,0x00,0x24,0x10,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x24,0x10,0x00,0x80,0x00,0x00,0x09,0x00,0xc4,0x11,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x04,0x12,0x00,0x80,0x00,0x00,0x09,0x00,0x04,0x12,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0xe8,0x09,0x00,0x80,0x00,0x00,0x09,0x00,0x10,0x04,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0xe0,0x03,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x08,0x80,0x00,0x08,0x00,0x01,0x80,0x04,
+ 0x10,0x80,0x00,0x04,0x00,0x01,0x80,0x04,0x20,0x80,0x00,0x02,0x00,0x02,0x40,
+ 0x04,0x40,0x80,0x00,0x01,0x00,0x02,0x40,0x02,0x80,0x80,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x81,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x82,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x84,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x88,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x90,0x04,0x00,0x00,0x04,0x20,0x02,0x00,0xa0,0x02,
+ 0x00,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0xf8,0xff,
+ 0xff,0x0f,0x00,0x04,0x20,0x01,0x00,0x80,0x00,0x00,0x00,0x04,0x20,0x01,0x00,
+ 0x80,0x00,0x00,0x00,0x08,0x20,0x01,0x00,0x80,0x00,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x80,0x00,0x00,0x00,0x08,0x10,0x01,0x00,0x80,0x00,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x80,0x00,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x08,
+ 0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x90,0x00,0x00,0x80,0x00,0x00,0x00,
+ 0x10,0x90,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x88,0x00,0x00,0x80,0x00,0x00,
+ 0x00,0x10,0x48,0x00,0x00,0x80,0x00,0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/silverRW.xbm b/xshogi/western_bitmaps/silverRW.xbm
index f44cbff..da1f1a2 100644
--- a/xshogi/western_bitmaps/silverRW.xbm
+++ b/xshogi/western_bitmaps/silverRW.xbm
@@ -1,14 +1,38 @@
-#define silverRW_width 32
-#define silverRW_height 32
-static char silverRW_bits[] = {
-   0xfe, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x01, 0x00, 0x00, 0xc0,
-   0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x1c, 0x1c, 0x40,
-   0x02, 0x22, 0x22, 0x60, 0x02, 0x41, 0x41, 0x60, 0x02, 0xe2, 0x23, 0x60,
-   0x02, 0xbc, 0x1e, 0x20, 0x04, 0x56, 0x35, 0x30, 0x04, 0xab, 0x6a, 0x30,
-   0x04, 0x56, 0x35, 0x30, 0x04, 0xbc, 0x1e, 0x10, 0x08, 0xe2, 0x23, 0x18,
-   0x08, 0x41, 0x41, 0x18, 0x08, 0x22, 0x22, 0x18, 0x08, 0x1c, 0x1c, 0x08,
-   0x10, 0xc0, 0x01, 0x0c, 0x10, 0x20, 0x02, 0x0c, 0x10, 0x20, 0x00, 0x0c,
-   0x10, 0xc0, 0x01, 0x04, 0x20, 0x00, 0x02, 0x06, 0x20, 0x20, 0x02, 0x06,
-   0x20, 0xc0, 0x01, 0x06, 0x20, 0x00, 0x00, 0x02, 0xc0, 0x00, 0x80, 0x01,
-   0x00, 0x03, 0x60, 0x00, 0x00, 0x0c, 0x18, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0xc0, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00};
+#define silverRW_width 64
+#define silverRW_height 64
+static unsigned char silverRW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0xfe,0xff,0xff,0xff,0xff,0xff,0xff,0x07,0x06,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x08,0x0a,0x00,0x00,0x00,0x00,0x00,0x00,0x10,0x12,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x20,0xe4,0xff,0xff,0xff,0xff,0xff,0xff,0x7f,0x24,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x40,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x44,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x10,0x00,0x00,0x10,0x00,0x20,
+ 0x48,0x00,0x20,0x00,0x00,0x08,0x00,0x20,0x48,0x00,0x40,0x00,0x00,0x04,0x00,
+ 0x20,0x48,0x00,0x80,0x00,0x00,0x02,0x00,0x20,0x48,0x00,0x00,0x01,0x00,0x01,
+ 0x00,0x10,0x48,0x00,0x00,0x02,0x80,0x00,0x00,0x10,0x88,0x00,0x00,0x04,0x40,
+ 0x00,0x00,0x10,0x90,0x00,0x00,0x08,0x20,0x00,0x00,0x10,0x90,0x00,0x00,0x10,
+ 0x10,0x00,0x00,0x10,0x90,0x00,0x00,0x20,0x08,0x00,0x00,0x10,0x90,0x00,0x00,
+ 0x40,0x04,0x00,0x00,0x08,0x90,0x00,0x00,0x80,0x02,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x00,0x01,0x00,0x00,0x08,0x10,0x01,0x00,0x80,0x03,0x00,0x00,0x08,0x20,
+ 0x01,0x00,0x40,0x05,0x00,0x00,0x08,0x20,0x01,0x00,0x20,0x09,0x00,0x00,0x08,
+ 0x20,0x01,0x00,0x10,0x11,0x00,0x00,0x04,0x20,0x01,0x00,0x08,0x21,0x00,0x00,
+ 0x04,0x20,0x01,0x00,0x04,0x41,0x00,0x00,0x04,0x20,0x02,0x00,0x02,0x81,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x01,0x01,0x01,0x00,0x04,0x40,0x02,0x80,0x00,0x01,
+ 0x02,0x00,0x04,0x40,0x02,0x40,0x00,0x01,0x04,0x00,0x02,0x40,0x02,0x20,0x00,
+ 0x01,0x08,0x00,0x02,0x40,0x02,0x10,0x00,0x01,0x10,0x00,0x02,0x40,0x02,0x00,
+ 0x00,0x00,0x00,0x00,0x02,0x40,0x04,0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,
+ 0x00,0x00,0x00,0x00,0x00,0x02,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,
+ 0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x80,0x07,0x00,0x00,0x01,
+ 0x80,0x04,0x00,0x40,0x00,0x00,0x00,0x01,0x80,0x08,0x00,0x40,0x00,0x00,0x00,
+ 0x01,0x80,0x08,0x00,0x80,0x03,0x00,0x00,0x01,0x00,0x09,0x00,0x00,0x04,0x00,
+ 0x00,0x01,0x00,0x09,0x00,0x00,0x04,0x00,0x80,0x00,0x00,0x09,0x00,0xc0,0x03,
+ 0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0x00,
+ 0x00,0x00,0x80,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x14,0x00,
+ 0x00,0x00,0x00,0x80,0x00,0x00,0x18,0x00,0x00,0x00,0x00,0x80,0x00,0x00,0x10,
+ 0x00,0x00,0x00,0x00,0x70,0x00,0x00,0x60,0x00,0x00,0x00,0x00,0x0f,0x00,0x00,
+ 0x80,0x07,0x00,0x00,0xf0,0x00,0x00,0x00,0x00,0x38,0x00,0x00,0x0e,0x00,0x00,
+ 0x00,0x00,0xc0,0x03,0xe0,0x01,0x00,0x00,0x00,0x00,0x00,0x3c,0x1e,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xc0,0x01,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/western_bitmaps/silverW.xbm b/xshogi/western_bitmaps/silverW.xbm
index 8d7067e..ad982e5 100644
--- a/xshogi/western_bitmaps/silverW.xbm
+++ b/xshogi/western_bitmaps/silverW.xbm
@@ -1,14 +1,38 @@
-#define silverW_width 32
-#define silverW_height 32
-static char silverW_bits[] = {
-   0x00, 0x00, 0x00, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0x30, 0x06, 0x00,
-   0x00, 0x0c, 0x18, 0x00, 0x00, 0x03, 0x60, 0x00, 0xc0, 0x00, 0x80, 0x01,
-   0x20, 0xc0, 0x01, 0x02, 0x20, 0x20, 0x02, 0x06, 0x20, 0x20, 0x00, 0x06,
-   0x20, 0xc0, 0x01, 0x06, 0x10, 0x00, 0x02, 0x04, 0x10, 0x20, 0x02, 0x0c,
-   0x10, 0xc0, 0x01, 0x0c, 0x10, 0x00, 0x00, 0x0c, 0x08, 0x1c, 0x1c, 0x08,
-   0x08, 0x22, 0x22, 0x18, 0x08, 0x41, 0x41, 0x18, 0x08, 0xe2, 0x23, 0x18,
-   0x04, 0xbc, 0x1e, 0x10, 0x04, 0x56, 0x35, 0x30, 0x04, 0xab, 0x6a, 0x30,
-   0x04, 0x56, 0x35, 0x30, 0x02, 0xbc, 0x1e, 0x20, 0x02, 0xe2, 0x23, 0x60,
-   0x02, 0x41, 0x41, 0x60, 0x02, 0x22, 0x22, 0x60, 0x01, 0x1c, 0x1c, 0x40,
-   0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0, 0x01, 0x00, 0x00, 0xc0,
-   0xff, 0xff, 0xff, 0xff, 0xfe, 0xff, 0xff, 0xff};
+#define silverW_width 64
+#define silverW_height 64
+static unsigned char silverW_bits[] = {
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0xf0,0x03,0x00,0x00,0x00,0x00,0x00,0x00,0x8e,0x3c,0x00,
+ 0x00,0x00,0x00,0x00,0xe0,0x81,0xc0,0x03,0x00,0x00,0x00,0x00,0x1e,0x00,0x01,
+ 0x3c,0x00,0x00,0x00,0xe0,0x01,0xc0,0x01,0xc0,0x03,0x00,0x00,0x1c,0x00,0x3c,
+ 0x1e,0x00,0x1c,0x00,0x00,0x04,0xc0,0x03,0xe0,0x01,0x10,0x00,0x00,0x06,0x38,
+ 0x00,0x00,0x0e,0x60,0x00,0x00,0x8a,0x07,0x00,0x00,0xf0,0x40,0x00,0x00,0x7a,
+ 0x00,0x00,0x00,0x00,0x4f,0x00,0x00,0x12,0x00,0x00,0x00,0x00,0x70,0x00,0x00,
+ 0x12,0x00,0xc0,0x03,0x00,0x80,0x00,0x00,0x11,0x00,0x20,0x00,0x00,0x80,0x00,
+ 0x00,0x11,0x00,0x20,0x00,0x00,0x80,0x00,0x00,0x09,0x00,0xc0,0x01,0x00,0x80,
+ 0x00,0x00,0x09,0x00,0x00,0x02,0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x02,0x00,
+ 0x80,0x00,0x00,0x09,0x00,0xe0,0x01,0x00,0x80,0x00,0x00,0x09,0x00,0x00,0x00,
+ 0x00,0x00,0x01,0x80,0x08,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x08,0x00,0x00,
+ 0x00,0x00,0x00,0x01,0x80,0x04,0x00,0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x00,
+ 0x00,0x00,0x00,0x00,0x01,0x80,0x04,0x08,0x80,0x00,0x08,0x00,0x01,0x80,0x04,
+ 0x10,0x80,0x00,0x04,0x00,0x01,0x80,0x04,0x20,0x80,0x00,0x02,0x00,0x02,0x40,
+ 0x04,0x40,0x80,0x00,0x01,0x00,0x02,0x40,0x02,0x80,0x80,0x80,0x00,0x00,0x02,
+ 0x40,0x02,0x00,0x81,0x40,0x00,0x00,0x02,0x40,0x02,0x00,0x82,0x20,0x00,0x00,
+ 0x02,0x40,0x02,0x00,0x84,0x10,0x00,0x00,0x02,0x40,0x02,0x00,0x88,0x08,0x00,
+ 0x00,0x04,0x20,0x02,0x00,0x90,0x04,0x00,0x00,0x04,0x20,0x02,0x00,0xa0,0x02,
+ 0x00,0x00,0x04,0x20,0x01,0x00,0xc0,0x01,0x00,0x00,0x04,0x20,0x01,0x00,0x80,
+ 0x00,0x00,0x00,0x04,0x20,0x01,0x00,0x40,0x01,0x00,0x00,0x04,0x20,0x01,0x00,
+ 0x20,0x02,0x00,0x00,0x08,0x20,0x01,0x00,0x10,0x04,0x00,0x00,0x08,0x10,0x01,
+ 0x00,0x08,0x08,0x00,0x00,0x08,0x10,0x01,0x00,0x04,0x10,0x00,0x00,0x08,0x90,
+ 0x00,0x00,0x02,0x20,0x00,0x00,0x08,0x90,0x00,0x00,0x01,0x40,0x00,0x00,0x08,
+ 0x90,0x00,0x80,0x00,0x80,0x00,0x00,0x10,0x90,0x00,0x40,0x00,0x00,0x01,0x00,
+ 0x10,0x90,0x00,0x20,0x00,0x00,0x02,0x00,0x10,0x88,0x00,0x10,0x00,0x00,0x04,
+ 0x00,0x10,0x48,0x00,0x08,0x00,0x00,0x08,0x00,0x10,0x48,0x00,0x00,0x00,0x00,
+ 0x00,0x00,0x10,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,
+ 0x00,0x00,0x00,0x20,0x48,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x48,0x00,0x00,
+ 0x00,0x00,0x00,0x00,0x20,0x44,0x00,0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,
+ 0x00,0x00,0x00,0x00,0x00,0x20,0x24,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x24,
+ 0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x28,0x00,0x00,0x00,0x00,0x00,0x00,0x40,
+ 0x30,0x00,0x00,0x00,0x00,0x00,0x00,0x40,0x30,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x60,0xe0,0xff,0xff,0xff,0xff,0xff,0xff,0x3f,0x00,0x00,0x00,0x00,0x00,0x00,
+ 0x00,0x00};
diff --git a/xshogi/xshogi.c b/xshogi/xshogi.c
index 33fa7ab..1d998d6 100644
--- a/xshogi/xshogi.c
+++ b/xshogi/xshogi.c
@@ -13,7 +13,7 @@
  * Modified implementation of ISS mode for XShogi:  Matthias Mutz
  * Current maintainer:                              Michael C. Vanier
  *
- * XShogi borrows its piece bitmaps from CRANES Shogi.
+ * XShogi borrows some of its piece bitmaps from CRANES Shogi.
  *
  * Copyright 1991 by Digital Equipment Corporation, Maynard, Massachusetts.
  * Enhancements Copyright 1992 Free Software Foundation, Inc.
@@ -101,7 +101,7 @@
 #include "bitmaps.h"  /* Piece bitmaps. */
 #include "xshogifn.h" /* Forward declarations. */
 
-#define off_board(x) (x < 2 || x > BOARD_SIZE + 1)
+#define off_board(x) ((x < 2) || (x > BOARD_SIZE + 1))
 
 
 /**********************************************************************
@@ -297,10 +297,8 @@ ShogiSquare pieceMenuTranslation[2][PIECE_MENU_SIZE] =
 
 typedef struct
 {
-    Pixel blackPieceColor;
-    Pixel whitePieceColor;
-    Pixel lightSquareColor;
-    Pixel darkSquareColor;
+    Pixel pieceColor;
+    Pixel squareColor;
     Pixel charPieceColor;
     Pixel zeroColor;
     Pixel oneColor;
@@ -378,14 +376,9 @@ typedef struct
 XtResource clientResources[] =
 {
     {
-        "blackPieceColor", "BlackPieceColor", XtRPixel, sizeof(Pixel),
-        XtOffset(AppDataPtr, blackPieceColor), XtRString,
-        BLACK_PIECE_COLOR
-    },
-    {
-        "whitePieceColor", "WhitePieceColor", XtRPixel, sizeof(Pixel),
-        XtOffset(AppDataPtr, whitePieceColor), XtRString,
-        WHITE_PIECE_COLOR
+        "pieceColor", "pieceColor", XtRPixel, sizeof(Pixel),
+        XtOffset(AppDataPtr, pieceColor), XtRString,
+        PIECE_COLOR
     },
     {
         "charPieceColor", "CharPieceColor", XtRPixel, sizeof(Pixel),
@@ -403,14 +396,9 @@ XtResource clientResources[] =
         ZERO_COLOR
     },
     {
-        "lightSquareColor", "LightSquareColor", XtRPixel,
-        sizeof(Pixel), XtOffset(AppDataPtr, lightSquareColor),
-        XtRString, LIGHT_SQUARE_COLOR
-    },
-    {
-        "darkSquareColor", "DarkSquareColor", XtRPixel, sizeof(Pixel),
-        XtOffset(AppDataPtr, darkSquareColor), XtRString,
-        DARK_SQUARE_COLOR
+        "squareColor", "squareColor", XtRPixel,
+        sizeof(Pixel), XtOffset(AppDataPtr, squareColor),
+        XtRString, SQUARE_COLOR
     },
     {
         "westernPieceSet", "WesternPieceSet", XtRBoolean, sizeof(Boolean),
@@ -722,7 +710,6 @@ XtResource clientResources[] =
 
 struct DisplayData
 {
-
     AppData appData;
 
     Arg shellArgs[6];
@@ -752,11 +739,8 @@ struct DisplayData
     int xScreen;
     Window xBoardWindow;
 
-    GC lightSquareGC, darkSquareGC, lineGC, wdPieceGC, wlPieceGC,
-        woPieceGC, boPieceGC, bdPieceGC, blPieceGC, wbPieceGC,
-        bwPieceGC, coordGC, dropPiece;
-
-    GC charPieceGC;
+    GC squareGC, lineGC, pieceGC, oPieceGC, charPieceGC,
+        squareOffBoardGC, coordGC, dropPiece;
 
     Font mainFontID, coordFontID;
     XFontStruct *mainFontStruct, *coordFontStruct;
@@ -1087,17 +1071,6 @@ char pieceToChar[] =
 };
 
 
-int pieceisWhite[] =
-{
-    False, False, False, False, False, False, False,
-    False, False, False, False, False, False, False,
-    True,  True,  True,  True,  True, True,  True,
-    True,  True,  True,  True,  True, True, True,
-    False
-};
-
-
-
 ShogiSquare pieceToPromoted[] =
 {
     BlackPPawn,   BlackPLance, BlackPKnight, BlackPSilver, BlackGold,
@@ -1114,20 +1087,16 @@ ShogiSquare pieceToPromoted[] =
 
 XrmOptionDescRec shellOptions[] =
 {
-    { "-blackPieceColor", "blackPieceColor", XrmoptionSepArg, NULL },
-    { "-bpc", "blackPieceColor", XrmoptionSepArg, NULL },
-    { "-whitePieceColor", "whitePieceColor", XrmoptionSepArg, NULL },
-    { "-wpc", "whitePieceColor", XrmoptionSepArg, NULL },
+    { "-pieceColor", "pieceColor", XrmoptionSepArg, NULL },
+    { "-pc", "pieceColor", XrmoptionSepArg, NULL },
     { "-charPieceColor", "charPieceColor", XrmoptionSepArg, NULL },
     { "-cpc", "charPieceColor", XrmoptionSepArg, NULL },
     { "-zeroColor", "zeroColor", XrmoptionSepArg, NULL },
     { "-zc", "zeroColor", XrmoptionSepArg, NULL },
     { "-oneColor", "oneColor", XrmoptionSepArg, NULL },
     { "-oc", "oneColor", XrmoptionSepArg, NULL },
-    { "-lightSquareColor", "lightSquareColor", XrmoptionSepArg, NULL },
-    { "-lsc", "lightSquareColor", XrmoptionSepArg, NULL },
-    { "-darkSquareColor", "darkSquareColor", XrmoptionSepArg, NULL },
-    { "-dsc", "darkSquareColor", XrmoptionSepArg, NULL },
+    { "-squareColor", "squareColor", XrmoptionSepArg, NULL },
+    { "-sc", "squareColor", XrmoptionSepArg, NULL },
     { "-westernPieceSet", "westernPieceSet", XrmoptionSepArg, NULL },
     { "-wps", "westernPieceSet", XrmoptionSepArg, NULL },
     { "-movesPerSession", "movesPerSession", XrmoptionSepArg, NULL },
@@ -1323,6 +1292,14 @@ typedef struct
 static FileModeInfo fmi;
 
 
+/*
+ * This is a hack that allows the parser to tell the program
+ * that the game it's loading has ended.
+ */
+
+int loaded_game_finished = 0;
+
+
 /**********************************************************************
  *
  * End of globals.
@@ -1435,12 +1412,15 @@ CreatePlayerWindow(void)
         player->xScreen = DefaultScreen(player->xDisplay);
     }
 
+#undef DONT_ADJUST_BOARDSIZE
+#ifndef DONT_ADJUST_BOARDSIZE
     if (((DisplayWidth(player->xDisplay, player->xScreen) < 800)
          || (DisplayHeight(player->xDisplay, player->xScreen) < 800))
         && (player->boardSize == Large))
     {
         player->boardSize = Medium;
     }
+#endif
 
     switch (player->boardSize)
     {
@@ -1598,9 +1578,6 @@ CreatePlayerWindow(void)
 
     if (player->appData.clockMode)
     {
-        /* sprintf(buf, "Black: %s ", TimeString(timeControl));
-           timerWidth = XTextWidth(player->mainFontStruct,
-           buf, strlen(buf)); */
         timerWidth = XTextWidth(player->mainFontStruct,
                                 "Black: 8:88:88 ", 15);
     }
@@ -1624,13 +1601,13 @@ CreatePlayerWindow(void)
     XtSetArg(args[0], XtNwidth, &commandsWidth);
     XtGetValues(player->commandsWidget, args, 1);
     w = ((commandsWidth > boardWidth) ? commandsWidth : boardWidth);
-    XtSetArg(args[0], XtNwidth, w - timerWidth*2 - 12);
+    XtSetArg(args[0], XtNwidth, w - timerWidth * 2 - 12);
     XtSetValues(player->titleWidget, args, 1);
     XtSetArg(args[0], XtNwidth, w - 8);
     XtSetValues(player->messageWidget, args, 1);
 
     /*
-     * formWidget uses these constraints but they are stored
+     * 'formWidget' uses these constraints but they are stored
      * in the children.
      */
 
@@ -1656,7 +1633,7 @@ CreatePlayerWindow(void)
     player->iconPixmap =
         XCreateBitmapFromData(player->xDisplay,
                               XtWindow(player->shellWidget),
-                              icon_bits, icon_width, icon_height);
+                              (char *)icon_bits, icon_width, icon_height);
 
     XtSetArg(args[0], XtNiconPixmap, player->iconPixmap);
     XtSetValues(player->shellWidget, args, 1);
@@ -1809,7 +1786,7 @@ main(int argc, char **argv)
     xshogiDebug = localPlayer.appData.debugMode;
 
     /*
-     * Determine matchMode state -- poor man's resource converter
+     * Determine matchMode state -- poor man's resource converter.
      */
 
     if (strcasecmp(localPlayer.appData.matchMode, "Init") == 0)
@@ -1950,105 +1927,65 @@ CreateGCs(void)
         gc_values.foreground
             = XWhitePixel(player->xDisplay, player->xScreen);
         gc_values.background
-            = XBlackPixel(player->xDisplay, player->xScreen);
-        player->lightSquareGC = player->darkSquareGC = player->wbPieceGC
-            = XtGetGC(player->shellWidget, value_mask, &gc_values);
-        gc_values.foreground
-            = XBlackPixel(player->xDisplay, player->xScreen);
-        gc_values.background
             = XWhitePixel(player->xDisplay, player->xScreen);
-        player->bwPieceGC
+
+        /* empty square off board */
+        player->squareOffBoardGC
+            = XtGetGC(player->shellWidget, value_mask, &gc_values);
+
+        /* empty square on board */
+        player->squareGC
             = XtGetGC(player->shellWidget, value_mask, &gc_values);
     }
     else
     {
-        /* white piece black background */
-        gc_values.foreground
-            = XWhitePixel(player->xDisplay, player->xScreen);
-        gc_values.background
-            = XBlackPixel(player->xDisplay, player->xScreen);
-        player->wbPieceGC
-            = XtGetGC(player->shellWidget, value_mask, &gc_values);
+        Pixel bg;         /* background color */
+        Arg   args[1];
 
-        /* black piece white background */
-        gc_values.foreground
-            = XBlackPixel(player->xDisplay, player->xScreen);
-        gc_values.background
-            = XWhitePixel(player->xDisplay, player->xScreen);
-        player->bwPieceGC
-            = XtGetGC(player->shellWidget, value_mask, &gc_values);
+        /* Get background color. */
+        XtSetArg(args[0], XtNbackground, &bg);
+        XtGetValues(player->shellWidget, args, 1);
 
-        /* light empty square */
-        gc_values.foreground
-            = player->appData.lightSquareColor;
-        gc_values.background
-            = player->appData.darkSquareColor;
-        player->lightSquareGC
+        /* empty square off board */
+        gc_values.foreground = gc_values.background = bg;
+        player->squareOffBoardGC
             = XtGetGC(player->shellWidget, value_mask, &gc_values);
 
-        /* dark empty square */
+        /* empty square on board */
         gc_values.foreground
-            = player->appData.darkSquareColor;
+            = player->appData.squareColor;
         gc_values.background
-            = player->appData.lightSquareColor;
-        player->darkSquareGC
+            = player->appData.squareColor;
+        player->squareGC
             = XtGetGC(player->shellWidget, value_mask, &gc_values);
 
-        /* black piece on dark square */
-        gc_values.background
-            = player->appData.blackPieceColor;
-        gc_values.foreground
-            = player->appData.darkSquareColor;
-        player->bdPieceGC
-            = XtGetGC(player->shellWidget, value_mask, &gc_values);
-
-        /* black piece on light square */
-        gc_values.background
-            = player->appData.blackPieceColor;
-        gc_values.foreground
-            = player->appData.lightSquareColor;
-        player->blPieceGC
-            = XtGetGC(player->shellWidget, value_mask, &gc_values);
-
-        /* white piece on dark square */
-        gc_values.background
-            = player->appData.whitePieceColor;
+        /* piece off board */
         gc_values.foreground
-            = player->appData.darkSquareColor;
-        player->wdPieceGC
-            = XtGetGC(player->shellWidget,  value_mask, &gc_values);
-
-        /* white piece on dark square */
-        gc_values.background
-            = player->appData.whitePieceColor;
-        gc_values.foreground
-            = player->appData.lightSquareColor;
-        player->wlPieceGC
+            = player->appData.pieceColor;
+        gc_values.background = bg;
+        player->oPieceGC
             = XtGetGC(player->shellWidget, value_mask, &gc_values);
 
-        /* black piece off board */
-        gc_values.background
-            = player->appData.blackPieceColor;
+        /* piece on board */
         gc_values.foreground
-            = XWhitePixel(player->xDisplay, player->xScreen);
-        player->boPieceGC
-            = XtGetGC(player->shellWidget, value_mask, &gc_values);
-
-        /* white piece off board */
+            = player->appData.pieceColor;
         gc_values.background
-            = player->appData.whitePieceColor;
-        gc_values.foreground
-            = XWhitePixel(player->xDisplay, player->xScreen);
-        player->woPieceGC
+            = player->appData.squareColor;
+        player->pieceGC
             = XtGetGC(player->shellWidget, value_mask, &gc_values);
 
         /* piece symbol */
+        /*
+         * FIXME: charPieceColor seems to have no effect;
+         *    the bitmap is *always* black.
+         */
         gc_values.function = (player->black_pixel_is_zero ? GXand : GXor);
 
         gc_values.foreground
-            = XBlackPixel(player->xDisplay, player->xScreen);
+            = player->appData.charPieceColor;
         gc_values.background
-            = XWhitePixel(player->xDisplay, player->xScreen);
+            = player->appData.charPieceColor;
+
         player->charPieceGC
             = XtGetGC(player->shellWidget, value_mask, &gc_values);
     }
@@ -2068,22 +2005,22 @@ CreatePieces(void)
         ReadBitmap(player->appData.reverseBigSolidBitmap,
                    &player->reverseBigSolidBitmap,
                    NULL,
-                   bigsolidR_bits, bigsolidR_bits, bigsolidR_bits);
+                   bigsolidR_bits, bigsolidR_m_bits, bigsolidR_l_bits);
 
         ReadBitmap(player->appData.reverseSmallSolidBitmap,
                    &player->reverseSmallSolidBitmap,
                    NULL,
-                   smallsolidR_bits, smallsolidR_bits, smallsolidR_bits);
+                   smallsolidR_bits, smallsolidR_m_bits, smallsolidR_l_bits);
 
         ReadBitmap(player->appData.normalBigSolidBitmap,
                    &player->normalBigSolidBitmap,
                    NULL,
-                   bigsolid_bits, bigsolid_bits, bigsolid_bits);
+                   bigsolid_bits, bigsolid_m_bits, bigsolid_l_bits);
 
         ReadBitmap(player->appData.normalSmallSolidBitmap,
                    &player->normalSmallSolidBitmap,
                    NULL,
-                   smallsolid_bits, smallsolid_bits, smallsolid_bits);
+                   smallsolid_bits, smallsolid_m_bits, smallsolid_l_bits);
 
         ReadBitmap(player->appData.reversePawnBitmap,
                    &player->reversePawnBitmap,
@@ -2429,10 +2366,12 @@ ReadBitmapFile(Display *display, Drawable d, char *filename,
 
 void
 ReadBitmap(String name, Pixmap *pm, Pixmap *qm,
-           char *small_bits, char *medium_bits, char *large_bits)
+           unsigned char *small_bits, 
+		   unsigned char *medium_bits, 
+		   unsigned char *large_bits)
 {
     int x_hot, y_hot;
-    u_int w, h;
+    unsigned int w, h;
 
     if ((name == NULL)
         || (ReadBitmapFile(player->xDisplay, player->xBoardWindow, name,
@@ -2466,7 +2405,7 @@ ReadBitmap(String name, Pixmap *pm, Pixmap *qm,
         case Large:
             *pm = XCreatePixmapFromBitmapData(player->xDisplay,
                                               player->xBoardWindow,
-                                              large_bits,
+                                              (char *)large_bits,
                                               player->squareSize,
                                               player->squareSize,
                                               fg, bg, depth);
@@ -2475,7 +2414,7 @@ ReadBitmap(String name, Pixmap *pm, Pixmap *qm,
         case Medium:
             *pm = XCreatePixmapFromBitmapData(player->xDisplay,
                                               player->xBoardWindow,
-                                              medium_bits,
+                                              (char *)medium_bits,
                                               player->squareSize,
                                               player->squareSize,
                                               fg, bg, depth);
@@ -2484,7 +2423,7 @@ ReadBitmap(String name, Pixmap *pm, Pixmap *qm,
         case Small:
             *pm = XCreatePixmapFromBitmapData(player->xDisplay,
                                               player->xBoardWindow,
-                                              small_bits,
+                                              (char *)small_bits,
                                               player->squareSize,
                                               player->squareSize,
                                               fg, bg, depth);
@@ -2511,10 +2450,10 @@ CreateGrid(void)
             = LINE_GAP / 2 + (i * (player->squareSize + LINE_GAP));
         player->gridSegments[i].x2 = LINE_GAP + BOARD_SIZE *
             (player->squareSize + LINE_GAP) + offset;
-        player->gridSegments[i + BOARD_SIZE + 1].x1 
+        player->gridSegments[i + BOARD_SIZE + 1].x1
             = player->gridSegments[i + BOARD_SIZE + 1].x2 = LINE_GAP / 2
             + (i * (player->squareSize + LINE_GAP)) + offset;
-        player->gridSegments[i + BOARD_SIZE + 1].y2 
+        player->gridSegments[i + BOARD_SIZE + 1].y2
             = BOARD_SIZE * (player->squareSize + LINE_GAP);
     }
 }
@@ -2549,8 +2488,8 @@ CreatePieceMenus(void)
                                           blackPieceMenu, NULL, 0);
             selection = pieceMenuTranslation[0][i];
             XtAddCallback(entry, XtNcallback,
-                          (XtCallbackProc) PieceMenuSelect,
-                          (caddr_t)selection);
+                          (XtCallbackProc)PieceMenuSelect,
+                          (XtPointer)selection);
 
             if (selection == BlackPawn)
             {
@@ -2579,8 +2518,8 @@ CreatePieceMenus(void)
                                           whitePieceMenu, NULL, 0);
             selection = pieceMenuTranslation[1][i];
             XtAddCallback(entry, XtNcallback,
-                          (XtCallbackProc) PieceMenuSelect,
-                          (caddr_t)selection);
+                          (XtCallbackProc)PieceMenuSelect,
+                          (XtPointer)selection);
 
             if (selection == WhitePawn)
             {
@@ -2601,14 +2540,14 @@ CreatePieceMenus(void)
 void
 PieceMenuPopup(Widget w, XEvent *event, String *params, Cardinal *num_params)
 {
-    if (event->type != ButtonPress) 
+    if (event->type != ButtonPress)
         return;
 
-    if (gameMode != EditPosition) 
+    if (gameMode != EditPosition)
         return;
 
-    if (((pmFromX = EventToXSquare(event->xbutton.x)) < 1) 
-        || (pmFromX > BOARD_SIZE + 2) 
+    if (((pmFromX = EventToXSquare(event->xbutton.x)) < 1)
+        || (pmFromX > BOARD_SIZE + 2)
         || ((pmFromY = EventToSquare(event->xbutton.y)) < 0))
     {
         pmFromX = pmFromY = -1;
@@ -2627,7 +2566,7 @@ PieceMenuPopup(Widget w, XEvent *event, String *params, Cardinal *num_params)
 
 
 static void
-PieceMenuSelect(Widget w, ShogiSquare piece, caddr_t junk)
+PieceMenuSelect(Widget w, ShogiSquare piece, char *junk)
 {
     if ((pmFromX < 0) || (pmFromY < 0))
         return;
@@ -2694,7 +2633,7 @@ SetBlackToPlay(void)
 {
     int saveCM;
 
-    if (gameMode != EditPosition) 
+    if (gameMode != EditPosition)
         return;
 
     whitePlaysFirst = False;
@@ -2712,7 +2651,7 @@ SetWhiteToPlay(void)
 {
     int saveCM;
 
-    if (gameMode != EditPosition) 
+    if (gameMode != EditPosition)
         return;
 
     whitePlaysFirst = True;
@@ -2912,96 +2851,53 @@ DrawSquare(int row, int column, ShogiSquare piece)
             {
                 /* empty square off board */
                 XFillRectangle(player->xDisplay, player->xBoardWindow,
-                               player->wbPieceGC,
+                               player->squareOffBoardGC,
                                x, y, player->squareSize,
                                player->squareSize);
             }
             else
             {
                 /* empty square on board */
-                XFillRectangle(player->xDisplay, player->xBoardWindow,
-                               ((square_color == LIGHT)
-                                ? player->lightSquareGC
-                                : player->darkSquareGC),
-                               x, y, player->squareSize,
+                XFillRectangle(player->xDisplay,
+                               player->xBoardWindow,
+                               player->squareGC,
+                               x, y,
+                               player->squareSize,
                                player->squareSize);
             }
         }
-        else if (player->monoMode)
+        else if (player->monoMode) /* Draw a piece in mono mode. */
         {
-            /* in mono mode */
-            if (square_color == LIGHT)
-            {
-                XCopyArea(player->xDisplay,
-                          ((((((int)piece) < ((int)WhitePawn)))
-                            ^ player->flipView)
-                           ? *pieceToNormal[remote][(int)piece]
-                           : *pieceToReverse[remote][(int)piece]),
-                          player->xBoardWindow,
-                          (player->monoMode
-                           ? player->wbPieceGC
-                           : player->wlPieceGC),
-                          0, 0,
-                          player->squareSize, player->squareSize, x, y);
-            }
-            else
-            {
-                XCopyArea(player->xDisplay,
-                          ((((((int)piece) < ((int)WhitePawn))) 
-                            ^ player->flipView)
-                           ? *pieceToNormal[remote][(int)piece]
-                           : *pieceToReverse[remote][(int)piece]),
-                          player->xBoardWindow,
-                          (player->monoMode
-                           ? player->bwPieceGC
-                           : player->blPieceGC),
-                          0, 0,
-                          player->squareSize, player->squareSize, x, y);
-            }
+            XCopyArea(player->xDisplay,
+                      ((((((int)piece) < ((int)WhitePawn)))
+                        ^ player->flipView)
+                       ? *pieceToNormal[remote][(int)piece]
+                       : *pieceToReverse[remote][(int)piece]),
+                      player->xBoardWindow,
+                      (player->monoMode
+                       ? player->squareOffBoardGC  /* ??? FIXME? */
+                       : player->pieceGC),
+                      0, 0,
+                      player->squareSize, player->squareSize, x, y);
         }
-        else
+        else /* Draw a piece in color mode. */
         {
-            /* in color mode */
-            if ((column < 0) || (column >= BOARD_SIZE))
+            if ((column < 0) || (column >= BOARD_SIZE))  /* off board */
             {
-                /* off board */
-                XCopyPlane(player->xDisplay,
-                           ((((((int)piece) < ((int)WhitePawn)))
-                             ^ player->flipView)
-                            ? *pieceToNormalSolid[remote][(int)piece]
-                            : *pieceToReverseSolid[remote][(int)piece]),
-                           player->xBoardWindow,
-                           (pieceisWhite[(int)piece]
-                            ? player->woPieceGC
-                            : player->boPieceGC),
-                           0, 0,
-                           player->squareSize, player->squareSize, x, y, 1);
+                /* draw piece background */
 
-                XCopyArea(player->xDisplay,
-                          ((((((int)piece) < ((int)WhitePawn)))
-                            ^ player->flipView)
-                           ? *pieceToNormal[remote][(int)piece]
-                           : *pieceToReverse[remote][(int)piece]),
-                          player->xBoardWindow,
-                          player->charPieceGC,
-                          0, 0,
-                          player->squareSize, player->squareSize, x, y);
-            }
-            else if (square_color == LIGHT)
-            {
-                /* on board, light square */
                 XCopyPlane(player->xDisplay,
                            ((((((int)piece) < ((int)WhitePawn)))
                              ^ player->flipView)
                             ? *pieceToNormalSolid[remote][(int)piece]
                             : *pieceToReverseSolid[remote][(int)piece]),
                            player->xBoardWindow,
-                           pieceisWhite[(int)piece]
-                           ? player->wlPieceGC
-                           : player->blPieceGC,
+                           player->oPieceGC,
                            0, 0,
                            player->squareSize, player->squareSize, x, y, 1);
 
+                /* draw piece bitmap */
+
                 XCopyArea(player->xDisplay,
                           ((((((int)piece) < ((int)WhitePawn)))
                             ^ player->flipView)
@@ -3012,21 +2908,22 @@ DrawSquare(int row, int column, ShogiSquare piece)
                           0, 0,
                           player->squareSize, player->squareSize, x, y);
             }
-            else
+            else  /* on board */
             {
-                /* on board, dark square */
+                /* draw piece background */
+
                 XCopyPlane(player->xDisplay,
                            ((((((int)piece) < ((int)WhitePawn)))
                              ^ player->flipView)
                             ? *pieceToNormalSolid[remote][(int)piece]
                             : *pieceToReverseSolid[remote][(int)piece]),
                            player->xBoardWindow,
-                           (pieceisWhite[(int)piece]
-                            ? player->wdPieceGC
-                            : player->bdPieceGC),
+                           player->pieceGC,
                            0, 0,
                            player->squareSize, player->squareSize, x, y, 1);
 
+                /* draw piece bitmap */
+
                 XCopyArea(player->xDisplay,
                           ((((((int)piece) < ((int)WhitePawn)))
                             ^ player->flipView)
@@ -3036,8 +2933,9 @@ DrawSquare(int row, int column, ShogiSquare piece)
                           player->charPieceGC,
                           0, 0,
                           player->squareSize, player->squareSize, x, y);
-            }
+             }
         }
+
         string[1] = NULLCHAR;
 
         if (player->showCoords
@@ -3097,7 +2995,7 @@ DrawSquare(int row, int column, ShogiSquare piece)
 
 
 void
-EventProc(Widget widget, caddr_t client_data, XEvent *event)
+EventProc(Widget widget, XtPointer client_data, XEvent *event)
 {
     if (event->type == MappingNotify)
     {
@@ -3476,7 +3374,7 @@ UpdateCatched(int Color, int Figure, int Drop, int DropAll, int currentMove)
                 DrawSquare(y, x, catchedIndexToPiece[Color][F]);
                 ShowCount(y, (Color ? (x - 1) : (x + 1)), c);
 
-                if (Color) 
+                if (Color)
                     y--;
                 else
                     y++;
@@ -3490,7 +3388,7 @@ UpdateCatched(int Color, int Figure, int Drop, int DropAll, int currentMove)
                 DrawSquare(y, x, EmptySquare);
                 ShowCount(y, (Color ? (x - 1) : (x + 1)), 0);
 
-                if (Color) 
+                if (Color)
                     y--;
                 else
                     y++;
@@ -3510,9 +3408,9 @@ UpdateCatched(int Color, int Figure, int Drop, int DropAll, int currentMove)
         {
             if (catches[currentMove][Color][F] > 0)
             {
-                if (Color) 
+                if (Color)
                     y--;
-                else 
+                else
                     y++;
             }
         }
@@ -3581,14 +3479,14 @@ PieceOfCatched(int color, int x, int y, int currentMove)
 
     if (color)
     {
-        if (x != 1) 
+        if (x != 1)
             return (no_piece);
 
         y = 8 - y;
     }
     else
     {
-        if (x != 11) 
+        if (x != 11)
             return no_piece;
     }
 
@@ -3596,7 +3494,7 @@ PieceOfCatched(int color, int x, int y, int currentMove)
     {
         if (catches[currentMove][color][F] > 0)
         {
-            if (n == y) 
+            if (n == y)
                 return F;
 
             n++;
@@ -3711,7 +3609,7 @@ HandleUserMove(Widget w, XEvent *event)
         break;
 
     case ButtonRelease:
-        if ((fromX < 0) || (fromY < 0)) 
+        if ((fromX < 0) || (fromY < 0))
             return;
 
         if (((to_x = EventToXSquare(event->xbutton.x)) < 1)
@@ -3818,7 +3716,7 @@ HandleUserMove(Widget w, XEvent *event)
                 if (updateRemotePlayer
                     && (BlackOnMove(forwardMostMove) == fromRemotePlayer))
                 {
-                    DisplayMessage("do not drop opponent pieces",
+                    DisplayMessage("Do not try to drop your opponent's pieces!",
                                    fromRemotePlayer);
                     fromX = fromY = -1;
                     return;
@@ -3854,7 +3752,7 @@ HandleUserMove(Widget w, XEvent *event)
                 && updateRemotePlayer
                 && ((from_piece < WhitePawn) == fromRemotePlayer))
             {
-                DisplayMessage("do not move opponent pieces",
+                DisplayMessage("Do not try to move your opponent's pieces!",
                                fromRemotePlayer);
                 fromX = fromY = -1;
                 return;
@@ -3896,18 +3794,18 @@ FinishUserMove(ShogiMove move_type, int to_x, int to_y)
         sprintf(user_move, "%c%c%c%c+\n",
                 '9' - fromX, 'i' - fromY, '9' - to_x, 'i' - to_y);
         break;
-        
+
     case BlackDrop:
     case WhiteDrop:
         sprintf(user_move, "%c*%c%c\n",
                 catchedIndexToChar[fromX - 81], '9' - to_x, 'i' - to_y);
         break;
-        
+
     case NormalMove:
         sprintf(user_move, "%c%c%c%c\n",
                 '9' - fromX, 'i' - fromY, '9' - to_x, 'i' - to_y);
         break;
-        
+
     default:
         fprintf(stderr, "%s: internal error; bad move_type\n",
                 (char *)programName);
@@ -3965,39 +3863,39 @@ ParseMachineMove(char *machine_move, ShogiMove *move_type,
         {
             switch (machine_move[0])
             {
-            case 'P': 
+            case 'P':
                 *from_x = 81;
                 break;
 
-            case 'L': 
+            case 'L':
                 *from_x = 82;
                 break;
 
-            case 'N': 
+            case 'N':
                 *from_x = 83;
                 break;
 
-            case 'S': 
+            case 'S':
                 *from_x = 84;
                 break;
 
-            case 'G': 
+            case 'G':
                 *from_x = 85;
                 break;
 
-            case 'B': 
+            case 'B':
                 *from_x = 86;
                 break;
 
-            case 'R': 
+            case 'R':
                 *from_x = 87;
                 break;
 
-            case 'K': 
+            case 'K':
                 *from_x = 88;
                 break;
 
-            default: 
+            default:
                 *from_x = -1;
             }
 
@@ -4015,7 +3913,7 @@ ParseMachineMove(char *machine_move, ShogiMove *move_type,
             switch (machine_move[4])
             {
             case '+':
-                *move_type = (BlackOnMove(forwardMostMove) 
+                *move_type = (BlackOnMove(forwardMostMove)
                     ? BlackPromotion : WhitePromotion);
                 break;
 
@@ -4084,7 +3982,7 @@ HandleMachineMove(char *message, FILE *fp)
         fprintf(stderr,
                 "%s: failed to start shogi program %s on %s: %s\n",
                 programName,
-                ((fp == fromFirstProgFP) 
+                ((fp == fromFirstProgFP)
                  ? localPlayer.appData.firstShogiProgram
                  : localPlayer.appData.secondShogiProgram),
                 ((fp == fromFirstProgFP)
@@ -4114,10 +4012,10 @@ HandleMachineMove(char *message, FILE *fp)
             return;
         }
 
-        if (forwardMostMove <= backwardMostMove) 
+        if (forwardMostMove <= backwardMostMove)
             return;
 
-        if (gameMode == PauseGame) 
+        if (gameMode == PauseGame)
             PauseProc(NULL, NULL, NULL, NULL);
 
         if (gameMode == PlayFromGameFile)
@@ -4129,7 +4027,7 @@ HandleMachineMove(char *message, FILE *fp)
 
         currentMove = --forwardMostMove;
 
-        if ((gameMode == PlayFromGameFile) 
+        if ((gameMode == PlayFromGameFile)
             || (gameMode == ForceMoves))
             DisplayClocks(ReDisplayTimers);
         else
@@ -4303,10 +4201,10 @@ HandleMachineMove(char *message, FILE *fp)
             if (xshogiDebug)
             {
                 printf("from '%s' synchronize %s clock %ld\n",
-                       message, 
+                       message,
                        (BlackOnMove(forwardMostMove)
-                        ? "Black's" 
-                        : "White's"), 
+                        ? "Black's"
+                        : "White's"),
                        time_remaining);
             }
 
@@ -4341,9 +4239,9 @@ HandleMachineMove(char *message, FILE *fp)
             if (xshogiDebug)
             {
                 printf("from '%s' synchronize %s clock %ld\n",
-                       message, 
+                       message,
                        ((!BlackOnMove(forwardMostMove))
-                        ? "Black's" : "White's"), 
+                        ? "Black's" : "White's"),
                        time_remaining);
             }
 
@@ -4380,7 +4278,7 @@ HandleMachineMove(char *message, FILE *fp)
         putc(BELLCHAR, stderr);
 
     if ((gameMode == TwoMachinesPlay)
-        || ((gameMode == PauseGame) 
+        || ((gameMode == PauseGame)
             && (pausePreviousMode == TwoMachinesPlay)))
     {
         strcat(machine_move, "\n");
@@ -4458,7 +4356,7 @@ ReadGameFileProc(void)
     if (gameFileFP == NULL)
         return (int)False;
 
-    if (gameMode == PauseGame) 
+    if (gameMode == PauseGame)
         return True;
 
     if (gameMode != PlayFromGameFile)
@@ -4496,7 +4394,9 @@ ReadGameFileProc(void)
     lastGameMode = gameMode;
     gameMode = ForceMoves;
     ModeHighlight();
-    DisplayMessage("End of game file", False);
+
+    if (!loaded_game_finished)
+        DisplayMessage("End of game file", False);
 
     if (readGameXID != 0)
     {
@@ -4513,7 +4413,7 @@ ReadGameFileProc(void)
 
 
 
-/* 
+/*
  * Apply a move to the given board.  Oddity: move_type is ignored on input
  * unless the move is seen to be a pawn promotion, in which case move_type
  * tells us what to promote to.
@@ -4611,9 +4511,9 @@ MakeMove(ShogiMove *move_type, int from_x, int from_y, int to_x, int to_y)
 
     if (gameMode == PlayFromGameFile)
     {
-        sprintf(message, "%d. %s%s", 
+        sprintf(message, "%d. %s%s",
                 ((currentMove + 1) / 2),
-                (BlackOnMove(currentMove) ? "... " : ""), 
+                (BlackOnMove(currentMove) ? "... " : ""),
                 currentMoveString);
         strcpy(parseList[currentMove - 1], currentMoveString);
     }
@@ -4626,17 +4526,17 @@ MakeMove(ShogiMove *move_type, int from_x, int from_y, int to_x, int to_y)
 
         MakeAlg(from_x, from_y, to_x, to_y, promoPiece,
                 currentMove - 1, movestr);
-        sprintf(message, "%d. %s%s", 
+        sprintf(message, "%d. %s%s",
                 ((currentMove + 1) / 2),
-                (BlackOnMove(currentMove) ? "... " : ""), 
+                (BlackOnMove(currentMove) ? "... " : ""),
                 movestr);
         strcpy(parseList[currentMove - 1], movestr);
     }
 
     DisplayMessage(message, False);
 
-    if ((gameMode == PlayFromGameFile) || (gameMode == ForceMoves) 
-        || ((gameMode == PauseGame) 
+    if ((gameMode == PlayFromGameFile) || (gameMode == ForceMoves)
+        || ((gameMode == PauseGame)
             && (pausePreviousMode == PlayFromGameFile)))
     {
         DisplayClocks(ReDisplayTimers);
@@ -4671,7 +4571,7 @@ InitShogiProgram(char *host_name, char *program_name, int *pid,
     int   dummy_source;
     XtInputId dummy_id;
 
-    if (localPlayer.appData.noShogiProgram) 
+    if (localPlayer.appData.noShogiProgram)
         return;
 
     signal(SIGPIPE, CatchPipeSignal);
@@ -5041,12 +4941,12 @@ PromotionPopUp(ShogiSquare piece, int to_x, int to_y, int fromRemotePlayer)
     XtSetArg(args[1], XtNheight, &pw_height);
     XtGetValues(player->promotionShell, args, 2);
 
-    XtTranslateCoords(player->boardWidget, 
+    XtTranslateCoords(player->boardWidget,
                       ((bw_width - pw_width) / 2),
-                      (LINE_GAP 
-                       + player->squareSize / 3 
-                       + (((piece == BlackPawn) ^ (player->flipView)) 
-                          ? 0 
+                      (LINE_GAP
+                       + player->squareSize / 3
+                       + (((piece == BlackPawn) ^ (player->flipView))
+                          ? 0
                           : (6 * (player->squareSize + LINE_GAP)))),
                       &x, &y);
 
@@ -5080,7 +4980,7 @@ PromotionCallback(Widget w, XtPointer client_data, XtPointer call_data)
     XtDestroyWidget(w);
     player->promotionUp = False;
 
-    if (fromX == -1) 
+    if (fromX == -1)
         return;
 
     if (strcmp(name, "Yes") == 0)
@@ -5230,7 +5130,7 @@ SelectCommand(Widget w, XtPointer client_data, XtPointer call_data)
     (*buttonProcs[list_return->list_index])
         (w, NULL, NULL, &fromRemotePlayer);
 
-    if (!filenameUp) 
+    if (!filenameUp)
         ModeHighlight();
 }
 
@@ -5375,7 +5275,7 @@ LoadGameProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
 
     if (gameMode != BeginningOfGame)
     {
-        DisplayMessage("Press Reset first", False);
+        DisplayMessage("Press Reset first.", False);
         return;
     }
 
@@ -5393,6 +5293,8 @@ LoadGame(char *name)
 {
     char buf[MSG_SIZ];
 
+    loaded_game_finished = 0;
+
     if (gameMode != BeginningOfGame)
     {
         DisplayMessage("Press Reset first", False);
@@ -5445,10 +5347,10 @@ LoadGame(char *name)
 
 
 
-/* 
+/*
  * Restart the shogi program and feed it all the moves made so far.
  * Used when the user wants to back up from end of game, when gnushogi
- * has already exited.  Assumes gameMode == EndOfGame. 
+ * has already exited.  Assumes gameMode == EndOfGame.
  */
 
 void
@@ -5527,14 +5429,14 @@ MachineWhiteProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
     }
 
     if (BlackOnMove((gameMode == ForceMoves)
-                    ? currentMove 
+                    ? currentMove
                     : forwardMostMove))
     {
-        DisplayMessage("It is not White's turn", False);
+        DisplayMessage("It is not White's turn.", False);
         return;
     }
 
-    if (gameMode == ForceMoves) 
+    if (gameMode == ForceMoves)
         forwardMostMove = currentMove;
 
     lastGameMode = gameMode = MachinePlaysWhite;
@@ -5577,14 +5479,14 @@ MachineBlackProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
     }
 
     if (!BlackOnMove((gameMode == ForceMoves)
-                     ? currentMove 
+                     ? currentMove
                      : forwardMostMove))
     {
-        DisplayMessage("It is not Black's turn", False);
+        DisplayMessage("It is not Black's turn.", False);
         return;
     }
 
-    if (gameMode == ForceMoves) 
+    if (gameMode == ForceMoves)
         forwardMostMove = currentMove;
 
     lastGameMode = gameMode = MachinePlaysBlack;
@@ -5607,7 +5509,7 @@ ForwardProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
 
     if (updateRemotePlayer)
     {
-        DisplayMessage("Forward button disabled", fromRemotePlayer);
+        DisplayMessage("Forward button disabled.", fromRemotePlayer);
         return;
     }
 
@@ -5717,7 +5619,7 @@ ResetProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
 
     if (fromRemotePlayer)
     {
-        DisplayMessage("only your opponent may reset the game",
+        DisplayMessage("Only your opponent may reset the game.",
                        fromRemotePlayer);
         return;
     }
@@ -5805,7 +5707,7 @@ Challenge(char *name)
 
     if (gameMode != BeginningOfGame)
     {
-        DisplayMessage("Press Reset first", False);
+        DisplayMessage("Press Reset first.", False);
         return (int)False;
     }
 
@@ -5880,14 +5782,14 @@ ChallengeProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
 
     if (updateRemotePlayer)
     {
-        DisplayMessage("you are already in challenge mode",
+        DisplayMessage("You are already in challenge mode.",
                        fromRemotePlayer);
         return;
     }
 
     if (gameMode != BeginningOfGame)
     {
-        DisplayMessage("Press Reset first", False);
+        DisplayMessage("Press Reset first.", False);
         return;
     }
 
@@ -5920,7 +5822,7 @@ SelectLevelProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
     if ((BlackOnMove(forwardMostMove) && (gameMode == MachinePlaysBlack))
         || (!BlackOnMove(forwardMostMove) && (gameMode == MachinePlaysWhite)))
     {
-        DisplayMessage("Wait until your turn", False);
+        DisplayMessage("Wait until your turn.", False);
     }
     else
     {
@@ -5937,7 +5839,7 @@ MoveNowProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
     if ((!BlackOnMove(forwardMostMove) && (gameMode == MachinePlaysBlack))
         || (BlackOnMove(forwardMostMove) && (gameMode == MachinePlaysWhite)))
     {
-        DisplayMessage("Wait until machines turn", False);
+        DisplayMessage("Wait until machine's turn.", False);
     }
     else
     {
@@ -5961,7 +5863,7 @@ LoadPositionProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
 
     if (gameMode != BeginningOfGame)
     {
-        DisplayMessage("Press Reset first", False);
+        DisplayMessage("Press Reset first.", False);
         return;
     }
 
@@ -5982,7 +5884,7 @@ LoadPosition(char *name)
 
     if (gameMode != BeginningOfGame)
     {
-        DisplayMessage("Press Reset first", False);
+        DisplayMessage("Press Reset first.", False);
         return False;
     }
 
@@ -6129,12 +6031,12 @@ EditPositionProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
         return;
     }
 
-    if (gameMode == EditPosition) 
+    if (gameMode == EditPosition)
         return;
 
     ForceProc(w, event, prms, nprms);
 
-    if (gameMode != ForceMoves) 
+    if (gameMode != ForceMoves)
         return;
 
     DisplayName("<-- Press to set side to play next");
@@ -6198,7 +6100,7 @@ EditPositionDone(void)
  *     Widget w
  *     XEvent *event
  *     String *prms
- *     Cardinal *nprms 
+ *     Cardinal *nprms
  *
  * RETURN VALUE
  *     void
@@ -6219,7 +6121,7 @@ BackwardProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
         return;
     }
 
-    /* 
+    /*
      * Why do we need this here?
      */
 
@@ -6540,7 +6442,7 @@ HintProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
         return;
     }
 
-    if (localPlayer.appData.noShogiProgram) 
+    if (localPlayer.appData.noShogiProgram)
         return;
 
     switch (gameMode)
@@ -6735,13 +6637,13 @@ TwoMachinesProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
         return;
     }
 
-    if (gameMode == PauseGame) 
+    if (gameMode == PauseGame)
         PauseProc(w, event, prms, nprms);
 
-    if (gameMode == PlayFromGameFile) 
+    if (gameMode == PlayFromGameFile)
         ForceProc(w, event, prms, nprms);
 
-    if ((gameMode == EndOfGame) 
+    if ((gameMode == EndOfGame)
         || (gameMode == TwoMachinesPlay)
         || localPlayer.appData.noShogiProgram)
     {
@@ -6760,7 +6662,7 @@ TwoMachinesProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
         case MachinePlaysWhite:
             ForceProc(w, event, prms, nprms);
 
-            if (gameMode != ForceMoves) 
+            if (gameMode != ForceMoves)
                 return;
 
             matchKind = MatchOpening;
@@ -6993,7 +6895,7 @@ PauseProc(Widget w, XEvent *event, String *prms, Cardinal *nprms)
             return;
 
         if (((gameMode == MachinePlaysWhite)
-             && !BlackOnMove(forwardMostMove)) 
+             && !BlackOnMove(forwardMostMove))
             || ((gameMode == MachinePlaysBlack) &&
                 BlackOnMove(forwardMostMove)))
         {
@@ -7033,7 +6935,7 @@ Iconify(Widget w, XEvent *event, String *prms, Cardinal *nprms)
 void
 SendToProgram(char *message, FILE *fp)
 {
-    if (fp == NULL) 
+    if (fp == NULL)
         return;
 
     lastMsgFP = fp;
@@ -7059,7 +6961,6 @@ void
 ReceiveFromProgram(FILE *fp, int *source, XtInputId *id)
 {
     char message[MSG_SIZ], *end_str, *number, *name;
-    extern const char *const sys_errlist[];
 
     if (fgets(message, MSG_SIZ, fp) == NULL)
     {
@@ -7088,7 +6989,7 @@ ReceiveFromProgram(FILE *fp, int *source, XtInputId *id)
         {
             sprintf(message,
                     "error reading from %s shogi program (%s): %s",
-                    number, name, sys_errlist[ferror(fp)]);
+                    number, name, strerror(ferror(fp)));
             fprintf(stderr, "%s: %s\n", programName, message);
         }
 
@@ -7118,7 +7019,7 @@ SendSearchDepth(FILE *fp)
 {
     char message[MSG_SIZ];
 
-    if (localPlayer.appData.searchDepth <= 0) 
+    if (localPlayer.appData.searchDepth <= 0)
         return;
 
     sprintf(message, "depth\n%d\nhelp\n", localPlayer.appData.searchDepth);
@@ -7178,10 +7079,10 @@ void SendTimeRemaining(FILE *fp)
         opptime = blackTimeRemaining;
     }
 
-    if (comtime <= 0) 
+    if (comtime <= 0)
         comtime = 1000;
 
-    if (opptime <= 0) 
+    if (opptime <= 0)
         opptime = 1000;
 
     sprintf(message, "time %ld\n",  comtime / 10);
@@ -7206,7 +7107,7 @@ void DisplayMove(int moveNumber)
     }
     else
     {
-        sprintf(message, "%d. %s%s  %s", 
+        sprintf(message, "%d. %s%s  %s",
                 (moveNumber / 2 + 1),
                 (BlackOnMove(moveNumber) ? "" : "... "),
                 parseList[moveNumber],
@@ -7232,8 +7133,8 @@ void DisplayTitle(char *title)
 /* CHECKME: does this work?
  * This routine sends a SIGINT (^C interrupt) to gnushogi to awaken it
  * if it might be busy thinking on our time.  This normally isn't needed,
- * but is useful on systems where the FIONREAD ioctl doesn't work since 
- * on those systems the gnushogi feature that lets you interrupt its thinking 
+ * but is useful on systems where the FIONREAD ioctl doesn't work since
+ * on those systems the gnushogi feature that lets you interrupt its thinking
  * just by typing a command does not work.
  *
  * In the future, similar code could be used to stop gnushogi and make
@@ -7314,7 +7215,7 @@ CheckTimeControl(void)
     if (!localPlayer.appData.clockMode)
         return;
 
-    if (forwardMostMove == 0) 
+    if (forwardMostMove == 0)
         return;
 
     /*
@@ -7359,14 +7260,13 @@ int
 PartialTickLength(void)
 {
     struct timeval tv;
-    struct timezone tz;
     int ptl;
 
-    gettimeofday(&tv, &tz);
+    gettimeofday(&tv, NULL);
     ptl = ((tv.tv_sec - tickStartTV.tv_sec) * 1000000 +
            (tv.tv_usec - tickStartTV.tv_usec) + 500) / 1000;
 
-    if (ptl > tickLength) 
+    if (ptl > tickLength)
         ptl = tickLength;
 
     return ptl;
@@ -7385,16 +7285,12 @@ PartialTickLength(void)
  * We give the human user a slight advantage if he is playing black---the
  * clocks don't run until he makes his first move, so it takes zero time.
  * Also, DisplayClocks doesn't account for network lag so it could get out
- * of sync with GNU Shogi's clock -- but then, referees are always right.  
+ * of sync with GNU Shogi's clock -- but then, referees are always right.
  */
 
 void
 DisplayClocks(int clock_mode)
 {
-#ifdef HAVE_GETTIMEOFDAY
-    struct timezone tz;
-#endif /* HAVE_GETTIMEOFDAY */
-
     long timeRemaining;
 
     switch (clock_mode)
@@ -7421,12 +7317,12 @@ DisplayClocks(int clock_mode)
 
     case DecrementTimers:
         /* Decrement running clock to next 1-second boundary */
-        if (gameMode == PauseGame) 
+        if (gameMode == PauseGame)
             return;
 
         timerXID = 0;
 
-        if (!localPlayer.appData.clockMode) 
+        if (!localPlayer.appData.clockMode)
             return;
 
         if (BlackOnMove(forwardMostMove))
@@ -7444,7 +7340,7 @@ DisplayClocks(int clock_mode)
 #ifdef HAVE_GETTIMEOFDAY
         tickLength = (((timeRemaining <= 1000) && (timeRemaining > 0))
                       ? 100 : 1000);
-        gettimeofday(&tickStartTV, &tz);
+        gettimeofday(&tickStartTV, NULL);
 #endif /* HAVE_GETTIMEOFDAY */
 
         timerXID =
@@ -7477,28 +7373,28 @@ DisplayClocks(int clock_mode)
         CheckTimeControl();
         DisplayLabels();
 
-        if (!localPlayer.appData.clockMode) 
+        if (!localPlayer.appData.clockMode)
             return;
 
         if ((gameMode == PauseGame)
-            && ((pausePreviousMode == MachinePlaysBlack) 
+            && ((pausePreviousMode == MachinePlaysBlack)
                 || (pausePreviousMode == MachinePlaysWhite)))
         {
             return;
         }
 
-        timeRemaining = (BlackOnMove(forwardMostMove) 
+        timeRemaining = (BlackOnMove(forwardMostMove)
                          ? blackTimeRemaining : whiteTimeRemaining);
 
 #ifdef HAVE_GETTIMEOFDAY
         tickLength = (((timeRemaining <= 1000) && (timeRemaining > 0))
-                      ? (((timeRemaining - 1) % 100) + 1) 
+                      ? (((timeRemaining - 1) % 100) + 1)
                       : (((timeRemaining - 1) % 1000) + 1));
 
-        if (tickLength <= 0) 
+        if (tickLength <= 0)
             tickLength += 1000;
 
-        gettimeofday(&tickStartTV, &tz);
+        gettimeofday(&tickStartTV, NULL);
 
 #endif /* HAVE_GETTIMEOFDAY */
         timerXID =
@@ -7520,7 +7416,7 @@ DisplayClocks(int clock_mode)
         XtRemoveTimeOut(timerXID);
         timerXID = 0;
 
-        if (!localPlayer.appData.clockMode) 
+        if (!localPlayer.appData.clockMode)
             return;
 
 #ifdef HAVE_GETTIMEOFDAY
@@ -7540,24 +7436,24 @@ DisplayClocks(int clock_mode)
 
         DisplayLabels();
 
-        if (!localPlayer.appData.clockMode) 
+        if (!localPlayer.appData.clockMode)
             return;
 
-        timeRemaining = (BlackOnMove(forwardMostMove) 
+        timeRemaining = (BlackOnMove(forwardMostMove)
                          ? blackTimeRemaining : whiteTimeRemaining);
 
-        if (timeRemaining == 0) 
+        if (timeRemaining == 0)
             return;
 
 #ifdef HAVE_GETTIMEOFDAY
-        tickLength = (((timeRemaining <= 1000) && (timeRemaining > 0)) 
+        tickLength = (((timeRemaining <= 1000) && (timeRemaining > 0))
                       ? (((timeRemaining - 1) % 100) + 1)
                       : (((timeRemaining - 1) % 1000) + 1));
 
-        if (tickLength <= 0) 
+        if (tickLength <= 0)
             tickLength += 1000;
 
-        gettimeofday(&tickStartTV, &tz);
+        gettimeofday(&tickStartTV, NULL);
 #endif /* HAVE_GETTIMEOFDAY */
 
         timerXID =
@@ -7716,10 +7612,8 @@ Usage(void)
     fprintf(stderr, "\t-size or -boardSize (Large | Medium | Small)\n");
     fprintf(stderr, "\t-coords or -showCoords (True | False)\n");
     fprintf(stderr, "\t-mono or -monoMode (True | False)\n");
-    fprintf(stderr, "\t-bpc or -blackPieceColor color\n");
-    fprintf(stderr, "\t-wpc or -whitePieceColor color\n");
-    fprintf(stderr, "\t-lsc or -lightSquareColor color\n");
-    fprintf(stderr, "\t-dsc or -darkSquareColor color\n");
+    fprintf(stderr, "\t-pc or -pieceColor color\n");
+    fprintf(stderr, "\t-sc  or -squareColor color\n");
     fprintf(stderr, "\t-wps or -westernPieceSet (True | False)\n");
     fprintf(stderr, "\t-debug or -debugMode (True | False)\n");
     exit(2);
@@ -7731,7 +7625,7 @@ void
 CatchPipeSignal(int dummy)
 {
     char message[MSG_SIZ];
-    
+
     sprintf(message,
             "%s shogi program (%s) exited unexpectedly",
             ((lastMsgFP == toFirstProgFP) ? "first" : "second"),
diff --git a/xshogi/xshogi.h b/xshogi/xshogi.h
index 10b596d..f86637e 100644
--- a/xshogi/xshogi.h
+++ b/xshogi/xshogi.h
@@ -13,7 +13,7 @@
  * Modified implementation of ISS mode for XShogi:  Matthias Mutz
  * Current maintainer:                              Michael C. Vanier
  *
- * XShogi borrows its piece bitmaps from CRANES Shogi.
+ * XShogi borrows some of its piece bitmaps from CRANES Shogi.
  *
  * Copyright 1991 by Digital Equipment Corporation, Maynard, Massachusetts.
  * Enhancements Copyright 1992 Free Software Foundation, Inc.
@@ -69,7 +69,7 @@
 #define DROP_COLS       3
 
 #ifdef WESTERN_BITMAPS
-#define LARGE_SQUARE_SIZE    32
+#define LARGE_SQUARE_SIZE    64
 #define MEDIUM_SQUARE_SIZE   32
 #else
 #define LARGE_SQUARE_SIZE    64
@@ -111,59 +111,57 @@
 #define INIT_STRING         "beep\neasy\nrandom\n"
 #define BLACK_STRING        "black\ngo\n"
 #define WHITE_STRING        "white\ngo\n"
-#define DEFAULT_SIZE        "Small"
+#define DEFAULT_SIZE        "Large"
 #define LIGHT               1
 #define DARK                0
 #define CHAR_PIECE_COLOR    "Black"
 #define ZERO_COLOR          "#000000"
 #define ONE_COLOR           "#FFFFFF"
-#define BLACK_PIECE_COLOR   "#FFFFD7"
-#define WHITE_PIECE_COLOR   "#FFFFD7"
-#define LIGHT_SQUARE_COLOR  "#EBDFB0"
-#define DARK_SQUARE_COLOR   "#EBDFB0"
+#define PIECE_COLOR         "#FFFFD7"
+#define SQUARE_COLOR        "#EBDFB0"
 #define MAIN_FONT           "-*-helvetica-medium-o-normal--*-*-*-*-*-*-*-*"
 #define COORD_FONT          "-*-helvetica-bold-r-normal--*-*-*-*-*-*-*-*"
 #define DEFAULT_FONT   "*font: -*-helvetica-medium-r-normal--*-120-*-*-*-*-*-*"
-#define BLINK_COUNT          3   
+#define BLINK_COUNT          3
 #define BORDER_X_OFFSET      3
 #define BORDER_Y_OFFSET     27
 
 
 
-typedef enum 
+typedef enum
 {
     Large, Medium, Small
 } BoardSize;
 
-typedef enum 
+typedef enum
 {
     BeginningOfGame, MachinePlaysBlack, MachinePlaysWhite, TwoMachinesPlay,
     ForceMoves, PlayFromGameFile, PauseGame, EndOfGame,
     EditPosition
 } GameMode;
 
-typedef enum 
+typedef enum
 {
     MatchFalse, MatchInit, MatchPosition, MatchOpening
 } MatchMode;
 
-typedef enum 
+typedef enum
 {
-    BlackPawn,    BlackLance,   BlackKnight, BlackSilver, BlackGold, 
-    BlackBishop,  BlackRook,    BlackPPawn,  BlackPLance, BlackPKnight, 
+    BlackPawn,    BlackLance,   BlackKnight, BlackSilver, BlackGold,
+    BlackBishop,  BlackRook,    BlackPPawn,  BlackPLance, BlackPKnight,
     BlackPSilver, BlackPBishop, BlackPRook,  BlackKing,
-    WhitePawn,    WhiteLance,   WhiteKnight, WhiteSilver, WhiteGold, 
-    WhiteBishop,  WhiteRook,    WhitePPawn,  WhitePLance, WhitePKnight, 
+    WhitePawn,    WhiteLance,   WhiteKnight, WhiteSilver, WhiteGold,
+    WhiteBishop,  WhiteRook,    WhitePPawn,  WhitePLance, WhitePKnight,
     WhitePSilver, WhitePBishop, WhitePRook,  WhiteKing,
     EmptySquare,
     ClearBoard,   BlackPlay,    WhitePlay /* for use on EditPosition menus */
 } ShogiSquare;
 
 typedef ShogiSquare Board[BOARD_SIZE][BOARD_SIZE];
-                   
+
 typedef int Catched[2][8];
 
-typedef enum 
+typedef enum
 {
     BlackPromotion = 1, WhitePromotion, BlackDrop, WhiteDrop,
         NormalMove,
@@ -171,12 +169,20 @@ typedef enum
     AmbiguousMove
 } ShogiMove;
 
-typedef enum 
+typedef enum
 {
-    ResetTimers, DecrementTimers, SwitchTimers, 
+    ResetTimers, DecrementTimers, SwitchTimers,
     ReDisplayTimers, StopTimers, StartTimers
 } ClockMode;
 
+
+/*
+ * This is a hack that allows the parser to tell the program
+ * that the game it's loading has finished.
+ */
+
+extern int loaded_game_finished;
+
 #endif /* _XSHOGI_H_ */
 
 
diff --git a/xshogi/xshogifn.h b/xshogi/xshogifn.h
index 0cfb415..627cdf2 100644
--- a/xshogi/xshogifn.h
+++ b/xshogi/xshogifn.h
@@ -13,7 +13,7 @@
  * Modified implementation of ISS mode for XShogi:  Matthias Mutz
  * Current maintainer:                              Michael C. Vanier
  *
- * XShogi borrows its piece bitmaps from CRANES Shogi.
+ * XShogi borrows some of its piece bitmaps from CRANES Shogi.
  *
  * Copyright 1991 by Digital Equipment Corporation, Maynard, Massachusetts.
  * Enhancements Copyright 1992 Free Software Foundation, Inc.
@@ -72,19 +72,19 @@ void CreatePieceMenus(void);
 char *FindFont(char *pattern, int targetPxlSize);
 void PieceMenuPopup(Widget w, XEvent *event, String *params,
                     Cardinal *num_params);
-static void PieceMenuSelect(Widget w, ShogiSquare piece, caddr_t junk);
+static void PieceMenuSelect(Widget w, ShogiSquare piece, char *junk);
 static void SetBlackToPlay(void);
 static void SetWhiteToPlay(void);
 void ReadBitmap(String name, Pixmap *pm, Pixmap *qm,
-                char small_bits[], char medium_bits[],
-                char large_bits[]);
+                unsigned char small_bits[], unsigned char medium_bits[],
+                unsigned char large_bits[]);
 void CreateGrid(void);
 int  EventToSquare(int x);
 int  EventToXSquare(int x);
 ShogiSquare CharToPiece(int c, int p);
 void DrawSquare(int row, int column, ShogiSquare piece);
 void BlinkSquare(int row, int column, ShogiSquare piece);
-void EventProc(Widget widget, caddr_t unused, XEvent *event);
+void EventProc(Widget widget, XtPointer client_data, XEvent *event);
 void DrawPosition(Widget w, XEvent *event, String *prms, Cardinal *nprms);
 void InitPosition(int redraw);
 void CopyBoard(Board to, Board from);
-- 
1.7.0.4